diff --git a/dist/400.html b/dist/400.html new file mode 100644 index 000000000..b3bff88ab --- /dev/null +++ b/dist/400.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 400 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
400
+ +

Oops.. You just found an error page..

+

We are sorry but your request contains bad syntax and cannot be fulfilled…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/401.html b/dist/401.html new file mode 100644 index 000000000..6105971ad --- /dev/null +++ b/dist/401.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 401 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
401
+ +

Oops.. You just found an error page..

+

We are sorry but you are not authorized to access this page…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/403.html b/dist/403.html new file mode 100644 index 000000000..db6226766 --- /dev/null +++ b/dist/403.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 403 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
403
+ +

Oops.. You just found an error page..

+

We are sorry but you do not have permission to access this page…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/404.html b/dist/404.html new file mode 100644 index 000000000..85601a8a9 --- /dev/null +++ b/dist/404.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 404 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
404
+ +

Oops.. You just found an error page..

+

We are sorry but our service is currently not available…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/500.html b/dist/500.html new file mode 100644 index 000000000..53d3cac37 --- /dev/null +++ b/dist/500.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 500 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
500
+ +

Oops.. You just found an error page..

+

We are sorry but your request contains bad syntax and cannot be fulfilled…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/503.html b/dist/503.html new file mode 100644 index 000000000..b29260a2f --- /dev/null +++ b/dist/503.html @@ -0,0 +1,73 @@ + + + + + + + + + + + + + + + + + + +Page 503 - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+ +
503
+ +

Oops.. You just found an error page..

+

We are sorry but our service is currently not available…

+ + + Go back + +
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/assets/brand/tabler.sketch b/dist/assets/brand/tabler.sketch new file mode 100644 index 000000000..474ff169f Binary files /dev/null and b/dist/assets/brand/tabler.sketch differ diff --git a/dist/assets/brand/tabler.svg b/dist/assets/brand/tabler.svg new file mode 100644 index 000000000..dd702d8aa --- /dev/null +++ b/dist/assets/brand/tabler.svg @@ -0,0 +1,19 @@ + + + + tabler + Created with Sketch. + + + + + + + \ No newline at end of file diff --git a/dist/assets/brand/tabler@1x.png b/dist/assets/brand/tabler@1x.png new file mode 100644 index 000000000..957180e9f Binary files /dev/null and b/dist/assets/brand/tabler@1x.png differ diff --git a/dist/assets/brand/tabler@2x.png b/dist/assets/brand/tabler@2x.png new file mode 100644 index 000000000..365be97da Binary files /dev/null and b/dist/assets/brand/tabler@2x.png differ diff --git a/dist/assets/css/dashboard.css b/dist/assets/css/dashboard.css new file mode 100644 index 000000000..3487a0ba9 --- /dev/null +++ b/dist/assets/css/dashboard.css @@ -0,0 +1,17244 @@ +@charset "UTF-8"; +/** +Dashboard UI + */ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors + * Copyright 2011-2018 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +:root { + --blue: #467fcf; + --indigo: #6574cd; + --purple: #a55eea; + --pink: #f66d9b; + --red: #cd201f; + --orange: #fd9644; + --yellow: #f1c40f; + --green: #5eba00; + --teal: #2bcbba; + --cyan: #17a2b8; + --white: #fff; + --gray: #868e96; + --gray-dark: #343a40; + --azure: #45aaf2; + --lime: #7bd235; + --primary: #467fcf; + --secondary: #868e96; + --success: #5eba00; + --info: #45aaf2; + --warning: #f1c40f; + --danger: #cd201f; + --light: #f8f9fa; + --dark: #343a40; + --breakpoint-xs: 0; + --breakpoint-sm: 576px; + --breakpoint-md: 768px; + --breakpoint-lg: 992px; + --breakpoint-xl: 1280px; + --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol"; + --font-family-monospace: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +*, +*::before, +*::after { + box-sizing: border-box; +} + +html { + font-family: sans-serif; + line-height: 1.15; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; + -ms-overflow-style: scrollbar; + -webkit-tap-highlight-color: transparent; +} + +@-ms-viewport { + width: device-width; +} + +article, aside, dialog, figcaption, figure, footer, header, hgroup, main, nav, section { + display: block; +} + +body { + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.5; + color: #495057; + text-align: left; + background-color: #f5f7fb; +} + +[tabindex="-1"]:focus { + outline: 0 !important; +} + +hr { + box-sizing: content-box; + height: 0; + overflow: visible; +} + +h1, h2, h3, h4, h5, h6 { + margin-top: 0; + margin-bottom: 0.66em; +} + +p { + margin-top: 0; + margin-bottom: 1rem; +} + +abbr[title], +abbr[data-original-title] { + text-decoration: underline; + -webkit-text-decoration: underline dotted; + text-decoration: underline dotted; + cursor: help; + border-bottom: 0; +} + +address { + margin-bottom: 1rem; + font-style: normal; + line-height: inherit; +} + +ol, +ul, +dl { + margin-top: 0; + margin-bottom: 1rem; +} + +ol ol, +ul ul, +ol ul, +ul ol { + margin-bottom: 0; +} + +dt { + font-weight: 700; +} + +dd { + margin-bottom: .5rem; + margin-left: 0; +} + +blockquote { + margin: 0 0 1rem; +} + +dfn { + font-style: italic; +} + +b, +strong { + font-weight: bolder; +} + +small { + font-size: 80%; +} + +sub, +sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sub { + bottom: -.25em; +} + +sup { + top: -.5em; +} + +a { + color: #467fcf; + text-decoration: none; + background-color: transparent; + -webkit-text-decoration-skip: objects; +} + +a:hover { + color: #295a9f; + text-decoration: underline; +} + +a:not([href]):not([tabindex]) { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):hover, a:not([href]):not([tabindex]):focus { + color: inherit; + text-decoration: none; +} + +a:not([href]):not([tabindex]):focus { + outline: 0; +} + +pre, +code, +kbd, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +pre { + margin-top: 0; + margin-bottom: 1rem; + overflow: auto; + -ms-overflow-style: scrollbar; +} + +figure { + margin: 0 0 1rem; +} + +img { + vertical-align: middle; + border-style: none; +} + +svg:not(:root) { + overflow: hidden; +} + +table { + border-collapse: collapse; +} + +caption { + padding-top: 0.75rem; + padding-bottom: 0.75rem; + color: #9aa0ac; + text-align: left; + caption-side: bottom; +} + +th { + text-align: inherit; +} + +label { + display: inline-block; + margin-bottom: .5rem; +} + +button { + border-radius: 0; +} + +button:focus { + outline: 1px dotted; + outline: 5px auto -webkit-focus-ring-color; +} + +input, +button, +select, +optgroup, +textarea { + margin: 0; + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +button, +input { + overflow: visible; +} + +button, +select { + text-transform: none; +} + +button, +html [type="button"], +[type="reset"], +[type="submit"] { + -webkit-appearance: button; +} + +button::-moz-focus-inner, +[type="button"]::-moz-focus-inner, +[type="reset"]::-moz-focus-inner, +[type="submit"]::-moz-focus-inner { + padding: 0; + border-style: none; +} + +input[type="radio"], +input[type="checkbox"] { + box-sizing: border-box; + padding: 0; +} + +input[type="date"], +input[type="time"], +input[type="datetime-local"], +input[type="month"] { + -webkit-appearance: listbox; +} + +textarea { + overflow: auto; + resize: vertical; +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + max-width: 100%; + padding: 0; + margin-bottom: .5rem; + font-size: 1.5rem; + line-height: inherit; + color: inherit; + white-space: normal; +} + +progress { + vertical-align: baseline; +} + +[type="number"]::-webkit-inner-spin-button, +[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +[type="search"] { + outline-offset: -2px; + -webkit-appearance: none; +} + +[type="search"]::-webkit-search-cancel-button, +[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +::-webkit-file-upload-button { + font: inherit; + -webkit-appearance: button; +} + +output { + display: inline-block; +} + +summary { + display: list-item; + cursor: pointer; +} + +template { + display: none; +} + +[hidden] { + display: none !important; +} + +h1, h2, h3, h4, h5, h6, +.h1, .h2, .h3, .h4, .h5, .h6 { + margin-bottom: 0.66em; + font-family: inherit; + font-weight: 600; + line-height: 1.1; + color: inherit; +} + +h1, .h1 { + font-size: 2rem; +} + +h2, .h2 { + font-size: 1.75rem; +} + +h3, .h3 { + font-size: 1.5rem; +} + +h4, .h4 { + font-size: 1.125rem; +} + +h5, .h5 { + font-size: 1rem; +} + +h6, .h6 { + font-size: 0.875rem; +} + +.lead { + font-size: 1.171875rem; + font-weight: 300; +} + +.display-1 { + font-size: 4.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-2 { + font-size: 4rem; + font-weight: 300; + line-height: 1.1; +} + +.display-3 { + font-size: 3.5rem; + font-weight: 300; + line-height: 1.1; +} + +.display-4 { + font-size: 3rem; + font-weight: 300; + line-height: 1.1; +} + +hr { + margin-top: 1rem; + margin-bottom: 1rem; + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +small, +.small { + font-size: 87.5%; + font-weight: 400; +} + +mark, +.mark { + padding: 0.2em; + background-color: #fcf8e3; +} + +.list-unstyled { + padding-left: 0; + list-style: none; +} + +.list-inline { + padding-left: 0; + list-style: none; +} + +.list-inline-item { + display: inline-block; +} + +.list-inline-item:not(:last-child) { + margin-right: 0.5rem; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +.blockquote { + margin-bottom: 1rem; + font-size: 1.171875rem; +} + +.blockquote-footer { + display: block; + font-size: 80%; + color: #868e96; +} + +.blockquote-footer::before { + content: "\2014 \00A0"; +} + +.img-fluid { + max-width: 100%; + height: auto; +} + +.img-thumbnail { + padding: 0.25rem; + background-color: #f5f7fb; + border: 1px solid #dee2e6; + border-radius: 3px; + max-width: 100%; + height: auto; +} + +.figure { + display: inline-block; +} + +.figure-img { + margin-bottom: 0.5rem; + line-height: 1; +} + +.figure-caption { + font-size: 90%; + color: #868e96; +} + +code, +kbd, +pre, +samp { + font-family: Monaco, Consolas, "Liberation Mono", "Courier New", monospace; +} + +code { + font-size: 85%; + color: #868e96; + word-break: break-word; +} + +a > code { + color: inherit; +} + +kbd { + padding: 0.2rem 0.4rem; + font-size: 85%; + color: #fff; + background-color: #343a40; + border-radius: 3px; +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; +} + +pre { + display: block; + font-size: 85%; + color: #212529; +} + +pre code { + font-size: inherit; + color: inherit; + word-break: normal; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +@media (min-width: 576px) { + .container { + max-width: 540px; + } +} + +@media (min-width: 768px) { + .container { + max-width: 720px; + } +} + +@media (min-width: 992px) { + .container { + max-width: 960px; + } +} + +@media (min-width: 1280px) { + .container { + max-width: 1200px; + } +} + +.container-fluid { + width: 100%; + padding-right: 0.75rem; + padding-left: 0.75rem; + margin-right: auto; + margin-left: auto; +} + +.row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.no-gutters { + margin-right: 0; + margin-left: 0; +} + +.no-gutters > .col, +.no-gutters > [class*="col-"] { + padding-right: 0; + padding-left: 0; +} + +.col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, +.col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, +.col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, +.col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, +.col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, +.col-xl-auto { + position: relative; + width: 100%; + min-height: 1px; + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.col { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; +} + +.col-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; +} + +.col-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; +} + +.col-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; +} + +.col-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; +} + +.col-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; +} + +.col-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; +} + +.col-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; +} + +.col-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; +} + +.col-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; +} + +.col-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; +} + +.col-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; +} + +.col-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; +} + +.col-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; +} + +.order-first { + -ms-flex-order: -1; + order: -1; +} + +.order-last { + -ms-flex-order: 13; + order: 13; +} + +.order-0 { + -ms-flex-order: 0; + order: 0; +} + +.order-1 { + -ms-flex-order: 1; + order: 1; +} + +.order-2 { + -ms-flex-order: 2; + order: 2; +} + +.order-3 { + -ms-flex-order: 3; + order: 3; +} + +.order-4 { + -ms-flex-order: 4; + order: 4; +} + +.order-5 { + -ms-flex-order: 5; + order: 5; +} + +.order-6 { + -ms-flex-order: 6; + order: 6; +} + +.order-7 { + -ms-flex-order: 7; + order: 7; +} + +.order-8 { + -ms-flex-order: 8; + order: 8; +} + +.order-9 { + -ms-flex-order: 9; + order: 9; +} + +.order-10 { + -ms-flex-order: 10; + order: 10; +} + +.order-11 { + -ms-flex-order: 11; + order: 11; +} + +.order-12 { + -ms-flex-order: 12; + order: 12; +} + +.offset-1 { + margin-left: 8.33333333%; +} + +.offset-2 { + margin-left: 16.66666667%; +} + +.offset-3 { + margin-left: 25%; +} + +.offset-4 { + margin-left: 33.33333333%; +} + +.offset-5 { + margin-left: 41.66666667%; +} + +.offset-6 { + margin-left: 50%; +} + +.offset-7 { + margin-left: 58.33333333%; +} + +.offset-8 { + margin-left: 66.66666667%; +} + +.offset-9 { + margin-left: 75%; +} + +.offset-10 { + margin-left: 83.33333333%; +} + +.offset-11 { + margin-left: 91.66666667%; +} + +@media (min-width: 576px) { + .col-sm { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-sm-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-sm-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-sm-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-sm-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-sm-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-sm-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-sm-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-sm-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-sm-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-sm-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-sm-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-sm-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-sm-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-sm-first { + -ms-flex-order: -1; + order: -1; + } + .order-sm-last { + -ms-flex-order: 13; + order: 13; + } + .order-sm-0 { + -ms-flex-order: 0; + order: 0; + } + .order-sm-1 { + -ms-flex-order: 1; + order: 1; + } + .order-sm-2 { + -ms-flex-order: 2; + order: 2; + } + .order-sm-3 { + -ms-flex-order: 3; + order: 3; + } + .order-sm-4 { + -ms-flex-order: 4; + order: 4; + } + .order-sm-5 { + -ms-flex-order: 5; + order: 5; + } + .order-sm-6 { + -ms-flex-order: 6; + order: 6; + } + .order-sm-7 { + -ms-flex-order: 7; + order: 7; + } + .order-sm-8 { + -ms-flex-order: 8; + order: 8; + } + .order-sm-9 { + -ms-flex-order: 9; + order: 9; + } + .order-sm-10 { + -ms-flex-order: 10; + order: 10; + } + .order-sm-11 { + -ms-flex-order: 11; + order: 11; + } + .order-sm-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-sm-0 { + margin-left: 0; + } + .offset-sm-1 { + margin-left: 8.33333333%; + } + .offset-sm-2 { + margin-left: 16.66666667%; + } + .offset-sm-3 { + margin-left: 25%; + } + .offset-sm-4 { + margin-left: 33.33333333%; + } + .offset-sm-5 { + margin-left: 41.66666667%; + } + .offset-sm-6 { + margin-left: 50%; + } + .offset-sm-7 { + margin-left: 58.33333333%; + } + .offset-sm-8 { + margin-left: 66.66666667%; + } + .offset-sm-9 { + margin-left: 75%; + } + .offset-sm-10 { + margin-left: 83.33333333%; + } + .offset-sm-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 768px) { + .col-md { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-md-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-md-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-md-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-md-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-md-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-md-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-md-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-md-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-md-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-md-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-md-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-md-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-md-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-md-first { + -ms-flex-order: -1; + order: -1; + } + .order-md-last { + -ms-flex-order: 13; + order: 13; + } + .order-md-0 { + -ms-flex-order: 0; + order: 0; + } + .order-md-1 { + -ms-flex-order: 1; + order: 1; + } + .order-md-2 { + -ms-flex-order: 2; + order: 2; + } + .order-md-3 { + -ms-flex-order: 3; + order: 3; + } + .order-md-4 { + -ms-flex-order: 4; + order: 4; + } + .order-md-5 { + -ms-flex-order: 5; + order: 5; + } + .order-md-6 { + -ms-flex-order: 6; + order: 6; + } + .order-md-7 { + -ms-flex-order: 7; + order: 7; + } + .order-md-8 { + -ms-flex-order: 8; + order: 8; + } + .order-md-9 { + -ms-flex-order: 9; + order: 9; + } + .order-md-10 { + -ms-flex-order: 10; + order: 10; + } + .order-md-11 { + -ms-flex-order: 11; + order: 11; + } + .order-md-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-md-0 { + margin-left: 0; + } + .offset-md-1 { + margin-left: 8.33333333%; + } + .offset-md-2 { + margin-left: 16.66666667%; + } + .offset-md-3 { + margin-left: 25%; + } + .offset-md-4 { + margin-left: 33.33333333%; + } + .offset-md-5 { + margin-left: 41.66666667%; + } + .offset-md-6 { + margin-left: 50%; + } + .offset-md-7 { + margin-left: 58.33333333%; + } + .offset-md-8 { + margin-left: 66.66666667%; + } + .offset-md-9 { + margin-left: 75%; + } + .offset-md-10 { + margin-left: 83.33333333%; + } + .offset-md-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 992px) { + .col-lg { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-lg-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-lg-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-lg-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-lg-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-lg-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-lg-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-lg-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-lg-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-lg-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-lg-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-lg-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-lg-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-lg-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-lg-first { + -ms-flex-order: -1; + order: -1; + } + .order-lg-last { + -ms-flex-order: 13; + order: 13; + } + .order-lg-0 { + -ms-flex-order: 0; + order: 0; + } + .order-lg-1 { + -ms-flex-order: 1; + order: 1; + } + .order-lg-2 { + -ms-flex-order: 2; + order: 2; + } + .order-lg-3 { + -ms-flex-order: 3; + order: 3; + } + .order-lg-4 { + -ms-flex-order: 4; + order: 4; + } + .order-lg-5 { + -ms-flex-order: 5; + order: 5; + } + .order-lg-6 { + -ms-flex-order: 6; + order: 6; + } + .order-lg-7 { + -ms-flex-order: 7; + order: 7; + } + .order-lg-8 { + -ms-flex-order: 8; + order: 8; + } + .order-lg-9 { + -ms-flex-order: 9; + order: 9; + } + .order-lg-10 { + -ms-flex-order: 10; + order: 10; + } + .order-lg-11 { + -ms-flex-order: 11; + order: 11; + } + .order-lg-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-lg-0 { + margin-left: 0; + } + .offset-lg-1 { + margin-left: 8.33333333%; + } + .offset-lg-2 { + margin-left: 16.66666667%; + } + .offset-lg-3 { + margin-left: 25%; + } + .offset-lg-4 { + margin-left: 33.33333333%; + } + .offset-lg-5 { + margin-left: 41.66666667%; + } + .offset-lg-6 { + margin-left: 50%; + } + .offset-lg-7 { + margin-left: 58.33333333%; + } + .offset-lg-8 { + margin-left: 66.66666667%; + } + .offset-lg-9 { + margin-left: 75%; + } + .offset-lg-10 { + margin-left: 83.33333333%; + } + .offset-lg-11 { + margin-left: 91.66666667%; + } +} + +@media (min-width: 1280px) { + .col-xl { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + max-width: 100%; + } + .col-xl-auto { + -ms-flex: 0 0 auto; + flex: 0 0 auto; + width: auto; + max-width: none; + } + .col-xl-1 { + -ms-flex: 0 0 8.33333333%; + flex: 0 0 8.33333333%; + max-width: 8.33333333%; + } + .col-xl-2 { + -ms-flex: 0 0 16.66666667%; + flex: 0 0 16.66666667%; + max-width: 16.66666667%; + } + .col-xl-3 { + -ms-flex: 0 0 25%; + flex: 0 0 25%; + max-width: 25%; + } + .col-xl-4 { + -ms-flex: 0 0 33.33333333%; + flex: 0 0 33.33333333%; + max-width: 33.33333333%; + } + .col-xl-5 { + -ms-flex: 0 0 41.66666667%; + flex: 0 0 41.66666667%; + max-width: 41.66666667%; + } + .col-xl-6 { + -ms-flex: 0 0 50%; + flex: 0 0 50%; + max-width: 50%; + } + .col-xl-7 { + -ms-flex: 0 0 58.33333333%; + flex: 0 0 58.33333333%; + max-width: 58.33333333%; + } + .col-xl-8 { + -ms-flex: 0 0 66.66666667%; + flex: 0 0 66.66666667%; + max-width: 66.66666667%; + } + .col-xl-9 { + -ms-flex: 0 0 75%; + flex: 0 0 75%; + max-width: 75%; + } + .col-xl-10 { + -ms-flex: 0 0 83.33333333%; + flex: 0 0 83.33333333%; + max-width: 83.33333333%; + } + .col-xl-11 { + -ms-flex: 0 0 91.66666667%; + flex: 0 0 91.66666667%; + max-width: 91.66666667%; + } + .col-xl-12 { + -ms-flex: 0 0 100%; + flex: 0 0 100%; + max-width: 100%; + } + .order-xl-first { + -ms-flex-order: -1; + order: -1; + } + .order-xl-last { + -ms-flex-order: 13; + order: 13; + } + .order-xl-0 { + -ms-flex-order: 0; + order: 0; + } + .order-xl-1 { + -ms-flex-order: 1; + order: 1; + } + .order-xl-2 { + -ms-flex-order: 2; + order: 2; + } + .order-xl-3 { + -ms-flex-order: 3; + order: 3; + } + .order-xl-4 { + -ms-flex-order: 4; + order: 4; + } + .order-xl-5 { + -ms-flex-order: 5; + order: 5; + } + .order-xl-6 { + -ms-flex-order: 6; + order: 6; + } + .order-xl-7 { + -ms-flex-order: 7; + order: 7; + } + .order-xl-8 { + -ms-flex-order: 8; + order: 8; + } + .order-xl-9 { + -ms-flex-order: 9; + order: 9; + } + .order-xl-10 { + -ms-flex-order: 10; + order: 10; + } + .order-xl-11 { + -ms-flex-order: 11; + order: 11; + } + .order-xl-12 { + -ms-flex-order: 12; + order: 12; + } + .offset-xl-0 { + margin-left: 0; + } + .offset-xl-1 { + margin-left: 8.33333333%; + } + .offset-xl-2 { + margin-left: 16.66666667%; + } + .offset-xl-3 { + margin-left: 25%; + } + .offset-xl-4 { + margin-left: 33.33333333%; + } + .offset-xl-5 { + margin-left: 41.66666667%; + } + .offset-xl-6 { + margin-left: 50%; + } + .offset-xl-7 { + margin-left: 58.33333333%; + } + .offset-xl-8 { + margin-left: 66.66666667%; + } + .offset-xl-9 { + margin-left: 75%; + } + .offset-xl-10 { + margin-left: 83.33333333%; + } + .offset-xl-11 { + margin-left: 91.66666667%; + } +} + +.table, .text-wrap table { + width: 100%; + max-width: 100%; + margin-bottom: 1rem; + background-color: transparent; +} + +.table th, .text-wrap table th, +.table td, .text-wrap table td { + padding: 0.75rem; + vertical-align: top; + border-top: 1px solid #dee2e6; +} + +.table thead th, .text-wrap table thead th { + vertical-align: bottom; + border-bottom: 2px solid #dee2e6; +} + +.table tbody + tbody, .text-wrap table tbody + tbody { + border-top: 2px solid #dee2e6; +} + +.table .table, .text-wrap table .table, .table .text-wrap table, .text-wrap .table table, .text-wrap table table { + background-color: #f5f7fb; +} + +.table-sm th, +.table-sm td { + padding: 0.3rem; +} + +.table-bordered, .text-wrap table { + border: 1px solid #dee2e6; +} + +.table-bordered th, .text-wrap table th, +.table-bordered td, .text-wrap table td { + border: 1px solid #dee2e6; +} + +.table-bordered thead th, .text-wrap table thead th, +.table-bordered thead td, .text-wrap table thead td { + border-bottom-width: 2px; +} + +.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-hover tbody tr:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-primary, +.table-primary > th, +.table-primary > td { + background-color: #cbdbf2; +} + +.table-hover .table-primary:hover { + background-color: #b7cded; +} + +.table-hover .table-primary:hover > td, +.table-hover .table-primary:hover > th { + background-color: #b7cded; +} + +.table-secondary, +.table-secondary > th, +.table-secondary > td { + background-color: #dddfe2; +} + +.table-hover .table-secondary:hover { + background-color: #cfd2d6; +} + +.table-hover .table-secondary:hover > td, +.table-hover .table-secondary:hover > th { + background-color: #cfd2d6; +} + +.table-success, +.table-success > th, +.table-success > td { + background-color: #d2ecb8; +} + +.table-hover .table-success:hover { + background-color: #c5e7a4; +} + +.table-hover .table-success:hover > td, +.table-hover .table-success:hover > th { + background-color: #c5e7a4; +} + +.table-info, +.table-info > th, +.table-info > td { + background-color: #cbe7fb; +} + +.table-hover .table-info:hover { + background-color: #b3dcf9; +} + +.table-hover .table-info:hover > td, +.table-hover .table-info:hover > th { + background-color: #b3dcf9; +} + +.table-warning, +.table-warning > th, +.table-warning > td { + background-color: #fbeebc; +} + +.table-hover .table-warning:hover { + background-color: #fae8a4; +} + +.table-hover .table-warning:hover > td, +.table-hover .table-warning:hover > th { + background-color: #fae8a4; +} + +.table-danger, +.table-danger > th, +.table-danger > td { + background-color: #f1c1c0; +} + +.table-hover .table-danger:hover { + background-color: #ecacab; +} + +.table-hover .table-danger:hover > td, +.table-hover .table-danger:hover > th { + background-color: #ecacab; +} + +.table-light, +.table-light > th, +.table-light > td { + background-color: #fdfdfe; +} + +.table-hover .table-light:hover { + background-color: #ececf6; +} + +.table-hover .table-light:hover > td, +.table-hover .table-light:hover > th { + background-color: #ececf6; +} + +.table-dark, +.table-dark > th, +.table-dark > td { + background-color: #c6c8ca; +} + +.table-hover .table-dark:hover { + background-color: #b9bbbe; +} + +.table-hover .table-dark:hover > td, +.table-hover .table-dark:hover > th { + background-color: #b9bbbe; +} + +.table-active, +.table-active > th, +.table-active > td { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover { + background-color: rgba(0, 0, 0, 0.04); +} + +.table-hover .table-active:hover > td, +.table-hover .table-active:hover > th { + background-color: rgba(0, 0, 0, 0.04); +} + +.table .thead-dark th, .text-wrap table .thead-dark th { + color: #f5f7fb; + background-color: #212529; + border-color: #32383e; +} + +.table .thead-light th, .text-wrap table .thead-light th { + color: #495057; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.table-dark { + color: #f5f7fb; + background-color: #212529; +} + +.table-dark th, +.table-dark td, +.table-dark thead th { + border-color: #32383e; +} + +.table-dark.table-bordered, .text-wrap table.table-dark { + border: 0; +} + +.table-dark.table-striped tbody tr:nth-of-type(odd) { + background-color: rgba(255, 255, 255, 0.05); +} + +.table-dark.table-hover tbody tr:hover { + background-color: rgba(255, 255, 255, 0.075); +} + +@media (max-width: 575.98px) { + .table-responsive-sm { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-sm > .table-bordered, .text-wrap .table-responsive-sm > table { + border: 0; + } +} + +@media (max-width: 767.98px) { + .table-responsive-md { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-md > .table-bordered, .text-wrap .table-responsive-md > table { + border: 0; + } +} + +@media (max-width: 991.98px) { + .table-responsive-lg { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-lg > .table-bordered, .text-wrap .table-responsive-lg > table { + border: 0; + } +} + +@media (max-width: 1279.98px) { + .table-responsive-xl { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; + } + .table-responsive-xl > .table-bordered, .text-wrap .table-responsive-xl > table { + border: 0; + } +} + +.table-responsive { + display: block; + width: 100%; + overflow-x: auto; + -webkit-overflow-scrolling: touch; + -ms-overflow-style: -ms-autohiding-scrollbar; +} + +.table-responsive > .table-bordered, .text-wrap .table-responsive > table { + border: 0; +} + +.form-control { + display: block; + width: 100%; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.6; + color: #495057; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +.form-control::-ms-expand { + background-color: transparent; + border: 0; +} + +.form-control:focus { + color: #495057; + background-color: #fff; + border-color: #1991eb; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.form-control::-webkit-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-moz-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::-ms-input-placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control::placeholder { + color: #adb5bd; + opacity: 1; +} + +.form-control:disabled, .form-control[readonly] { + background-color: #f8f9fa; + opacity: 1; +} + +select.form-control:not([size]):not([multiple]) { + height: 2.375rem; +} + +select.form-control:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.form-control-file, +.form-control-range { + display: block; + width: 100%; +} + +.col-form-label { + padding-top: calc(0.375rem + 1px); + padding-bottom: calc(0.375rem + 1px); + margin-bottom: 0; + font-size: inherit; + line-height: 1.6; +} + +.col-form-label-lg { + padding-top: calc(0.5rem + 1px); + padding-bottom: calc(0.5rem + 1px); + font-size: 1.125rem; + line-height: 1.44444444; +} + +.col-form-label-sm { + padding-top: calc(0.25rem + 1px); + padding-bottom: calc(0.25rem + 1px); + font-size: 0.875rem; + line-height: 1.14285714; +} + +.form-control-plaintext { + display: block; + width: 100%; + padding-top: 0.375rem; + padding-bottom: 0.375rem; + margin-bottom: 0; + line-height: 1.6; + background-color: transparent; + border: solid transparent; + border-width: 1px 0; +} + +.form-control-plaintext.form-control-sm, .input-group-sm > .form-control-plaintext.form-control, +.input-group-sm > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-sm > .input-group-prepend > .form-control-plaintext.btn, +.input-group-sm > .input-group-append > .form-control-plaintext.btn, .form-control-plaintext.form-control-lg, .input-group-lg > .form-control-plaintext.form-control, +.input-group-lg > .input-group-prepend > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-append > .form-control-plaintext.input-group-text, +.input-group-lg > .input-group-prepend > .form-control-plaintext.btn, +.input-group-lg > .input-group-append > .form-control-plaintext.btn { + padding-right: 0; + padding-left: 0; +} + +.form-control-sm, .input-group-sm > .form-control, +.input-group-sm > .input-group-prepend > .input-group-text, +.input-group-sm > .input-group-append > .input-group-text, +.input-group-sm > .input-group-prepend > .btn, +.input-group-sm > .input-group-append > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.14285714; + border-radius: 3px; +} + +select.form-control-sm:not([size]):not([multiple]), .input-group-sm > select.form-control:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-sm > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-sm > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(1.8125rem + 2px); +} + +.form-control-lg, .input-group-lg > .form-control, +.input-group-lg > .input-group-prepend > .input-group-text, +.input-group-lg > .input-group-append > .input-group-text, +.input-group-lg > .input-group-prepend > .btn, +.input-group-lg > .input-group-append > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.44444444; + border-radius: 3px; +} + +select.form-control-lg:not([size]):not([multiple]), .input-group-lg > select.form-control:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.input-group-text:not([size]):not([multiple]), +.input-group-lg > .input-group-prepend > select.btn:not([size]):not([multiple]), +.input-group-lg > .input-group-append > select.btn:not([size]):not([multiple]) { + height: calc(2.6875rem + 2px); +} + +.form-group { + margin-bottom: 1rem; +} + +.form-text { + display: block; + margin-top: 0.25rem; +} + +.form-row { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + margin-right: -5px; + margin-left: -5px; +} + +.form-row > .col, +.form-row > [class*="col-"] { + padding-right: 5px; + padding-left: 5px; +} + +.form-check { + position: relative; + display: block; + padding-left: 1.25rem; +} + +.form-check-input { + position: absolute; + margin-top: 0.3rem; + margin-left: -1.25rem; +} + +.form-check-input:disabled ~ .form-check-label { + color: #9aa0ac; +} + +.form-check-label { + margin-bottom: 0; +} + +.form-check-inline { + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + padding-left: 0; + margin-right: 0.75rem; +} + +.form-check-inline .form-check-input { + position: static; + margin-top: 0; + margin-right: 0.3125rem; + margin-left: 0; +} + +.valid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #5eba00; +} + +.valid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(94, 186, 0, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:valid, .form-control.is-valid, .was-validated +.custom-select:valid, +.custom-select.is-valid { + border-color: #5eba00; +} + +.was-validated .form-control:valid:focus, .form-control.is-valid:focus, .was-validated +.custom-select:valid:focus, +.custom-select.is-valid:focus { + border-color: #5eba00; + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .form-control:valid ~ .valid-feedback, +.was-validated .form-control:valid ~ .valid-tooltip, .form-control.is-valid ~ .valid-feedback, +.form-control.is-valid ~ .valid-tooltip, .was-validated +.custom-select:valid ~ .valid-feedback, +.was-validated +.custom-select:valid ~ .valid-tooltip, +.custom-select.is-valid ~ .valid-feedback, +.custom-select.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { + color: #5eba00; +} + +.was-validated .form-check-input:valid ~ .valid-feedback, +.was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, +.form-check-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { + color: #5eba00; +} + +.was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { + background-color: #9eff3b; +} + +.was-validated .custom-control-input:valid ~ .valid-feedback, +.was-validated .custom-control-input:valid ~ .valid-tooltip, .custom-control-input.is-valid ~ .valid-feedback, +.custom-control-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { + background-color: #78ed00; +} + +.was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { + border-color: #5eba00; +} + +.was-validated .custom-file-input:valid ~ .custom-file-label::before, .custom-file-input.is-valid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:valid ~ .valid-feedback, +.was-validated .custom-file-input:valid ~ .valid-tooltip, .custom-file-input.is-valid ~ .valid-feedback, +.custom-file-input.is-valid ~ .valid-tooltip { + display: block; +} + +.was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.25); +} + +.invalid-feedback { + display: none; + width: 100%; + margin-top: 0.25rem; + font-size: 87.5%; + color: #cd201f; +} + +.invalid-tooltip { + position: absolute; + top: 100%; + z-index: 5; + display: none; + max-width: 100%; + padding: .5rem; + margin-top: .1rem; + font-size: .875rem; + line-height: 1; + color: #fff; + background-color: rgba(205, 32, 31, 0.8); + border-radius: .2rem; +} + +.was-validated .form-control:invalid, .form-control.is-invalid, .was-validated +.custom-select:invalid, +.custom-select.is-invalid { + border-color: #cd201f; +} + +.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus, .was-validated +.custom-select:invalid:focus, +.custom-select.is-invalid:focus { + border-color: #cd201f; + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .form-control:invalid ~ .invalid-feedback, +.was-validated .form-control:invalid ~ .invalid-tooltip, .form-control.is-invalid ~ .invalid-feedback, +.form-control.is-invalid ~ .invalid-tooltip, .was-validated +.custom-select:invalid ~ .invalid-feedback, +.was-validated +.custom-select:invalid ~ .invalid-tooltip, +.custom-select.is-invalid ~ .invalid-feedback, +.custom-select.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { + color: #cd201f; +} + +.was-validated .form-check-input:invalid ~ .invalid-feedback, +.was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, +.form-check-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { + color: #cd201f; +} + +.was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { + background-color: #ec8080; +} + +.was-validated .custom-control-input:invalid ~ .invalid-feedback, +.was-validated .custom-control-input:invalid ~ .invalid-tooltip, .custom-control-input.is-invalid ~ .invalid-feedback, +.custom-control-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { + background-color: #e23e3d; +} + +.was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { + border-color: #cd201f; +} + +.was-validated .custom-file-input:invalid ~ .custom-file-label::before, .custom-file-input.is-invalid ~ .custom-file-label::before { + border-color: inherit; +} + +.was-validated .custom-file-input:invalid ~ .invalid-feedback, +.was-validated .custom-file-input:invalid ~ .invalid-tooltip, .custom-file-input.is-invalid ~ .invalid-feedback, +.custom-file-input.is-invalid ~ .invalid-tooltip { + display: block; +} + +.was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.25); +} + +.form-inline { + display: -ms-flexbox; + display: flex; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; +} + +.form-inline .form-check { + width: 100%; +} + +@media (min-width: 576px) { + .form-inline label { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + margin-bottom: 0; + } + .form-inline .form-group { + display: -ms-flexbox; + display: flex; + -ms-flex: 0 0 auto; + flex: 0 0 auto; + -ms-flex-flow: row wrap; + flex-flow: row wrap; + -ms-flex-align: center; + align-items: center; + margin-bottom: 0; + } + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + .form-inline .form-control-plaintext { + display: inline-block; + } + .form-inline .input-group { + width: auto; + } + .form-inline .form-check { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: auto; + padding-left: 0; + } + .form-inline .form-check-input { + position: relative; + margin-top: 0; + margin-right: 0.25rem; + margin-left: 0; + } + .form-inline .custom-control { + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + } + .form-inline .custom-control-label { + margin-bottom: 0; + } +} + +.btn { + display: inline-block; + font-weight: 400; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + border: 1px solid transparent; + padding: 0.375rem 0.75rem; + font-size: 0.9375rem; + line-height: 1.84615385; + border-radius: 3px; + transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; +} + +.btn:hover, .btn:focus { + text-decoration: none; +} + +.btn:focus, .btn.focus { + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.btn.disabled, .btn:disabled { + opacity: 0.65; +} + +.btn:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.btn:not(:disabled):not(.disabled):active, .btn:not(:disabled):not(.disabled).active { + background-image: none; +} + +a.btn.disabled, +fieldset:disabled a.btn { + pointer-events: none; +} + +.btn-primary { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-primary:focus, .btn-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-primary.disabled, .btn-primary:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, +.show > .btn-primary.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-secondary { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-success { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-success:focus, .btn-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-success.disabled, .btn-success:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, +.show > .btn-success.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-info { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-info:focus, .btn-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-info.disabled, .btn-info:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, +.show > .btn-info.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-warning { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-warning:focus, .btn-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-warning.disabled, .btn-warning:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, +.show > .btn-warning.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-danger { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-danger:focus, .btn-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-danger.disabled, .btn-danger:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, +.show > .btn-danger.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-light { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:hover { + color: #495057; + background-color: #e2e6ea; + border-color: #dae0e5; +} + +.btn-light:focus, .btn-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-light.disabled, .btn-light:disabled { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, +.show > .btn-light.dropdown-toggle { + color: #495057; + background-color: #dae0e5; + border-color: #d3d9df; +} + +.btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-dark:focus, .btn-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-dark.disabled, .btn-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, +.show > .btn-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-primary { + color: #467fcf; + background-color: transparent; + background-image: none; + border-color: #467fcf; +} + +.btn-outline-primary:hover { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:focus, .btn-outline-primary.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-primary.disabled, .btn-outline-primary:disabled { + color: #467fcf; + background-color: transparent; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, +.show > .btn-outline-primary.dropdown-toggle { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-primary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-outline-secondary { + color: #868e96; + background-color: transparent; + background-image: none; + border-color: #868e96; +} + +.btn-outline-secondary:hover { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:focus, .btn-outline-secondary.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-secondary.disabled, .btn-outline-secondary:disabled { + color: #868e96; + background-color: transparent; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, +.show > .btn-outline-secondary.dropdown-toggle { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-outline-success { + color: #5eba00; + background-color: transparent; + background-image: none; + border-color: #5eba00; +} + +.btn-outline-success:hover { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:focus, .btn-outline-success.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-success.disabled, .btn-outline-success:disabled { + color: #5eba00; + background-color: transparent; +} + +.btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, +.show > .btn-outline-success.dropdown-toggle { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-success.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-outline-info { + color: #45aaf2; + background-color: transparent; + background-image: none; + border-color: #45aaf2; +} + +.btn-outline-info:hover { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:focus, .btn-outline-info.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-info.disabled, .btn-outline-info:disabled { + color: #45aaf2; + background-color: transparent; +} + +.btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, +.show > .btn-outline-info.dropdown-toggle { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-info.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-outline-warning { + color: #f1c40f; + background-color: transparent; + background-image: none; + border-color: #f1c40f; +} + +.btn-outline-warning:hover { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:focus, .btn-outline-warning.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-warning.disabled, .btn-outline-warning:disabled { + color: #f1c40f; + background-color: transparent; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, +.show > .btn-outline-warning.dropdown-toggle { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-warning.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-outline-danger { + color: #cd201f; + background-color: transparent; + background-image: none; + border-color: #cd201f; +} + +.btn-outline-danger:hover { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:focus, .btn-outline-danger.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-danger.disabled, .btn-outline-danger:disabled { + color: #cd201f; + background-color: transparent; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, +.show > .btn-outline-danger.dropdown-toggle { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-danger.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-outline-light { + color: #f8f9fa; + background-color: transparent; + background-image: none; + border-color: #f8f9fa; +} + +.btn-outline-light:hover { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:focus, .btn-outline-light.focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-light.disabled, .btn-outline-light:disabled { + color: #f8f9fa; + background-color: transparent; +} + +.btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, +.show > .btn-outline-light.dropdown-toggle { + color: #495057; + background-color: #f8f9fa; + border-color: #f8f9fa; +} + +.btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-light.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(248, 249, 250, 0.5); +} + +.btn-outline-dark { + color: #343a40; + background-color: transparent; + background-image: none; + border-color: #343a40; +} + +.btn-outline-dark:hover { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:focus, .btn-outline-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-outline-dark.disabled, .btn-outline-dark:disabled { + color: #343a40; + background-color: transparent; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, +.show > .btn-outline-dark.dropdown-toggle { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-outline-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-link { + font-weight: 400; + color: #467fcf; + background-color: transparent; +} + +.btn-link:hover { + color: #295a9f; + text-decoration: underline; + background-color: transparent; + border-color: transparent; +} + +.btn-link:focus, .btn-link.focus { + text-decoration: underline; + border-color: transparent; + box-shadow: none; +} + +.btn-link:disabled, .btn-link.disabled { + color: #868e96; +} + +.btn-lg, .btn-group-lg > .btn { + padding: 0.5rem 1rem; + font-size: 1.125rem; + line-height: 1.625; + border-radius: 3px; +} + +.btn-sm, .btn-group-sm > .btn { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.33333333; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block + .btn-block { + margin-top: 0.5rem; +} + +input[type="submit"].btn-block, +input[type="reset"].btn-block, +input[type="button"].btn-block { + width: 100%; +} + +.fade { + opacity: 0; + transition: opacity 0.15s linear; +} + +.fade.show { + opacity: 1; +} + +.collapse { + display: none; +} + +.collapse.show { + display: block; +} + +tr.collapse.show { + display: table-row; +} + +tbody.collapse.show { + display: table-row-group; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + transition: height 0.35s ease; +} + +.dropup, +.dropdown { + position: relative; +} + +.dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid; + border-right: 0.3em solid transparent; + border-bottom: 0; + border-left: 0.3em solid transparent; +} + +.dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 10rem; + padding: 0.5rem 0; + margin: 0.125rem 0 0; + font-size: 0.9375rem; + color: #495057; + text-align: left; + list-style: none; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.dropup .dropdown-menu { + margin-top: 0; + margin-bottom: 0.125rem; +} + +.dropup .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0; + border-right: 0.3em solid transparent; + border-bottom: 0.3em solid; + border-left: 0.3em solid transparent; +} + +.dropup .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-menu { + margin-top: 0; + margin-left: 0.125rem; +} + +.dropright .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-bottom: 0.3em solid transparent; + border-left: 0.3em solid; +} + +.dropright .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropright .dropdown-toggle::after { + vertical-align: 0; +} + +.dropleft .dropdown-menu { + margin-top: 0; + margin-right: 0.125rem; +} + +.dropleft .dropdown-toggle::after { + display: inline-block; + width: 0; + height: 0; + margin-left: 0.255em; + vertical-align: 0.255em; + content: ""; +} + +.dropleft .dropdown-toggle::after { + display: none; +} + +.dropleft .dropdown-toggle::before { + display: inline-block; + width: 0; + height: 0; + margin-right: 0.255em; + vertical-align: 0.255em; + content: ""; + border-top: 0.3em solid transparent; + border-right: 0.3em solid; + border-bottom: 0.3em solid transparent; +} + +.dropleft .dropdown-toggle:empty::after { + margin-left: 0; +} + +.dropleft .dropdown-toggle::before { + vertical-align: 0; +} + +.dropdown-divider { + height: 0; + margin: 0.5rem 0; + overflow: hidden; + border-top: 1px solid #e9ecef; +} + +.dropdown-item { + display: block; + width: 100%; + padding: 0.25rem 1.5rem; + clear: both; + font-weight: 400; + color: #212529; + text-align: inherit; + white-space: nowrap; + background-color: transparent; + border: 0; +} + +.dropdown-item:hover, .dropdown-item:focus { + color: #16181b; + text-decoration: none; + background-color: #f8f9fa; +} + +.dropdown-item.active, .dropdown-item:active { + color: #fff; + text-decoration: none; + background-color: #467fcf; +} + +.dropdown-item.disabled, .dropdown-item:disabled { + color: #868e96; + background-color: transparent; +} + +.dropdown-menu.show { + display: block; +} + +.dropdown-header { + display: block; + padding: 0.5rem 1.5rem; + margin-bottom: 0; + font-size: 0.875rem; + color: #868e96; + white-space: nowrap; +} + +.btn-group, +.btn-group-vertical { + position: relative; + display: -ms-inline-flexbox; + display: inline-flex; + vertical-align: middle; +} + +.btn-group > .btn, +.btn-group-vertical > .btn { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; +} + +.btn-group > .btn:hover, +.btn-group-vertical > .btn:hover { + z-index: 1; +} + +.btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, +.btn-group-vertical > .btn:focus, +.btn-group-vertical > .btn:active, +.btn-group-vertical > .btn.active { + z-index: 1; +} + +.btn-group .btn + .btn, +.btn-group .btn + .btn-group, +.btn-group .btn-group + .btn, +.btn-group .btn-group + .btn-group, +.btn-group-vertical .btn + .btn, +.btn-group-vertical .btn + .btn-group, +.btn-group-vertical .btn-group + .btn, +.btn-group-vertical .btn-group + .btn-group { + margin-left: -1px; +} + +.btn-toolbar { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.btn-toolbar .input-group { + width: auto; +} + +.btn-group > .btn:first-child { + margin-left: 0; +} + +.btn-group > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group > .btn-group:not(:last-child) > .btn { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group > .btn:not(:first-child), +.btn-group > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.dropdown-toggle-split { + padding-right: 0.5625rem; + padding-left: 0.5625rem; +} + +.dropdown-toggle-split::after { + margin-left: 0; +} + +.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { + padding-right: 0.375rem; + padding-left: 0.375rem; +} + +.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { + padding-right: 0.75rem; + padding-left: 0.75rem; +} + +.btn-group-vertical { + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: center; + justify-content: center; +} + +.btn-group-vertical .btn, +.btn-group-vertical .btn-group { + width: 100%; +} + +.btn-group-vertical > .btn + .btn, +.btn-group-vertical > .btn + .btn-group, +.btn-group-vertical > .btn-group + .btn, +.btn-group-vertical > .btn-group + .btn-group { + margin-top: -1px; + margin-left: 0; +} + +.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), +.btn-group-vertical > .btn-group:not(:last-child) > .btn { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group-vertical > .btn:not(:first-child), +.btn-group-vertical > .btn-group:not(:first-child) > .btn { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.btn-group-toggle > .btn, +.btn-group-toggle > .btn-group > .btn { + margin-bottom: 0; +} + +.btn-group-toggle > .btn input[type="radio"], +.btn-group-toggle > .btn input[type="checkbox"], +.btn-group-toggle > .btn-group > .btn input[type="radio"], +.btn-group-toggle > .btn-group > .btn input[type="checkbox"] { + position: absolute; + clip: rect(0, 0, 0, 0); + pointer-events: none; +} + +.input-group { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: stretch; + align-items: stretch; + width: 100%; +} + +.input-group > .form-control, +.input-group > .custom-select, +.input-group > .custom-file { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + width: 1%; + margin-bottom: 0; +} + +.input-group > .form-control:focus, +.input-group > .custom-select:focus, +.input-group > .custom-file:focus { + z-index: 3; +} + +.input-group > .form-control + .form-control, +.input-group > .form-control + .custom-select, +.input-group > .form-control + .custom-file, +.input-group > .custom-select + .form-control, +.input-group > .custom-select + .custom-select, +.input-group > .custom-select + .custom-file, +.input-group > .custom-file + .form-control, +.input-group > .custom-file + .custom-select, +.input-group > .custom-file + .custom-file { + margin-left: -1px; +} + +.input-group > .form-control:not(:last-child), +.input-group > .custom-select:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .form-control:not(:first-child), +.input-group > .custom-select:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group > .custom-file { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.input-group > .custom-file:not(:last-child) .custom-file-label, +.input-group > .custom-file:not(:last-child) .custom-file-label::before { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .custom-file:not(:first-child) .custom-file-label, +.input-group > .custom-file:not(:first-child) .custom-file-label::before { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group-prepend, +.input-group-append { + display: -ms-flexbox; + display: flex; +} + +.input-group-prepend .btn, +.input-group-append .btn { + position: relative; + z-index: 2; +} + +.input-group-prepend .btn + .btn, +.input-group-prepend .btn + .input-group-text, +.input-group-prepend .input-group-text + .input-group-text, +.input-group-prepend .input-group-text + .btn, +.input-group-append .btn + .btn, +.input-group-append .btn + .input-group-text, +.input-group-append .input-group-text + .input-group-text, +.input-group-append .input-group-text + .btn { + margin-left: -1px; +} + +.input-group-prepend { + margin-right: -1px; +} + +.input-group-append { + margin-left: -1px; +} + +.input-group-text { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + padding: 0.375rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + font-weight: 400; + line-height: 1.6; + color: #495057; + text-align: center; + white-space: nowrap; + background-color: #fbfbfc; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.input-group-text input[type="radio"], +.input-group-text input[type="checkbox"] { + margin-top: 0; +} + +.input-group > .input-group-prepend > .btn, +.input-group > .input-group-prepend > .input-group-text, +.input-group > .input-group-append:not(:last-child) > .btn, +.input-group > .input-group-append:not(:last-child) > .input-group-text, +.input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), +.input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group > .input-group-append > .btn, +.input-group > .input-group-append > .input-group-text, +.input-group > .input-group-prepend:not(:first-child) > .btn, +.input-group > .input-group-prepend:not(:first-child) > .input-group-text, +.input-group > .input-group-prepend:first-child > .btn:not(:first-child), +.input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.custom-control { + position: relative; + display: block; + min-height: 1.5rem; + padding-left: 1.5rem; +} + +.custom-control-inline { + display: -ms-inline-flexbox; + display: inline-flex; + margin-right: 1rem; +} + +.custom-control-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-control-input:checked ~ .custom-control-label::before { + color: #fff; + background-color: #467fcf; +} + +.custom-control-input:focus ~ .custom-control-label::before { + box-shadow: 0 0 0 1px #f5f7fb, 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-control-input:active ~ .custom-control-label::before { + color: #fff; + background-color: #d4e1f4; +} + +.custom-control-input:disabled ~ .custom-control-label { + color: #868e96; +} + +.custom-control-input:disabled ~ .custom-control-label::before { + background-color: #e9ecef; +} + +.custom-control-label { + margin-bottom: 0; +} + +.custom-control-label::before { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + content: ""; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-color: #dee2e6; +} + +.custom-control-label::after { + position: absolute; + top: 0.25rem; + left: 0; + display: block; + width: 1rem; + height: 1rem; + content: ""; + background-repeat: no-repeat; + background-position: center center; + background-size: 50% 50%; +} + +.custom-checkbox .custom-control-label::before { + border-radius: 3px; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 4 4'%3E%3Cpath stroke='%23fff' d='M0 2h4'/%3E%3C/svg%3E"); +} + +.custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-radio .custom-control-label::before { + border-radius: 50%; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::before { + background-color: #467fcf; +} + +.custom-radio .custom-control-input:checked ~ .custom-control-label::after { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3E%3Ccircle r='3' fill='%23fff'/%3E%3C/svg%3E"); +} + +.custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { + background-color: rgba(70, 127, 207, 0.5); +} + +.custom-select { + display: inline-block; + width: 100%; + height: 2.375rem; + padding: 0.5rem 1.75rem 0.5rem 0.75rem; + line-height: 1.5; + color: #495057; + vertical-align: middle; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat right 0.75rem center; + background-size: 8px 10px; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; +} + +.custom-select:focus { + border-color: #1991eb; + outline: 0; + box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075), 0 0 5px rgba(25, 145, 235, 0.5); +} + +.custom-select:focus::-ms-value { + color: #495057; + background-color: #fff; +} + +.custom-select[multiple], .custom-select[size]:not([size="1"]) { + height: auto; + padding-right: 0.75rem; + background-image: none; +} + +.custom-select:disabled { + color: #868e96; + background-color: #e9ecef; +} + +.custom-select::-ms-expand { + opacity: 0; +} + +.custom-select-sm { + height: calc(1.8125rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 75%; +} + +.custom-select-lg { + height: calc(2.6875rem + 2px); + padding-top: 0.5rem; + padding-bottom: 0.5rem; + font-size: 125%; +} + +.custom-file { + position: relative; + display: inline-block; + width: 100%; + height: 2.375rem; + margin-bottom: 0; +} + +.custom-file-input { + position: relative; + z-index: 2; + width: 100%; + height: 2.375rem; + margin: 0; + opacity: 0; +} + +.custom-file-input:focus ~ .custom-file-control { + border-color: #1991eb; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.custom-file-input:focus ~ .custom-file-control::before { + border-color: #1991eb; +} + +.custom-file-input:lang(en) ~ .custom-file-label::after { + content: "Browse"; +} + +.custom-file-label { + position: absolute; + top: 0; + right: 0; + left: 0; + z-index: 1; + height: 2.375rem; + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.custom-file-label::after { + position: absolute; + top: 0; + right: 0; + bottom: 0; + z-index: 3; + display: block; + height: calc(2.375rem - 1px * 2); + padding: 0.375rem 0.75rem; + line-height: 1.5; + color: #495057; + content: "Browse"; + background-color: #fbfbfc; + border-left: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 0 3px 3px 0; +} + +.nav { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.nav-link { + display: block; + padding: 0.5rem 1rem; +} + +.nav-link:hover, .nav-link:focus { + text-decoration: none; +} + +.nav-link.disabled { + color: #868e96; +} + +.nav-tabs { + border-bottom: 1px solid #dee2e6; +} + +.nav-tabs .nav-item { + margin-bottom: -1px; +} + +.nav-tabs .nav-link { + border: 1px solid transparent; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { + border-color: #e9ecef #e9ecef #dee2e6; +} + +.nav-tabs .nav-link.disabled { + color: #868e96; + background-color: transparent; + border-color: transparent; +} + +.nav-tabs .nav-link.active, +.nav-tabs .nav-item.show .nav-link { + color: #495057; + background-color: #f5f7fb; + border-color: #dee2e6 #dee2e6 #f5f7fb; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.nav-pills .nav-link { + border-radius: 3px; +} + +.nav-pills .nav-link.active, +.nav-pills .show > .nav-link { + color: #fff; + background-color: #467fcf; +} + +.nav-fill .nav-item { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + text-align: center; +} + +.nav-justified .nav-item { + -ms-flex-preferred-size: 0; + flex-basis: 0; + -ms-flex-positive: 1; + flex-grow: 1; + text-align: center; +} + +.tab-content > .tab-pane { + display: none; +} + +.tab-content > .active { + display: block; +} + +.navbar { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 0.5rem 1rem; +} + +.navbar > .container, +.navbar > .container-fluid { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: justify; + justify-content: space-between; +} + +.navbar-brand { + display: inline-block; + padding-top: 0.359375rem; + padding-bottom: 0.359375rem; + margin-right: 1rem; + font-size: 1.125rem; + line-height: inherit; + white-space: nowrap; +} + +.navbar-brand:hover, .navbar-brand:focus { + text-decoration: none; +} + +.navbar-nav { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.navbar-nav .nav-link { + padding-right: 0; + padding-left: 0; +} + +.navbar-nav .dropdown-menu { + position: static; + float: none; +} + +.navbar-text { + display: inline-block; + padding-top: 0.5rem; + padding-bottom: 0.5rem; +} + +.navbar-collapse { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; + -ms-flex-positive: 1; + flex-grow: 1; + -ms-flex-align: center; + align-items: center; +} + +.navbar-toggler { + padding: 0.25rem 0.75rem; + font-size: 1.125rem; + line-height: 1; + background-color: transparent; + border: 1px solid transparent; + border-radius: 3px; +} + +.navbar-toggler:hover, .navbar-toggler:focus { + text-decoration: none; +} + +.navbar-toggler:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.navbar-toggler-icon { + display: inline-block; + width: 1.5em; + height: 1.5em; + vertical-align: middle; + content: ""; + background: no-repeat center center; + background-size: 100% 100%; +} + +@media (max-width: 575.98px) { + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 576px) { + .navbar-expand-sm { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-sm .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-sm .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-sm .navbar-nav .dropdown-menu-right { + right: 0; + left: auto; + } + .navbar-expand-sm .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-sm > .container, + .navbar-expand-sm > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-sm .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-sm .navbar-toggler { + display: none; + } + .navbar-expand-sm .dropup .dropdown-menu { + top: auto; + bottom: 100%; + } +} + +@media (max-width: 767.98px) { + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 768px) { + .navbar-expand-md { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-md .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-md .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-md .navbar-nav .dropdown-menu-right { + right: 0; + left: auto; + } + .navbar-expand-md .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-md > .container, + .navbar-expand-md > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-md .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-md .navbar-toggler { + display: none; + } + .navbar-expand-md .dropup .dropdown-menu { + top: auto; + bottom: 100%; + } +} + +@media (max-width: 991.98px) { + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 992px) { + .navbar-expand-lg { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-lg .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-lg .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-lg .navbar-nav .dropdown-menu-right { + right: 0; + left: auto; + } + .navbar-expand-lg .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-lg > .container, + .navbar-expand-lg > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-lg .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-lg .navbar-toggler { + display: none; + } + .navbar-expand-lg .dropup .dropdown-menu { + top: auto; + bottom: 100%; + } +} + +@media (max-width: 1279.98px) { + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + padding-right: 0; + padding-left: 0; + } +} + +@media (min-width: 1280px) { + .navbar-expand-xl { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; + } + .navbar-expand-xl .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; + } + .navbar-expand-xl .navbar-nav .dropdown-menu { + position: absolute; + } + .navbar-expand-xl .navbar-nav .dropdown-menu-right { + right: 0; + left: auto; + } + .navbar-expand-xl .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; + } + .navbar-expand-xl > .container, + .navbar-expand-xl > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; + } + .navbar-expand-xl .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; + } + .navbar-expand-xl .navbar-toggler { + display: none; + } + .navbar-expand-xl .dropup .dropdown-menu { + top: auto; + bottom: 100%; + } +} + +.navbar-expand { + -ms-flex-flow: row nowrap; + flex-flow: row nowrap; + -ms-flex-pack: start; + justify-content: flex-start; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + padding-right: 0; + padding-left: 0; +} + +.navbar-expand .navbar-nav { + -ms-flex-direction: row; + flex-direction: row; +} + +.navbar-expand .navbar-nav .dropdown-menu { + position: absolute; +} + +.navbar-expand .navbar-nav .dropdown-menu-right { + right: 0; + left: auto; +} + +.navbar-expand .navbar-nav .nav-link { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.navbar-expand > .container, +.navbar-expand > .container-fluid { + -ms-flex-wrap: nowrap; + flex-wrap: nowrap; +} + +.navbar-expand .navbar-collapse { + display: -ms-flexbox !important; + display: flex !important; + -ms-flex-preferred-size: auto; + flex-basis: auto; +} + +.navbar-expand .navbar-toggler { + display: none; +} + +.navbar-expand .dropup .dropdown-menu { + top: auto; + bottom: 100%; +} + +.navbar-light .navbar-brand { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-nav .nav-link { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { + color: rgba(0, 0, 0, 0.7); +} + +.navbar-light .navbar-nav .nav-link.disabled { + color: rgba(0, 0, 0, 0.3); +} + +.navbar-light .navbar-nav .show > .nav-link, +.navbar-light .navbar-nav .active > .nav-link, +.navbar-light .navbar-nav .nav-link.show, +.navbar-light .navbar-nav .nav-link.active { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-toggler { + color: rgba(0, 0, 0, 0.5); + border-color: rgba(0, 0, 0, 0.1); +} + +.navbar-light .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(0, 0, 0, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-light .navbar-text { + color: rgba(0, 0, 0, 0.5); +} + +.navbar-light .navbar-text a { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { + color: rgba(0, 0, 0, 0.9); +} + +.navbar-dark .navbar-brand { + color: #fff; +} + +.navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { + color: #fff; +} + +.navbar-dark .navbar-nav .nav-link { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { + color: rgba(255, 255, 255, 0.75); +} + +.navbar-dark .navbar-nav .nav-link.disabled { + color: rgba(255, 255, 255, 0.25); +} + +.navbar-dark .navbar-nav .show > .nav-link, +.navbar-dark .navbar-nav .active > .nav-link, +.navbar-dark .navbar-nav .nav-link.show, +.navbar-dark .navbar-nav .nav-link.active { + color: #fff; +} + +.navbar-dark .navbar-toggler { + color: rgba(255, 255, 255, 0.5); + border-color: rgba(255, 255, 255, 0.1); +} + +.navbar-dark .navbar-toggler-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg viewBox='0 0 30 30' xmlns='http://www.w3.org/2000/svg'%3E%3Cpath stroke='rgba(255, 255, 255, 0.5)' stroke-width='2' stroke-linecap='round' stroke-miterlimit='10' d='M4 7h22M4 15h22M4 23h22'/%3E%3C/svg%3E"); +} + +.navbar-dark .navbar-text { + color: rgba(255, 255, 255, 0.5); +} + +.navbar-dark .navbar-text a { + color: #fff; +} + +.navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { + color: #fff; +} + +.card { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + min-width: 0; + word-wrap: break-word; + background-color: #fff; + background-clip: border-box; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; +} + +.card > hr { + margin-right: 0; + margin-left: 0; +} + +.card > .list-group:first-child .list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card > .list-group:last-child .list-group-item:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.card-body { + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1.5rem; +} + +.card-title { + margin-bottom: 1.5rem; +} + +.card-subtitle { + margin-top: -0.75rem; + margin-bottom: 0; +} + +.card-text:last-child { + margin-bottom: 0; +} + +.card-link:hover { + text-decoration: none; +} + +.card-link + .card-link { + margin-left: 1.5rem; +} + +.card-header { + padding: 1.5rem 1.5rem; + margin-bottom: 0; + background-color: rgba(0, 0, 0, 0.03); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-header:first-child { + border-radius: calc(3px - 1px) calc(3px - 1px) 0 0; +} + +.card-header + .list-group .list-group-item:first-child { + border-top: 0; +} + +.card-footer { + padding: 1.5rem 1.5rem; + background-color: rgba(0, 0, 0, 0.03); + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-footer:last-child { + border-radius: 0 0 calc(3px - 1px) calc(3px - 1px); +} + +.card-header-tabs { + margin-right: -0.75rem; + margin-bottom: -1.5rem; + margin-left: -0.75rem; + border-bottom: 0; +} + +.card-header-pills { + margin-right: -0.75rem; + margin-left: -0.75rem; +} + +.card-img-overlay { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + padding: 1.25rem; +} + +.card-img { + width: 100%; + border-radius: calc(3px - 1px); +} + +.card-img-top { + width: 100%; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.card-img-bottom { + width: 100%; + border-bottom-right-radius: calc(3px - 1px); + border-bottom-left-radius: calc(3px - 1px); +} + +.card-deck { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-deck .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-deck { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + margin-right: -0.75rem; + margin-left: -0.75rem; + } + .card-deck .card { + display: -ms-flexbox; + display: flex; + -ms-flex: 1 0 0%; + flex: 1 0 0%; + -ms-flex-direction: column; + flex-direction: column; + margin-right: 0.75rem; + margin-bottom: 0; + margin-left: 0.75rem; + } +} + +.card-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-group > .card { + margin-bottom: 0.75rem; +} + +@media (min-width: 576px) { + .card-group { + -ms-flex-flow: row wrap; + flex-flow: row wrap; + } + .card-group > .card { + -ms-flex: 1 0 0%; + flex: 1 0 0%; + margin-bottom: 0; + } + .card-group > .card + .card { + margin-left: 0; + border-left: 0; + } + .card-group > .card:first-child { + border-top-right-radius: 0; + border-bottom-right-radius: 0; + } + .card-group > .card:first-child .card-img-top, + .card-group > .card:first-child .card-header { + border-top-right-radius: 0; + } + .card-group > .card:first-child .card-img-bottom, + .card-group > .card:first-child .card-footer { + border-bottom-right-radius: 0; + } + .card-group > .card:last-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; + } + .card-group > .card:last-child .card-img-top, + .card-group > .card:last-child .card-header { + border-top-left-radius: 0; + } + .card-group > .card:last-child .card-img-bottom, + .card-group > .card:last-child .card-footer { + border-bottom-left-radius: 0; + } + .card-group > .card:only-child { + border-radius: 3px; + } + .card-group > .card:only-child .card-img-top, + .card-group > .card:only-child .card-header { + border-top-left-radius: 3px; + border-top-right-radius: 3px; + } + .card-group > .card:only-child .card-img-bottom, + .card-group > .card:only-child .card-footer { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) { + border-radius: 0; + } + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-top, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-img-bottom, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-header, + .card-group > .card:not(:first-child):not(:last-child):not(:only-child) .card-footer { + border-radius: 0; + } +} + +.card-columns .card { + margin-bottom: 1.5rem; +} + +@media (min-width: 576px) { + .card-columns { + -webkit-column-count: 3; + -moz-column-count: 3; + column-count: 3; + -webkit-column-gap: 1.25rem; + -moz-column-gap: 1.25rem; + column-gap: 1.25rem; + } + .card-columns .card { + display: inline-block; + width: 100%; + } +} + +.breadcrumb { + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; + padding: 0.75rem 1rem; + margin-bottom: 1rem; + list-style: none; + background-color: #e9ecef; + border-radius: 3px; +} + +.breadcrumb-item + .breadcrumb-item::before { + display: inline-block; + padding-right: 0.5rem; + padding-left: 0.5rem; + color: #868e96; + content: "/"; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: underline; +} + +.breadcrumb-item + .breadcrumb-item:hover::before { + text-decoration: none; +} + +.breadcrumb-item.active { + color: #868e96; +} + +.pagination { + display: -ms-flexbox; + display: flex; + padding-left: 0; + list-style: none; + border-radius: 3px; +} + +.page-link { + position: relative; + display: block; + padding: 0.5rem 0.75rem; + margin-left: -1px; + line-height: 1.25; + color: #467fcf; + background-color: #fff; + border: 1px solid #dee2e6; +} + +.page-link:hover { + color: #295a9f; + text-decoration: none; + background-color: #e9ecef; + border-color: #dee2e6; +} + +.page-link:focus { + z-index: 2; + outline: 0; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.page-link:not(:disabled):not(.disabled) { + cursor: pointer; +} + +.page-item:first-child .page-link { + margin-left: 0; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.page-item.active .page-link { + z-index: 1; + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.page-item.disabled .page-link { + color: #868e96; + pointer-events: none; + cursor: auto; + background-color: #fff; + border-color: #dee2e6; +} + +.pagination-lg .page-link { + padding: 0.75rem 1.5rem; + font-size: 1.125rem; + line-height: 1.5; +} + +.pagination-lg .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-lg .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pagination-sm .page-link { + padding: 0.25rem 0.5rem; + font-size: 0.875rem; + line-height: 1.5; +} + +.pagination-sm .page-item:first-child .page-link { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm .page-item:last-child .page-link { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.badge { + display: inline-block; + padding: 0.25em 0.4em; + font-size: 75%; + font-weight: 600; + line-height: 1; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: 3px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.badge-pill { + padding-right: 0.6em; + padding-left: 0.6em; + border-radius: 10rem; +} + +.badge-primary { + color: #fff; + background-color: #467fcf; +} + +.badge-primary[href]:hover, .badge-primary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #2f66b3; +} + +.badge-secondary { + color: #fff; + background-color: #868e96; +} + +.badge-secondary[href]:hover, .badge-secondary[href]:focus { + color: #fff; + text-decoration: none; + background-color: #6c757d; +} + +.badge-success { + color: #fff; + background-color: #5eba00; +} + +.badge-success[href]:hover, .badge-success[href]:focus { + color: #fff; + text-decoration: none; + background-color: #448700; +} + +.badge-info { + color: #fff; + background-color: #45aaf2; +} + +.badge-info[href]:hover, .badge-info[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1594ef; +} + +.badge-warning { + color: #fff; + background-color: #f1c40f; +} + +.badge-warning[href]:hover, .badge-warning[href]:focus { + color: #fff; + text-decoration: none; + background-color: #c29d0b; +} + +.badge-danger { + color: #fff; + background-color: #cd201f; +} + +.badge-danger[href]:hover, .badge-danger[href]:focus { + color: #fff; + text-decoration: none; + background-color: #a11918; +} + +.badge-light { + color: #495057; + background-color: #f8f9fa; +} + +.badge-light[href]:hover, .badge-light[href]:focus { + color: #495057; + text-decoration: none; + background-color: #dae0e5; +} + +.badge-dark { + color: #fff; + background-color: #343a40; +} + +.badge-dark[href]:hover, .badge-dark[href]:focus { + color: #fff; + text-decoration: none; + background-color: #1d2124; +} + +.jumbotron { + padding: 2rem 1rem; + margin-bottom: 2rem; + background-color: #e9ecef; + border-radius: 3px; +} + +@media (min-width: 576px) { + .jumbotron { + padding: 4rem 2rem; + } +} + +.jumbotron-fluid { + padding-right: 0; + padding-left: 0; + border-radius: 0; +} + +.alert { + position: relative; + padding: 0.75rem 1.25rem; + margin-bottom: 1rem; + border: 1px solid transparent; + border-radius: 3px; +} + +.alert-heading { + color: inherit; +} + +.alert-link { + font-weight: 600; +} + +.alert-dismissible { + padding-right: 3.90625rem; +} + +.alert-dismissible .close { + position: absolute; + top: 0; + right: 0; + padding: 0.75rem 1.25rem; + color: inherit; +} + +.alert-primary { + color: #24426c; + background-color: #dae5f5; + border-color: #cbdbf2; +} + +.alert-primary hr { + border-top-color: #b7cded; +} + +.alert-primary .alert-link { + color: #172b46; +} + +.alert-secondary { + color: #464a4e; + background-color: #e7e8ea; + border-color: #dddfe2; +} + +.alert-secondary hr { + border-top-color: #cfd2d6; +} + +.alert-secondary .alert-link { + color: #2e3133; +} + +.alert-success { + color: #316100; + background-color: #dff1cc; + border-color: #d2ecb8; +} + +.alert-success hr { + border-top-color: #c5e7a4; +} + +.alert-success .alert-link { + color: #172e00; +} + +.alert-info { + color: #24587e; + background-color: #daeefc; + border-color: #cbe7fb; +} + +.alert-info hr { + border-top-color: #b3dcf9; +} + +.alert-info .alert-link { + color: #193c56; +} + +.alert-warning { + color: #7d6608; + background-color: #fcf3cf; + border-color: #fbeebc; +} + +.alert-warning hr { + border-top-color: #fae8a4; +} + +.alert-warning .alert-link { + color: #4d3f05; +} + +.alert-danger { + color: #6b1110; + background-color: #f5d2d2; + border-color: #f1c1c0; +} + +.alert-danger hr { + border-top-color: #ecacab; +} + +.alert-danger .alert-link { + color: #3f0a09; +} + +.alert-light { + color: #818182; + background-color: #fefefe; + border-color: #fdfdfe; +} + +.alert-light hr { + border-top-color: #ececf6; +} + +.alert-light .alert-link { + color: #686868; +} + +.alert-dark { + color: #1b1e21; + background-color: #d6d8d9; + border-color: #c6c8ca; +} + +.alert-dark hr { + border-top-color: #b9bbbe; +} + +.alert-dark .alert-link { + color: #040505; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 1rem 0; + } + to { + background-position: 0 0; + } +} + +.progress { + display: -ms-flexbox; + display: flex; + height: 1rem; + overflow: hidden; + font-size: 0.703125rem; + background-color: #e9ecef; + border-radius: 3px; +} + +.progress-bar { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + color: #fff; + text-align: center; + background-color: #467fcf; + transition: width 0.6s ease; +} + +.progress-bar-striped { + background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); + background-size: 1rem 1rem; +} + +.progress-bar-animated { + -webkit-animation: progress-bar-stripes 1s linear infinite; + animation: progress-bar-stripes 1s linear infinite; +} + +.media { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; +} + +.media-body { + -ms-flex: 1; + flex: 1; +} + +.list-group { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + padding-left: 0; + margin-bottom: 0; +} + +.list-group-item-action { + width: 100%; + color: #495057; + text-align: inherit; +} + +.list-group-item-action:hover, .list-group-item-action:focus { + color: #495057; + text-decoration: none; + background-color: #f8f9fa; +} + +.list-group-item-action:active { + color: #495057; + background-color: #e9ecef; +} + +.list-group-item { + position: relative; + display: block; + padding: 0.75rem 1.25rem; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.list-group-item:hover, .list-group-item:focus { + z-index: 1; + text-decoration: none; +} + +.list-group-item.disabled, .list-group-item:disabled { + color: #868e96; + background-color: #fff; +} + +.list-group-item.active { + z-index: 2; + color: #467fcf; + background-color: #f8fafd; + border-color: rgba(0, 40, 100, 0.12); +} + +.list-group-flush .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; +} + +.list-group-flush:first-child .list-group-item:first-child { + border-top: 0; +} + +.list-group-flush:last-child .list-group-item:last-child { + border-bottom: 0; +} + +.list-group-item-primary { + color: #24426c; + background-color: #cbdbf2; +} + +.list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { + color: #24426c; + background-color: #b7cded; +} + +.list-group-item-primary.list-group-item-action.active { + color: #fff; + background-color: #24426c; + border-color: #24426c; +} + +.list-group-item-secondary { + color: #464a4e; + background-color: #dddfe2; +} + +.list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { + color: #464a4e; + background-color: #cfd2d6; +} + +.list-group-item-secondary.list-group-item-action.active { + color: #fff; + background-color: #464a4e; + border-color: #464a4e; +} + +.list-group-item-success { + color: #316100; + background-color: #d2ecb8; +} + +.list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { + color: #316100; + background-color: #c5e7a4; +} + +.list-group-item-success.list-group-item-action.active { + color: #fff; + background-color: #316100; + border-color: #316100; +} + +.list-group-item-info { + color: #24587e; + background-color: #cbe7fb; +} + +.list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { + color: #24587e; + background-color: #b3dcf9; +} + +.list-group-item-info.list-group-item-action.active { + color: #fff; + background-color: #24587e; + border-color: #24587e; +} + +.list-group-item-warning { + color: #7d6608; + background-color: #fbeebc; +} + +.list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { + color: #7d6608; + background-color: #fae8a4; +} + +.list-group-item-warning.list-group-item-action.active { + color: #fff; + background-color: #7d6608; + border-color: #7d6608; +} + +.list-group-item-danger { + color: #6b1110; + background-color: #f1c1c0; +} + +.list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { + color: #6b1110; + background-color: #ecacab; +} + +.list-group-item-danger.list-group-item-action.active { + color: #fff; + background-color: #6b1110; + border-color: #6b1110; +} + +.list-group-item-light { + color: #818182; + background-color: #fdfdfe; +} + +.list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { + color: #818182; + background-color: #ececf6; +} + +.list-group-item-light.list-group-item-action.active { + color: #fff; + background-color: #818182; + border-color: #818182; +} + +.list-group-item-dark { + color: #1b1e21; + background-color: #c6c8ca; +} + +.list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { + color: #1b1e21; + background-color: #b9bbbe; +} + +.list-group-item-dark.list-group-item-action.active { + color: #fff; + background-color: #1b1e21; + border-color: #1b1e21; +} + +.close { + float: right; + font-size: 1.40625rem; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + opacity: .5; +} + +.close:hover, .close:focus { + color: #000; + text-decoration: none; + opacity: .75; +} + +.close:not(:disabled):not(.disabled) { + cursor: pointer; +} + +button.close { + padding: 0; + background-color: transparent; + border: 0; + -webkit-appearance: none; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1050; + display: none; + overflow: hidden; + outline: 0; +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 0.5rem; + pointer-events: none; +} + +.modal.fade .modal-dialog { + transition: -webkit-transform 0.3s ease-out; + transition: transform 0.3s ease-out; + transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; + -webkit-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +.modal.show .modal-dialog { + -webkit-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-dialog-centered { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + min-height: calc(100% - (0.5rem * 2)); +} + +.modal-content { + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + width: 100%; + pointer-events: auto; + background-color: #fff; + background-clip: padding-box; + border: 1px solid rgba(0, 0, 0, 0.2); + border-radius: 3px; + outline: 0; +} + +.modal-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + background-color: #000; +} + +.modal-backdrop.fade { + opacity: 0; +} + +.modal-backdrop.show { + opacity: 0.5; +} + +.modal-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: start; + align-items: flex-start; + -ms-flex-pack: justify; + justify-content: space-between; + padding: 1rem; + border-bottom: 1px solid #e9ecef; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.modal-header .close { + padding: 1rem; + margin: -1rem -1rem -1rem auto; +} + +.modal-title { + margin-bottom: 0; + line-height: 1.5; +} + +.modal-body { + position: relative; + -ms-flex: 1 1 auto; + flex: 1 1 auto; + padding: 1rem; +} + +.modal-footer { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: end; + justify-content: flex-end; + padding: 1rem; + border-top: 1px solid #e9ecef; +} + +.modal-footer > :not(:first-child) { + margin-left: .25rem; +} + +.modal-footer > :not(:last-child) { + margin-right: .25rem; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width: 576px) { + .modal-dialog { + max-width: 500px; + margin: 1.75rem auto; + } + .modal-dialog-centered { + min-height: calc(100% - (1.75rem * 2)); + } + .modal-sm { + max-width: 300px; + } +} + +@media (min-width: 992px) { + .modal-lg { + max-width: 800px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + margin: 0; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + opacity: 0; +} + +.tooltip.show { + opacity: 0.9; +} + +.tooltip .arrow { + position: absolute; + display: block; + width: 0.8rem; + height: 0.4rem; +} + +.tooltip .arrow::before { + position: absolute; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { + padding: 0.4rem 0; +} + +.bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { + bottom: 0; +} + +.bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { + top: 0; + border-width: 0.4rem 0.4rem 0; + border-top-color: #000; +} + +.bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { + padding: 0 0.4rem; +} + +.bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { + left: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { + right: 0; + border-width: 0.4rem 0.4rem 0.4rem 0; + border-right-color: #000; +} + +.bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { + padding: 0.4rem 0; +} + +.bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { + top: 0; +} + +.bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { + bottom: 0; + border-width: 0 0.4rem 0.4rem; + border-bottom-color: #000; +} + +.bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { + padding: 0 0.4rem; +} + +.bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { + right: 0; + width: 0.4rem; + height: 0.8rem; +} + +.bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { + left: 0; + border-width: 0.4rem 0 0.4rem 0.4rem; + border-left-color: #000; +} + +.tooltip-inner { + max-width: 200px; + padding: 0.25rem 0.5rem; + color: #fff; + text-align: center; + background-color: #000; + border-radius: 3px; +} + +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: block; + max-width: 276px; + font-family: "Source Sans Pro", -apple-system, BlinkMacSystemFont, "Segoe UI", "Helvetica Neue", Arial, sans-serif; + font-style: normal; + font-weight: 400; + line-height: 1.5; + text-align: left; + text-align: start; + text-decoration: none; + text-shadow: none; + text-transform: none; + letter-spacing: normal; + word-break: normal; + word-spacing: normal; + white-space: normal; + line-break: auto; + font-size: 0.875rem; + word-wrap: break-word; + background-color: #fff; + background-clip: padding-box; + border: 1px solid #dee3eb; + border-radius: 3px; +} + +.popover .arrow { + position: absolute; + display: block; + width: 0.5rem; + height: 0.5rem; + margin: 0 3px; +} + +.popover .arrow::before, .popover .arrow::after { + position: absolute; + display: block; + content: ""; + border-color: transparent; + border-style: solid; +} + +.bs-popover-top, .bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.5rem; +} + +.bs-popover-top .arrow, .bs-popover-auto[x-placement^="top"] .arrow { + bottom: calc((0.5rem + 1px) * -1); +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before, +.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after { + border-width: 0.5rem 0.25rem 0; +} + +.bs-popover-top .arrow::before, .bs-popover-auto[x-placement^="top"] .arrow::before { + bottom: 0; + border-top-color: #dee3eb; +} + +.bs-popover-top .arrow::after, .bs-popover-auto[x-placement^="top"] .arrow::after { + bottom: 1px; + border-top-color: #fff; +} + +.bs-popover-right, .bs-popover-auto[x-placement^="right"] { + margin-left: 0.5rem; +} + +.bs-popover-right .arrow, .bs-popover-auto[x-placement^="right"] .arrow { + left: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before, +.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after { + border-width: 0.25rem 0.5rem 0.25rem 0; +} + +.bs-popover-right .arrow::before, .bs-popover-auto[x-placement^="right"] .arrow::before { + left: 0; + border-right-color: #dee3eb; +} + +.bs-popover-right .arrow::after, .bs-popover-auto[x-placement^="right"] .arrow::after { + left: 1px; + border-right-color: #fff; +} + +.bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { + margin-top: 0.5rem; +} + +.bs-popover-bottom .arrow, .bs-popover-auto[x-placement^="bottom"] .arrow { + top: calc((0.5rem + 1px) * -1); +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before, +.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after { + border-width: 0 0.25rem 0.5rem 0.25rem; +} + +.bs-popover-bottom .arrow::before, .bs-popover-auto[x-placement^="bottom"] .arrow::before { + top: 0; + border-bottom-color: #dee3eb; +} + +.bs-popover-bottom .arrow::after, .bs-popover-auto[x-placement^="bottom"] .arrow::after { + top: 1px; + border-bottom-color: #fff; +} + +.bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { + position: absolute; + top: 0; + left: 50%; + display: block; + width: 0.5rem; + margin-left: -0.25rem; + content: ""; + border-bottom: 1px solid #f7f7f7; +} + +.bs-popover-left, .bs-popover-auto[x-placement^="left"] { + margin-right: 0.5rem; +} + +.bs-popover-left .arrow, .bs-popover-auto[x-placement^="left"] .arrow { + right: calc((0.5rem + 1px) * -1); + width: 0.5rem; + height: 0.5rem; + margin: 3px 0; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before, +.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after { + border-width: 0.25rem 0 0.25rem 0.5rem; +} + +.bs-popover-left .arrow::before, .bs-popover-auto[x-placement^="left"] .arrow::before { + right: 0; + border-left-color: #dee3eb; +} + +.bs-popover-left .arrow::after, .bs-popover-auto[x-placement^="left"] .arrow::after { + right: 1px; + border-left-color: #fff; +} + +.popover-header { + padding: 0.5rem 0.75rem; + margin-bottom: 0; + font-size: 0.9375rem; + color: inherit; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-top-left-radius: calc(3px - 1px); + border-top-right-radius: calc(3px - 1px); +} + +.popover-header:empty { + display: none; +} + +.popover-body { + padding: 0.75rem 1rem; + color: #6e7687; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-item { + position: relative; + display: none; + -ms-flex-align: center; + align-items: center; + width: 100%; + transition: -webkit-transform 0.6s ease; + transition: transform 0.6s ease; + transition: transform 0.6s ease, -webkit-transform 0.6s ease; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000px; + perspective: 1000px; +} + +.carousel-item.active, +.carousel-item-next, +.carousel-item-prev { + display: block; +} + +.carousel-item-next, +.carousel-item-prev { + position: absolute; + top: 0; +} + +.carousel-item-next.carousel-item-left, +.carousel-item-prev.carousel-item-right { + -webkit-transform: translateX(0); + transform: translateX(0); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next.carousel-item-left, + .carousel-item-prev.carousel-item-right { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-item-next, +.active.carousel-item-right { + -webkit-transform: translateX(100%); + transform: translateX(100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-next, + .active.carousel-item-right { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.carousel-item-prev, +.active.carousel-item-left { + -webkit-transform: translateX(-100%); + transform: translateX(-100%); +} + +@supports ((-webkit-transform-style: preserve-3d) or (transform-style: preserve-3d)) { + .carousel-item-prev, + .active.carousel-item-left { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.carousel-control-prev, +.carousel-control-next { + position: absolute; + top: 0; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + width: 15%; + color: #fff; + text-align: center; + opacity: 0.5; +} + +.carousel-control-prev:hover, .carousel-control-prev:focus, +.carousel-control-next:hover, +.carousel-control-next:focus { + color: #fff; + text-decoration: none; + outline: 0; + opacity: .9; +} + +.carousel-control-prev { + left: 0; +} + +.carousel-control-next { + right: 0; +} + +.carousel-control-prev-icon, +.carousel-control-next-icon { + display: inline-block; + width: 20px; + height: 20px; + background: transparent no-repeat center center; + background-size: 100% 100%; +} + +.carousel-control-prev-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M5.25 0l-4 4 4 4 1.5-1.5-2.5-2.5 2.5-2.5-1.5-1.5z'/%3E%3C/svg%3E"); +} + +.carousel-control-next-icon { + background-image: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' viewBox='0 0 8 8'%3E%3Cpath d='M2.75 0l-1.5 1.5 2.5 2.5-2.5 2.5 1.5 1.5 4-4-4-4z'/%3E%3C/svg%3E"); +} + +.carousel-indicators { + position: absolute; + right: 0; + bottom: 10px; + left: 0; + z-index: 15; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + padding-left: 0; + margin-right: 15%; + margin-left: 15%; + list-style: none; +} + +.carousel-indicators li { + position: relative; + -ms-flex: 0 1 auto; + flex: 0 1 auto; + width: 30px; + height: 3px; + margin-right: 3px; + margin-left: 3px; + text-indent: -999px; + background-color: rgba(255, 255, 255, 0.5); +} + +.carousel-indicators li::before { + position: absolute; + top: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators li::after { + position: absolute; + bottom: -10px; + left: 0; + display: inline-block; + width: 100%; + height: 10px; + content: ""; +} + +.carousel-indicators .active { + background-color: #fff; +} + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 20px; + left: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; +} + +.align-baseline { + vertical-align: baseline !important; +} + +.align-top { + vertical-align: top !important; +} + +.align-middle { + vertical-align: middle !important; +} + +.align-bottom { + vertical-align: bottom !important; +} + +.align-text-bottom { + vertical-align: text-bottom !important; +} + +.align-text-top { + vertical-align: text-top !important; +} + +.bg-primary { + background-color: #467fcf !important; +} + +a.bg-primary:hover, a.bg-primary:focus, +button.bg-primary:hover, +button.bg-primary:focus { + background-color: #2f66b3 !important; +} + +.bg-secondary { + background-color: #868e96 !important; +} + +a.bg-secondary:hover, a.bg-secondary:focus, +button.bg-secondary:hover, +button.bg-secondary:focus { + background-color: #6c757d !important; +} + +.bg-success { + background-color: #5eba00 !important; +} + +a.bg-success:hover, a.bg-success:focus, +button.bg-success:hover, +button.bg-success:focus { + background-color: #448700 !important; +} + +.bg-info { + background-color: #45aaf2 !important; +} + +a.bg-info:hover, a.bg-info:focus, +button.bg-info:hover, +button.bg-info:focus { + background-color: #1594ef !important; +} + +.bg-warning { + background-color: #f1c40f !important; +} + +a.bg-warning:hover, a.bg-warning:focus, +button.bg-warning:hover, +button.bg-warning:focus { + background-color: #c29d0b !important; +} + +.bg-danger { + background-color: #cd201f !important; +} + +a.bg-danger:hover, a.bg-danger:focus, +button.bg-danger:hover, +button.bg-danger:focus { + background-color: #a11918 !important; +} + +.bg-light { + background-color: #f8f9fa !important; +} + +a.bg-light:hover, a.bg-light:focus, +button.bg-light:hover, +button.bg-light:focus { + background-color: #dae0e5 !important; +} + +.bg-dark { + background-color: #343a40 !important; +} + +a.bg-dark:hover, a.bg-dark:focus, +button.bg-dark:hover, +button.bg-dark:focus { + background-color: #1d2124 !important; +} + +.bg-white { + background-color: #fff !important; +} + +.bg-transparent { + background-color: transparent !important; +} + +.border { + border: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-top { + border-top: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-right { + border-right: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-bottom { + border-bottom: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-left { + border-left: 1px solid rgba(0, 40, 100, 0.12) !important; +} + +.border-0 { + border: 0 !important; +} + +.border-top-0 { + border-top: 0 !important; +} + +.border-right-0 { + border-right: 0 !important; +} + +.border-bottom-0 { + border-bottom: 0 !important; +} + +.border-left-0 { + border-left: 0 !important; +} + +.border-primary { + border-color: #467fcf !important; +} + +.border-secondary { + border-color: #868e96 !important; +} + +.border-success { + border-color: #5eba00 !important; +} + +.border-info { + border-color: #45aaf2 !important; +} + +.border-warning { + border-color: #f1c40f !important; +} + +.border-danger { + border-color: #cd201f !important; +} + +.border-light { + border-color: #f8f9fa !important; +} + +.border-dark { + border-color: #343a40 !important; +} + +.border-white { + border-color: #fff !important; +} + +.rounded { + border-radius: 3px !important; +} + +.rounded-top { + border-top-left-radius: 3px !important; + border-top-right-radius: 3px !important; +} + +.rounded-right { + border-top-right-radius: 3px !important; + border-bottom-right-radius: 3px !important; +} + +.rounded-bottom { + border-bottom-right-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-left { + border-top-left-radius: 3px !important; + border-bottom-left-radius: 3px !important; +} + +.rounded-circle { + border-radius: 50% !important; +} + +.rounded-0 { + border-radius: 0 !important; +} + +.clearfix::after { + display: block; + clear: both; + content: ""; +} + +.d-none { + display: none !important; +} + +.d-inline { + display: inline !important; +} + +.d-inline-block { + display: inline-block !important; +} + +.d-block { + display: block !important; +} + +.d-table { + display: table !important; +} + +.d-table-row { + display: table-row !important; +} + +.d-table-cell { + display: table-cell !important; +} + +.d-flex { + display: -ms-flexbox !important; + display: flex !important; +} + +.d-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; +} + +@media (min-width: 576px) { + .d-sm-none { + display: none !important; + } + .d-sm-inline { + display: inline !important; + } + .d-sm-inline-block { + display: inline-block !important; + } + .d-sm-block { + display: block !important; + } + .d-sm-table { + display: table !important; + } + .d-sm-table-row { + display: table-row !important; + } + .d-sm-table-cell { + display: table-cell !important; + } + .d-sm-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-sm-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 768px) { + .d-md-none { + display: none !important; + } + .d-md-inline { + display: inline !important; + } + .d-md-inline-block { + display: inline-block !important; + } + .d-md-block { + display: block !important; + } + .d-md-table { + display: table !important; + } + .d-md-table-row { + display: table-row !important; + } + .d-md-table-cell { + display: table-cell !important; + } + .d-md-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-md-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 992px) { + .d-lg-none { + display: none !important; + } + .d-lg-inline { + display: inline !important; + } + .d-lg-inline-block { + display: inline-block !important; + } + .d-lg-block { + display: block !important; + } + .d-lg-table { + display: table !important; + } + .d-lg-table-row { + display: table-row !important; + } + .d-lg-table-cell { + display: table-cell !important; + } + .d-lg-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-lg-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media (min-width: 1280px) { + .d-xl-none { + display: none !important; + } + .d-xl-inline { + display: inline !important; + } + .d-xl-inline-block { + display: inline-block !important; + } + .d-xl-block { + display: block !important; + } + .d-xl-table { + display: table !important; + } + .d-xl-table-row { + display: table-row !important; + } + .d-xl-table-cell { + display: table-cell !important; + } + .d-xl-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-xl-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +@media print { + .d-print-none { + display: none !important; + } + .d-print-inline { + display: inline !important; + } + .d-print-inline-block { + display: inline-block !important; + } + .d-print-block { + display: block !important; + } + .d-print-table { + display: table !important; + } + .d-print-table-row { + display: table-row !important; + } + .d-print-table-cell { + display: table-cell !important; + } + .d-print-flex { + display: -ms-flexbox !important; + display: flex !important; + } + .d-print-inline-flex { + display: -ms-inline-flexbox !important; + display: inline-flex !important; + } +} + +.embed-responsive { + position: relative; + display: block; + width: 100%; + padding: 0; + overflow: hidden; +} + +.embed-responsive::before { + display: block; + content: ""; +} + +.embed-responsive .embed-responsive-item, +.embed-responsive iframe, +.embed-responsive embed, +.embed-responsive object, +.embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive-21by9::before { + padding-top: 42.85714286%; +} + +.embed-responsive-16by9::before { + padding-top: 56.25%; +} + +.embed-responsive-4by3::before { + padding-top: 75%; +} + +.embed-responsive-1by1::before { + padding-top: 100%; +} + +.flex-row { + -ms-flex-direction: row !important; + flex-direction: row !important; +} + +.flex-column { + -ms-flex-direction: column !important; + flex-direction: column !important; +} + +.flex-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; +} + +.flex-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; +} + +.flex-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; +} + +.flex-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; +} + +.flex-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; +} + +.justify-content-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; +} + +.justify-content-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; +} + +.justify-content-center { + -ms-flex-pack: center !important; + justify-content: center !important; +} + +.justify-content-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; +} + +.justify-content-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; +} + +.align-items-start { + -ms-flex-align: start !important; + align-items: flex-start !important; +} + +.align-items-end { + -ms-flex-align: end !important; + align-items: flex-end !important; +} + +.align-items-center { + -ms-flex-align: center !important; + align-items: center !important; +} + +.align-items-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; +} + +.align-items-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; +} + +.align-content-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; +} + +.align-content-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; +} + +.align-content-center { + -ms-flex-line-pack: center !important; + align-content: center !important; +} + +.align-content-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; +} + +.align-content-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; +} + +.align-content-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; +} + +.align-self-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; +} + +.align-self-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; +} + +.align-self-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; +} + +.align-self-center { + -ms-flex-item-align: center !important; + align-self: center !important; +} + +.align-self-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; +} + +.align-self-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; +} + +@media (min-width: 576px) { + .flex-sm-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-sm-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-sm-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-sm-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-sm-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-sm-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-sm-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .justify-content-sm-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-sm-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-sm-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-sm-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-sm-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-sm-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-sm-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-sm-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-sm-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-sm-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-sm-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-sm-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-sm-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-sm-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-sm-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-sm-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-sm-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-sm-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-sm-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-sm-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-sm-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-sm-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 768px) { + .flex-md-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-md-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-md-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-md-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-md-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-md-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-md-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .justify-content-md-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-md-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-md-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-md-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-md-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-md-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-md-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-md-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-md-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-md-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-md-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-md-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-md-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-md-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-md-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-md-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-md-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-md-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-md-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-md-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-md-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-md-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 992px) { + .flex-lg-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-lg-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-lg-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-lg-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-lg-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-lg-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-lg-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .justify-content-lg-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-lg-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-lg-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-lg-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-lg-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-lg-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-lg-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-lg-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-lg-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-lg-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-lg-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-lg-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-lg-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-lg-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-lg-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-lg-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-lg-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-lg-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-lg-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-lg-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-lg-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-lg-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +@media (min-width: 1280px) { + .flex-xl-row { + -ms-flex-direction: row !important; + flex-direction: row !important; + } + .flex-xl-column { + -ms-flex-direction: column !important; + flex-direction: column !important; + } + .flex-xl-row-reverse { + -ms-flex-direction: row-reverse !important; + flex-direction: row-reverse !important; + } + .flex-xl-column-reverse { + -ms-flex-direction: column-reverse !important; + flex-direction: column-reverse !important; + } + .flex-xl-wrap { + -ms-flex-wrap: wrap !important; + flex-wrap: wrap !important; + } + .flex-xl-nowrap { + -ms-flex-wrap: nowrap !important; + flex-wrap: nowrap !important; + } + .flex-xl-wrap-reverse { + -ms-flex-wrap: wrap-reverse !important; + flex-wrap: wrap-reverse !important; + } + .justify-content-xl-start { + -ms-flex-pack: start !important; + justify-content: flex-start !important; + } + .justify-content-xl-end { + -ms-flex-pack: end !important; + justify-content: flex-end !important; + } + .justify-content-xl-center { + -ms-flex-pack: center !important; + justify-content: center !important; + } + .justify-content-xl-between { + -ms-flex-pack: justify !important; + justify-content: space-between !important; + } + .justify-content-xl-around { + -ms-flex-pack: distribute !important; + justify-content: space-around !important; + } + .align-items-xl-start { + -ms-flex-align: start !important; + align-items: flex-start !important; + } + .align-items-xl-end { + -ms-flex-align: end !important; + align-items: flex-end !important; + } + .align-items-xl-center { + -ms-flex-align: center !important; + align-items: center !important; + } + .align-items-xl-baseline { + -ms-flex-align: baseline !important; + align-items: baseline !important; + } + .align-items-xl-stretch { + -ms-flex-align: stretch !important; + align-items: stretch !important; + } + .align-content-xl-start { + -ms-flex-line-pack: start !important; + align-content: flex-start !important; + } + .align-content-xl-end { + -ms-flex-line-pack: end !important; + align-content: flex-end !important; + } + .align-content-xl-center { + -ms-flex-line-pack: center !important; + align-content: center !important; + } + .align-content-xl-between { + -ms-flex-line-pack: justify !important; + align-content: space-between !important; + } + .align-content-xl-around { + -ms-flex-line-pack: distribute !important; + align-content: space-around !important; + } + .align-content-xl-stretch { + -ms-flex-line-pack: stretch !important; + align-content: stretch !important; + } + .align-self-xl-auto { + -ms-flex-item-align: auto !important; + align-self: auto !important; + } + .align-self-xl-start { + -ms-flex-item-align: start !important; + align-self: flex-start !important; + } + .align-self-xl-end { + -ms-flex-item-align: end !important; + align-self: flex-end !important; + } + .align-self-xl-center { + -ms-flex-item-align: center !important; + align-self: center !important; + } + .align-self-xl-baseline { + -ms-flex-item-align: baseline !important; + align-self: baseline !important; + } + .align-self-xl-stretch { + -ms-flex-item-align: stretch !important; + align-self: stretch !important; + } +} + +.float-left { + float: left !important; +} + +.float-right { + float: right !important; +} + +.float-none { + float: none !important; +} + +@media (min-width: 576px) { + .float-sm-left { + float: left !important; + } + .float-sm-right { + float: right !important; + } + .float-sm-none { + float: none !important; + } +} + +@media (min-width: 768px) { + .float-md-left { + float: left !important; + } + .float-md-right { + float: right !important; + } + .float-md-none { + float: none !important; + } +} + +@media (min-width: 992px) { + .float-lg-left { + float: left !important; + } + .float-lg-right { + float: right !important; + } + .float-lg-none { + float: none !important; + } +} + +@media (min-width: 1280px) { + .float-xl-left { + float: left !important; + } + .float-xl-right { + float: right !important; + } + .float-xl-none { + float: none !important; + } +} + +.position-static { + position: static !important; +} + +.position-relative { + position: relative !important; +} + +.position-absolute { + position: absolute !important; +} + +.position-fixed { + position: fixed !important; +} + +.position-sticky { + position: -webkit-sticky !important; + position: sticky !important; +} + +.fixed-top { + position: fixed; + top: 0; + right: 0; + left: 0; + z-index: 1030; +} + +.fixed-bottom { + position: fixed; + right: 0; + bottom: 0; + left: 0; + z-index: 1030; +} + +@supports ((position: -webkit-sticky) or (position: sticky)) { + .sticky-top { + position: -webkit-sticky; + position: sticky; + top: 0; + z-index: 1020; + } +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + overflow: hidden; + clip: rect(0, 0, 0, 0); + white-space: nowrap; + -webkit-clip-path: inset(50%); + clip-path: inset(50%); + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + overflow: visible; + clip: auto; + white-space: normal; + -webkit-clip-path: none; + clip-path: none; +} + +.w-25 { + width: 25% !important; +} + +.w-50 { + width: 50% !important; +} + +.w-75 { + width: 75% !important; +} + +.w-100 { + width: 100% !important; +} + +.w-0 { + width: 0 !important; +} + +.w-1 { + width: 0.25rem !important; +} + +.w-2 { + width: 0.5rem !important; +} + +.w-3 { + width: 0.75rem !important; +} + +.w-4 { + width: 1rem !important; +} + +.w-5 { + width: 1.5rem !important; +} + +.w-6 { + width: 2rem !important; +} + +.w-7 { + width: 3rem !important; +} + +.w-8 { + width: 4rem !important; +} + +.w-9 { + width: 6rem !important; +} + +.w-auto { + width: auto !important; +} + +.h-25 { + height: 25% !important; +} + +.h-50 { + height: 50% !important; +} + +.h-75 { + height: 75% !important; +} + +.h-100 { + height: 100% !important; +} + +.h-0 { + height: 0 !important; +} + +.h-1 { + height: 0.25rem !important; +} + +.h-2 { + height: 0.5rem !important; +} + +.h-3 { + height: 0.75rem !important; +} + +.h-4 { + height: 1rem !important; +} + +.h-5 { + height: 1.5rem !important; +} + +.h-6 { + height: 2rem !important; +} + +.h-7 { + height: 3rem !important; +} + +.h-8 { + height: 4rem !important; +} + +.h-9 { + height: 6rem !important; +} + +.h-auto { + height: auto !important; +} + +.mw-100 { + max-width: 100% !important; +} + +.mh-100 { + max-height: 100% !important; +} + +.m-0 { + margin: 0 !important; +} + +.mt-0, +.my-0 { + margin-top: 0 !important; +} + +.mr-0, +.mx-0 { + margin-right: 0 !important; +} + +.mb-0, +.my-0 { + margin-bottom: 0 !important; +} + +.ml-0, +.mx-0 { + margin-left: 0 !important; +} + +.m-1 { + margin: 0.25rem !important; +} + +.mt-1, +.my-1 { + margin-top: 0.25rem !important; +} + +.mr-1, +.mx-1 { + margin-right: 0.25rem !important; +} + +.mb-1, +.my-1 { + margin-bottom: 0.25rem !important; +} + +.ml-1, +.mx-1 { + margin-left: 0.25rem !important; +} + +.m-2 { + margin: 0.5rem !important; +} + +.mt-2, +.my-2 { + margin-top: 0.5rem !important; +} + +.mr-2, +.mx-2 { + margin-right: 0.5rem !important; +} + +.mb-2, +.my-2 { + margin-bottom: 0.5rem !important; +} + +.ml-2, +.mx-2 { + margin-left: 0.5rem !important; +} + +.m-3 { + margin: 0.75rem !important; +} + +.mt-3, +.my-3 { + margin-top: 0.75rem !important; +} + +.mr-3, +.mx-3 { + margin-right: 0.75rem !important; +} + +.mb-3, +.my-3 { + margin-bottom: 0.75rem !important; +} + +.ml-3, +.mx-3 { + margin-left: 0.75rem !important; +} + +.m-4 { + margin: 1rem !important; +} + +.mt-4, +.my-4 { + margin-top: 1rem !important; +} + +.mr-4, +.mx-4 { + margin-right: 1rem !important; +} + +.mb-4, +.my-4 { + margin-bottom: 1rem !important; +} + +.ml-4, +.mx-4 { + margin-left: 1rem !important; +} + +.m-5 { + margin: 1.5rem !important; +} + +.mt-5, +.my-5 { + margin-top: 1.5rem !important; +} + +.mr-5, +.mx-5 { + margin-right: 1.5rem !important; +} + +.mb-5, +.my-5 { + margin-bottom: 1.5rem !important; +} + +.ml-5, +.mx-5 { + margin-left: 1.5rem !important; +} + +.m-6 { + margin: 2rem !important; +} + +.mt-6, +.my-6 { + margin-top: 2rem !important; +} + +.mr-6, +.mx-6 { + margin-right: 2rem !important; +} + +.mb-6, +.my-6 { + margin-bottom: 2rem !important; +} + +.ml-6, +.mx-6 { + margin-left: 2rem !important; +} + +.m-7 { + margin: 3rem !important; +} + +.mt-7, +.my-7 { + margin-top: 3rem !important; +} + +.mr-7, +.mx-7 { + margin-right: 3rem !important; +} + +.mb-7, +.my-7 { + margin-bottom: 3rem !important; +} + +.ml-7, +.mx-7 { + margin-left: 3rem !important; +} + +.m-8 { + margin: 4rem !important; +} + +.mt-8, +.my-8 { + margin-top: 4rem !important; +} + +.mr-8, +.mx-8 { + margin-right: 4rem !important; +} + +.mb-8, +.my-8 { + margin-bottom: 4rem !important; +} + +.ml-8, +.mx-8 { + margin-left: 4rem !important; +} + +.m-9 { + margin: 6rem !important; +} + +.mt-9, +.my-9 { + margin-top: 6rem !important; +} + +.mr-9, +.mx-9 { + margin-right: 6rem !important; +} + +.mb-9, +.my-9 { + margin-bottom: 6rem !important; +} + +.ml-9, +.mx-9 { + margin-left: 6rem !important; +} + +.p-0 { + padding: 0 !important; +} + +.pt-0, +.py-0 { + padding-top: 0 !important; +} + +.pr-0, +.px-0 { + padding-right: 0 !important; +} + +.pb-0, +.py-0 { + padding-bottom: 0 !important; +} + +.pl-0, +.px-0 { + padding-left: 0 !important; +} + +.p-1 { + padding: 0.25rem !important; +} + +.pt-1, +.py-1 { + padding-top: 0.25rem !important; +} + +.pr-1, +.px-1 { + padding-right: 0.25rem !important; +} + +.pb-1, +.py-1 { + padding-bottom: 0.25rem !important; +} + +.pl-1, +.px-1 { + padding-left: 0.25rem !important; +} + +.p-2 { + padding: 0.5rem !important; +} + +.pt-2, +.py-2 { + padding-top: 0.5rem !important; +} + +.pr-2, +.px-2 { + padding-right: 0.5rem !important; +} + +.pb-2, +.py-2 { + padding-bottom: 0.5rem !important; +} + +.pl-2, +.px-2 { + padding-left: 0.5rem !important; +} + +.p-3 { + padding: 0.75rem !important; +} + +.pt-3, +.py-3 { + padding-top: 0.75rem !important; +} + +.pr-3, +.px-3 { + padding-right: 0.75rem !important; +} + +.pb-3, +.py-3 { + padding-bottom: 0.75rem !important; +} + +.pl-3, +.px-3 { + padding-left: 0.75rem !important; +} + +.p-4 { + padding: 1rem !important; +} + +.pt-4, +.py-4 { + padding-top: 1rem !important; +} + +.pr-4, +.px-4 { + padding-right: 1rem !important; +} + +.pb-4, +.py-4 { + padding-bottom: 1rem !important; +} + +.pl-4, +.px-4 { + padding-left: 1rem !important; +} + +.p-5 { + padding: 1.5rem !important; +} + +.pt-5, +.py-5 { + padding-top: 1.5rem !important; +} + +.pr-5, +.px-5 { + padding-right: 1.5rem !important; +} + +.pb-5, +.py-5 { + padding-bottom: 1.5rem !important; +} + +.pl-5, +.px-5 { + padding-left: 1.5rem !important; +} + +.p-6 { + padding: 2rem !important; +} + +.pt-6, +.py-6 { + padding-top: 2rem !important; +} + +.pr-6, +.px-6 { + padding-right: 2rem !important; +} + +.pb-6, +.py-6 { + padding-bottom: 2rem !important; +} + +.pl-6, +.px-6 { + padding-left: 2rem !important; +} + +.p-7 { + padding: 3rem !important; +} + +.pt-7, +.py-7 { + padding-top: 3rem !important; +} + +.pr-7, +.px-7 { + padding-right: 3rem !important; +} + +.pb-7, +.py-7 { + padding-bottom: 3rem !important; +} + +.pl-7, +.px-7 { + padding-left: 3rem !important; +} + +.p-8 { + padding: 4rem !important; +} + +.pt-8, +.py-8 { + padding-top: 4rem !important; +} + +.pr-8, +.px-8 { + padding-right: 4rem !important; +} + +.pb-8, +.py-8 { + padding-bottom: 4rem !important; +} + +.pl-8, +.px-8 { + padding-left: 4rem !important; +} + +.p-9 { + padding: 6rem !important; +} + +.pt-9, +.py-9 { + padding-top: 6rem !important; +} + +.pr-9, +.px-9 { + padding-right: 6rem !important; +} + +.pb-9, +.py-9 { + padding-bottom: 6rem !important; +} + +.pl-9, +.px-9 { + padding-left: 6rem !important; +} + +.m-auto { + margin: auto !important; +} + +.mt-auto, +.my-auto { + margin-top: auto !important; +} + +.mr-auto, +.mx-auto { + margin-right: auto !important; +} + +.mb-auto, +.my-auto { + margin-bottom: auto !important; +} + +.ml-auto, +.mx-auto { + margin-left: auto !important; +} + +@media (min-width: 576px) { + .m-sm-0 { + margin: 0 !important; + } + .mt-sm-0, + .my-sm-0 { + margin-top: 0 !important; + } + .mr-sm-0, + .mx-sm-0 { + margin-right: 0 !important; + } + .mb-sm-0, + .my-sm-0 { + margin-bottom: 0 !important; + } + .ml-sm-0, + .mx-sm-0 { + margin-left: 0 !important; + } + .m-sm-1 { + margin: 0.25rem !important; + } + .mt-sm-1, + .my-sm-1 { + margin-top: 0.25rem !important; + } + .mr-sm-1, + .mx-sm-1 { + margin-right: 0.25rem !important; + } + .mb-sm-1, + .my-sm-1 { + margin-bottom: 0.25rem !important; + } + .ml-sm-1, + .mx-sm-1 { + margin-left: 0.25rem !important; + } + .m-sm-2 { + margin: 0.5rem !important; + } + .mt-sm-2, + .my-sm-2 { + margin-top: 0.5rem !important; + } + .mr-sm-2, + .mx-sm-2 { + margin-right: 0.5rem !important; + } + .mb-sm-2, + .my-sm-2 { + margin-bottom: 0.5rem !important; + } + .ml-sm-2, + .mx-sm-2 { + margin-left: 0.5rem !important; + } + .m-sm-3 { + margin: 0.75rem !important; + } + .mt-sm-3, + .my-sm-3 { + margin-top: 0.75rem !important; + } + .mr-sm-3, + .mx-sm-3 { + margin-right: 0.75rem !important; + } + .mb-sm-3, + .my-sm-3 { + margin-bottom: 0.75rem !important; + } + .ml-sm-3, + .mx-sm-3 { + margin-left: 0.75rem !important; + } + .m-sm-4 { + margin: 1rem !important; + } + .mt-sm-4, + .my-sm-4 { + margin-top: 1rem !important; + } + .mr-sm-4, + .mx-sm-4 { + margin-right: 1rem !important; + } + .mb-sm-4, + .my-sm-4 { + margin-bottom: 1rem !important; + } + .ml-sm-4, + .mx-sm-4 { + margin-left: 1rem !important; + } + .m-sm-5 { + margin: 1.5rem !important; + } + .mt-sm-5, + .my-sm-5 { + margin-top: 1.5rem !important; + } + .mr-sm-5, + .mx-sm-5 { + margin-right: 1.5rem !important; + } + .mb-sm-5, + .my-sm-5 { + margin-bottom: 1.5rem !important; + } + .ml-sm-5, + .mx-sm-5 { + margin-left: 1.5rem !important; + } + .m-sm-6 { + margin: 2rem !important; + } + .mt-sm-6, + .my-sm-6 { + margin-top: 2rem !important; + } + .mr-sm-6, + .mx-sm-6 { + margin-right: 2rem !important; + } + .mb-sm-6, + .my-sm-6 { + margin-bottom: 2rem !important; + } + .ml-sm-6, + .mx-sm-6 { + margin-left: 2rem !important; + } + .m-sm-7 { + margin: 3rem !important; + } + .mt-sm-7, + .my-sm-7 { + margin-top: 3rem !important; + } + .mr-sm-7, + .mx-sm-7 { + margin-right: 3rem !important; + } + .mb-sm-7, + .my-sm-7 { + margin-bottom: 3rem !important; + } + .ml-sm-7, + .mx-sm-7 { + margin-left: 3rem !important; + } + .m-sm-8 { + margin: 4rem !important; + } + .mt-sm-8, + .my-sm-8 { + margin-top: 4rem !important; + } + .mr-sm-8, + .mx-sm-8 { + margin-right: 4rem !important; + } + .mb-sm-8, + .my-sm-8 { + margin-bottom: 4rem !important; + } + .ml-sm-8, + .mx-sm-8 { + margin-left: 4rem !important; + } + .m-sm-9 { + margin: 6rem !important; + } + .mt-sm-9, + .my-sm-9 { + margin-top: 6rem !important; + } + .mr-sm-9, + .mx-sm-9 { + margin-right: 6rem !important; + } + .mb-sm-9, + .my-sm-9 { + margin-bottom: 6rem !important; + } + .ml-sm-9, + .mx-sm-9 { + margin-left: 6rem !important; + } + .p-sm-0 { + padding: 0 !important; + } + .pt-sm-0, + .py-sm-0 { + padding-top: 0 !important; + } + .pr-sm-0, + .px-sm-0 { + padding-right: 0 !important; + } + .pb-sm-0, + .py-sm-0 { + padding-bottom: 0 !important; + } + .pl-sm-0, + .px-sm-0 { + padding-left: 0 !important; + } + .p-sm-1 { + padding: 0.25rem !important; + } + .pt-sm-1, + .py-sm-1 { + padding-top: 0.25rem !important; + } + .pr-sm-1, + .px-sm-1 { + padding-right: 0.25rem !important; + } + .pb-sm-1, + .py-sm-1 { + padding-bottom: 0.25rem !important; + } + .pl-sm-1, + .px-sm-1 { + padding-left: 0.25rem !important; + } + .p-sm-2 { + padding: 0.5rem !important; + } + .pt-sm-2, + .py-sm-2 { + padding-top: 0.5rem !important; + } + .pr-sm-2, + .px-sm-2 { + padding-right: 0.5rem !important; + } + .pb-sm-2, + .py-sm-2 { + padding-bottom: 0.5rem !important; + } + .pl-sm-2, + .px-sm-2 { + padding-left: 0.5rem !important; + } + .p-sm-3 { + padding: 0.75rem !important; + } + .pt-sm-3, + .py-sm-3 { + padding-top: 0.75rem !important; + } + .pr-sm-3, + .px-sm-3 { + padding-right: 0.75rem !important; + } + .pb-sm-3, + .py-sm-3 { + padding-bottom: 0.75rem !important; + } + .pl-sm-3, + .px-sm-3 { + padding-left: 0.75rem !important; + } + .p-sm-4 { + padding: 1rem !important; + } + .pt-sm-4, + .py-sm-4 { + padding-top: 1rem !important; + } + .pr-sm-4, + .px-sm-4 { + padding-right: 1rem !important; + } + .pb-sm-4, + .py-sm-4 { + padding-bottom: 1rem !important; + } + .pl-sm-4, + .px-sm-4 { + padding-left: 1rem !important; + } + .p-sm-5 { + padding: 1.5rem !important; + } + .pt-sm-5, + .py-sm-5 { + padding-top: 1.5rem !important; + } + .pr-sm-5, + .px-sm-5 { + padding-right: 1.5rem !important; + } + .pb-sm-5, + .py-sm-5 { + padding-bottom: 1.5rem !important; + } + .pl-sm-5, + .px-sm-5 { + padding-left: 1.5rem !important; + } + .p-sm-6 { + padding: 2rem !important; + } + .pt-sm-6, + .py-sm-6 { + padding-top: 2rem !important; + } + .pr-sm-6, + .px-sm-6 { + padding-right: 2rem !important; + } + .pb-sm-6, + .py-sm-6 { + padding-bottom: 2rem !important; + } + .pl-sm-6, + .px-sm-6 { + padding-left: 2rem !important; + } + .p-sm-7 { + padding: 3rem !important; + } + .pt-sm-7, + .py-sm-7 { + padding-top: 3rem !important; + } + .pr-sm-7, + .px-sm-7 { + padding-right: 3rem !important; + } + .pb-sm-7, + .py-sm-7 { + padding-bottom: 3rem !important; + } + .pl-sm-7, + .px-sm-7 { + padding-left: 3rem !important; + } + .p-sm-8 { + padding: 4rem !important; + } + .pt-sm-8, + .py-sm-8 { + padding-top: 4rem !important; + } + .pr-sm-8, + .px-sm-8 { + padding-right: 4rem !important; + } + .pb-sm-8, + .py-sm-8 { + padding-bottom: 4rem !important; + } + .pl-sm-8, + .px-sm-8 { + padding-left: 4rem !important; + } + .p-sm-9 { + padding: 6rem !important; + } + .pt-sm-9, + .py-sm-9 { + padding-top: 6rem !important; + } + .pr-sm-9, + .px-sm-9 { + padding-right: 6rem !important; + } + .pb-sm-9, + .py-sm-9 { + padding-bottom: 6rem !important; + } + .pl-sm-9, + .px-sm-9 { + padding-left: 6rem !important; + } + .m-sm-auto { + margin: auto !important; + } + .mt-sm-auto, + .my-sm-auto { + margin-top: auto !important; + } + .mr-sm-auto, + .mx-sm-auto { + margin-right: auto !important; + } + .mb-sm-auto, + .my-sm-auto { + margin-bottom: auto !important; + } + .ml-sm-auto, + .mx-sm-auto { + margin-left: auto !important; + } +} + +@media (min-width: 768px) { + .m-md-0 { + margin: 0 !important; + } + .mt-md-0, + .my-md-0 { + margin-top: 0 !important; + } + .mr-md-0, + .mx-md-0 { + margin-right: 0 !important; + } + .mb-md-0, + .my-md-0 { + margin-bottom: 0 !important; + } + .ml-md-0, + .mx-md-0 { + margin-left: 0 !important; + } + .m-md-1 { + margin: 0.25rem !important; + } + .mt-md-1, + .my-md-1 { + margin-top: 0.25rem !important; + } + .mr-md-1, + .mx-md-1 { + margin-right: 0.25rem !important; + } + .mb-md-1, + .my-md-1 { + margin-bottom: 0.25rem !important; + } + .ml-md-1, + .mx-md-1 { + margin-left: 0.25rem !important; + } + .m-md-2 { + margin: 0.5rem !important; + } + .mt-md-2, + .my-md-2 { + margin-top: 0.5rem !important; + } + .mr-md-2, + .mx-md-2 { + margin-right: 0.5rem !important; + } + .mb-md-2, + .my-md-2 { + margin-bottom: 0.5rem !important; + } + .ml-md-2, + .mx-md-2 { + margin-left: 0.5rem !important; + } + .m-md-3 { + margin: 0.75rem !important; + } + .mt-md-3, + .my-md-3 { + margin-top: 0.75rem !important; + } + .mr-md-3, + .mx-md-3 { + margin-right: 0.75rem !important; + } + .mb-md-3, + .my-md-3 { + margin-bottom: 0.75rem !important; + } + .ml-md-3, + .mx-md-3 { + margin-left: 0.75rem !important; + } + .m-md-4 { + margin: 1rem !important; + } + .mt-md-4, + .my-md-4 { + margin-top: 1rem !important; + } + .mr-md-4, + .mx-md-4 { + margin-right: 1rem !important; + } + .mb-md-4, + .my-md-4 { + margin-bottom: 1rem !important; + } + .ml-md-4, + .mx-md-4 { + margin-left: 1rem !important; + } + .m-md-5 { + margin: 1.5rem !important; + } + .mt-md-5, + .my-md-5 { + margin-top: 1.5rem !important; + } + .mr-md-5, + .mx-md-5 { + margin-right: 1.5rem !important; + } + .mb-md-5, + .my-md-5 { + margin-bottom: 1.5rem !important; + } + .ml-md-5, + .mx-md-5 { + margin-left: 1.5rem !important; + } + .m-md-6 { + margin: 2rem !important; + } + .mt-md-6, + .my-md-6 { + margin-top: 2rem !important; + } + .mr-md-6, + .mx-md-6 { + margin-right: 2rem !important; + } + .mb-md-6, + .my-md-6 { + margin-bottom: 2rem !important; + } + .ml-md-6, + .mx-md-6 { + margin-left: 2rem !important; + } + .m-md-7 { + margin: 3rem !important; + } + .mt-md-7, + .my-md-7 { + margin-top: 3rem !important; + } + .mr-md-7, + .mx-md-7 { + margin-right: 3rem !important; + } + .mb-md-7, + .my-md-7 { + margin-bottom: 3rem !important; + } + .ml-md-7, + .mx-md-7 { + margin-left: 3rem !important; + } + .m-md-8 { + margin: 4rem !important; + } + .mt-md-8, + .my-md-8 { + margin-top: 4rem !important; + } + .mr-md-8, + .mx-md-8 { + margin-right: 4rem !important; + } + .mb-md-8, + .my-md-8 { + margin-bottom: 4rem !important; + } + .ml-md-8, + .mx-md-8 { + margin-left: 4rem !important; + } + .m-md-9 { + margin: 6rem !important; + } + .mt-md-9, + .my-md-9 { + margin-top: 6rem !important; + } + .mr-md-9, + .mx-md-9 { + margin-right: 6rem !important; + } + .mb-md-9, + .my-md-9 { + margin-bottom: 6rem !important; + } + .ml-md-9, + .mx-md-9 { + margin-left: 6rem !important; + } + .p-md-0 { + padding: 0 !important; + } + .pt-md-0, + .py-md-0 { + padding-top: 0 !important; + } + .pr-md-0, + .px-md-0 { + padding-right: 0 !important; + } + .pb-md-0, + .py-md-0 { + padding-bottom: 0 !important; + } + .pl-md-0, + .px-md-0 { + padding-left: 0 !important; + } + .p-md-1 { + padding: 0.25rem !important; + } + .pt-md-1, + .py-md-1 { + padding-top: 0.25rem !important; + } + .pr-md-1, + .px-md-1 { + padding-right: 0.25rem !important; + } + .pb-md-1, + .py-md-1 { + padding-bottom: 0.25rem !important; + } + .pl-md-1, + .px-md-1 { + padding-left: 0.25rem !important; + } + .p-md-2 { + padding: 0.5rem !important; + } + .pt-md-2, + .py-md-2 { + padding-top: 0.5rem !important; + } + .pr-md-2, + .px-md-2 { + padding-right: 0.5rem !important; + } + .pb-md-2, + .py-md-2 { + padding-bottom: 0.5rem !important; + } + .pl-md-2, + .px-md-2 { + padding-left: 0.5rem !important; + } + .p-md-3 { + padding: 0.75rem !important; + } + .pt-md-3, + .py-md-3 { + padding-top: 0.75rem !important; + } + .pr-md-3, + .px-md-3 { + padding-right: 0.75rem !important; + } + .pb-md-3, + .py-md-3 { + padding-bottom: 0.75rem !important; + } + .pl-md-3, + .px-md-3 { + padding-left: 0.75rem !important; + } + .p-md-4 { + padding: 1rem !important; + } + .pt-md-4, + .py-md-4 { + padding-top: 1rem !important; + } + .pr-md-4, + .px-md-4 { + padding-right: 1rem !important; + } + .pb-md-4, + .py-md-4 { + padding-bottom: 1rem !important; + } + .pl-md-4, + .px-md-4 { + padding-left: 1rem !important; + } + .p-md-5 { + padding: 1.5rem !important; + } + .pt-md-5, + .py-md-5 { + padding-top: 1.5rem !important; + } + .pr-md-5, + .px-md-5 { + padding-right: 1.5rem !important; + } + .pb-md-5, + .py-md-5 { + padding-bottom: 1.5rem !important; + } + .pl-md-5, + .px-md-5 { + padding-left: 1.5rem !important; + } + .p-md-6 { + padding: 2rem !important; + } + .pt-md-6, + .py-md-6 { + padding-top: 2rem !important; + } + .pr-md-6, + .px-md-6 { + padding-right: 2rem !important; + } + .pb-md-6, + .py-md-6 { + padding-bottom: 2rem !important; + } + .pl-md-6, + .px-md-6 { + padding-left: 2rem !important; + } + .p-md-7 { + padding: 3rem !important; + } + .pt-md-7, + .py-md-7 { + padding-top: 3rem !important; + } + .pr-md-7, + .px-md-7 { + padding-right: 3rem !important; + } + .pb-md-7, + .py-md-7 { + padding-bottom: 3rem !important; + } + .pl-md-7, + .px-md-7 { + padding-left: 3rem !important; + } + .p-md-8 { + padding: 4rem !important; + } + .pt-md-8, + .py-md-8 { + padding-top: 4rem !important; + } + .pr-md-8, + .px-md-8 { + padding-right: 4rem !important; + } + .pb-md-8, + .py-md-8 { + padding-bottom: 4rem !important; + } + .pl-md-8, + .px-md-8 { + padding-left: 4rem !important; + } + .p-md-9 { + padding: 6rem !important; + } + .pt-md-9, + .py-md-9 { + padding-top: 6rem !important; + } + .pr-md-9, + .px-md-9 { + padding-right: 6rem !important; + } + .pb-md-9, + .py-md-9 { + padding-bottom: 6rem !important; + } + .pl-md-9, + .px-md-9 { + padding-left: 6rem !important; + } + .m-md-auto { + margin: auto !important; + } + .mt-md-auto, + .my-md-auto { + margin-top: auto !important; + } + .mr-md-auto, + .mx-md-auto { + margin-right: auto !important; + } + .mb-md-auto, + .my-md-auto { + margin-bottom: auto !important; + } + .ml-md-auto, + .mx-md-auto { + margin-left: auto !important; + } +} + +@media (min-width: 992px) { + .m-lg-0 { + margin: 0 !important; + } + .mt-lg-0, + .my-lg-0 { + margin-top: 0 !important; + } + .mr-lg-0, + .mx-lg-0 { + margin-right: 0 !important; + } + .mb-lg-0, + .my-lg-0 { + margin-bottom: 0 !important; + } + .ml-lg-0, + .mx-lg-0 { + margin-left: 0 !important; + } + .m-lg-1 { + margin: 0.25rem !important; + } + .mt-lg-1, + .my-lg-1 { + margin-top: 0.25rem !important; + } + .mr-lg-1, + .mx-lg-1 { + margin-right: 0.25rem !important; + } + .mb-lg-1, + .my-lg-1 { + margin-bottom: 0.25rem !important; + } + .ml-lg-1, + .mx-lg-1 { + margin-left: 0.25rem !important; + } + .m-lg-2 { + margin: 0.5rem !important; + } + .mt-lg-2, + .my-lg-2 { + margin-top: 0.5rem !important; + } + .mr-lg-2, + .mx-lg-2 { + margin-right: 0.5rem !important; + } + .mb-lg-2, + .my-lg-2 { + margin-bottom: 0.5rem !important; + } + .ml-lg-2, + .mx-lg-2 { + margin-left: 0.5rem !important; + } + .m-lg-3 { + margin: 0.75rem !important; + } + .mt-lg-3, + .my-lg-3 { + margin-top: 0.75rem !important; + } + .mr-lg-3, + .mx-lg-3 { + margin-right: 0.75rem !important; + } + .mb-lg-3, + .my-lg-3 { + margin-bottom: 0.75rem !important; + } + .ml-lg-3, + .mx-lg-3 { + margin-left: 0.75rem !important; + } + .m-lg-4 { + margin: 1rem !important; + } + .mt-lg-4, + .my-lg-4 { + margin-top: 1rem !important; + } + .mr-lg-4, + .mx-lg-4 { + margin-right: 1rem !important; + } + .mb-lg-4, + .my-lg-4 { + margin-bottom: 1rem !important; + } + .ml-lg-4, + .mx-lg-4 { + margin-left: 1rem !important; + } + .m-lg-5 { + margin: 1.5rem !important; + } + .mt-lg-5, + .my-lg-5 { + margin-top: 1.5rem !important; + } + .mr-lg-5, + .mx-lg-5 { + margin-right: 1.5rem !important; + } + .mb-lg-5, + .my-lg-5 { + margin-bottom: 1.5rem !important; + } + .ml-lg-5, + .mx-lg-5 { + margin-left: 1.5rem !important; + } + .m-lg-6 { + margin: 2rem !important; + } + .mt-lg-6, + .my-lg-6 { + margin-top: 2rem !important; + } + .mr-lg-6, + .mx-lg-6 { + margin-right: 2rem !important; + } + .mb-lg-6, + .my-lg-6 { + margin-bottom: 2rem !important; + } + .ml-lg-6, + .mx-lg-6 { + margin-left: 2rem !important; + } + .m-lg-7 { + margin: 3rem !important; + } + .mt-lg-7, + .my-lg-7 { + margin-top: 3rem !important; + } + .mr-lg-7, + .mx-lg-7 { + margin-right: 3rem !important; + } + .mb-lg-7, + .my-lg-7 { + margin-bottom: 3rem !important; + } + .ml-lg-7, + .mx-lg-7 { + margin-left: 3rem !important; + } + .m-lg-8 { + margin: 4rem !important; + } + .mt-lg-8, + .my-lg-8 { + margin-top: 4rem !important; + } + .mr-lg-8, + .mx-lg-8 { + margin-right: 4rem !important; + } + .mb-lg-8, + .my-lg-8 { + margin-bottom: 4rem !important; + } + .ml-lg-8, + .mx-lg-8 { + margin-left: 4rem !important; + } + .m-lg-9 { + margin: 6rem !important; + } + .mt-lg-9, + .my-lg-9 { + margin-top: 6rem !important; + } + .mr-lg-9, + .mx-lg-9 { + margin-right: 6rem !important; + } + .mb-lg-9, + .my-lg-9 { + margin-bottom: 6rem !important; + } + .ml-lg-9, + .mx-lg-9 { + margin-left: 6rem !important; + } + .p-lg-0 { + padding: 0 !important; + } + .pt-lg-0, + .py-lg-0 { + padding-top: 0 !important; + } + .pr-lg-0, + .px-lg-0 { + padding-right: 0 !important; + } + .pb-lg-0, + .py-lg-0 { + padding-bottom: 0 !important; + } + .pl-lg-0, + .px-lg-0 { + padding-left: 0 !important; + } + .p-lg-1 { + padding: 0.25rem !important; + } + .pt-lg-1, + .py-lg-1 { + padding-top: 0.25rem !important; + } + .pr-lg-1, + .px-lg-1 { + padding-right: 0.25rem !important; + } + .pb-lg-1, + .py-lg-1 { + padding-bottom: 0.25rem !important; + } + .pl-lg-1, + .px-lg-1 { + padding-left: 0.25rem !important; + } + .p-lg-2 { + padding: 0.5rem !important; + } + .pt-lg-2, + .py-lg-2 { + padding-top: 0.5rem !important; + } + .pr-lg-2, + .px-lg-2 { + padding-right: 0.5rem !important; + } + .pb-lg-2, + .py-lg-2 { + padding-bottom: 0.5rem !important; + } + .pl-lg-2, + .px-lg-2 { + padding-left: 0.5rem !important; + } + .p-lg-3 { + padding: 0.75rem !important; + } + .pt-lg-3, + .py-lg-3 { + padding-top: 0.75rem !important; + } + .pr-lg-3, + .px-lg-3 { + padding-right: 0.75rem !important; + } + .pb-lg-3, + .py-lg-3 { + padding-bottom: 0.75rem !important; + } + .pl-lg-3, + .px-lg-3 { + padding-left: 0.75rem !important; + } + .p-lg-4 { + padding: 1rem !important; + } + .pt-lg-4, + .py-lg-4 { + padding-top: 1rem !important; + } + .pr-lg-4, + .px-lg-4 { + padding-right: 1rem !important; + } + .pb-lg-4, + .py-lg-4 { + padding-bottom: 1rem !important; + } + .pl-lg-4, + .px-lg-4 { + padding-left: 1rem !important; + } + .p-lg-5 { + padding: 1.5rem !important; + } + .pt-lg-5, + .py-lg-5 { + padding-top: 1.5rem !important; + } + .pr-lg-5, + .px-lg-5 { + padding-right: 1.5rem !important; + } + .pb-lg-5, + .py-lg-5 { + padding-bottom: 1.5rem !important; + } + .pl-lg-5, + .px-lg-5 { + padding-left: 1.5rem !important; + } + .p-lg-6 { + padding: 2rem !important; + } + .pt-lg-6, + .py-lg-6 { + padding-top: 2rem !important; + } + .pr-lg-6, + .px-lg-6 { + padding-right: 2rem !important; + } + .pb-lg-6, + .py-lg-6 { + padding-bottom: 2rem !important; + } + .pl-lg-6, + .px-lg-6 { + padding-left: 2rem !important; + } + .p-lg-7 { + padding: 3rem !important; + } + .pt-lg-7, + .py-lg-7 { + padding-top: 3rem !important; + } + .pr-lg-7, + .px-lg-7 { + padding-right: 3rem !important; + } + .pb-lg-7, + .py-lg-7 { + padding-bottom: 3rem !important; + } + .pl-lg-7, + .px-lg-7 { + padding-left: 3rem !important; + } + .p-lg-8 { + padding: 4rem !important; + } + .pt-lg-8, + .py-lg-8 { + padding-top: 4rem !important; + } + .pr-lg-8, + .px-lg-8 { + padding-right: 4rem !important; + } + .pb-lg-8, + .py-lg-8 { + padding-bottom: 4rem !important; + } + .pl-lg-8, + .px-lg-8 { + padding-left: 4rem !important; + } + .p-lg-9 { + padding: 6rem !important; + } + .pt-lg-9, + .py-lg-9 { + padding-top: 6rem !important; + } + .pr-lg-9, + .px-lg-9 { + padding-right: 6rem !important; + } + .pb-lg-9, + .py-lg-9 { + padding-bottom: 6rem !important; + } + .pl-lg-9, + .px-lg-9 { + padding-left: 6rem !important; + } + .m-lg-auto { + margin: auto !important; + } + .mt-lg-auto, + .my-lg-auto { + margin-top: auto !important; + } + .mr-lg-auto, + .mx-lg-auto { + margin-right: auto !important; + } + .mb-lg-auto, + .my-lg-auto { + margin-bottom: auto !important; + } + .ml-lg-auto, + .mx-lg-auto { + margin-left: auto !important; + } +} + +@media (min-width: 1280px) { + .m-xl-0 { + margin: 0 !important; + } + .mt-xl-0, + .my-xl-0 { + margin-top: 0 !important; + } + .mr-xl-0, + .mx-xl-0 { + margin-right: 0 !important; + } + .mb-xl-0, + .my-xl-0 { + margin-bottom: 0 !important; + } + .ml-xl-0, + .mx-xl-0 { + margin-left: 0 !important; + } + .m-xl-1 { + margin: 0.25rem !important; + } + .mt-xl-1, + .my-xl-1 { + margin-top: 0.25rem !important; + } + .mr-xl-1, + .mx-xl-1 { + margin-right: 0.25rem !important; + } + .mb-xl-1, + .my-xl-1 { + margin-bottom: 0.25rem !important; + } + .ml-xl-1, + .mx-xl-1 { + margin-left: 0.25rem !important; + } + .m-xl-2 { + margin: 0.5rem !important; + } + .mt-xl-2, + .my-xl-2 { + margin-top: 0.5rem !important; + } + .mr-xl-2, + .mx-xl-2 { + margin-right: 0.5rem !important; + } + .mb-xl-2, + .my-xl-2 { + margin-bottom: 0.5rem !important; + } + .ml-xl-2, + .mx-xl-2 { + margin-left: 0.5rem !important; + } + .m-xl-3 { + margin: 0.75rem !important; + } + .mt-xl-3, + .my-xl-3 { + margin-top: 0.75rem !important; + } + .mr-xl-3, + .mx-xl-3 { + margin-right: 0.75rem !important; + } + .mb-xl-3, + .my-xl-3 { + margin-bottom: 0.75rem !important; + } + .ml-xl-3, + .mx-xl-3 { + margin-left: 0.75rem !important; + } + .m-xl-4 { + margin: 1rem !important; + } + .mt-xl-4, + .my-xl-4 { + margin-top: 1rem !important; + } + .mr-xl-4, + .mx-xl-4 { + margin-right: 1rem !important; + } + .mb-xl-4, + .my-xl-4 { + margin-bottom: 1rem !important; + } + .ml-xl-4, + .mx-xl-4 { + margin-left: 1rem !important; + } + .m-xl-5 { + margin: 1.5rem !important; + } + .mt-xl-5, + .my-xl-5 { + margin-top: 1.5rem !important; + } + .mr-xl-5, + .mx-xl-5 { + margin-right: 1.5rem !important; + } + .mb-xl-5, + .my-xl-5 { + margin-bottom: 1.5rem !important; + } + .ml-xl-5, + .mx-xl-5 { + margin-left: 1.5rem !important; + } + .m-xl-6 { + margin: 2rem !important; + } + .mt-xl-6, + .my-xl-6 { + margin-top: 2rem !important; + } + .mr-xl-6, + .mx-xl-6 { + margin-right: 2rem !important; + } + .mb-xl-6, + .my-xl-6 { + margin-bottom: 2rem !important; + } + .ml-xl-6, + .mx-xl-6 { + margin-left: 2rem !important; + } + .m-xl-7 { + margin: 3rem !important; + } + .mt-xl-7, + .my-xl-7 { + margin-top: 3rem !important; + } + .mr-xl-7, + .mx-xl-7 { + margin-right: 3rem !important; + } + .mb-xl-7, + .my-xl-7 { + margin-bottom: 3rem !important; + } + .ml-xl-7, + .mx-xl-7 { + margin-left: 3rem !important; + } + .m-xl-8 { + margin: 4rem !important; + } + .mt-xl-8, + .my-xl-8 { + margin-top: 4rem !important; + } + .mr-xl-8, + .mx-xl-8 { + margin-right: 4rem !important; + } + .mb-xl-8, + .my-xl-8 { + margin-bottom: 4rem !important; + } + .ml-xl-8, + .mx-xl-8 { + margin-left: 4rem !important; + } + .m-xl-9 { + margin: 6rem !important; + } + .mt-xl-9, + .my-xl-9 { + margin-top: 6rem !important; + } + .mr-xl-9, + .mx-xl-9 { + margin-right: 6rem !important; + } + .mb-xl-9, + .my-xl-9 { + margin-bottom: 6rem !important; + } + .ml-xl-9, + .mx-xl-9 { + margin-left: 6rem !important; + } + .p-xl-0 { + padding: 0 !important; + } + .pt-xl-0, + .py-xl-0 { + padding-top: 0 !important; + } + .pr-xl-0, + .px-xl-0 { + padding-right: 0 !important; + } + .pb-xl-0, + .py-xl-0 { + padding-bottom: 0 !important; + } + .pl-xl-0, + .px-xl-0 { + padding-left: 0 !important; + } + .p-xl-1 { + padding: 0.25rem !important; + } + .pt-xl-1, + .py-xl-1 { + padding-top: 0.25rem !important; + } + .pr-xl-1, + .px-xl-1 { + padding-right: 0.25rem !important; + } + .pb-xl-1, + .py-xl-1 { + padding-bottom: 0.25rem !important; + } + .pl-xl-1, + .px-xl-1 { + padding-left: 0.25rem !important; + } + .p-xl-2 { + padding: 0.5rem !important; + } + .pt-xl-2, + .py-xl-2 { + padding-top: 0.5rem !important; + } + .pr-xl-2, + .px-xl-2 { + padding-right: 0.5rem !important; + } + .pb-xl-2, + .py-xl-2 { + padding-bottom: 0.5rem !important; + } + .pl-xl-2, + .px-xl-2 { + padding-left: 0.5rem !important; + } + .p-xl-3 { + padding: 0.75rem !important; + } + .pt-xl-3, + .py-xl-3 { + padding-top: 0.75rem !important; + } + .pr-xl-3, + .px-xl-3 { + padding-right: 0.75rem !important; + } + .pb-xl-3, + .py-xl-3 { + padding-bottom: 0.75rem !important; + } + .pl-xl-3, + .px-xl-3 { + padding-left: 0.75rem !important; + } + .p-xl-4 { + padding: 1rem !important; + } + .pt-xl-4, + .py-xl-4 { + padding-top: 1rem !important; + } + .pr-xl-4, + .px-xl-4 { + padding-right: 1rem !important; + } + .pb-xl-4, + .py-xl-4 { + padding-bottom: 1rem !important; + } + .pl-xl-4, + .px-xl-4 { + padding-left: 1rem !important; + } + .p-xl-5 { + padding: 1.5rem !important; + } + .pt-xl-5, + .py-xl-5 { + padding-top: 1.5rem !important; + } + .pr-xl-5, + .px-xl-5 { + padding-right: 1.5rem !important; + } + .pb-xl-5, + .py-xl-5 { + padding-bottom: 1.5rem !important; + } + .pl-xl-5, + .px-xl-5 { + padding-left: 1.5rem !important; + } + .p-xl-6 { + padding: 2rem !important; + } + .pt-xl-6, + .py-xl-6 { + padding-top: 2rem !important; + } + .pr-xl-6, + .px-xl-6 { + padding-right: 2rem !important; + } + .pb-xl-6, + .py-xl-6 { + padding-bottom: 2rem !important; + } + .pl-xl-6, + .px-xl-6 { + padding-left: 2rem !important; + } + .p-xl-7 { + padding: 3rem !important; + } + .pt-xl-7, + .py-xl-7 { + padding-top: 3rem !important; + } + .pr-xl-7, + .px-xl-7 { + padding-right: 3rem !important; + } + .pb-xl-7, + .py-xl-7 { + padding-bottom: 3rem !important; + } + .pl-xl-7, + .px-xl-7 { + padding-left: 3rem !important; + } + .p-xl-8 { + padding: 4rem !important; + } + .pt-xl-8, + .py-xl-8 { + padding-top: 4rem !important; + } + .pr-xl-8, + .px-xl-8 { + padding-right: 4rem !important; + } + .pb-xl-8, + .py-xl-8 { + padding-bottom: 4rem !important; + } + .pl-xl-8, + .px-xl-8 { + padding-left: 4rem !important; + } + .p-xl-9 { + padding: 6rem !important; + } + .pt-xl-9, + .py-xl-9 { + padding-top: 6rem !important; + } + .pr-xl-9, + .px-xl-9 { + padding-right: 6rem !important; + } + .pb-xl-9, + .py-xl-9 { + padding-bottom: 6rem !important; + } + .pl-xl-9, + .px-xl-9 { + padding-left: 6rem !important; + } + .m-xl-auto { + margin: auto !important; + } + .mt-xl-auto, + .my-xl-auto { + margin-top: auto !important; + } + .mr-xl-auto, + .mx-xl-auto { + margin-right: auto !important; + } + .mb-xl-auto, + .my-xl-auto { + margin-bottom: auto !important; + } + .ml-xl-auto, + .mx-xl-auto { + margin-left: auto !important; + } +} + +.text-justify { + text-align: justify !important; +} + +.text-nowrap { + white-space: nowrap !important; +} + +.text-truncate { + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; +} + +.text-left { + text-align: left !important; +} + +.text-right { + text-align: right !important; +} + +.text-center { + text-align: center !important; +} + +@media (min-width: 576px) { + .text-sm-left { + text-align: left !important; + } + .text-sm-right { + text-align: right !important; + } + .text-sm-center { + text-align: center !important; + } +} + +@media (min-width: 768px) { + .text-md-left { + text-align: left !important; + } + .text-md-right { + text-align: right !important; + } + .text-md-center { + text-align: center !important; + } +} + +@media (min-width: 992px) { + .text-lg-left { + text-align: left !important; + } + .text-lg-right { + text-align: right !important; + } + .text-lg-center { + text-align: center !important; + } +} + +@media (min-width: 1280px) { + .text-xl-left { + text-align: left !important; + } + .text-xl-right { + text-align: right !important; + } + .text-xl-center { + text-align: center !important; + } +} + +.text-lowercase { + text-transform: lowercase !important; +} + +.text-uppercase { + text-transform: uppercase !important; +} + +.text-capitalize { + text-transform: capitalize !important; +} + +.font-weight-light { + font-weight: 300 !important; +} + +.font-weight-normal { + font-weight: 400 !important; +} + +.font-weight-bold { + font-weight: 700 !important; +} + +.font-italic { + font-style: italic !important; +} + +.text-white { + color: #fff !important; +} + +.text-primary { + color: #467fcf !important; +} + +a.text-primary:hover, a.text-primary:focus { + color: #2f66b3 !important; +} + +.text-secondary { + color: #868e96 !important; +} + +a.text-secondary:hover, a.text-secondary:focus { + color: #6c757d !important; +} + +.text-success { + color: #5eba00 !important; +} + +a.text-success:hover, a.text-success:focus { + color: #448700 !important; +} + +.text-info { + color: #45aaf2 !important; +} + +a.text-info:hover, a.text-info:focus { + color: #1594ef !important; +} + +.text-warning { + color: #f1c40f !important; +} + +a.text-warning:hover, a.text-warning:focus { + color: #c29d0b !important; +} + +.text-danger { + color: #cd201f !important; +} + +a.text-danger:hover, a.text-danger:focus { + color: #a11918 !important; +} + +.text-light { + color: #f8f9fa !important; +} + +a.text-light:hover, a.text-light:focus { + color: #dae0e5 !important; +} + +.text-dark { + color: #343a40 !important; +} + +a.text-dark:hover, a.text-dark:focus { + color: #1d2124 !important; +} + +.text-muted { + color: #9aa0ac !important; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.visible { + visibility: visible !important; +} + +.invisible { + visibility: hidden !important; +} + +@media print { + *, + *::before, + *::after { + text-shadow: none !important; + box-shadow: none !important; + } + a:not(.btn) { + text-decoration: underline; + } + abbr[title]::after { + content: " (" attr(title) ")"; + } + pre { + white-space: pre-wrap !important; + } + pre, + blockquote { + border: 1px solid #999; + page-break-inside: avoid; + } + thead { + display: table-header-group; + } + tr, + img { + page-break-inside: avoid; + } + p, + h2, + h3 { + orphans: 3; + widows: 3; + } + h2, + h3 { + page-break-after: avoid; + } + @page { + size: a3; + } + body { + min-width: 992px !important; + } + .container { + min-width: 992px !important; + } + .navbar { + display: none; + } + .badge { + border: 1px solid #000; + } + .table, .text-wrap table { + border-collapse: collapse !important; + } + .table td, .text-wrap table td, + .table th, .text-wrap table th { + background-color: #fff !important; + } + .table-bordered th, .text-wrap table th, + .table-bordered td, .text-wrap table td { + border: 1px solid #ddd !important; + } +} + +html { + font-size: 15px; + height: 100%; +} + +@media (min-width: 768px) { + html { + font-size: 16px; + } +} + +body { + direction: ltr; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; + -webkit-tap-highlight-color: transparent; + -webkit-text-size-adjust: none; + -ms-touch-action: manipulation; + touch-action: manipulation; + -webkit-font-feature-settings: "liga" 0; + font-feature-settings: "liga" 0; + height: 100%; + overflow-y: scroll; + position: relative; +} + +@media print { + body { + background: none; + } +} + +body *::-webkit-scrollbar { + width: 6px; + height: 6px; + transition: .3s background; +} + +body *::-webkit-scrollbar-thumb { + background: #ced4da; +} + +body *:hover::-webkit-scrollbar-thumb { + background: #adb5bd; +} + +.lead { + line-height: 1.4; +} + +a { + -webkit-text-decoration-skip: ink; + text-decoration-skip: ink; +} + +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, +.h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a { + color: inherit; +} + +strong, +b { + font-weight: 600; +} + +p, +ul, +ol, +blockquote { + margin-bottom: 1em; +} + +blockquote { + font-style: italic; + color: #6e7687; + padding-left: 2rem; + border-left: 2px solid rgba(0, 40, 100, 0.12); +} + +blockquote p { + margin-bottom: 1rem; +} + +blockquote cite { + display: block; + text-align: right; +} + +blockquote cite:before { + content: '— '; +} + +hr { + margin-top: 2rem; + margin-bottom: 2rem; +} + +pre { + color: #343a40; + padding: 1rem; + overflow: auto; + font-size: 85%; + line-height: 1.45; + background-color: #f8fafc; + border-radius: 3px; + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + text-shadow: 0 1px white; + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +img { + max-width: 100%; +} + +.text-wrap { + font-size: 1rem; + line-height: 1.66; +} + +.text-wrap > :first-child { + margin-top: 0; +} + +.text-wrap > :last-child { + margin-bottom: 0; +} + +.text-wrap > h1, .text-wrap > h2, .text-wrap > h3, .text-wrap > h4, .text-wrap > h5, .text-wrap > h6 { + margin-top: 1em; +} + +.section-nav { + background-color: #f8f9fa; + margin: 1rem 0; + padding: .5rem 1rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + list-style: none; +} + +.section-nav:before { + content: 'Table of contents:'; + display: block; + font-weight: 600; +} + +@media print { + .container { + max-width: none; + } +} + +.row-cards > .col, +.row-cards > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.row-deck > .col, +.row-deck > [class*='col-'] { + display: -ms-flexbox; + display: flex; + -ms-flex-align: stretch; + align-items: stretch; +} + +.row-deck > .col .card, +.row-deck > [class*='col-'] .card { + -ms-flex: 1; + flex: 1; +} + +.col-text { + max-width: 48rem; +} + +.col-login { + max-width: 24rem; +} + +.xs-gutters { + margin-right: -0.25rem; + margin-left: -0.25rem; +} + +.xs-gutters > .col, +.xs-gutters > [class*="col-"] { + padding-right: 0.25rem; + padding-left: 0.25rem; +} + +.xs-gutters .card { + margin-bottom: 0.5rem; +} + +.sm-gutters { + margin-right: -0.5rem; + margin-left: -0.5rem; +} + +.sm-gutters > .col, +.sm-gutters > [class*="col-"] { + padding-right: 0.5rem; + padding-left: 0.5rem; +} + +.sm-gutters .card { + margin-bottom: 1rem; +} + +.lg-gutters { + margin-right: -1rem; + margin-left: -1rem; +} + +.lg-gutters > .col, +.lg-gutters > [class*="col-"] { + padding-right: 1rem; + padding-left: 1rem; +} + +.lg-gutters .card { + margin-bottom: 2rem; +} + +.xl-gutters { + margin-right: -1.5rem; + margin-left: -1.5rem; +} + +.xl-gutters > .col, +.xl-gutters > [class*="col-"] { + padding-right: 1.5rem; + padding-left: 1.5rem; +} + +.xl-gutters .card { + margin-bottom: 3rem; +} + +.page { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: center; + justify-content: center; + min-height: 100%; +} + +body.fixed-header .page { + padding-top: 4.5rem; +} + +@media (min-width: 1600px) { + body.aside-opened .page { + margin-right: 22rem; + } +} + +.page-main { + -ms-flex: 1; + flex: 1; +} + +.page-content { + margin: .75rem 0; +} + +@media (min-width: 768px) { + .page-content { + margin: 1.5rem 0; + } +} + +.page-header { + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + margin: 1.5rem 0 1.5rem; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.page-title { + margin: 0; + font-size: 1.5rem; + font-weight: 400; + line-height: 2.5rem; +} + +.page-title-icon { + color: #9aa0ac; + font-size: 1.25rem; +} + +.page-subtitle { + font-size: 0.8125rem; + color: #6e7687; + margin-left: 2rem; +} + +.page-subtitle a { + color: inherit; +} + +.page-options { + margin-left: auto; +} + +.page-breadcrumb { + -ms-flex-preferred-size: 100%; + flex-basis: 100%; +} + +.page-description { + margin: .25rem 0 0; + color: #6e7687; +} + +.page-description a { + color: inherit; +} + +.page-single { + -ms-flex: 1; + flex: 1; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + padding: 1rem 0; +} + +.content-heading { + font-weight: 400; + margin: 2rem 0 1.5rem; + font-size: 1.25rem; + line-height: 1.25; +} + +.content-heading:first-child { + margin-top: 0; +} + +.aside { + position: fixed; + top: 0; + right: 0; + bottom: 0; + width: 22rem; + background: #ffffff; + border-left: 1px solid rgba(0, 40, 100, 0.12); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + z-index: 100; + visibility: hidden; + box-shadow: 0 0 5px 2px rgba(0, 0, 0, 0.05); +} + +@media (min-width: 1600px) { + body.aside-opened .aside { + visibility: visible; + } +} + +.aside-body { + padding: 1.5rem; + -ms-flex: 1; + flex: 1; + overflow: auto; +} + +.aside-footer { + padding: 1rem 1.5rem; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.aside-header { + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.header { + padding-top: 1rem; + padding-bottom: 1rem; + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +body.fixed-header .header { + position: fixed; + top: 0; + left: 0; + right: 0; + z-index: 1030; +} + +@media print { + .header { + display: none; + } +} + +.header .nav-link, +.header .nav-item { + padding: 0 .75rem; + min-width: 2rem; + transition: .3s color; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + line-height: 1; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; +} + +.header .nav-link .badge, +.header .nav-item .badge { + position: absolute; + top: 0; + right: 0; + padding: .2rem .25rem; + min-width: 1rem; +} + +.bg-header { + background: #0667d0 !important; +} + +.navbar-brand { + color: inherit; + margin-right: 1rem; + font-size: 1.25rem; + white-space: nowrap; + font-weight: 600; + padding: 0; + transition: .3s opacity; + line-height: 2rem; +} + +.navbar-brand:hover { + opacity: .8; + color: inherit; + text-decoration: none; +} + +.navbar-brand-img { + height: 2rem; + line-height: 2rem; + vertical-align: bottom; + margin-right: .5rem; + width: auto; +} + +.header-avatar { + width: 2rem; + height: 2rem; + display: inline-block; + vertical-align: bottom; + border-radius: 50%; +} + +.header-overlay { + position: fixed; + top: 4.5rem; + right: 0; + bottom: 0; + left: 0; + background: rgba(26, 54, 80, 0.1); + visibility: hidden; + opacity: 0; + z-index: 900; + transition: .6s opacity, .6s visibility; + -webkit-backdrop-filter: blur(1px); + backdrop-filter: blur(1px); +} + +.dropdown-menu.show + .header-overlay { + visibility: visible; + opacity: 1; +} + +.header-nav { + background: #fff; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: #9aa0ac; + -ms-flex-align: center; + align-items: center; +} + +@media print { + .header-nav { + display: none; + } +} + +.header-nav .nav-tabs { + border: 0; +} + +.header-nav .nav-tabs .nav-item + .nav-item { + margin-left: 1.5rem; +} + +.header-btn { + display: inline-block; + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + font-size: 1rem; +} + +.header-btn.has-new { + position: relative; +} + +.header-btn.has-new:before { + content: ''; + width: 6px; + height: 6px; + background: #cd201f; + position: absolute; + top: 4px; + right: 4px; + border-radius: 50%; +} + +.footer { + background: #fff; + border-top: 1px solid rgba(0, 40, 100, 0.12); + font-size: 0.875rem; + padding: 1.25rem 0; + color: #9aa0ac; +} + +.footer a:not(.btn) { + color: #6e7687; +} + +@media print { + .footer { + display: none; + } +} + +.colors-list { + display: block; +} + +.colors-list-item { + display: inline-block; + width: 1rem; + height: 1rem; + border-radius: 3px; + vertical-align: middle; +} + +.display-1 i, +.display-2 i, +.display-3 i, +.display-4 i { + vertical-align: baseline; + font-size: 0.815em; +} + +.text-inherit { + color: inherit !important; +} + +.text-default { + color: #495057 !important; +} + +.text-muted-dark { + color: #6e7687 !important; +} + +.bg-blue { + background-color: #467fcf !important; +} + +a.bg-blue:hover, a.bg-blue:focus, +button.bg-blue:hover, +button.bg-blue:focus { + background-color: #2f66b3 !important; +} + +.text-blue { + color: #467fcf !important; +} + +.bg-indigo { + background-color: #6574cd !important; +} + +a.bg-indigo:hover, a.bg-indigo:focus, +button.bg-indigo:hover, +button.bg-indigo:focus { + background-color: #3f51c1 !important; +} + +.text-indigo { + color: #6574cd !important; +} + +.bg-purple { + background-color: #a55eea !important; +} + +a.bg-purple:hover, a.bg-purple:focus, +button.bg-purple:hover, +button.bg-purple:focus { + background-color: #8c31e4 !important; +} + +.text-purple { + color: #a55eea !important; +} + +.bg-pink { + background-color: #f66d9b !important; +} + +a.bg-pink:hover, a.bg-pink:focus, +button.bg-pink:hover, +button.bg-pink:focus { + background-color: #f33d7a !important; +} + +.text-pink { + color: #f66d9b !important; +} + +.bg-red { + background-color: #cd201f !important; +} + +a.bg-red:hover, a.bg-red:focus, +button.bg-red:hover, +button.bg-red:focus { + background-color: #a11918 !important; +} + +.text-red { + color: #cd201f !important; +} + +.bg-orange { + background-color: #fd9644 !important; +} + +a.bg-orange:hover, a.bg-orange:focus, +button.bg-orange:hover, +button.bg-orange:focus { + background-color: #fc7a12 !important; +} + +.text-orange { + color: #fd9644 !important; +} + +.bg-yellow { + background-color: #f1c40f !important; +} + +a.bg-yellow:hover, a.bg-yellow:focus, +button.bg-yellow:hover, +button.bg-yellow:focus { + background-color: #c29d0b !important; +} + +.text-yellow { + color: #f1c40f !important; +} + +.bg-green { + background-color: #5eba00 !important; +} + +a.bg-green:hover, a.bg-green:focus, +button.bg-green:hover, +button.bg-green:focus { + background-color: #448700 !important; +} + +.text-green { + color: #5eba00 !important; +} + +.bg-teal { + background-color: #2bcbba !important; +} + +a.bg-teal:hover, a.bg-teal:focus, +button.bg-teal:hover, +button.bg-teal:focus { + background-color: #22a193 !important; +} + +.text-teal { + color: #2bcbba !important; +} + +.bg-cyan { + background-color: #17a2b8 !important; +} + +a.bg-cyan:hover, a.bg-cyan:focus, +button.bg-cyan:hover, +button.bg-cyan:focus { + background-color: #117a8b !important; +} + +.text-cyan { + color: #17a2b8 !important; +} + +.bg-white { + background-color: #fff !important; +} + +a.bg-white:hover, a.bg-white:focus, +button.bg-white:hover, +button.bg-white:focus { + background-color: #e6e5e5 !important; +} + +.text-white { + color: #fff !important; +} + +.bg-gray { + background-color: #868e96 !important; +} + +a.bg-gray:hover, a.bg-gray:focus, +button.bg-gray:hover, +button.bg-gray:focus { + background-color: #6c757d !important; +} + +.text-gray { + color: #868e96 !important; +} + +.bg-gray-dark { + background-color: #343a40 !important; +} + +a.bg-gray-dark:hover, a.bg-gray-dark:focus, +button.bg-gray-dark:hover, +button.bg-gray-dark:focus { + background-color: #1d2124 !important; +} + +.text-gray-dark { + color: #343a40 !important; +} + +.bg-azure { + background-color: #45aaf2 !important; +} + +a.bg-azure:hover, a.bg-azure:focus, +button.bg-azure:hover, +button.bg-azure:focus { + background-color: #1594ef !important; +} + +.text-azure { + color: #45aaf2 !important; +} + +.bg-lime { + background-color: #7bd235 !important; +} + +a.bg-lime:hover, a.bg-lime:focus, +button.bg-lime:hover, +button.bg-lime:focus { + background-color: #63ad27 !important; +} + +.text-lime { + color: #7bd235 !important; +} + +.icon { + color: #9aa0ac !important; +} + +.icon i { + vertical-align: -1px; +} + +a.icon { + text-decoration: none; + cursor: pointer; +} + +a.icon:hover { + color: #495057 !important; +} + +.o-auto { + overflow: auto !important; +} + +.o-hidden { + overflow: hidden !important; +} + +.nav-tabs { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.nav-tabs .nav-link { + border: 0; + color: inherit; + border-bottom: 1px solid transparent; + margin-bottom: -1px; + transition: .3s border-color; + font-weight: 400; + padding: 1rem 0; +} + +.nav-tabs .nav-link.active { + border-color: #467fcf; + color: #467fcf; + background: transparent; +} + +.nav-tabs .nav-link:hover:not(.disabled) { + border-color: #6e7687; + color: #6e7687; +} + +.nav-tabs .nav-link.disabled { + opacity: .4; + cursor: default; + pointer-events: none; +} + +.nav-tabs .nav-item { + margin-bottom: 0; + position: relative; +} + +.nav-tabs .nav-item i { + margin-right: .25rem; + line-height: 1; + font-size: 0.875rem; + width: 0.875rem; + vertical-align: baseline; + display: inline-block; +} + +.nav-tabs .nav-item + .nav-item { + margin-left: 1.25rem; +} + +.nav-tabs .nav-item:hover .nav-submenu { + display: block; +} + +.nav-tabs .nav-submenu { + display: none; + position: absolute; + background: #fff; + border: 1px solid rgba(0, 40, 100, 0.12); + border-top: none; + z-index: 1; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 10rem; + border-radius: 0 0 3px 3px; +} + +.nav-tabs .nav-submenu .nav-item { + display: block; + padding: .5rem 1rem; + color: #9aa0ac; + margin: 0 !important; + cursor: pointer; + transition: .3s background; +} + +.nav-tabs .nav-submenu .nav-item.active { + color: #467fcf; +} + +.nav-tabs .nav-submenu .nav-item:hover { + color: #6e7687; + text-decoration: none; + background: rgba(0, 0, 0, 0.024); +} + +.nav-link { + display: block; + padding: 0.25rem 0.75rem; +} + +.btn { + cursor: pointer; + font-weight: 600; + letter-spacing: .03em; + font-size: 0.8125rem; + min-width: 2.375rem; +} + +.btn i { + font-size: 1rem; + vertical-align: -2px; +} + +.btn-icon { + padding-left: .5rem; + padding-right: .5rem; + text-align: center; +} + +.btn-secondary { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); + box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.05); +} + +.btn-secondary:hover { + color: #495057; + background-color: #f6f6f6; + border-color: rgba(0, 20, 49, 0.12); +} + +.btn-secondary:focus, .btn-secondary.focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-secondary.disabled, .btn-secondary:disabled { + color: #495057; + background-color: #fff; + border-color: rgba(0, 40, 100, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, +.show > .btn-secondary.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: rgba(0, 15, 36, 0.12); +} + +.btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, +.show > .btn-secondary.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 40, 100, 0.5); +} + +.btn-pill { + border-radius: 10rem; + padding-left: 1.5em; + padding-right: 1.5em; +} + +.btn-square { + border-radius: 0; +} + +.btn-facebook { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:hover { + color: #fff; + background-color: #30497c; + border-color: #2d4373; +} + +.btn-facebook:focus, .btn-facebook.focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-facebook.disabled, .btn-facebook:disabled { + color: #fff; + background-color: #3b5998; + border-color: #3b5998; +} + +.btn-facebook:not(:disabled):not(.disabled):active, .btn-facebook:not(:disabled):not(.disabled).active, +.show > .btn-facebook.dropdown-toggle { + color: #fff; + background-color: #2d4373; + border-color: #293e6a; +} + +.btn-facebook:not(:disabled):not(.disabled):active:focus, .btn-facebook:not(:disabled):not(.disabled).active:focus, +.show > .btn-facebook.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(59, 89, 152, 0.5); +} + +.btn-twitter { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:hover { + color: #fff; + background-color: #0d8ddc; + border-color: #0c85d0; +} + +.btn-twitter:focus, .btn-twitter.focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-twitter.disabled, .btn-twitter:disabled { + color: #fff; + background-color: #1da1f2; + border-color: #1da1f2; +} + +.btn-twitter:not(:disabled):not(.disabled):active, .btn-twitter:not(:disabled):not(.disabled).active, +.show > .btn-twitter.dropdown-toggle { + color: #fff; + background-color: #0c85d0; + border-color: #0b7ec4; +} + +.btn-twitter:not(:disabled):not(.disabled):active:focus, .btn-twitter:not(:disabled):not(.disabled).active:focus, +.show > .btn-twitter.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(29, 161, 242, 0.5); +} + +.btn-google { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:hover { + color: #fff; + background-color: #d03526; + border-color: #c63224; +} + +.btn-google:focus, .btn-google.focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-google.disabled, .btn-google:disabled { + color: #fff; + background-color: #dc4e41; + border-color: #dc4e41; +} + +.btn-google:not(:disabled):not(.disabled):active, .btn-google:not(:disabled):not(.disabled).active, +.show > .btn-google.dropdown-toggle { + color: #fff; + background-color: #c63224; + border-color: #bb2f22; +} + +.btn-google:not(:disabled):not(.disabled):active:focus, .btn-google:not(:disabled):not(.disabled).active:focus, +.show > .btn-google.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(220, 78, 65, 0.5); +} + +.btn-youtube { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:hover { + color: #fff; + background-color: #d90000; + border-color: #cc0000; +} + +.btn-youtube:focus, .btn-youtube.focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-youtube.disabled, .btn-youtube:disabled { + color: #fff; + background-color: #f00; + border-color: #f00; +} + +.btn-youtube:not(:disabled):not(.disabled):active, .btn-youtube:not(:disabled):not(.disabled).active, +.show > .btn-youtube.dropdown-toggle { + color: #fff; + background-color: #cc0000; + border-color: #bf0000; +} + +.btn-youtube:not(:disabled):not(.disabled):active:focus, .btn-youtube:not(:disabled):not(.disabled).active:focus, +.show > .btn-youtube.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 0, 0, 0.5); +} + +.btn-vimeo { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:hover { + color: #fff; + background-color: #139ecb; + border-color: #1295bf; +} + +.btn-vimeo:focus, .btn-vimeo.focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-vimeo.disabled, .btn-vimeo:disabled { + color: #fff; + background-color: #1ab7ea; + border-color: #1ab7ea; +} + +.btn-vimeo:not(:disabled):not(.disabled):active, .btn-vimeo:not(:disabled):not(.disabled).active, +.show > .btn-vimeo.dropdown-toggle { + color: #fff; + background-color: #1295bf; + border-color: #108cb4; +} + +.btn-vimeo:not(:disabled):not(.disabled):active:focus, .btn-vimeo:not(:disabled):not(.disabled).active:focus, +.show > .btn-vimeo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(26, 183, 234, 0.5); +} + +.btn-dribbble { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:hover { + color: #fff; + background-color: #e62a72; + border-color: #e51e6b; +} + +.btn-dribbble:focus, .btn-dribbble.focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-dribbble.disabled, .btn-dribbble:disabled { + color: #fff; + background-color: #ea4c89; + border-color: #ea4c89; +} + +.btn-dribbble:not(:disabled):not(.disabled):active, .btn-dribbble:not(:disabled):not(.disabled).active, +.show > .btn-dribbble.dropdown-toggle { + color: #fff; + background-color: #e51e6b; + border-color: #dc1a65; +} + +.btn-dribbble:not(:disabled):not(.disabled):active:focus, .btn-dribbble:not(:disabled):not(.disabled).active:focus, +.show > .btn-dribbble.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(234, 76, 137, 0.5); +} + +.btn-github { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:hover { + color: #fff; + background-color: #040404; + border-color: black; +} + +.btn-github:focus, .btn-github.focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-github.disabled, .btn-github:disabled { + color: #fff; + background-color: #181717; + border-color: #181717; +} + +.btn-github:not(:disabled):not(.disabled):active, .btn-github:not(:disabled):not(.disabled).active, +.show > .btn-github.dropdown-toggle { + color: #fff; + background-color: black; + border-color: black; +} + +.btn-github:not(:disabled):not(.disabled):active:focus, .btn-github:not(:disabled):not(.disabled).active:focus, +.show > .btn-github.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(24, 23, 23, 0.5); +} + +.btn-instagram { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:hover { + color: #fff; + background-color: #de1f44; + border-color: #d31e40; +} + +.btn-instagram:focus, .btn-instagram.focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-instagram.disabled, .btn-instagram:disabled { + color: #fff; + background-color: #e4405f; + border-color: #e4405f; +} + +.btn-instagram:not(:disabled):not(.disabled):active, .btn-instagram:not(:disabled):not(.disabled).active, +.show > .btn-instagram.dropdown-toggle { + color: #fff; + background-color: #d31e40; + border-color: #c81c3d; +} + +.btn-instagram:not(:disabled):not(.disabled):active:focus, .btn-instagram:not(:disabled):not(.disabled).active:focus, +.show > .btn-instagram.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(228, 64, 95, 0.5); +} + +.btn-pinterest { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:hover { + color: #fff; + background-color: #980617; + border-color: #8c0615; +} + +.btn-pinterest:focus, .btn-pinterest.focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-pinterest.disabled, .btn-pinterest:disabled { + color: #fff; + background-color: #bd081c; + border-color: #bd081c; +} + +.btn-pinterest:not(:disabled):not(.disabled):active, .btn-pinterest:not(:disabled):not(.disabled).active, +.show > .btn-pinterest.dropdown-toggle { + color: #fff; + background-color: #8c0615; + border-color: #800513; +} + +.btn-pinterest:not(:disabled):not(.disabled):active:focus, .btn-pinterest:not(:disabled):not(.disabled).active:focus, +.show > .btn-pinterest.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(189, 8, 28, 0.5); +} + +.btn-vk { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:hover { + color: #fff; + background-color: #527093; + border-color: #4d6a8b; +} + +.btn-vk:focus, .btn-vk.focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-vk.disabled, .btn-vk:disabled { + color: #fff; + background-color: #6383a8; + border-color: #6383a8; +} + +.btn-vk:not(:disabled):not(.disabled):active, .btn-vk:not(:disabled):not(.disabled).active, +.show > .btn-vk.dropdown-toggle { + color: #fff; + background-color: #4d6a8b; + border-color: #496482; +} + +.btn-vk:not(:disabled):not(.disabled):active:focus, .btn-vk:not(:disabled):not(.disabled).active:focus, +.show > .btn-vk.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(99, 131, 168, 0.5); +} + +.btn-rss { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:hover { + color: #fff; + background-color: #d98c00; + border-color: #cc8400; +} + +.btn-rss:focus, .btn-rss.focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-rss.disabled, .btn-rss:disabled { + color: #fff; + background-color: #ffa500; + border-color: #ffa500; +} + +.btn-rss:not(:disabled):not(.disabled):active, .btn-rss:not(:disabled):not(.disabled).active, +.show > .btn-rss.dropdown-toggle { + color: #fff; + background-color: #cc8400; + border-color: #bf7c00; +} + +.btn-rss:not(:disabled):not(.disabled):active:focus, .btn-rss:not(:disabled):not(.disabled).active:focus, +.show > .btn-rss.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 165, 0, 0.5); +} + +.btn-flickr { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:hover { + color: #fff; + background-color: #0052b6; + border-color: #004ca9; +} + +.btn-flickr:focus, .btn-flickr.focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-flickr.disabled, .btn-flickr:disabled { + color: #fff; + background-color: #0063dc; + border-color: #0063dc; +} + +.btn-flickr:not(:disabled):not(.disabled):active, .btn-flickr:not(:disabled):not(.disabled).active, +.show > .btn-flickr.dropdown-toggle { + color: #fff; + background-color: #004ca9; + border-color: #00469c; +} + +.btn-flickr:not(:disabled):not(.disabled):active:focus, .btn-flickr:not(:disabled):not(.disabled).active:focus, +.show > .btn-flickr.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 99, 220, 0.5); +} + +.btn-bitbucket { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:hover { + color: #fff; + background-color: #0043a6; + border-color: #003e99; +} + +.btn-bitbucket:focus, .btn-bitbucket.focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-bitbucket.disabled, .btn-bitbucket:disabled { + color: #fff; + background-color: #0052cc; + border-color: #0052cc; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active, .btn-bitbucket:not(:disabled):not(.disabled).active, +.show > .btn-bitbucket.dropdown-toggle { + color: #fff; + background-color: #003e99; + border-color: #00388c; +} + +.btn-bitbucket:not(:disabled):not(.disabled):active:focus, .btn-bitbucket:not(:disabled):not(.disabled).active:focus, +.show > .btn-bitbucket.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(0, 82, 204, 0.5); +} + +.btn-blue { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:hover { + color: #fff; + background-color: #316cbe; + border-color: #2f66b3; +} + +.btn-blue:focus, .btn-blue.focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-blue.disabled, .btn-blue:disabled { + color: #fff; + background-color: #467fcf; + border-color: #467fcf; +} + +.btn-blue:not(:disabled):not(.disabled):active, .btn-blue:not(:disabled):not(.disabled).active, +.show > .btn-blue.dropdown-toggle { + color: #fff; + background-color: #2f66b3; + border-color: #2c60a9; +} + +.btn-blue:not(:disabled):not(.disabled):active:focus, .btn-blue:not(:disabled):not(.disabled).active:focus, +.show > .btn-blue.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.5); +} + +.btn-indigo { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:hover { + color: #fff; + background-color: #485ac4; + border-color: #3f51c1; +} + +.btn-indigo:focus, .btn-indigo.focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-indigo.disabled, .btn-indigo:disabled { + color: #fff; + background-color: #6574cd; + border-color: #6574cd; +} + +.btn-indigo:not(:disabled):not(.disabled):active, .btn-indigo:not(:disabled):not(.disabled).active, +.show > .btn-indigo.dropdown-toggle { + color: #fff; + background-color: #3f51c1; + border-color: #3b4db7; +} + +.btn-indigo:not(:disabled):not(.disabled):active:focus, .btn-indigo:not(:disabled):not(.disabled).active:focus, +.show > .btn-indigo.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(101, 116, 205, 0.5); +} + +.btn-purple { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:hover { + color: #fff; + background-color: #923ce6; + border-color: #8c31e4; +} + +.btn-purple:focus, .btn-purple.focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-purple.disabled, .btn-purple:disabled { + color: #fff; + background-color: #a55eea; + border-color: #a55eea; +} + +.btn-purple:not(:disabled):not(.disabled):active, .btn-purple:not(:disabled):not(.disabled).active, +.show > .btn-purple.dropdown-toggle { + color: #fff; + background-color: #8c31e4; + border-color: #8526e3; +} + +.btn-purple:not(:disabled):not(.disabled):active:focus, .btn-purple:not(:disabled):not(.disabled).active:focus, +.show > .btn-purple.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(165, 94, 234, 0.5); +} + +.btn-pink { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:hover { + color: #fff; + background-color: #f44982; + border-color: #f33d7a; +} + +.btn-pink:focus, .btn-pink.focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-pink.disabled, .btn-pink:disabled { + color: #fff; + background-color: #f66d9b; + border-color: #f66d9b; +} + +.btn-pink:not(:disabled):not(.disabled):active, .btn-pink:not(:disabled):not(.disabled).active, +.show > .btn-pink.dropdown-toggle { + color: #fff; + background-color: #f33d7a; + border-color: #f23172; +} + +.btn-pink:not(:disabled):not(.disabled):active:focus, .btn-pink:not(:disabled):not(.disabled).active:focus, +.show > .btn-pink.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(246, 109, 155, 0.5); +} + +.btn-red { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:hover { + color: #fff; + background-color: #ac1b1a; + border-color: #a11918; +} + +.btn-red:focus, .btn-red.focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-red.disabled, .btn-red:disabled { + color: #fff; + background-color: #cd201f; + border-color: #cd201f; +} + +.btn-red:not(:disabled):not(.disabled):active, .btn-red:not(:disabled):not(.disabled).active, +.show > .btn-red.dropdown-toggle { + color: #fff; + background-color: #a11918; + border-color: #961717; +} + +.btn-red:not(:disabled):not(.disabled):active:focus, .btn-red:not(:disabled):not(.disabled).active:focus, +.show > .btn-red.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(205, 32, 31, 0.5); +} + +.btn-orange { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:hover { + color: #fff; + background-color: #fd811e; + border-color: #fc7a12; +} + +.btn-orange:focus, .btn-orange.focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-orange.disabled, .btn-orange:disabled { + color: #fff; + background-color: #fd9644; + border-color: #fd9644; +} + +.btn-orange:not(:disabled):not(.disabled):active, .btn-orange:not(:disabled):not(.disabled).active, +.show > .btn-orange.dropdown-toggle { + color: #fff; + background-color: #fc7a12; + border-color: #fc7305; +} + +.btn-orange:not(:disabled):not(.disabled):active:focus, .btn-orange:not(:disabled):not(.disabled).active:focus, +.show > .btn-orange.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(253, 150, 68, 0.5); +} + +.btn-yellow { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:hover { + color: #fff; + background-color: #cea70c; + border-color: #c29d0b; +} + +.btn-yellow:focus, .btn-yellow.focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-yellow.disabled, .btn-yellow:disabled { + color: #fff; + background-color: #f1c40f; + border-color: #f1c40f; +} + +.btn-yellow:not(:disabled):not(.disabled):active, .btn-yellow:not(:disabled):not(.disabled).active, +.show > .btn-yellow.dropdown-toggle { + color: #fff; + background-color: #c29d0b; + border-color: #b6940b; +} + +.btn-yellow:not(:disabled):not(.disabled):active:focus, .btn-yellow:not(:disabled):not(.disabled).active:focus, +.show > .btn-yellow.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(241, 196, 15, 0.5); +} + +.btn-green { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:hover { + color: #fff; + background-color: #4b9400; + border-color: #448700; +} + +.btn-green:focus, .btn-green.focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-green.disabled, .btn-green:disabled { + color: #fff; + background-color: #5eba00; + border-color: #5eba00; +} + +.btn-green:not(:disabled):not(.disabled):active, .btn-green:not(:disabled):not(.disabled).active, +.show > .btn-green.dropdown-toggle { + color: #fff; + background-color: #448700; + border-color: #3e7a00; +} + +.btn-green:not(:disabled):not(.disabled):active:focus, .btn-green:not(:disabled):not(.disabled).active:focus, +.show > .btn-green.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(94, 186, 0, 0.5); +} + +.btn-teal { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:hover { + color: #fff; + background-color: #24ab9d; + border-color: #22a193; +} + +.btn-teal:focus, .btn-teal.focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-teal.disabled, .btn-teal:disabled { + color: #fff; + background-color: #2bcbba; + border-color: #2bcbba; +} + +.btn-teal:not(:disabled):not(.disabled):active, .btn-teal:not(:disabled):not(.disabled).active, +.show > .btn-teal.dropdown-toggle { + color: #fff; + background-color: #22a193; + border-color: #20968a; +} + +.btn-teal:not(:disabled):not(.disabled):active:focus, .btn-teal:not(:disabled):not(.disabled).active:focus, +.show > .btn-teal.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(43, 203, 186, 0.5); +} + +.btn-cyan { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:hover { + color: #fff; + background-color: #138496; + border-color: #117a8b; +} + +.btn-cyan:focus, .btn-cyan.focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-cyan.disabled, .btn-cyan:disabled { + color: #fff; + background-color: #17a2b8; + border-color: #17a2b8; +} + +.btn-cyan:not(:disabled):not(.disabled):active, .btn-cyan:not(:disabled):not(.disabled).active, +.show > .btn-cyan.dropdown-toggle { + color: #fff; + background-color: #117a8b; + border-color: #10707f; +} + +.btn-cyan:not(:disabled):not(.disabled):active:focus, .btn-cyan:not(:disabled):not(.disabled).active:focus, +.show > .btn-cyan.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(23, 162, 184, 0.5); +} + +.btn-white { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:hover { + color: #495057; + background-color: #ececec; + border-color: #e6e5e5; +} + +.btn-white:focus, .btn-white.focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-white.disabled, .btn-white:disabled { + color: #495057; + background-color: #fff; + border-color: #fff; +} + +.btn-white:not(:disabled):not(.disabled):active, .btn-white:not(:disabled):not(.disabled).active, +.show > .btn-white.dropdown-toggle { + color: #495057; + background-color: #e6e5e5; + border-color: #dfdfdf; +} + +.btn-white:not(:disabled):not(.disabled):active:focus, .btn-white:not(:disabled):not(.disabled).active:focus, +.show > .btn-white.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(255, 255, 255, 0.5); +} + +.btn-gray { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:hover { + color: #fff; + background-color: #727b84; + border-color: #6c757d; +} + +.btn-gray:focus, .btn-gray.focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray.disabled, .btn-gray:disabled { + color: #fff; + background-color: #868e96; + border-color: #868e96; +} + +.btn-gray:not(:disabled):not(.disabled):active, .btn-gray:not(:disabled):not(.disabled).active, +.show > .btn-gray.dropdown-toggle { + color: #fff; + background-color: #6c757d; + border-color: #666e76; +} + +.btn-gray:not(:disabled):not(.disabled):active:focus, .btn-gray:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(134, 142, 150, 0.5); +} + +.btn-gray-dark { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:hover { + color: #fff; + background-color: #23272b; + border-color: #1d2124; +} + +.btn-gray-dark:focus, .btn-gray-dark.focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-gray-dark.disabled, .btn-gray-dark:disabled { + color: #fff; + background-color: #343a40; + border-color: #343a40; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active, .btn-gray-dark:not(:disabled):not(.disabled).active, +.show > .btn-gray-dark.dropdown-toggle { + color: #fff; + background-color: #1d2124; + border-color: #171a1d; +} + +.btn-gray-dark:not(:disabled):not(.disabled):active:focus, .btn-gray-dark:not(:disabled):not(.disabled).active:focus, +.show > .btn-gray-dark.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(52, 58, 64, 0.5); +} + +.btn-azure { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:hover { + color: #fff; + background-color: #219af0; + border-color: #1594ef; +} + +.btn-azure:focus, .btn-azure.focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-azure.disabled, .btn-azure:disabled { + color: #fff; + background-color: #45aaf2; + border-color: #45aaf2; +} + +.btn-azure:not(:disabled):not(.disabled):active, .btn-azure:not(:disabled):not(.disabled).active, +.show > .btn-azure.dropdown-toggle { + color: #fff; + background-color: #1594ef; + border-color: #108ee7; +} + +.btn-azure:not(:disabled):not(.disabled):active:focus, .btn-azure:not(:disabled):not(.disabled).active:focus, +.show > .btn-azure.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(69, 170, 242, 0.5); +} + +.btn-lime { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:hover { + color: #fff; + background-color: #69b829; + border-color: #63ad27; +} + +.btn-lime:focus, .btn-lime.focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-lime.disabled, .btn-lime:disabled { + color: #fff; + background-color: #7bd235; + border-color: #7bd235; +} + +.btn-lime:not(:disabled):not(.disabled):active, .btn-lime:not(:disabled):not(.disabled).active, +.show > .btn-lime.dropdown-toggle { + color: #fff; + background-color: #63ad27; + border-color: #5da324; +} + +.btn-lime:not(:disabled):not(.disabled):active:focus, .btn-lime:not(:disabled):not(.disabled).active:focus, +.show > .btn-lime.dropdown-toggle:focus { + box-shadow: 0 0 0 2px rgba(123, 210, 53, 0.5); +} + +.btn-option { + background: transparent; + color: #9aa0ac; +} + +.btn-option:hover { + color: #6e7687; +} + +.btn-option:focus { + box-shadow: none; + color: #6e7687; +} + +.btn-sm, .btn-group-sm > .btn { + font-size: 0.75rem; + min-width: 1.625rem; +} + +.btn-lg, .btn-group-lg > .btn { + font-size: 1rem; + min-width: 2.75rem; + font-weight: 400; +} + +.btn-list { + margin-bottom: -.5rem; + font-size: 0; +} + +.btn-list > .btn, +.btn-list > .dropdown { + margin-bottom: .5rem; +} + +.btn-list > .btn:not(:last-child), +.btn-list > .dropdown:not(:last-child) { + margin-right: .5rem; +} + +.btn-loading { + color: transparent !important; + pointer-events: none; + position: relative; +} + +.btn-loading:after { + content: ''; + -webkit-animation: loader 500ms infinite linear; + animation: loader 500ms infinite linear; + border: 2px solid #fff; + border-radius: 50%; + border-right-color: transparent !important; + border-top-color: transparent !important; + display: block; + height: 1.4em; + width: 1.4em; + position: absolute; + left: calc(50% - (1.4em / 2)); + top: calc(50% - (1.4em / 2)); + -webkit-transform-origin: center; + transform-origin: center; + position: absolute !important; +} + +.btn-loading.btn-sm:after, .btn-group-sm > .btn-loading.btn:after { + height: 1em; + width: 1em; + left: calc(50% - (1em / 2)); + top: calc(50% - (1em / 2)); +} + +.btn-loading.btn-secondary:after { + border-color: #495057; +} + +.alert { + font-size: 0.9375rem; +} + +.alert-icon { + padding-left: 3rem; +} + +.alert-icon > i { + color: inherit !important; + font-size: 1rem; + position: absolute; + top: 1rem; + left: 1rem; +} + +.alert-avatar { + padding-left: 3.75rem; +} + +.alert-avatar .avatar { + position: absolute; + top: .5rem; + left: .75rem; +} + +.close { + font-size: 1rem; + line-height: 1.5; + transition: .3s color; +} + +.close:before { + content: '\ea00'; + font-family: "feather"; +} + +.badge { + color: #fff; +} + +.badge-default { + background: #e9ecef; + color: #868e96; +} + +.table thead th, .text-wrap table thead th { + border-top: 0; + border-bottom-width: 1px; + padding-top: .5rem; + padding-bottom: .5rem; +} + +.table th, .text-wrap table th { + color: #9aa0ac; + text-transform: uppercase; + font-size: 0.875rem; + font-weight: 400; +} + +.table-md th, +.table-md td { + padding: .5rem; +} + +.table-vcenter td, +.table-vcenter th { + vertical-align: middle; +} + +.table-center td, +.table-center th { + text-align: center; +} + +.table-striped tbody tr:nth-of-type(odd) { + background: transparent; +} + +.table-striped tbody tr:nth-of-type(even) { + background-color: rgba(0, 0, 0, 0.02); +} + +.table-calendar { + margin: 0 0 .75rem; +} + +.table-calendar td, +.table-calendar th { + border: 0; + text-align: center; + padding: 0 !important; + width: 14.28571429%; + line-height: 2.5rem; +} + +.table-calendar td { + border-top: 0; +} + +.table-calendar-link { + line-height: 2rem; + min-width: calc(2rem + 2px); + display: inline-block; + border-radius: 3px; + background: #f8f9fa; + color: #495057; + font-weight: 600; + transition: .3s background, .3s color; + position: relative; +} + +.table-calendar-link:before { + content: ''; + width: 4px; + height: 4px; + position: absolute; + left: .25rem; + top: .25rem; + border-radius: 50px; + background: #467fcf; +} + +.table-calendar-link:hover { + color: #fff; + text-decoration: none; + background: #467fcf; + transition: .3s background; +} + +.table-calendar-link:hover:before { + background: #fff; +} + +.table-header { + cursor: pointer; + transition: .3s color; +} + +.table-header:hover { + color: #495057 !important; +} + +.table-header:after { + content: '\f0dc'; + font-family: FontAwesome; + display: inline-block; + margin-left: .5rem; + font-size: .75rem; +} + +.table-header-asc { + color: #495057 !important; +} + +.table-header-asc:after { + content: '\f0de'; +} + +.table-header-desc { + color: #495057 !important; +} + +.table-header-desc:after { + content: '\f0dd'; +} + +.page-breadcrumb { + background: none; + padding: 0; + margin: 1rem 0 0; + font-size: 0.875rem; +} + +@media (min-width: 768px) { + .page-breadcrumb { + margin: -.5rem 0 0; + } +} + +.page-breadcrumb .breadcrumb-item { + color: #9aa0ac; +} + +.page-breadcrumb .breadcrumb-item.active { + color: #6e7687; +} + +.card { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + position: relative; + margin-bottom: 1.5rem; + width: 100%; +} + +.card .card { + box-shadow: none; +} + +@media print { + .card { + box-shadow: none; + border: none; + } +} + +.card-body { + -ms-flex: 1; + flex: 1; + margin: 0; + padding: 1.5rem 1.5rem; + position: relative; +} + +.card-body + .card-body { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-body > :last-child { + margin-bottom: 0; +} + +@media print { + .card-body { + padding: 0; + } +} + +.card-body-scrollable { + overflow: auto; +} + +.card-footer, +.card-bottom { + padding: 1rem 1.5rem; + background: none; +} + +.card-footer { + border-top: 1px solid rgba(0, 40, 100, 0.12); + color: #6e7687; +} + +.card-header { + background: none; + padding: 0.5rem 1.5rem; + display: -ms-flexbox; + display: flex; + min-height: 3.5rem; + -ms-flex-align: center; + align-items: center; +} + +.card-header .card-title { + margin-bottom: 0; +} + +.card-header.border-0 + .card-body { + padding-top: 0; +} + +@media print { + .card-header { + display: none; + } +} + +.card-img-top { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.card-img-overlay { + background-color: rgba(0, 0, 0, 0.4); + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.card-title { + font-size: 1.125rem; + line-height: 1.2; + font-weight: 400; + margin-bottom: 1.5rem; +} + +.card-title a { + color: inherit; +} + +.card-title:only-child { + margin-bottom: 0; +} + +.card-title small, +.card-subtitle { + color: #9aa0ac; + font-size: 0.875rem; + display: block; + margin: -.75rem 0 1rem; + line-height: 1.1; + font-weight: 400; +} + +.card-table { + margin-bottom: 0; +} + +.card-table tr:first-child td, +.card-table tr:first-child th { + border-top: 0; +} + +.card-table tr td:first-child, +.card-table tr th:first-child { + padding-left: 1.5rem; +} + +.card-table tr td:last-child, +.card-table tr th:last-child { + padding-right: 1.5rem; +} + +.card-body + .card-table { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-profile .card-header { + height: 9rem; + background-size: cover; +} + +.card-profile-img { + max-width: 6rem; + margin-top: -5rem; + margin-bottom: 1rem; + border: 3px solid #fff; + border-radius: 100%; + box-shadow: 0 1px 1px rgba(0, 0, 0, 0.1); +} + +.card-link + .card-link { + margin-left: 1rem; +} + +.card-body + .card-list-group { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-list-group .list-group-item { + border-right: 0; + border-left: 0; + border-radius: 0; + padding-left: 1.5rem; + padding-right: 1.5rem; +} + +.card-list-group .list-group-item:last-child { + border-bottom: 0; +} + +.card-list-group .list-group-item:first-child { + border-top: 0; +} + +.card-header-tabs { + margin: -1.25rem 0; + border-bottom: 0; + line-height: 2rem; +} + +.card-header-tabs .nav-item { + margin-bottom: 1px; +} + +.card-header-pills { + margin: -.75rem 0; +} + +.card-aside { + -ms-flex-direction: row; + flex-direction: row; +} + +.card-aside-column { + min-width: 5rem; + width: 30%; + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; + background: no-repeat center/cover; +} + +.card-value { + font-size: 2.5rem; + line-height: 3.4rem; + height: 3.4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + font-weight: 400; +} + +.card-value i { + vertical-align: middle; +} + +.card-chart-bg { + height: 4rem; + margin-top: -1rem; + position: relative; + z-index: 1; +} + +.card-options { + margin-left: auto; + display: -ms-flexbox; + display: flex; + -ms-flex-order: 100; + order: 100; + margin-right: -.5rem; + color: #9aa0ac; + -ms-flex-item-align: center; + align-self: center; +} + +.card-options a { + margin-left: .5rem; + color: #9aa0ac; + display: inline-block; + min-width: 1rem; +} + +.card-options a:hover { + text-decoration: none; + color: #6e7687; +} + +.card-options a i { + font-size: 1rem; + vertical-align: middle; +} + +.card-options .dropdown-toggle:after { + display: none; +} + +/* +Card options + */ +.card-collapsed > :not(.card-header):not(.card-status) { + display: none; +} + +.card-collapsed .card-options-collapse i:before { + content: '\e92d'; +} + +.card-fullscreen .card-options-fullscreen i:before { + content: '\e992'; +} + +.card-fullscreen .card-options-remove { + display: none; +} + +/* +Card maps + */ +.card-map { + height: 15rem; + background: #e9ecef; +} + +.card-map-placeholder { + background: url(../images/staticmap.png) no-repeat center; +} + +/** +Card tabs + */ +.card-tabs { + display: -ms-flexbox; + display: flex; +} + +.card-tabs-bottom .card-tabs-item { + border: 0; + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.card-tabs-bottom .card-tabs-item.active { + border-top-color: #fff; +} + +.card-tabs-item { + -ms-flex: 1; + flex: 1; + display: block; + padding: 1rem 1.5rem; + border-bottom: 1px solid rgba(0, 40, 100, 0.12); + color: inherit; + overflow: hidden; +} + +a.card-tabs-item { + background: #fafbfc; +} + +a.card-tabs-item:hover { + text-decoration: none; + color: inherit; +} + +a.card-tabs-item:focus { + z-index: 1; +} + +a.card-tabs-item.active { + background: #fff; + border-bottom-color: #fff; +} + +.card-tabs-item + .card-tabs-item { + border-left: 1px solid rgba(0, 40, 100, 0.12); +} + +/** +Card status + */ +.card-status { + position: absolute; + top: -1px; + left: -1px; + right: -1px; + height: 3px; + border-radius: 3px 3px 0 0; + background: rgba(0, 40, 100, 0.12); +} + +.card-status-left { + right: auto; + bottom: 0; + height: auto; + width: 3px; + border-radius: 3px 0 0 3px; +} + +/** +Card icon + */ +.card-icon { + width: 3rem; + font-size: 2.5rem; + line-height: 3rem; + text-align: center; +} + +/** +Card fullscreen + */ +.card-fullscreen { + position: fixed; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: 1; + margin: 0; +} + +/** +Card alert + */ +.card-alert { + border-radius: 0; + margin: -1px -1px 0; +} + +.popover { + -webkit-filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); + filter: drop-shadow(0 1px 3px rgba(0, 0, 0, 0.1)); +} + +.popover.bs-popover-top, .popover.bs-popover-auto[x-placement^="top"] { + margin-bottom: 0.625rem; +} + +.popover .arrow { + margin-left: calc(.25rem + 2px); +} + +.dropdown { + display: inline-block; +} + +.dropdown-menu { + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); + min-width: 12rem; + max-width: 100%; +} + +.dropdown-toggle { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; +} + +.dropdown-toggle:after { + vertical-align: 0.155em; +} + +.dropdown-toggle:empty:after { + margin-left: 0; +} + +.dropdown-icon { + color: #6e7687; + margin-right: .5rem; + margin-left: -.5rem; + width: 1em; + display: inline-block; + text-align: center; + vertical-align: -1px; +} + +.list-inline-dots .list-inline-item + .list-inline-item:before { + content: '· '; + margin-left: -2px; + margin-right: 3px; +} + +.list-separated-item { + padding: 1rem 0; +} + +.list-separated-item:first-child { + padding-top: 0; +} + +.list-separated-item:last-child { + padding-bottom: 0; +} + +.list-separated-item + .list-separated-item { + border-top: 1px solid rgba(0, 40, 100, 0.12); +} + +.list-group-item.active .icon { + color: inherit !important; +} + +.list-group-transparent .list-group-item { + background: none; + border: 0; + padding: .5rem 1rem; + border-radius: 3px; +} + +.list-group-transparent .list-group-item.active { + background: rgba(70, 127, 207, 0.06); + font-weight: 600; +} + +.avatar { + width: 2rem; + height: 2rem; + line-height: 2rem; + border-radius: 50%; + display: inline-block; + background: #ced4da no-repeat center/cover; + position: relative; + text-align: center; + color: #868e96; + font-weight: 600; + vertical-align: bottom; + font-size: .875rem; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.avatar i { + font-size: 125%; + vertical-align: sub; +} + +.avatar-status { + position: absolute; + right: -2px; + bottom: -2px; + width: .75rem; + height: .75rem; + border: 2px solid #fff; + background: #868e96; + border-radius: 50%; +} + +.avatar-sm { + width: 1.5rem; + height: 1.5rem; + line-height: 1.5rem; + font-size: .75rem; +} + +.avatar-md { + width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; + font-size: 1rem; +} + +.avatar-lg { + width: 3rem; + height: 3rem; + line-height: 3rem; + font-size: 1.25rem; +} + +.avatar-xl { + width: 4rem; + height: 4rem; + line-height: 4rem; + font-size: 1.75rem; +} + +.avatar-xxl { + width: 5rem; + height: 5rem; + line-height: 5rem; + font-size: 2rem; +} + +.avatar-placeholder { + background: #ced4da url('data:image/svg+xml;charset=utf8,') no-repeat center/80%; +} + +.avatar-list { + margin: 0 0 -.5rem; + padding: 0; + font-size: 0; +} + +.avatar-list .avatar { + margin-bottom: .5rem; +} + +.avatar-list .avatar:not(:last-child) { + margin-right: .5rem; +} + +.avatar-list-stacked .avatar { + margin-right: -.8em !important; +} + +.avatar-list-stacked .avatar { + box-shadow: 0 0 0 2px #fff; +} + +.avatar-blue { + background-color: #c8d9f1; + color: #467fcf; +} + +.avatar-indigo { + background-color: #d1d5f0; + color: #6574cd; +} + +.avatar-purple { + background-color: #e4cff9; + color: #a55eea; +} + +.avatar-pink { + background-color: #fcd3e1; + color: #f66d9b; +} + +.avatar-red { + background-color: #f0bcbc; + color: #cd201f; +} + +.avatar-orange { + background-color: #fee0c7; + color: #fd9644; +} + +.avatar-yellow { + background-color: #fbedb7; + color: #f1c40f; +} + +.avatar-green { + background-color: #cfeab3; + color: #5eba00; +} + +.avatar-teal { + background-color: #bfefea; + color: #2bcbba; +} + +.avatar-cyan { + background-color: #b9e3ea; + color: #17a2b8; +} + +.avatar-white { + background-color: white; + color: #fff; +} + +.avatar-gray { + background-color: #dbdde0; + color: #868e96; +} + +.avatar-gray-dark { + background-color: #c2c4c6; + color: #343a40; +} + +.avatar-azure { + background-color: #c7e6fb; + color: #45aaf2; +} + +.avatar-lime { + background-color: #d7f2c2; + color: #7bd235; +} + +.product-price { + font-size: 1rem; +} + +.product-price strong { + font-size: 1.5rem; +} + +@-webkit-keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate { + 0% { + left: -35%; + right: 100%; + } + 100%, 60% { + left: 100%; + right: -90%; + } +} + +@-webkit-keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 100%, 60% { + left: 107%; + right: -8%; + } +} + +.progress { + position: relative; +} + +.progress-xs, +.progress-xs .progress-bar { + height: .25rem; +} + +.progress-sm, +.progress-sm .progress-bar { + height: .5rem; +} + +.progress-bar-indeterminate:after, .progress-bar-indeterminate:before { + content: ''; + position: absolute; + background-color: inherit; + left: 0; + will-change: left, right; + top: 0; + bottom: 0; +} + +.progress-bar-indeterminate:before { + -webkit-animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; + animation: indeterminate 2.1s cubic-bezier(0.65, 0.815, 0.735, 0.395) infinite; +} + +.progress-bar-indeterminate:after { + -webkit-animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.84, 0.44, 1) infinite; + -webkit-animation-delay: 1.15s; + animation-delay: 1.15s; +} + +@-webkit-keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +@keyframes loader { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + to { + -webkit-transform: rotate(360deg); + transform: rotate(360deg); + } +} + +/** +Dimmer +*/ +.dimmer { + position: relative; +} + +.dimmer .loader { + display: none; + margin: 0 auto; + position: absolute; + top: 50%; + left: 0; + right: 0; + -webkit-transform: translateY(-50%); + transform: translateY(-50%); +} + +.dimmer.active .loader { + display: block; +} + +.dimmer.active .dimmer-content { + opacity: .04; + pointer-events: none; +} + +/** +Loader +*/ +.loader { + display: block; + position: relative; + height: 2.5rem; + width: 2.5rem; + color: #467fcf; +} + +.loader:before, .loader:after { + width: 2.5rem; + height: 2.5rem; + margin: -1.25rem 0 0 -1.25rem; + position: absolute; + content: ''; + top: 50%; + left: 50%; +} + +.loader:before { + border-radius: 50%; + border: 3px solid currentColor; + opacity: .15; +} + +.loader:after { + -webkit-animation: loader .6s linear; + animation: loader .6s linear; + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; + border-radius: 50%; + border: 3px solid; + border-color: transparent; + border-top-color: currentColor; + box-shadow: 0 0 0 1px transparent; +} + +.icons-list { + list-style: none; + margin: 0 -1px -1px 0; + padding: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-wrap: wrap; + flex-wrap: wrap; +} + +.icons-list > li { + -ms-flex: 1 0 4rem; + flex: 1 0 4rem; +} + +.icons-list-wrap { + overflow: hidden; +} + +.icons-list-item { + text-align: center; + height: 4rem; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + border-right: 1px solid rgba(0, 40, 100, 0.12); + border-bottom: 1px solid rgba(0, 40, 100, 0.12); +} + +.icons-list-item i { + font-size: 1.25rem; +} + +.img-gallery { + margin-right: -.25rem; + margin-left: -.25rem; + margin-bottom: -.5rem; +} + +.img-gallery > .col, +.img-gallery > [class*="col-"] { + padding-left: .25rem; + padding-right: .25rem; + padding-bottom: .5rem; +} + +.link-overlay { + position: relative; +} + +.link-overlay:hover .link-overlay-bg { + opacity: 1; +} + +.link-overlay-bg { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + background: rgba(70, 127, 207, 0.8); + display: -ms-flexbox; + display: flex; + color: #fff; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + font-size: 1.25rem; + opacity: 0; + transition: .3s opacity; +} + +.media-icon { + width: 2rem; + height: 2rem; + line-height: 2rem; + text-align: center; + border-radius: 100%; +} + +.media-list { + margin: 0; + padding: 0; + list-style: none; +} + +textarea[cols] { + height: auto; +} + +.form-group { + display: block; +} + +.form-label { + display: block; + margin-bottom: .375rem; + font-weight: 600; + font-size: 0.875rem; +} + +.form-label-small { + float: right; + font-weight: 400; + font-size: 87.5%; +} + +.form-footer { + margin-top: 2rem; +} + +.custom-control { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + margin: 0; +} + +.custom-controls-stacked .custom-control { + margin-bottom: .25rem; +} + +.custom-control-label { + vertical-align: middle; +} + +.custom-control-label:before { + border: 1px solid rgba(0, 40, 100, 0.12); + background-color: #fff; + background-size: .5rem; +} + +.custom-control-description { + line-height: 1.5rem; +} + +.input-group-prepend, +.input-group-append, +.input-group-btn { + font-size: 0.9375rem; +} + +.input-group-prepend > .btn, +.input-group-append > .btn, +.input-group-btn > .btn { + height: 100%; + border-color: rgba(0, 40, 100, 0.12); +} + +.input-group-prepend > .input-group-text { + border-right: 0; +} + +.input-group-append > .input-group-text { + border-left: 0; +} + +/** +Icon input + */ +.input-icon { + position: relative; +} + +.input-icon .form-control:not(:last-child) { + padding-right: 2.5rem; +} + +.input-icon .form-control:not(:first-child) { + padding-left: 2.5rem; +} + +.input-icon-addon { + position: absolute; + top: 0; + bottom: 0; + left: 0; + color: #9aa0ac; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; + min-width: 2.5rem; + pointer-events: none; +} + +.input-icon-addon:last-child { + left: auto; + right: 0; +} + +.form-fieldset { + background: #f8f9fa; + border: 1px solid #e9ecef; + padding: 1rem; + border-radius: 3px; + margin-bottom: 1rem; +} + +.form-required { + color: #cd201f; +} + +.form-required:before { + content: ' '; +} + +.state-valid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.state-invalid { + padding-right: 2rem; + background: url("data:image/svg+xml;charset=utf8,") no-repeat center right 0.5rem/1rem; +} + +.form-help { + display: inline-block; + width: 1rem; + height: 1rem; + text-align: center; + line-height: 1rem; + color: #9aa0ac; + background: #f8f9fa; + border-radius: 50%; + font-size: 0.75rem; + transition: .3s background-color, .3s color; + text-decoration: none; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.form-help:hover, .form-help[aria-describedby] { + background: #467fcf; + color: #fff; +} + +.sparkline { + display: inline-block; + height: 2rem; +} + +.jqstooltip { + box-sizing: content-box; + font-family: inherit !important; + background: #333 !important; + border: none !important; + border-radius: 3px; + font-size: 11px !important; + font-weight: 700 !important; + line-height: 1 !important; + padding: 6px !important; +} + +.jqstooltip .jqsfield { + font: inherit !important; +} + +.social-links li a { + background: #f8f8f8; + border-radius: 50%; + color: #9aa0ac; + display: inline-block; + height: 1.75rem; + width: 1.75rem; + line-height: 1.75rem; + text-align: center; +} + +.map, +.chart { + position: relative; + padding-top: 56.25%; +} + +.map-square, +.chart-square { + padding-top: 100%; +} + +.map-content, +.chart-content { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; +} + +.map-header { + margin-top: -1.5rem; + margin-bottom: 1.5rem; + height: 15rem; + position: relative; + margin-bottom: -1.5rem; +} + +.map-header:before { + content: ''; + position: absolute; + bottom: 0; + left: 0; + right: 0; + height: 10rem; + background: linear-gradient(to bottom, rgba(245, 247, 251, 0) 5%, #f5f7fb 95%); + pointer-events: none; +} + +.map-header-layer { + height: 100%; +} + +.map-static { + height: 120px; + width: 100%; + max-width: 640px; + background-position: center center; + background-size: 640px 120px; +} + +@-webkit-keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +@keyframes status-pulse { + 0%, 100% { + opacity: 1; + } + 50% { + opacity: .32; + } +} + +.status-icon { + content: ''; + width: 0.5rem; + height: 0.5rem; + display: inline-block; + background: currentColor; + border-radius: 50%; + -webkit-transform: translateY(-1px); + transform: translateY(-1px); + margin-right: .375rem; + vertical-align: middle; +} + +.status-animated { + -webkit-animation: 1s status-pulse infinite ease; + animation: 1s status-pulse infinite ease; +} + +.chart-circle { + display: block; + height: 8rem; + width: 8rem; + position: relative; +} + +.chart-circle canvas { + margin: 0 auto; + display: block; + max-width: 100%; + max-height: 100%; +} + +.chart-circle-xs { + height: 2.5rem; + width: 2.5rem; + font-size: .8rem; +} + +.chart-circle-sm { + height: 4rem; + width: 4rem; + font-size: .8rem; +} + +.chart-circle-lg { + height: 10rem; + width: 10rem; + font-size: .8rem; +} + +.chart-circle-value { + position: absolute; + top: 0; + left: 0; + right: 0; + margin-left: auto; + margin-right: auto; + bottom: 0; + display: -ms-flexbox; + display: flex; + -ms-flex-pack: center; + justify-content: center; + -ms-flex-align: center; + align-items: center; + -ms-flex-direction: column; + flex-direction: column; + line-height: 1; +} + +.chart-circle-value small { + display: block; + color: #9aa0ac; + font-size: 0.9375rem; +} + +.chips { + margin: 0 0 -.5rem; +} + +.chips .chip { + margin: 0 .5rem .5rem 0; +} + +.chip { + display: inline-block; + height: 2rem; + line-height: 2rem; + font-size: 0.875rem; + font-weight: 500; + color: #6e7687; + padding: 0 .75rem; + border-radius: 1rem; + background-color: #f8f9fa; + transition: .3s background; +} + +.chip .avatar { + float: left; + margin: 0 .5rem 0 -.75rem; + height: 2rem; + width: 2rem; + border-radius: 50%; +} + +a.chip:hover { + color: inherit; + text-decoration: none; + background-color: #e9ecef; +} + +.stamp { + color: #fff; + background: #868e96; + display: inline-block; + min-width: 2rem; + height: 2rem; + padding: 0 .25rem; + line-height: 2rem; + text-align: center; + border-radius: 3px; + font-weight: 600; +} + +.stamp-md { + min-width: 2.5rem; + height: 2.5rem; + line-height: 2.5rem; +} + +.chat { + outline: 0; + margin: 0; + padding: 0; + list-style-type: none; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; + -ms-flex-pack: end; + justify-content: flex-end; + min-height: 100%; +} + +.chat-line { + padding: 0; + text-align: right; + position: relative; + display: -ms-flexbox; + display: flex; + -ms-flex-direction: row-reverse; + flex-direction: row-reverse; +} + +.chat-line + .chat-line { + padding-top: 1rem; +} + +.chat-message { + position: relative; + display: inline-block; + background-color: #467fcf; + color: #fff; + font-size: 0.875rem; + padding: .375rem .5rem; + border-radius: 3px; + white-space: normal; + text-align: left; + margin: 0 .5rem 0 2.5rem; + line-height: 1.4; +} + +.chat-message > :last-child { + margin-bottom: 0 !important; +} + +.chat-message:after { + content: ""; + position: absolute; + right: -5px; + top: 7px; + border-bottom: 6px solid transparent; + border-left: 6px solid #467fcf; + border-top: 6px solid transparent; +} + +.chat-message img { + max-width: 100%; +} + +.chat-message p { + margin-bottom: 1em; +} + +.chat-line-friend { + -ms-flex-direction: row; + flex-direction: row; +} + +.chat-line-friend + .chat-line-friend { + margin-top: -.5rem; +} + +.chat-line-friend + .chat-line-friend .chat-author { + visibility: hidden; +} + +.chat-line-friend + .chat-line-friend .chat-message:after { + display: none; +} + +.chat-line-friend .chat-message { + background-color: #f3f3f3; + color: #495057; + margin-left: .5rem; + margin-right: 2.5rem; +} + +.chat-line-friend .chat-message:after { + right: auto; + left: -5px; + border-left-width: 0; + border-right: 5px solid #f3f3f3; +} + +.example { + padding: 1.5rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px 3px 0 0; + font-size: 0.9375rem; + overflow: hidden; +} + +.example-bg { + background: #f5f7fb; +} + +.example + .highlight { + border-top: none; + margin-top: 0; + border-radius: 0 0 3px 3px; +} + +.highlight { + margin: 1rem 0 2rem; + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-size: 0.9375rem; + max-height: 40rem; + overflow: auto; + background: #fcfcfc; +} + +.highlight pre { + margin-bottom: 0; + background-color: transparent; +} + +.example-column { + margin: 0 auto; +} + +.example-column > .card:last-of-type { + margin-bottom: 0; +} + +.example-column-1 { + max-width: 20rem; +} + +.example-column-2 { + max-width: 40rem; +} + +.tag { + font-size: 0.75rem; + color: #6e7687; + background-color: #e9ecef; + border-radius: 3px; + padding: 0 .5rem; + line-height: 2em; + display: -ms-inline-flexbox; + display: inline-flex; + cursor: default; + font-weight: 400; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +a.tag { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag:hover { + background-color: rgba(110, 118, 135, 0.2); + color: inherit; +} + +.tag-addon { + display: inline-block; + padding: 0 .5rem; + color: inherit; + text-decoration: none; + background: rgba(0, 0, 0, 0.06); + margin: 0 -.5rem 0 .5rem; + text-align: center; + min-width: 1.5rem; +} + +.tag-addon:last-child { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.tag-addon i { + vertical-align: middle; + margin: 0 -.25rem; +} + +a.tag-addon { + text-decoration: none; + cursor: pointer; + transition: .3s color, .3s background; +} + +a.tag-addon:hover { + background: rgba(0, 0, 0, 0.16); + color: inherit; +} + +.tag-avatar { + width: 1.5rem; + height: 1.5rem; + border-radius: 3px 0 0 3px; + margin: 0 .5rem 0 -.5rem; +} + +.tag-blue { + background-color: #467fcf; + color: #fff; +} + +.tag-indigo { + background-color: #6574cd; + color: #fff; +} + +.tag-purple { + background-color: #a55eea; + color: #fff; +} + +.tag-pink { + background-color: #f66d9b; + color: #fff; +} + +.tag-red { + background-color: #cd201f; + color: #fff; +} + +.tag-orange { + background-color: #fd9644; + color: #fff; +} + +.tag-yellow { + background-color: #f1c40f; + color: #fff; +} + +.tag-green { + background-color: #5eba00; + color: #fff; +} + +.tag-teal { + background-color: #2bcbba; + color: #fff; +} + +.tag-cyan { + background-color: #17a2b8; + color: #fff; +} + +.tag-white { + background-color: #fff; + color: #fff; +} + +.tag-gray { + background-color: #868e96; + color: #fff; +} + +.tag-gray-dark { + background-color: #343a40; + color: #fff; +} + +.tag-azure { + background-color: #45aaf2; + color: #fff; +} + +.tag-lime { + background-color: #7bd235; + color: #fff; +} + +.tag-primary { + background-color: #467fcf; + color: #fff; +} + +.tag-secondary { + background-color: #868e96; + color: #fff; +} + +.tag-success { + background-color: #5eba00; + color: #fff; +} + +.tag-info { + background-color: #45aaf2; + color: #fff; +} + +.tag-warning { + background-color: #f1c40f; + color: #fff; +} + +.tag-danger { + background-color: #cd201f; + color: #fff; +} + +.tag-light { + background-color: #f8f9fa; + color: #fff; +} + +.tag-dark { + background-color: #343a40; + color: #fff; +} + +.tag-rounded { + border-radius: 50px; +} + +.tag-rounded .tag-avatar { + border-radius: 50px; +} + +.tags { + margin-bottom: -.5rem; + font-size: 0; +} + +.tags > .tag { + margin-bottom: .5rem; +} + +.tags > .tag:not(:last-child) { + margin-right: .5rem; +} + +.highlight .hll { + background-color: #ffc; +} + +.highlight .c { + color: #999; +} + +.highlight .k { + color: #069; +} + +.highlight .o { + color: #555; +} + +.highlight .cm { + color: #999; +} + +.highlight .cp { + color: #099; +} + +.highlight .c1 { + color: #999; +} + +.highlight .cs { + color: #999; +} + +.highlight .gd { + background-color: #fcc; + border: 1px solid #c00; +} + +.highlight .ge { + font-style: italic; +} + +.highlight .gr { + color: #f00; +} + +.highlight .gh { + color: #030; +} + +.highlight .gi { + background-color: #cfc; + border: 1px solid #0c0; +} + +.highlight .go { + color: #aaa; +} + +.highlight .gp { + color: #009; +} + +.highlight .gu { + color: #030; +} + +.highlight .gt { + color: #9c6; +} + +.highlight .kc { + color: #069; +} + +.highlight .kd { + color: #069; +} + +.highlight .kn { + color: #069; +} + +.highlight .kp { + color: #069; +} + +.highlight .kr { + color: #069; +} + +.highlight .kt { + color: #078; +} + +.highlight .m { + color: #f60; +} + +.highlight .s { + color: #d44950; +} + +.highlight .na { + color: #4f9fcf; +} + +.highlight .nb { + color: #366; +} + +.highlight .nc { + color: #0a8; +} + +.highlight .no { + color: #360; +} + +.highlight .nd { + color: #99f; +} + +.highlight .ni { + color: #999; +} + +.highlight .ne { + color: #c00; +} + +.highlight .nf { + color: #c0f; +} + +.highlight .nl { + color: #99f; +} + +.highlight .nn { + color: #0cf; +} + +.highlight .nt { + color: #2f6f9f; +} + +.highlight .nv { + color: #033; +} + +.highlight .ow { + color: #000; +} + +.highlight .w { + color: #bbb; +} + +.highlight .mf { + color: #f60; +} + +.highlight .mh { + color: #f60; +} + +.highlight .mi { + color: #f60; +} + +.highlight .mo { + color: #f60; +} + +.highlight .sb { + color: #c30; +} + +.highlight .sc { + color: #c30; +} + +.highlight .sd { + font-style: italic; + color: #c30; +} + +.highlight .s2 { + color: #c30; +} + +.highlight .se { + color: #c30; +} + +.highlight .sh { + color: #c30; +} + +.highlight .si { + color: #a00; +} + +.highlight .sx { + color: #c30; +} + +.highlight .sr { + color: #3aa; +} + +.highlight .s1 { + color: #c30; +} + +.highlight .ss { + color: #fc3; +} + +.highlight .bp { + color: #366; +} + +.highlight .vc { + color: #033; +} + +.highlight .vg { + color: #033; +} + +.highlight .vi { + color: #033; +} + +.highlight .il { + color: #f60; +} + +.highlight .css .o, +.highlight .css .o + .nt, +.highlight .css .nt + .nt { + color: #999; +} + +.highlight .language-bash::before, +.highlight .language-sh::before { + color: #009; + content: "$ "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.highlight .language-powershell::before { + color: #009; + content: "PM> "; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.custom-range { + -ms-flex-align: center; + align-items: center; + -webkit-appearance: none; + -moz-appearance: none; + appearance: none; + background: none; + cursor: pointer; + display: -ms-flexbox; + display: flex; + height: 100%; + min-height: 2.375rem; + overflow: hidden; + padding: 0; + border: 0; +} + +.custom-range:focus { + box-shadow: none; + outline: none; +} + +.custom-range:focus::-webkit-slider-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-moz-range-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range:focus::-ms-thumb { + border-color: #467fcf; + background-color: #467fcf; +} + +.custom-range::-moz-focus-outer { + border: 0; +} + +.custom-range::-webkit-slider-runnable-track { + background: #467fcf; + content: ''; + height: 2px; + pointer-events: none; +} + +.custom-range::-webkit-slider-thumb { + width: 14px; + height: 14px; + -webkit-appearance: none; + appearance: none; + background: #fff; + border-radius: 50px; + box-shadow: 1px 0 0 -6px rgba(0, 50, 126, 0.12), 6px 0 0 -6px rgba(0, 50, 126, 0.12), 7px 0 0 -6px rgba(0, 50, 126, 0.12), 8px 0 0 -6px rgba(0, 50, 126, 0.12), 9px 0 0 -6px rgba(0, 50, 126, 0.12), 10px 0 0 -6px rgba(0, 50, 126, 0.12), 11px 0 0 -6px rgba(0, 50, 126, 0.12), 12px 0 0 -6px rgba(0, 50, 126, 0.12), 13px 0 0 -6px rgba(0, 50, 126, 0.12), 14px 0 0 -6px rgba(0, 50, 126, 0.12), 15px 0 0 -6px rgba(0, 50, 126, 0.12), 16px 0 0 -6px rgba(0, 50, 126, 0.12), 17px 0 0 -6px rgba(0, 50, 126, 0.12), 18px 0 0 -6px rgba(0, 50, 126, 0.12), 19px 0 0 -6px rgba(0, 50, 126, 0.12), 20px 0 0 -6px rgba(0, 50, 126, 0.12), 21px 0 0 -6px rgba(0, 50, 126, 0.12), 22px 0 0 -6px rgba(0, 50, 126, 0.12), 23px 0 0 -6px rgba(0, 50, 126, 0.12), 24px 0 0 -6px rgba(0, 50, 126, 0.12), 25px 0 0 -6px rgba(0, 50, 126, 0.12), 26px 0 0 -6px rgba(0, 50, 126, 0.12), 27px 0 0 -6px rgba(0, 50, 126, 0.12), 28px 0 0 -6px rgba(0, 50, 126, 0.12), 29px 0 0 -6px rgba(0, 50, 126, 0.12), 30px 0 0 -6px rgba(0, 50, 126, 0.12), 31px 0 0 -6px rgba(0, 50, 126, 0.12), 32px 0 0 -6px rgba(0, 50, 126, 0.12), 33px 0 0 -6px rgba(0, 50, 126, 0.12), 34px 0 0 -6px rgba(0, 50, 126, 0.12), 35px 0 0 -6px rgba(0, 50, 126, 0.12), 36px 0 0 -6px rgba(0, 50, 126, 0.12), 37px 0 0 -6px rgba(0, 50, 126, 0.12), 38px 0 0 -6px rgba(0, 50, 126, 0.12), 39px 0 0 -6px rgba(0, 50, 126, 0.12), 40px 0 0 -6px rgba(0, 50, 126, 0.12), 41px 0 0 -6px rgba(0, 50, 126, 0.12), 42px 0 0 -6px rgba(0, 50, 126, 0.12), 43px 0 0 -6px rgba(0, 50, 126, 0.12), 44px 0 0 -6px rgba(0, 50, 126, 0.12), 45px 0 0 -6px rgba(0, 50, 126, 0.12), 46px 0 0 -6px rgba(0, 50, 126, 0.12), 47px 0 0 -6px rgba(0, 50, 126, 0.12), 48px 0 0 -6px rgba(0, 50, 126, 0.12), 49px 0 0 -6px rgba(0, 50, 126, 0.12), 50px 0 0 -6px rgba(0, 50, 126, 0.12), 51px 0 0 -6px rgba(0, 50, 126, 0.12), 52px 0 0 -6px rgba(0, 50, 126, 0.12), 53px 0 0 -6px rgba(0, 50, 126, 0.12), 54px 0 0 -6px rgba(0, 50, 126, 0.12), 55px 0 0 -6px rgba(0, 50, 126, 0.12), 56px 0 0 -6px rgba(0, 50, 126, 0.12), 57px 0 0 -6px rgba(0, 50, 126, 0.12), 58px 0 0 -6px rgba(0, 50, 126, 0.12), 59px 0 0 -6px rgba(0, 50, 126, 0.12), 60px 0 0 -6px rgba(0, 50, 126, 0.12), 61px 0 0 -6px rgba(0, 50, 126, 0.12), 62px 0 0 -6px rgba(0, 50, 126, 0.12), 63px 0 0 -6px rgba(0, 50, 126, 0.12), 64px 0 0 -6px rgba(0, 50, 126, 0.12), 65px 0 0 -6px rgba(0, 50, 126, 0.12), 66px 0 0 -6px rgba(0, 50, 126, 0.12), 67px 0 0 -6px rgba(0, 50, 126, 0.12), 68px 0 0 -6px rgba(0, 50, 126, 0.12), 69px 0 0 -6px rgba(0, 50, 126, 0.12), 70px 0 0 -6px rgba(0, 50, 126, 0.12), 71px 0 0 -6px rgba(0, 50, 126, 0.12), 72px 0 0 -6px rgba(0, 50, 126, 0.12), 73px 0 0 -6px rgba(0, 50, 126, 0.12), 74px 0 0 -6px rgba(0, 50, 126, 0.12), 75px 0 0 -6px rgba(0, 50, 126, 0.12), 76px 0 0 -6px rgba(0, 50, 126, 0.12), 77px 0 0 -6px rgba(0, 50, 126, 0.12), 78px 0 0 -6px rgba(0, 50, 126, 0.12), 79px 0 0 -6px rgba(0, 50, 126, 0.12), 80px 0 0 -6px rgba(0, 50, 126, 0.12), 81px 0 0 -6px rgba(0, 50, 126, 0.12), 82px 0 0 -6px rgba(0, 50, 126, 0.12), 83px 0 0 -6px rgba(0, 50, 126, 0.12), 84px 0 0 -6px rgba(0, 50, 126, 0.12), 85px 0 0 -6px rgba(0, 50, 126, 0.12), 86px 0 0 -6px rgba(0, 50, 126, 0.12), 87px 0 0 -6px rgba(0, 50, 126, 0.12), 88px 0 0 -6px rgba(0, 50, 126, 0.12), 89px 0 0 -6px rgba(0, 50, 126, 0.12), 90px 0 0 -6px rgba(0, 50, 126, 0.12), 91px 0 0 -6px rgba(0, 50, 126, 0.12), 92px 0 0 -6px rgba(0, 50, 126, 0.12), 93px 0 0 -6px rgba(0, 50, 126, 0.12), 94px 0 0 -6px rgba(0, 50, 126, 0.12), 95px 0 0 -6px rgba(0, 50, 126, 0.12), 96px 0 0 -6px rgba(0, 50, 126, 0.12), 97px 0 0 -6px rgba(0, 50, 126, 0.12), 98px 0 0 -6px rgba(0, 50, 126, 0.12), 99px 0 0 -6px rgba(0, 50, 126, 0.12), 100px 0 0 -6px rgba(0, 50, 126, 0.12), 101px 0 0 -6px rgba(0, 50, 126, 0.12), 102px 0 0 -6px rgba(0, 50, 126, 0.12), 103px 0 0 -6px rgba(0, 50, 126, 0.12), 104px 0 0 -6px rgba(0, 50, 126, 0.12), 105px 0 0 -6px rgba(0, 50, 126, 0.12), 106px 0 0 -6px rgba(0, 50, 126, 0.12), 107px 0 0 -6px rgba(0, 50, 126, 0.12), 108px 0 0 -6px rgba(0, 50, 126, 0.12), 109px 0 0 -6px rgba(0, 50, 126, 0.12), 110px 0 0 -6px rgba(0, 50, 126, 0.12), 111px 0 0 -6px rgba(0, 50, 126, 0.12), 112px 0 0 -6px rgba(0, 50, 126, 0.12), 113px 0 0 -6px rgba(0, 50, 126, 0.12), 114px 0 0 -6px rgba(0, 50, 126, 0.12), 115px 0 0 -6px rgba(0, 50, 126, 0.12), 116px 0 0 -6px rgba(0, 50, 126, 0.12), 117px 0 0 -6px rgba(0, 50, 126, 0.12), 118px 0 0 -6px rgba(0, 50, 126, 0.12), 119px 0 0 -6px rgba(0, 50, 126, 0.12), 120px 0 0 -6px rgba(0, 50, 126, 0.12), 121px 0 0 -6px rgba(0, 50, 126, 0.12), 122px 0 0 -6px rgba(0, 50, 126, 0.12), 123px 0 0 -6px rgba(0, 50, 126, 0.12), 124px 0 0 -6px rgba(0, 50, 126, 0.12), 125px 0 0 -6px rgba(0, 50, 126, 0.12), 126px 0 0 -6px rgba(0, 50, 126, 0.12), 127px 0 0 -6px rgba(0, 50, 126, 0.12), 128px 0 0 -6px rgba(0, 50, 126, 0.12), 129px 0 0 -6px rgba(0, 50, 126, 0.12), 130px 0 0 -6px rgba(0, 50, 126, 0.12), 131px 0 0 -6px rgba(0, 50, 126, 0.12), 132px 0 0 -6px rgba(0, 50, 126, 0.12), 133px 0 0 -6px rgba(0, 50, 126, 0.12), 134px 0 0 -6px rgba(0, 50, 126, 0.12), 135px 0 0 -6px rgba(0, 50, 126, 0.12), 136px 0 0 -6px rgba(0, 50, 126, 0.12), 137px 0 0 -6px rgba(0, 50, 126, 0.12), 138px 0 0 -6px rgba(0, 50, 126, 0.12), 139px 0 0 -6px rgba(0, 50, 126, 0.12), 140px 0 0 -6px rgba(0, 50, 126, 0.12), 141px 0 0 -6px rgba(0, 50, 126, 0.12), 142px 0 0 -6px rgba(0, 50, 126, 0.12), 143px 0 0 -6px rgba(0, 50, 126, 0.12), 144px 0 0 -6px rgba(0, 50, 126, 0.12), 145px 0 0 -6px rgba(0, 50, 126, 0.12), 146px 0 0 -6px rgba(0, 50, 126, 0.12), 147px 0 0 -6px rgba(0, 50, 126, 0.12), 148px 0 0 -6px rgba(0, 50, 126, 0.12), 149px 0 0 -6px rgba(0, 50, 126, 0.12), 150px 0 0 -6px rgba(0, 50, 126, 0.12), 151px 0 0 -6px rgba(0, 50, 126, 0.12), 152px 0 0 -6px rgba(0, 50, 126, 0.12), 153px 0 0 -6px rgba(0, 50, 126, 0.12), 154px 0 0 -6px rgba(0, 50, 126, 0.12), 155px 0 0 -6px rgba(0, 50, 126, 0.12), 156px 0 0 -6px rgba(0, 50, 126, 0.12), 157px 0 0 -6px rgba(0, 50, 126, 0.12), 158px 0 0 -6px rgba(0, 50, 126, 0.12), 159px 0 0 -6px rgba(0, 50, 126, 0.12), 160px 0 0 -6px rgba(0, 50, 126, 0.12), 161px 0 0 -6px rgba(0, 50, 126, 0.12), 162px 0 0 -6px rgba(0, 50, 126, 0.12), 163px 0 0 -6px rgba(0, 50, 126, 0.12), 164px 0 0 -6px rgba(0, 50, 126, 0.12), 165px 0 0 -6px rgba(0, 50, 126, 0.12), 166px 0 0 -6px rgba(0, 50, 126, 0.12), 167px 0 0 -6px rgba(0, 50, 126, 0.12), 168px 0 0 -6px rgba(0, 50, 126, 0.12), 169px 0 0 -6px rgba(0, 50, 126, 0.12), 170px 0 0 -6px rgba(0, 50, 126, 0.12), 171px 0 0 -6px rgba(0, 50, 126, 0.12), 172px 0 0 -6px rgba(0, 50, 126, 0.12), 173px 0 0 -6px rgba(0, 50, 126, 0.12), 174px 0 0 -6px rgba(0, 50, 126, 0.12), 175px 0 0 -6px rgba(0, 50, 126, 0.12), 176px 0 0 -6px rgba(0, 50, 126, 0.12), 177px 0 0 -6px rgba(0, 50, 126, 0.12), 178px 0 0 -6px rgba(0, 50, 126, 0.12), 179px 0 0 -6px rgba(0, 50, 126, 0.12), 180px 0 0 -6px rgba(0, 50, 126, 0.12), 181px 0 0 -6px rgba(0, 50, 126, 0.12), 182px 0 0 -6px rgba(0, 50, 126, 0.12), 183px 0 0 -6px rgba(0, 50, 126, 0.12), 184px 0 0 -6px rgba(0, 50, 126, 0.12), 185px 0 0 -6px rgba(0, 50, 126, 0.12), 186px 0 0 -6px rgba(0, 50, 126, 0.12), 187px 0 0 -6px rgba(0, 50, 126, 0.12), 188px 0 0 -6px rgba(0, 50, 126, 0.12), 189px 0 0 -6px rgba(0, 50, 126, 0.12), 190px 0 0 -6px rgba(0, 50, 126, 0.12), 191px 0 0 -6px rgba(0, 50, 126, 0.12), 192px 0 0 -6px rgba(0, 50, 126, 0.12), 193px 0 0 -6px rgba(0, 50, 126, 0.12), 194px 0 0 -6px rgba(0, 50, 126, 0.12), 195px 0 0 -6px rgba(0, 50, 126, 0.12), 196px 0 0 -6px rgba(0, 50, 126, 0.12), 197px 0 0 -6px rgba(0, 50, 126, 0.12), 198px 0 0 -6px rgba(0, 50, 126, 0.12), 199px 0 0 -6px rgba(0, 50, 126, 0.12), 200px 0 0 -6px rgba(0, 50, 126, 0.12), 201px 0 0 -6px rgba(0, 50, 126, 0.12), 202px 0 0 -6px rgba(0, 50, 126, 0.12), 203px 0 0 -6px rgba(0, 50, 126, 0.12), 204px 0 0 -6px rgba(0, 50, 126, 0.12), 205px 0 0 -6px rgba(0, 50, 126, 0.12), 206px 0 0 -6px rgba(0, 50, 126, 0.12), 207px 0 0 -6px rgba(0, 50, 126, 0.12), 208px 0 0 -6px rgba(0, 50, 126, 0.12), 209px 0 0 -6px rgba(0, 50, 126, 0.12), 210px 0 0 -6px rgba(0, 50, 126, 0.12), 211px 0 0 -6px rgba(0, 50, 126, 0.12), 212px 0 0 -6px rgba(0, 50, 126, 0.12), 213px 0 0 -6px rgba(0, 50, 126, 0.12), 214px 0 0 -6px rgba(0, 50, 126, 0.12), 215px 0 0 -6px rgba(0, 50, 126, 0.12), 216px 0 0 -6px rgba(0, 50, 126, 0.12), 217px 0 0 -6px rgba(0, 50, 126, 0.12), 218px 0 0 -6px rgba(0, 50, 126, 0.12), 219px 0 0 -6px rgba(0, 50, 126, 0.12), 220px 0 0 -6px rgba(0, 50, 126, 0.12), 221px 0 0 -6px rgba(0, 50, 126, 0.12), 222px 0 0 -6px rgba(0, 50, 126, 0.12), 223px 0 0 -6px rgba(0, 50, 126, 0.12), 224px 0 0 -6px rgba(0, 50, 126, 0.12), 225px 0 0 -6px rgba(0, 50, 126, 0.12), 226px 0 0 -6px rgba(0, 50, 126, 0.12), 227px 0 0 -6px rgba(0, 50, 126, 0.12), 228px 0 0 -6px rgba(0, 50, 126, 0.12), 229px 0 0 -6px rgba(0, 50, 126, 0.12), 230px 0 0 -6px rgba(0, 50, 126, 0.12), 231px 0 0 -6px rgba(0, 50, 126, 0.12), 232px 0 0 -6px rgba(0, 50, 126, 0.12), 233px 0 0 -6px rgba(0, 50, 126, 0.12), 234px 0 0 -6px rgba(0, 50, 126, 0.12), 235px 0 0 -6px rgba(0, 50, 126, 0.12), 236px 0 0 -6px rgba(0, 50, 126, 0.12), 237px 0 0 -6px rgba(0, 50, 126, 0.12), 238px 0 0 -6px rgba(0, 50, 126, 0.12), 239px 0 0 -6px rgba(0, 50, 126, 0.12), 240px 0 0 -6px rgba(0, 50, 126, 0.12); + margin-top: -6px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-track { + width: 240px; + height: 2px; + background: rgba(0, 50, 126, 0.12); +} + +.custom-range::-moz-range-thumb { + width: 14px; + height: 14px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + position: relative; + transition: .3s border-color, .3s background-color; +} + +.custom-range::-moz-range-progress { + height: 2px; + background: #467fcf; + border: 0; + margin-top: 0; +} + +.custom-range::-ms-track { + background: transparent; + border: 0; + border-color: transparent; + border-radius: 0; + border-width: 0; + color: transparent; + height: 2px; + margin-top: 10px; + width: 240px; +} + +.custom-range::-ms-thumb { + width: 240px; + height: 2px; + background: #fff; + border-radius: 50px; + border: 1px solid rgba(0, 30, 75, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-range::-ms-fill-lower { + background: #467fcf; + border-radius: 0; +} + +.custom-range::-ms-fill-upper { + background: rgba(0, 50, 126, 0.12); + border-radius: 0; +} + +.custom-range::-ms-tooltip { + display: none; +} + +.selectgroup { + display: -ms-inline-flexbox; + display: inline-flex; +} + +.selectgroup-item { + -ms-flex-positive: 1; + flex-grow: 1; + position: relative; +} + +.selectgroup-item + .selectgroup-item { + margin-left: -1px; +} + +.selectgroup-item:not(:first-child) .selectgroup-button { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.selectgroup-item:not(:last-child) .selectgroup-button { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.selectgroup-input { + opacity: 0; + position: absolute; + z-index: -1; + top: 0; + left: 0; +} + +.selectgroup-button { + display: block; + border: 1px solid rgba(0, 40, 100, 0.12); + text-align: center; + padding: 0.375rem 1rem; + position: relative; + cursor: pointer; + border-radius: 3px; + color: #9aa0ac; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + font-size: 0.9375rem; + line-height: 1.5; + min-width: 2.375rem; +} + +.selectgroup-button-icon { + padding-left: .5rem; + padding-right: .5rem; + font-size: 1.125rem; + line-height: 1.125rem; +} + +.selectgroup-input:checked + .selectgroup-button { + border-color: #467fcf; + z-index: 1; + color: #467fcf; + background: #edf2fa; +} + +.selectgroup-input:focus + .selectgroup-button { + border-color: #467fcf; + z-index: 2; + color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectgroup-pills { + -ms-flex-wrap: wrap; + flex-wrap: wrap; + -ms-flex-align: start; + align-items: flex-start; +} + +.selectgroup-pills .selectgroup-item { + margin-right: .5rem; + -ms-flex-positive: 0; + flex-grow: 0; +} + +.selectgroup-pills .selectgroup-button { + border-radius: 50px !important; +} + +.custom-switch { + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: default; + display: -ms-inline-flexbox; + display: inline-flex; + -ms-flex-align: center; + align-items: center; + margin: 0; +} + +.custom-switch-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.custom-switches-stacked { + display: -ms-flexbox; + display: flex; + -ms-flex-direction: column; + flex-direction: column; +} + +.custom-switches-stacked .custom-switch { + margin-bottom: .5rem; +} + +.custom-switch-indicator { + display: inline-block; + height: 1.25rem; + width: 2.25rem; + background: #e9ecef; + border-radius: 50px; + position: relative; + vertical-align: bottom; + border: 1px solid rgba(0, 40, 100, 0.12); + transition: .3s border-color, .3s background-color; +} + +.custom-switch-indicator:before { + content: ''; + position: absolute; + height: calc(1.25rem - 4px); + width: calc(1.25rem - 4px); + top: 1px; + left: 1px; + background: #fff; + border-radius: 50%; + transition: .3s left; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); +} + +.custom-switch-input:checked ~ .custom-switch-indicator { + background: #467fcf; +} + +.custom-switch-input:checked ~ .custom-switch-indicator:before { + left: calc(1rem + 1px); +} + +.custom-switch-input:focus ~ .custom-switch-indicator { + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); + border-color: #467fcf; +} + +.custom-switch-description { + margin-left: .5rem; + color: #6e7687; + transition: .3s color; +} + +.custom-switch-input:checked ~ .custom-switch-description { + color: #495057; +} + +.imagecheck { + margin: 0; + position: relative; + cursor: pointer; +} + +.imagecheck-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.imagecheck-figure { + border: 1px solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + margin: 0; + position: relative; +} + +.imagecheck-input:focus ~ .imagecheck-figure { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.imagecheck-input:checked ~ .imagecheck-figure { + border-color: rgba(0, 40, 100, 0.24); +} + +.imagecheck-figure:before { + content: ''; + position: absolute; + top: .25rem; + left: .25rem; + display: block; + width: 1rem; + height: 1rem; + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background: #467fcf url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; + color: #fff; + z-index: 1; + border-radius: 3px; + opacity: 0; + transition: .3s opacity; +} + +.imagecheck-input:checked ~ .imagecheck-figure:before { + opacity: 1; +} + +.imagecheck-image { + max-width: 100%; + opacity: .64; + transition: .3s opacity; +} + +.imagecheck-image:first-child { + border-top-left-radius: 2px; + border-top-right-radius: 2px; +} + +.imagecheck-image:last-child { + border-bottom-left-radius: 2px; + border-bottom-right-radius: 2px; +} + +.imagecheck:hover .imagecheck-image, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-image, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-image { + opacity: 1; +} + +.imagecheck-caption { + text-align: center; + padding: .25rem .25rem; + color: #9aa0ac; + font-size: 0.875rem; + transition: .3s color; +} + +.imagecheck:hover .imagecheck-caption, +.imagecheck-input:focus ~ .imagecheck-figure .imagecheck-caption, +.imagecheck-input:checked ~ .imagecheck-figure .imagecheck-caption { + color: #495057; +} + +.colorinput { + margin: 0; + position: relative; + cursor: pointer; +} + +.colorinput-input { + position: absolute; + z-index: -1; + opacity: 0; +} + +.colorinput-color { + display: inline-block; + width: 1.75rem; + height: 1.75rem; + border-radius: 3px; + border: 1px solid rgba(0, 40, 100, 0.12); + color: #fff; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05); +} + +.colorinput-color:before { + content: ''; + opacity: 0; + position: absolute; + top: .25rem; + left: .25rem; + height: 1.25rem; + width: 1.25rem; + transition: .3s opacity; + background: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3E%3Cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26 2.974 7.25 8 2.193z'/%3E%3C/svg%3E") no-repeat center center/50% 50%; +} + +.colorinput-input:checked ~ .colorinput-color:before { + opacity: 1; +} + +.colorinput-input:focus ~ .colorinput-color { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.timeline { + position: relative; + margin: 0 0 2rem; + padding: 0; + list-style: none; +} + +.timeline:before { + background-color: #e9ecef; + position: absolute; + display: block; + content: ''; + width: 1px; + height: 100%; + top: 0; + bottom: 0; + left: 4px; +} + +.timeline-item { + position: relative; + display: -ms-flexbox; + display: flex; + padding-left: 2rem; + margin: .5rem 0; +} + +.timeline-item:first-child:before, .timeline-item:last-child:before { + content: ''; + position: absolute; + background: #fff; + width: 1px; + left: .25rem; +} + +.timeline-item:first-child { + margin-top: 0; +} + +.timeline-item:first-child:before { + top: 0; + height: .5rem; +} + +.timeline-item:last-child { + margin-bottom: 0; +} + +.timeline-item:last-child:before { + top: .5rem; + bottom: 0; +} + +.timeline-badge { + position: absolute; + display: block; + width: 0.4375rem; + height: 0.4375rem; + left: 1px; + top: .5rem; + border-radius: 100%; + border: 1px solid #fff; + background: #adb5bd; +} + +.timeline-time { + white-space: nowrap; + margin-left: auto; + color: #9aa0ac; + font-size: 87.5%; +} + +.browser { + width: 1.25rem; + height: 1.25rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; +} + +.browser-android-browser { + background-image: url("../images/browsers/android-browser.svg"); +} + +.browser-aol-explorer { + background-image: url("../images/browsers/aol-explorer.svg"); +} + +.browser-blackberry { + background-image: url("../images/browsers/blackberry.svg"); +} + +.browser-camino { + background-image: url("../images/browsers/camino.svg"); +} + +.browser-chrome { + background-image: url("../images/browsers/chrome.svg"); +} + +.browser-chromium { + background-image: url("../images/browsers/chromium.svg"); +} + +.browser-dolphin { + background-image: url("../images/browsers/dolphin.svg"); +} + +.browser-edge { + background-image: url("../images/browsers/edge.svg"); +} + +.browser-firefox { + background-image: url("../images/browsers/firefox.svg"); +} + +.browser-ie { + background-image: url("../images/browsers/ie.svg"); +} + +.browser-maxthon { + background-image: url("../images/browsers/maxthon.svg"); +} + +.browser-mozilla { + background-image: url("../images/browsers/mozilla.svg"); +} + +.browser-netscape { + background-image: url("../images/browsers/netscape.svg"); +} + +.browser-opera { + background-image: url("../images/browsers/opera.svg"); +} + +.browser-safari { + background-image: url("../images/browsers/safari.svg"); +} + +.browser-sleipnir { + background-image: url("../images/browsers/sleipnir.svg"); +} + +.browser-uc-browser { + background-image: url("../images/browsers/uc-browser.svg"); +} + +.browser-vivaldi { + background-image: url("../images/browsers/vivaldi.svg"); +} + +.flag { + width: 1.6rem; + height: 1.2rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.flag-ad { + background-image: url("../images/flags/ad.svg"); +} + +.flag-ae { + background-image: url("../images/flags/ae.svg"); +} + +.flag-af { + background-image: url("../images/flags/af.svg"); +} + +.flag-ag { + background-image: url("../images/flags/ag.svg"); +} + +.flag-ai { + background-image: url("../images/flags/ai.svg"); +} + +.flag-al { + background-image: url("../images/flags/al.svg"); +} + +.flag-am { + background-image: url("../images/flags/am.svg"); +} + +.flag-ao { + background-image: url("../images/flags/ao.svg"); +} + +.flag-aq { + background-image: url("../images/flags/aq.svg"); +} + +.flag-ar { + background-image: url("../images/flags/ar.svg"); +} + +.flag-as { + background-image: url("../images/flags/as.svg"); +} + +.flag-at { + background-image: url("../images/flags/at.svg"); +} + +.flag-au { + background-image: url("../images/flags/au.svg"); +} + +.flag-aw { + background-image: url("../images/flags/aw.svg"); +} + +.flag-ax { + background-image: url("../images/flags/ax.svg"); +} + +.flag-az { + background-image: url("../images/flags/az.svg"); +} + +.flag-ba { + background-image: url("../images/flags/ba.svg"); +} + +.flag-bb { + background-image: url("../images/flags/bb.svg"); +} + +.flag-bd { + background-image: url("../images/flags/bd.svg"); +} + +.flag-be { + background-image: url("../images/flags/be.svg"); +} + +.flag-bf { + background-image: url("../images/flags/bf.svg"); +} + +.flag-bg { + background-image: url("../images/flags/bg.svg"); +} + +.flag-bh { + background-image: url("../images/flags/bh.svg"); +} + +.flag-bi { + background-image: url("../images/flags/bi.svg"); +} + +.flag-bj { + background-image: url("../images/flags/bj.svg"); +} + +.flag-bl { + background-image: url("../images/flags/bl.svg"); +} + +.flag-bm { + background-image: url("../images/flags/bm.svg"); +} + +.flag-bn { + background-image: url("../images/flags/bn.svg"); +} + +.flag-bo { + background-image: url("../images/flags/bo.svg"); +} + +.flag-bq { + background-image: url("../images/flags/bq.svg"); +} + +.flag-br { + background-image: url("../images/flags/br.svg"); +} + +.flag-bs { + background-image: url("../images/flags/bs.svg"); +} + +.flag-bt { + background-image: url("../images/flags/bt.svg"); +} + +.flag-bv { + background-image: url("../images/flags/bv.svg"); +} + +.flag-bw { + background-image: url("../images/flags/bw.svg"); +} + +.flag-by { + background-image: url("../images/flags/by.svg"); +} + +.flag-bz { + background-image: url("../images/flags/bz.svg"); +} + +.flag-ca { + background-image: url("../images/flags/ca.svg"); +} + +.flag-cc { + background-image: url("../images/flags/cc.svg"); +} + +.flag-cd { + background-image: url("../images/flags/cd.svg"); +} + +.flag-cf { + background-image: url("../images/flags/cf.svg"); +} + +.flag-cg { + background-image: url("../images/flags/cg.svg"); +} + +.flag-ch { + background-image: url("../images/flags/ch.svg"); +} + +.flag-ci { + background-image: url("../images/flags/ci.svg"); +} + +.flag-ck { + background-image: url("../images/flags/ck.svg"); +} + +.flag-cl { + background-image: url("../images/flags/cl.svg"); +} + +.flag-cm { + background-image: url("../images/flags/cm.svg"); +} + +.flag-cn { + background-image: url("../images/flags/cn.svg"); +} + +.flag-co { + background-image: url("../images/flags/co.svg"); +} + +.flag-cr { + background-image: url("../images/flags/cr.svg"); +} + +.flag-cu { + background-image: url("../images/flags/cu.svg"); +} + +.flag-cv { + background-image: url("../images/flags/cv.svg"); +} + +.flag-cw { + background-image: url("../images/flags/cw.svg"); +} + +.flag-cx { + background-image: url("../images/flags/cx.svg"); +} + +.flag-cy { + background-image: url("../images/flags/cy.svg"); +} + +.flag-cz { + background-image: url("../images/flags/cz.svg"); +} + +.flag-de { + background-image: url("../images/flags/de.svg"); +} + +.flag-dj { + background-image: url("../images/flags/dj.svg"); +} + +.flag-dk { + background-image: url("../images/flags/dk.svg"); +} + +.flag-dm { + background-image: url("../images/flags/dm.svg"); +} + +.flag-do { + background-image: url("../images/flags/do.svg"); +} + +.flag-dz { + background-image: url("../images/flags/dz.svg"); +} + +.flag-ec { + background-image: url("../images/flags/ec.svg"); +} + +.flag-ee { + background-image: url("../images/flags/ee.svg"); +} + +.flag-eg { + background-image: url("../images/flags/eg.svg"); +} + +.flag-eh { + background-image: url("../images/flags/eh.svg"); +} + +.flag-er { + background-image: url("../images/flags/er.svg"); +} + +.flag-es { + background-image: url("../images/flags/es.svg"); +} + +.flag-et { + background-image: url("../images/flags/et.svg"); +} + +.flag-eu { + background-image: url("../images/flags/eu.svg"); +} + +.flag-fi { + background-image: url("../images/flags/fi.svg"); +} + +.flag-fj { + background-image: url("../images/flags/fj.svg"); +} + +.flag-fk { + background-image: url("../images/flags/fk.svg"); +} + +.flag-fm { + background-image: url("../images/flags/fm.svg"); +} + +.flag-fo { + background-image: url("../images/flags/fo.svg"); +} + +.flag-fr { + background-image: url("../images/flags/fr.svg"); +} + +.flag-ga { + background-image: url("../images/flags/ga.svg"); +} + +.flag-gb-eng { + background-image: url("../images/flags/gb-eng.svg"); +} + +.flag-gb-nir { + background-image: url("../images/flags/gb-nir.svg"); +} + +.flag-gb-sct { + background-image: url("../images/flags/gb-sct.svg"); +} + +.flag-gb-wls { + background-image: url("../images/flags/gb-wls.svg"); +} + +.flag-gb { + background-image: url("../images/flags/gb.svg"); +} + +.flag-gd { + background-image: url("../images/flags/gd.svg"); +} + +.flag-ge { + background-image: url("../images/flags/ge.svg"); +} + +.flag-gf { + background-image: url("../images/flags/gf.svg"); +} + +.flag-gg { + background-image: url("../images/flags/gg.svg"); +} + +.flag-gh { + background-image: url("../images/flags/gh.svg"); +} + +.flag-gi { + background-image: url("../images/flags/gi.svg"); +} + +.flag-gl { + background-image: url("../images/flags/gl.svg"); +} + +.flag-gm { + background-image: url("../images/flags/gm.svg"); +} + +.flag-gn { + background-image: url("../images/flags/gn.svg"); +} + +.flag-gp { + background-image: url("../images/flags/gp.svg"); +} + +.flag-gq { + background-image: url("../images/flags/gq.svg"); +} + +.flag-gr { + background-image: url("../images/flags/gr.svg"); +} + +.flag-gs { + background-image: url("../images/flags/gs.svg"); +} + +.flag-gt { + background-image: url("../images/flags/gt.svg"); +} + +.flag-gu { + background-image: url("../images/flags/gu.svg"); +} + +.flag-gw { + background-image: url("../images/flags/gw.svg"); +} + +.flag-gy { + background-image: url("../images/flags/gy.svg"); +} + +.flag-hk { + background-image: url("../images/flags/hk.svg"); +} + +.flag-hm { + background-image: url("../images/flags/hm.svg"); +} + +.flag-hn { + background-image: url("../images/flags/hn.svg"); +} + +.flag-hr { + background-image: url("../images/flags/hr.svg"); +} + +.flag-ht { + background-image: url("../images/flags/ht.svg"); +} + +.flag-hu { + background-image: url("../images/flags/hu.svg"); +} + +.flag-id { + background-image: url("../images/flags/id.svg"); +} + +.flag-ie { + background-image: url("../images/flags/ie.svg"); +} + +.flag-il { + background-image: url("../images/flags/il.svg"); +} + +.flag-im { + background-image: url("../images/flags/im.svg"); +} + +.flag-in { + background-image: url("../images/flags/in.svg"); +} + +.flag-io { + background-image: url("../images/flags/io.svg"); +} + +.flag-iq { + background-image: url("../images/flags/iq.svg"); +} + +.flag-ir { + background-image: url("../images/flags/ir.svg"); +} + +.flag-is { + background-image: url("../images/flags/is.svg"); +} + +.flag-it { + background-image: url("../images/flags/it.svg"); +} + +.flag-je { + background-image: url("../images/flags/je.svg"); +} + +.flag-jm { + background-image: url("../images/flags/jm.svg"); +} + +.flag-jo { + background-image: url("../images/flags/jo.svg"); +} + +.flag-jp { + background-image: url("../images/flags/jp.svg"); +} + +.flag-ke { + background-image: url("../images/flags/ke.svg"); +} + +.flag-kg { + background-image: url("../images/flags/kg.svg"); +} + +.flag-kh { + background-image: url("../images/flags/kh.svg"); +} + +.flag-ki { + background-image: url("../images/flags/ki.svg"); +} + +.flag-km { + background-image: url("../images/flags/km.svg"); +} + +.flag-kn { + background-image: url("../images/flags/kn.svg"); +} + +.flag-kp { + background-image: url("../images/flags/kp.svg"); +} + +.flag-kr { + background-image: url("../images/flags/kr.svg"); +} + +.flag-kw { + background-image: url("../images/flags/kw.svg"); +} + +.flag-ky { + background-image: url("../images/flags/ky.svg"); +} + +.flag-kz { + background-image: url("../images/flags/kz.svg"); +} + +.flag-la { + background-image: url("../images/flags/la.svg"); +} + +.flag-lb { + background-image: url("../images/flags/lb.svg"); +} + +.flag-lc { + background-image: url("../images/flags/lc.svg"); +} + +.flag-li { + background-image: url("../images/flags/li.svg"); +} + +.flag-lk { + background-image: url("../images/flags/lk.svg"); +} + +.flag-lr { + background-image: url("../images/flags/lr.svg"); +} + +.flag-ls { + background-image: url("../images/flags/ls.svg"); +} + +.flag-lt { + background-image: url("../images/flags/lt.svg"); +} + +.flag-lu { + background-image: url("../images/flags/lu.svg"); +} + +.flag-lv { + background-image: url("../images/flags/lv.svg"); +} + +.flag-ly { + background-image: url("../images/flags/ly.svg"); +} + +.flag-ma { + background-image: url("../images/flags/ma.svg"); +} + +.flag-mc { + background-image: url("../images/flags/mc.svg"); +} + +.flag-md { + background-image: url("../images/flags/md.svg"); +} + +.flag-me { + background-image: url("../images/flags/me.svg"); +} + +.flag-mf { + background-image: url("../images/flags/mf.svg"); +} + +.flag-mg { + background-image: url("../images/flags/mg.svg"); +} + +.flag-mh { + background-image: url("../images/flags/mh.svg"); +} + +.flag-mk { + background-image: url("../images/flags/mk.svg"); +} + +.flag-ml { + background-image: url("../images/flags/ml.svg"); +} + +.flag-mm { + background-image: url("../images/flags/mm.svg"); +} + +.flag-mn { + background-image: url("../images/flags/mn.svg"); +} + +.flag-mo { + background-image: url("../images/flags/mo.svg"); +} + +.flag-mp { + background-image: url("../images/flags/mp.svg"); +} + +.flag-mq { + background-image: url("../images/flags/mq.svg"); +} + +.flag-mr { + background-image: url("../images/flags/mr.svg"); +} + +.flag-ms { + background-image: url("../images/flags/ms.svg"); +} + +.flag-mt { + background-image: url("../images/flags/mt.svg"); +} + +.flag-mu { + background-image: url("../images/flags/mu.svg"); +} + +.flag-mv { + background-image: url("../images/flags/mv.svg"); +} + +.flag-mw { + background-image: url("../images/flags/mw.svg"); +} + +.flag-mx { + background-image: url("../images/flags/mx.svg"); +} + +.flag-my { + background-image: url("../images/flags/my.svg"); +} + +.flag-mz { + background-image: url("../images/flags/mz.svg"); +} + +.flag-na { + background-image: url("../images/flags/na.svg"); +} + +.flag-nc { + background-image: url("../images/flags/nc.svg"); +} + +.flag-ne { + background-image: url("../images/flags/ne.svg"); +} + +.flag-nf { + background-image: url("../images/flags/nf.svg"); +} + +.flag-ng { + background-image: url("../images/flags/ng.svg"); +} + +.flag-ni { + background-image: url("../images/flags/ni.svg"); +} + +.flag-nl { + background-image: url("../images/flags/nl.svg"); +} + +.flag-no { + background-image: url("../images/flags/no.svg"); +} + +.flag-np { + background-image: url("../images/flags/np.svg"); +} + +.flag-nr { + background-image: url("../images/flags/nr.svg"); +} + +.flag-nu { + background-image: url("../images/flags/nu.svg"); +} + +.flag-nz { + background-image: url("../images/flags/nz.svg"); +} + +.flag-om { + background-image: url("../images/flags/om.svg"); +} + +.flag-pa { + background-image: url("../images/flags/pa.svg"); +} + +.flag-pe { + background-image: url("../images/flags/pe.svg"); +} + +.flag-pf { + background-image: url("../images/flags/pf.svg"); +} + +.flag-pg { + background-image: url("../images/flags/pg.svg"); +} + +.flag-ph { + background-image: url("../images/flags/ph.svg"); +} + +.flag-pk { + background-image: url("../images/flags/pk.svg"); +} + +.flag-pl { + background-image: url("../images/flags/pl.svg"); +} + +.flag-pm { + background-image: url("../images/flags/pm.svg"); +} + +.flag-pn { + background-image: url("../images/flags/pn.svg"); +} + +.flag-pr { + background-image: url("../images/flags/pr.svg"); +} + +.flag-ps { + background-image: url("../images/flags/ps.svg"); +} + +.flag-pt { + background-image: url("../images/flags/pt.svg"); +} + +.flag-pw { + background-image: url("../images/flags/pw.svg"); +} + +.flag-py { + background-image: url("../images/flags/py.svg"); +} + +.flag-qa { + background-image: url("../images/flags/qa.svg"); +} + +.flag-re { + background-image: url("../images/flags/re.svg"); +} + +.flag-ro { + background-image: url("../images/flags/ro.svg"); +} + +.flag-rs { + background-image: url("../images/flags/rs.svg"); +} + +.flag-ru { + background-image: url("../images/flags/ru.svg"); +} + +.flag-rw { + background-image: url("../images/flags/rw.svg"); +} + +.flag-sa { + background-image: url("../images/flags/sa.svg"); +} + +.flag-sb { + background-image: url("../images/flags/sb.svg"); +} + +.flag-sc { + background-image: url("../images/flags/sc.svg"); +} + +.flag-sd { + background-image: url("../images/flags/sd.svg"); +} + +.flag-se { + background-image: url("../images/flags/se.svg"); +} + +.flag-sg { + background-image: url("../images/flags/sg.svg"); +} + +.flag-sh { + background-image: url("../images/flags/sh.svg"); +} + +.flag-si { + background-image: url("../images/flags/si.svg"); +} + +.flag-sj { + background-image: url("../images/flags/sj.svg"); +} + +.flag-sk { + background-image: url("../images/flags/sk.svg"); +} + +.flag-sl { + background-image: url("../images/flags/sl.svg"); +} + +.flag-sm { + background-image: url("../images/flags/sm.svg"); +} + +.flag-sn { + background-image: url("../images/flags/sn.svg"); +} + +.flag-so { + background-image: url("../images/flags/so.svg"); +} + +.flag-sr { + background-image: url("../images/flags/sr.svg"); +} + +.flag-ss { + background-image: url("../images/flags/ss.svg"); +} + +.flag-st { + background-image: url("../images/flags/st.svg"); +} + +.flag-sv { + background-image: url("../images/flags/sv.svg"); +} + +.flag-sx { + background-image: url("../images/flags/sx.svg"); +} + +.flag-sy { + background-image: url("../images/flags/sy.svg"); +} + +.flag-sz { + background-image: url("../images/flags/sz.svg"); +} + +.flag-tc { + background-image: url("../images/flags/tc.svg"); +} + +.flag-td { + background-image: url("../images/flags/td.svg"); +} + +.flag-tf { + background-image: url("../images/flags/tf.svg"); +} + +.flag-tg { + background-image: url("../images/flags/tg.svg"); +} + +.flag-th { + background-image: url("../images/flags/th.svg"); +} + +.flag-tj { + background-image: url("../images/flags/tj.svg"); +} + +.flag-tk { + background-image: url("../images/flags/tk.svg"); +} + +.flag-tl { + background-image: url("../images/flags/tl.svg"); +} + +.flag-tm { + background-image: url("../images/flags/tm.svg"); +} + +.flag-tn { + background-image: url("../images/flags/tn.svg"); +} + +.flag-to { + background-image: url("../images/flags/to.svg"); +} + +.flag-tr { + background-image: url("../images/flags/tr.svg"); +} + +.flag-tt { + background-image: url("../images/flags/tt.svg"); +} + +.flag-tv { + background-image: url("../images/flags/tv.svg"); +} + +.flag-tw { + background-image: url("../images/flags/tw.svg"); +} + +.flag-tz { + background-image: url("../images/flags/tz.svg"); +} + +.flag-ua { + background-image: url("../images/flags/ua.svg"); +} + +.flag-ug { + background-image: url("../images/flags/ug.svg"); +} + +.flag-um { + background-image: url("../images/flags/um.svg"); +} + +.flag-un { + background-image: url("../images/flags/un.svg"); +} + +.flag-us { + background-image: url("../images/flags/us.svg"); +} + +.flag-uy { + background-image: url("../images/flags/uy.svg"); +} + +.flag-uz { + background-image: url("../images/flags/uz.svg"); +} + +.flag-va { + background-image: url("../images/flags/va.svg"); +} + +.flag-vc { + background-image: url("../images/flags/vc.svg"); +} + +.flag-ve { + background-image: url("../images/flags/ve.svg"); +} + +.flag-vg { + background-image: url("../images/flags/vg.svg"); +} + +.flag-vi { + background-image: url("../images/flags/vi.svg"); +} + +.flag-vn { + background-image: url("../images/flags/vn.svg"); +} + +.flag-vu { + background-image: url("../images/flags/vu.svg"); +} + +.flag-wf { + background-image: url("../images/flags/wf.svg"); +} + +.flag-ws { + background-image: url("../images/flags/ws.svg"); +} + +.flag-ye { + background-image: url("../images/flags/ye.svg"); +} + +.flag-yt { + background-image: url("../images/flags/yt.svg"); +} + +.flag-za { + background-image: url("../images/flags/za.svg"); +} + +.flag-zm { + background-image: url("../images/flags/zm.svg"); +} + +.flag-zw { + background-image: url("../images/flags/zw.svg"); +} + +.payment { + width: 2.5rem; + height: 1.5rem; + display: inline-block; + background: no-repeat center/100% 100%; + vertical-align: bottom; + font-style: normal; + box-shadow: 0 0 1px 1px rgba(0, 0, 0, 0.1); + border-radius: 2px; +} + +.payment-2checkout-dark { + background-image: url("../images/payments/2checkout-dark.svg"); +} + +.payment-2checkout { + background-image: url("../images/payments/2checkout.svg"); +} + +.payment-alipay-dark { + background-image: url("../images/payments/alipay-dark.svg"); +} + +.payment-alipay { + background-image: url("../images/payments/alipay.svg"); +} + +.payment-amazon-dark { + background-image: url("../images/payments/amazon-dark.svg"); +} + +.payment-amazon { + background-image: url("../images/payments/amazon.svg"); +} + +.payment-americanexpress-dark { + background-image: url("../images/payments/americanexpress-dark.svg"); +} + +.payment-americanexpress { + background-image: url("../images/payments/americanexpress.svg"); +} + +.payment-applepay-dark { + background-image: url("../images/payments/applepay-dark.svg"); +} + +.payment-applepay { + background-image: url("../images/payments/applepay.svg"); +} + +.payment-bancontact-dark { + background-image: url("../images/payments/bancontact-dark.svg"); +} + +.payment-bancontact { + background-image: url("../images/payments/bancontact.svg"); +} + +.payment-bitcoin-dark { + background-image: url("../images/payments/bitcoin-dark.svg"); +} + +.payment-bitcoin { + background-image: url("../images/payments/bitcoin.svg"); +} + +.payment-bitpay-dark { + background-image: url("../images/payments/bitpay-dark.svg"); +} + +.payment-bitpay { + background-image: url("../images/payments/bitpay.svg"); +} + +.payment-cirrus-dark { + background-image: url("../images/payments/cirrus-dark.svg"); +} + +.payment-cirrus { + background-image: url("../images/payments/cirrus.svg"); +} + +.payment-clickandbuy-dark { + background-image: url("../images/payments/clickandbuy-dark.svg"); +} + +.payment-clickandbuy { + background-image: url("../images/payments/clickandbuy.svg"); +} + +.payment-coinkite-dark { + background-image: url("../images/payments/coinkite-dark.svg"); +} + +.payment-coinkite { + background-image: url("../images/payments/coinkite.svg"); +} + +.payment-dinersclub-dark { + background-image: url("../images/payments/dinersclub-dark.svg"); +} + +.payment-dinersclub { + background-image: url("../images/payments/dinersclub.svg"); +} + +.payment-directdebit-dark { + background-image: url("../images/payments/directdebit-dark.svg"); +} + +.payment-directdebit { + background-image: url("../images/payments/directdebit.svg"); +} + +.payment-discover-dark { + background-image: url("../images/payments/discover-dark.svg"); +} + +.payment-discover { + background-image: url("../images/payments/discover.svg"); +} + +.payment-dwolla-dark { + background-image: url("../images/payments/dwolla-dark.svg"); +} + +.payment-dwolla { + background-image: url("../images/payments/dwolla.svg"); +} + +.payment-ebay-dark { + background-image: url("../images/payments/ebay-dark.svg"); +} + +.payment-ebay { + background-image: url("../images/payments/ebay.svg"); +} + +.payment-eway-dark { + background-image: url("../images/payments/eway-dark.svg"); +} + +.payment-eway { + background-image: url("../images/payments/eway.svg"); +} + +.payment-giropay-dark { + background-image: url("../images/payments/giropay-dark.svg"); +} + +.payment-giropay { + background-image: url("../images/payments/giropay.svg"); +} + +.payment-googlewallet-dark { + background-image: url("../images/payments/googlewallet-dark.svg"); +} + +.payment-googlewallet { + background-image: url("../images/payments/googlewallet.svg"); +} + +.payment-ingenico-dark { + background-image: url("../images/payments/ingenico-dark.svg"); +} + +.payment-ingenico { + background-image: url("../images/payments/ingenico.svg"); +} + +.payment-jcb-dark { + background-image: url("../images/payments/jcb-dark.svg"); +} + +.payment-jcb { + background-image: url("../images/payments/jcb.svg"); +} + +.payment-klarna-dark { + background-image: url("../images/payments/klarna-dark.svg"); +} + +.payment-klarna { + background-image: url("../images/payments/klarna.svg"); +} + +.payment-laser-dark { + background-image: url("../images/payments/laser-dark.svg"); +} + +.payment-laser { + background-image: url("../images/payments/laser.svg"); +} + +.payment-maestro-dark { + background-image: url("../images/payments/maestro-dark.svg"); +} + +.payment-maestro { + background-image: url("../images/payments/maestro.svg"); +} + +.payment-mastercard-dark { + background-image: url("../images/payments/mastercard-dark.svg"); +} + +.payment-mastercard { + background-image: url("../images/payments/mastercard.svg"); +} + +.payment-monero-dark { + background-image: url("../images/payments/monero-dark.svg"); +} + +.payment-monero { + background-image: url("../images/payments/monero.svg"); +} + +.payment-neteller-dark { + background-image: url("../images/payments/neteller-dark.svg"); +} + +.payment-neteller { + background-image: url("../images/payments/neteller.svg"); +} + +.payment-ogone-dark { + background-image: url("../images/payments/ogone-dark.svg"); +} + +.payment-ogone { + background-image: url("../images/payments/ogone.svg"); +} + +.payment-okpay-dark { + background-image: url("../images/payments/okpay-dark.svg"); +} + +.payment-okpay { + background-image: url("../images/payments/okpay.svg"); +} + +.payment-paybox-dark { + background-image: url("../images/payments/paybox-dark.svg"); +} + +.payment-paybox { + background-image: url("../images/payments/paybox.svg"); +} + +.payment-paymill-dark { + background-image: url("../images/payments/paymill-dark.svg"); +} + +.payment-paymill { + background-image: url("../images/payments/paymill.svg"); +} + +.payment-payone-dark { + background-image: url("../images/payments/payone-dark.svg"); +} + +.payment-payone { + background-image: url("../images/payments/payone.svg"); +} + +.payment-payoneer-dark { + background-image: url("../images/payments/payoneer-dark.svg"); +} + +.payment-payoneer { + background-image: url("../images/payments/payoneer.svg"); +} + +.payment-paypal-dark { + background-image: url("../images/payments/paypal-dark.svg"); +} + +.payment-paypal { + background-image: url("../images/payments/paypal.svg"); +} + +.payment-paysafecard-dark { + background-image: url("../images/payments/paysafecard-dark.svg"); +} + +.payment-paysafecard { + background-image: url("../images/payments/paysafecard.svg"); +} + +.payment-payu-dark { + background-image: url("../images/payments/payu-dark.svg"); +} + +.payment-payu { + background-image: url("../images/payments/payu.svg"); +} + +.payment-payza-dark { + background-image: url("../images/payments/payza-dark.svg"); +} + +.payment-payza { + background-image: url("../images/payments/payza.svg"); +} + +.payment-ripple-dark { + background-image: url("../images/payments/ripple-dark.svg"); +} + +.payment-ripple { + background-image: url("../images/payments/ripple.svg"); +} + +.payment-sage-dark { + background-image: url("../images/payments/sage-dark.svg"); +} + +.payment-sage { + background-image: url("../images/payments/sage.svg"); +} + +.payment-sepa-dark { + background-image: url("../images/payments/sepa-dark.svg"); +} + +.payment-sepa { + background-image: url("../images/payments/sepa.svg"); +} + +.payment-shopify-dark { + background-image: url("../images/payments/shopify-dark.svg"); +} + +.payment-shopify { + background-image: url("../images/payments/shopify.svg"); +} + +.payment-skrill-dark { + background-image: url("../images/payments/skrill-dark.svg"); +} + +.payment-skrill { + background-image: url("../images/payments/skrill.svg"); +} + +.payment-solo-dark { + background-image: url("../images/payments/solo-dark.svg"); +} + +.payment-solo { + background-image: url("../images/payments/solo.svg"); +} + +.payment-square-dark { + background-image: url("../images/payments/square-dark.svg"); +} + +.payment-square { + background-image: url("../images/payments/square.svg"); +} + +.payment-stripe-dark { + background-image: url("../images/payments/stripe-dark.svg"); +} + +.payment-stripe { + background-image: url("../images/payments/stripe.svg"); +} + +.payment-switch-dark { + background-image: url("../images/payments/switch-dark.svg"); +} + +.payment-switch { + background-image: url("../images/payments/switch.svg"); +} + +.payment-ukash-dark { + background-image: url("../images/payments/ukash-dark.svg"); +} + +.payment-ukash { + background-image: url("../images/payments/ukash.svg"); +} + +.payment-unionpay-dark { + background-image: url("../images/payments/unionpay-dark.svg"); +} + +.payment-unionpay { + background-image: url("../images/payments/unionpay.svg"); +} + +.payment-verifone-dark { + background-image: url("../images/payments/verifone-dark.svg"); +} + +.payment-verifone { + background-image: url("../images/payments/verifone.svg"); +} + +.payment-verisign-dark { + background-image: url("../images/payments/verisign-dark.svg"); +} + +.payment-verisign { + background-image: url("../images/payments/verisign.svg"); +} + +.payment-visa-dark { + background-image: url("../images/payments/visa-dark.svg"); +} + +.payment-visa { + background-image: url("../images/payments/visa.svg"); +} + +.payment-webmoney-dark { + background-image: url("../images/payments/webmoney-dark.svg"); +} + +.payment-webmoney { + background-image: url("../images/payments/webmoney.svg"); +} + +.payment-westernunion-dark { + background-image: url("../images/payments/westernunion-dark.svg"); +} + +.payment-westernunion { + background-image: url("../images/payments/westernunion.svg"); +} + +.payment-worldpay-dark { + background-image: url("../images/payments/worldpay-dark.svg"); +} + +.payment-worldpay { + background-image: url("../images/payments/worldpay.svg"); +} + +svg { + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-container { + width: 100%; + height: 100%; + position: relative; + overflow: hidden; + -ms-touch-action: none; + touch-action: none; +} + +.jvectormap-tip { + position: absolute; + display: none; + border-radius: 3px; + background: #212529; + color: white; + padding: 6px; + font-size: 11px; + line-height: 1; + font-weight: 700; +} + +.jvectormap-tip small { + font-size: inherit; + font-weight: 400; +} + +.jvectormap-zoomin, .jvectormap-zoomout, .jvectormap-goback { + position: absolute; + left: 10px; + border-radius: 3px; + background: #292929; + padding: 3px; + color: white; + cursor: pointer; + line-height: 10px; + text-align: center; + box-sizing: content-box; +} + +.jvectormap-zoomin, .jvectormap-zoomout { + width: 10px; + height: 10px; +} + +.jvectormap-zoomin { + top: 10px; +} + +.jvectormap-zoomout { + top: 30px; +} + +.jvectormap-goback { + bottom: 10px; + z-index: 1000; + padding: 6px; +} + +.jvectormap-spinner { + position: absolute; + left: 0; + top: 0; + right: 0; + bottom: 0; + background: center no-repeat url(data:image/gif;base64,R0lGODlhIAAgAPMAAP///wAAAMbGxoSEhLa2tpqamjY2NlZWVtjY2OTk5Ly8vB4eHgQEBAAAAAAAAAAAACH/C05FVFNDQVBFMi4wAwEAAAAh/hpDcmVhdGVkIHdpdGggYWpheGxvYWQuaW5mbwAh+QQJCgAAACwAAAAAIAAgAAAE5xDISWlhperN52JLhSSdRgwVo1ICQZRUsiwHpTJT4iowNS8vyW2icCF6k8HMMBkCEDskxTBDAZwuAkkqIfxIQyhBQBFvAQSDITM5VDW6XNE4KagNh6Bgwe60smQUB3d4Rz1ZBApnFASDd0hihh12BkE9kjAJVlycXIg7CQIFA6SlnJ87paqbSKiKoqusnbMdmDC2tXQlkUhziYtyWTxIfy6BE8WJt5YJvpJivxNaGmLHT0VnOgSYf0dZXS7APdpB309RnHOG5gDqXGLDaC457D1zZ/V/nmOM82XiHRLYKhKP1oZmADdEAAAh+QQJCgAAACwAAAAAIAAgAAAE6hDISWlZpOrNp1lGNRSdRpDUolIGw5RUYhhHukqFu8DsrEyqnWThGvAmhVlteBvojpTDDBUEIFwMFBRAmBkSgOrBFZogCASwBDEY/CZSg7GSE0gSCjQBMVG023xWBhklAnoEdhQEfyNqMIcKjhRsjEdnezB+A4k8gTwJhFuiW4dokXiloUepBAp5qaKpp6+Ho7aWW54wl7obvEe0kRuoplCGepwSx2jJvqHEmGt6whJpGpfJCHmOoNHKaHx61WiSR92E4lbFoq+B6QDtuetcaBPnW6+O7wDHpIiK9SaVK5GgV543tzjgGcghAgAh+QQJCgAAACwAAAAAIAAgAAAE7hDISSkxpOrN5zFHNWRdhSiVoVLHspRUMoyUakyEe8PTPCATW9A14E0UvuAKMNAZKYUZCiBMuBakSQKG8G2FzUWox2AUtAQFcBKlVQoLgQReZhQlCIJesQXI5B0CBnUMOxMCenoCfTCEWBsJColTMANldx15BGs8B5wlCZ9Po6OJkwmRpnqkqnuSrayqfKmqpLajoiW5HJq7FL1Gr2mMMcKUMIiJgIemy7xZtJsTmsM4xHiKv5KMCXqfyUCJEonXPN2rAOIAmsfB3uPoAK++G+w48edZPK+M6hLJpQg484enXIdQFSS1u6UhksENEQAAIfkECQoAAAAsAAAAACAAIAAABOcQyEmpGKLqzWcZRVUQnZYg1aBSh2GUVEIQ2aQOE+G+cD4ntpWkZQj1JIiZIogDFFyHI0UxQwFugMSOFIPJftfVAEoZLBbcLEFhlQiqGp1Vd140AUklUN3eCA51C1EWMzMCezCBBmkxVIVHBWd3HHl9JQOIJSdSnJ0TDKChCwUJjoWMPaGqDKannasMo6WnM562R5YluZRwur0wpgqZE7NKUm+FNRPIhjBJxKZteWuIBMN4zRMIVIhffcgojwCF117i4nlLnY5ztRLsnOk+aV+oJY7V7m76PdkS4trKcdg0Zc0tTcKkRAAAIfkECQoAAAAsAAAAACAAIAAABO4QyEkpKqjqzScpRaVkXZWQEximw1BSCUEIlDohrft6cpKCk5xid5MNJTaAIkekKGQkWyKHkvhKsR7ARmitkAYDYRIbUQRQjWBwJRzChi9CRlBcY1UN4g0/VNB0AlcvcAYHRyZPdEQFYV8ccwR5HWxEJ02YmRMLnJ1xCYp0Y5idpQuhopmmC2KgojKasUQDk5BNAwwMOh2RtRq5uQuPZKGIJQIGwAwGf6I0JXMpC8C7kXWDBINFMxS4DKMAWVWAGYsAdNqW5uaRxkSKJOZKaU3tPOBZ4DuK2LATgJhkPJMgTwKCdFjyPHEnKxFCDhEAACH5BAkKAAAALAAAAAAgACAAAATzEMhJaVKp6s2nIkolIJ2WkBShpkVRWqqQrhLSEu9MZJKK9y1ZrqYK9WiClmvoUaF8gIQSNeF1Er4MNFn4SRSDARWroAIETg1iVwuHjYB1kYc1mwruwXKC9gmsJXliGxc+XiUCby9ydh1sOSdMkpMTBpaXBzsfhoc5l58Gm5yToAaZhaOUqjkDgCWNHAULCwOLaTmzswadEqggQwgHuQsHIoZCHQMMQgQGubVEcxOPFAcMDAYUA85eWARmfSRQCdcMe0zeP1AAygwLlJtPNAAL19DARdPzBOWSm1brJBi45soRAWQAAkrQIykShQ9wVhHCwCQCACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiRMDjI0Fd30/iI2UA5GSS5UDj2l6NoqgOgN4gksEBgYFf0FDqKgHnyZ9OX8HrgYHdHpcHQULXAS2qKpENRg7eAMLC7kTBaixUYFkKAzWAAnLC7FLVxLWDBLKCwaKTULgEwbLA4hJtOkSBNqITT3xEgfLpBtzE/jiuL04RGEBgwWhShRgQExHBAAh+QQJCgAAACwAAAAAIAAgAAAE7xDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfZiCqGk5dTESJeaOAlClzsJsqwiJwiqnFrb2nS9kmIcgEsjQydLiIlHehhpejaIjzh9eomSjZR+ipslWIRLAgMDOR2DOqKogTB9pCUJBagDBXR6XB0EBkIIsaRsGGMMAxoDBgYHTKJiUYEGDAzHC9EACcUGkIgFzgwZ0QsSBcXHiQvOwgDdEwfFs0sDzt4S6BK4xYjkDOzn0unFeBzOBijIm1Dgmg5YFQwsCMjp1oJ8LyIAACH5BAkKAAAALAAAAAAgACAAAATwEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GGl6NoiPOH16iZKNlH6KmyWFOggHhEEvAwwMA0N9GBsEC6amhnVcEwavDAazGwIDaH1ipaYLBUTCGgQDA8NdHz0FpqgTBwsLqAbWAAnIA4FWKdMLGdYGEgraigbT0OITBcg5QwPT4xLrROZL6AuQAPUS7bxLpoWidY0JtxLHKhwwMJBTHgPKdEQAACH5BAkKAAAALAAAAAAgACAAAATrEMhJaVKp6s2nIkqFZF2VIBWhUsJaTokqUCoBq+E71SRQeyqUToLA7VxF0JDyIQh/MVVPMt1ECZlfcjZJ9mIKoaTl1MRIl5o4CUKXOwmyrCInCKqcWtvadL2SYhyASyNDJ0uIiUd6GAULDJCRiXo1CpGXDJOUjY+Yip9DhToJA4RBLwMLCwVDfRgbBAaqqoZ1XBMHswsHtxtFaH1iqaoGNgAIxRpbFAgfPQSqpbgGBqUD1wBXeCYp1AYZ19JJOYgH1KwA4UBvQwXUBxPqVD9L3sbp2BNk2xvvFPJd+MFCN6HAAIKgNggY0KtEBAAh+QQJCgAAACwAAAAAIAAgAAAE6BDISWlSqerNpyJKhWRdlSAVoVLCWk6JKlAqAavhO9UkUHsqlE6CwO1cRdCQ8iEIfzFVTzLdRAmZX3I2SfYIDMaAFdTESJeaEDAIMxYFqrOUaNW4E4ObYcCXaiBVEgULe0NJaxxtYksjh2NLkZISgDgJhHthkpU4mW6blRiYmZOlh4JWkDqILwUGBnE6TYEbCgevr0N1gH4At7gHiRpFaLNrrq8HNgAJA70AWxQIH1+vsYMDAzZQPC9VCNkDWUhGkuE5PxJNwiUK4UfLzOlD4WvzAHaoG9nxPi5d+jYUqfAhhykOFwJWiAAAIfkECQoAAAAsAAAAACAAIAAABPAQyElpUqnqzaciSoVkXVUMFaFSwlpOCcMYlErAavhOMnNLNo8KsZsMZItJEIDIFSkLGQoQTNhIsFehRww2CQLKF0tYGKYSg+ygsZIuNqJksKgbfgIGepNo2cIUB3V1B3IvNiBYNQaDSTtfhhx0CwVPI0UJe0+bm4g5VgcGoqOcnjmjqDSdnhgEoamcsZuXO1aWQy8KAwOAuTYYGwi7w5h+Kr0SJ8MFihpNbx+4Erq7BYBuzsdiH1jCAzoSfl0rVirNbRXlBBlLX+BP0XJLAPGzTkAuAOqb0WT5AH7OcdCm5B8TgRwSRKIHQtaLCwg1RAAAOwAAAAAAAAAAAA==); +} + +.jvectormap-legend-title { + font-weight: bold; + font-size: 14px; + text-align: center; +} + +.jvectormap-legend-cnt { + position: absolute; +} + +.jvectormap-legend-cnt-h { + bottom: 0; + right: 0; +} + +.jvectormap-legend-cnt-v { + top: 0; + right: 0; +} + +.jvectormap-legend { + background: black; + color: white; + border-radius: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend { + float: left; + margin: 0 10px 10px 0; + padding: 3px 3px 1px 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend .jvectormap-legend-tick { + float: left; +} + +.jvectormap-legend-cnt-v .jvectormap-legend { + margin: 10px 10px 0 0; + padding: 3px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick { + width: 40px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-sample { + height: 15px; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-sample { + height: 20px; + width: 20px; + display: inline-block; + vertical-align: middle; +} + +.jvectormap-legend-tick-text { + font-size: 12px; +} + +.jvectormap-legend-cnt-h .jvectormap-legend-tick-text { + text-align: center; +} + +.jvectormap-legend-cnt-v .jvectormap-legend-tick-text { + display: inline-block; + vertical-align: middle; + line-height: 20px; + padding-left: 3px; +} + +/** + * selectize.css (v0.12.4) + * Copyright (c) 2013–2015 Brian Reavis & contributors + * + * Licensed under the Apache License, Version 2.0 (the "License"); you may not use this + * file except in compliance with the License. You may obtain a copy of the License at: + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software distributed under + * the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF + * ANY KIND, either express or implied. See the License for the specific language + * governing permissions and limitations under the License. + * + * @author Brian Reavis + */ +.selectize-control.plugin-drag_drop.multi > .selectize-input > div.ui-sortable-placeholder { + visibility: visible !important; + background: #f2f2f2 !important; + background: rgba(0, 0, 0, 0.06) !important; + border: 0 none !important; + box-shadow: inset 0 0 12px 4px #fff; +} + +.selectize-control.plugin-drag_drop .ui-sortable-placeholder::after { + content: '!'; + visibility: hidden; +} + +.selectize-control.plugin-drag_drop .ui-sortable-helper { + box-shadow: 0 2px 5px rgba(0, 0, 0, 0.2); +} + +.selectize-dropdown-header { + position: relative; + padding: 5px 8px; + border-bottom: 1px solid #d0d0d0; + background: #f8f8f8; + border-radius: 3px 3px 0 0; +} + +.selectize-dropdown-header-close { + position: absolute; + right: 8px; + top: 50%; + color: #495057; + opacity: 0.4; + margin-top: -12px; + line-height: 20px; + font-size: 20px !important; +} + +.selectize-dropdown-header-close:hover { + color: #000; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup { + border-right: 1px solid #f2f2f2; + border-top: 0 none; + float: left; + box-sizing: border-box; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:last-child { + border-right: 0 none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup:before { + display: none; +} + +.selectize-dropdown.plugin-optgroup_columns .optgroup-header { + border-top: 0 none; +} + +.selectize-control.plugin-remove_button [data-value] { + position: relative; + padding-right: 24px !important; +} + +.selectize-control.plugin-remove_button [data-value] .remove { + z-index: 1; + /* fixes ie bug (see #392) */ + position: absolute; + top: 0; + right: 0; + bottom: 0; + width: 17px; + text-align: center; + font-weight: bold; + font-size: 12px; + color: inherit; + text-decoration: none; + vertical-align: middle; + display: inline-block; + padding: 2px 0 0 0; + border-left: 1px solid #d0d0d0; + border-radius: 0 2px 2px 0; + box-sizing: border-box; +} + +.selectize-control.plugin-remove_button [data-value] .remove:hover { + background: rgba(0, 0, 0, 0.05); +} + +.selectize-control.plugin-remove_button [data-value].active .remove { + border-left-color: #cacaca; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove:hover { + background: none; +} + +.selectize-control.plugin-remove_button .disabled [data-value] .remove { + border-left-color: #fff; +} + +.selectize-control.plugin-remove_button .remove-single { + position: absolute; + right: 28px; + top: 6px; + font-size: 23px; +} + +.selectize-control { + position: relative; + padding: 0; + border: 0; +} + +.selectize-dropdown, +.selectize-input, +.selectize-input input { + color: #495057; + font-family: inherit; + font-size: 15px; + line-height: 18px; + -webkit-font-smoothing: inherit; +} + +.selectize-input, +.selectize-control.single .selectize-input.input-active { + background: #fff; + cursor: text; + display: inline-block; +} + +.selectize-input { + border: 1px solid rgba(0, 40, 100, 0.12); + padding: 0.5625rem 0.75rem; + display: inline-block; + display: block; + width: 100%; + overflow: hidden; + position: relative; + z-index: 1; + box-sizing: border-box; + border-radius: 3px; + transition: .3s border-color, .3s box-shadow; +} + +.selectize-control.multi .selectize-input.has-items { + padding: 7px 0.75rem 4px 7px; +} + +.selectize-input.full { + background-color: #fff; +} + +.selectize-input.disabled, +.selectize-input.disabled * { + cursor: default !important; +} + +.selectize-input.focus { + border-color: #467fcf; + box-shadow: 0 0 0 2px rgba(70, 127, 207, 0.25); +} + +.selectize-input.dropdown-active { + border-radius: 3px 3px 0 0; +} + +.selectize-input > * { + vertical-align: baseline; + display: -moz-inline-stack; + display: inline-block; + zoom: 1; + *display: inline; +} + +.selectize-control.multi .selectize-input > div { + cursor: pointer; + margin: 0 3px 3px 0; + padding: 2px 6px; + background: #e9ecef; + color: #495057; + font-size: 13px; + border: 0 solid rgba(0, 40, 100, 0.12); + border-radius: 3px; + font-weight: 400; +} + +.selectize-control.multi .selectize-input > div.active { + background: #e8e8e8; + color: #303030; + border: 0 solid #cacaca; +} + +.selectize-control.multi .selectize-input.disabled > div, +.selectize-control.multi .selectize-input.disabled > div.active { + color: #7d7d7d; + background: #fff; + border: 0 solid #fff; +} + +.selectize-input > input { + display: inline-block !important; + padding: 0 !important; + min-height: 0 !important; + max-height: none !important; + max-width: 100% !important; + margin: 0 2px 0 0 !important; + text-indent: 0 !important; + border: 0 none !important; + background: none !important; + line-height: inherit !important; + box-shadow: none !important; +} + +.selectize-input > input::-ms-clear { + display: none; +} + +.selectize-input > input:focus { + outline: none !important; +} + +.selectize-input::after { + content: ' '; + display: block; + clear: left; +} + +.selectize-input.dropdown-active::before { + content: ' '; + display: block; + position: absolute; + background: #f0f0f0; + height: 1px; + bottom: 0; + left: 0; + right: 0; +} + +.selectize-dropdown { + position: absolute; + z-index: 10; + border: 1px solid rgba(0, 40, 100, 0.12); + background: #fff; + margin: -1px 0 0 0; + border-top: 0 none; + box-sizing: border-box; + border-radius: 0 0 3px 3px; + height: auto; + padding: 0; +} + +.selectize-dropdown [data-selectable] { + cursor: pointer; + overflow: hidden; +} + +.selectize-dropdown [data-selectable] .highlight { + background: rgba(125, 168, 208, 0.2); + border-radius: 1px; +} + +.selectize-dropdown [data-selectable], +.selectize-dropdown .optgroup-header { + padding: 6px .75rem; +} + +.selectize-dropdown .optgroup:first-child .optgroup-header { + border-top: 0 none; +} + +.selectize-dropdown .optgroup-header { + color: #495057; + background: #fff; + cursor: default; +} + +.selectize-dropdown .active { + background-color: #F1F4F8; + color: #467fcf; +} + +.selectize-dropdown .active.create { + color: #495057; +} + +.selectize-dropdown .create { + color: rgba(48, 48, 48, 0.5); +} + +.selectize-dropdown-content { + overflow-y: auto; + overflow-x: hidden; + max-height: 200px; + -webkit-overflow-scrolling: touch; +} + +.selectize-control.single .selectize-input, +.selectize-control.single .selectize-input input { + cursor: pointer; +} + +.selectize-control.single .selectize-input.input-active, +.selectize-control.single .selectize-input.input-active input { + cursor: text; +} + +.selectize-control.single .selectize-input:after { + content: ''; + display: block; + position: absolute; + top: 13px; + right: 12px; + width: 8px; + height: 10px; + background: #fff url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 10 5'%3E%3Cpath fill='#999' d='M0 0L10 0L5 5L0 0'/%3E%3C/svg%3E") no-repeat center; + background-size: 8px 10px; + transition: .3s transform; +} + +.selectize-control.single .selectize-input.dropdown-active:after { + -webkit-transform: rotate(180deg); + transform: rotate(180deg); +} + +.selectize-control .selectize-input.disabled { + opacity: 0.5; + background-color: #fafafa; +} + +.selectize-dropdown .image, +.selectize-input .image { + width: 1.25rem; + height: 1.25rem; + background-size: contain; + margin: -1px .5rem -1px -4px; + line-height: 1.25rem; + float: left; + display: -ms-flexbox; + display: flex; + -ms-flex-align: center; + align-items: center; + -ms-flex-pack: center; + justify-content: center; +} + +.selectize-dropdown .image img, +.selectize-input .image img { + max-width: 100%; + box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.4); + border-radius: 2px; +} + +.selectize-input .image { + width: 1.5rem; + height: 1.5rem; + margin: -3px .75rem -3px -5px; +} + +@font-face { + font-family: "feather"; + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106"); + /* IE9*/ + src: url("../fonts/feather/feather-webfont.eot?t=1501841394106#iefix") format("embedded-opentype"), url("../fonts/feather/feather-webfont.woff?t=1501841394106") format("woff"), url("../fonts/feather/feather-webfont.ttf?t=1501841394106") format("truetype"), url("../fonts/feather/feather-webfont.svg?t=1501841394106#feather") format("svg"); + /* iOS 4.1- */ +} + +.fe { + font-family: 'feather' !important; + speak: none; + font-style: normal; + font-weight: normal; + font-variant: normal; + text-transform: none; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.fe-activity:before { + content: "\e900"; +} + +.fe-airplay:before { + content: "\e901"; +} + +.fe-alert-circle:before { + content: "\e902"; +} + +.fe-alert-octagon:before { + content: "\e903"; +} + +.fe-alert-triangle:before { + content: "\e904"; +} + +.fe-align-center:before { + content: "\e905"; +} + +.fe-align-justify:before { + content: "\e906"; +} + +.fe-align-left:before { + content: "\e907"; +} + +.fe-align-right:before { + content: "\e908"; +} + +.fe-anchor:before { + content: "\e909"; +} + +.fe-aperture:before { + content: "\e90a"; +} + +.fe-arrow-down:before { + content: "\e90b"; +} + +.fe-arrow-down-circle:before { + content: "\e90c"; +} + +.fe-arrow-down-left:before { + content: "\e90d"; +} + +.fe-arrow-down-right:before { + content: "\e90e"; +} + +.fe-arrow-left:before { + content: "\e90f"; +} + +.fe-arrow-left-circle:before { + content: "\e910"; +} + +.fe-arrow-right:before { + content: "\e911"; +} + +.fe-arrow-right-circle:before { + content: "\e912"; +} + +.fe-arrow-up:before { + content: "\e913"; +} + +.fe-arrow-up-circle:before { + content: "\e914"; +} + +.fe-arrow-up-left:before { + content: "\e915"; +} + +.fe-arrow-up-right:before { + content: "\e916"; +} + +.fe-at-sign:before { + content: "\e917"; +} + +.fe-award:before { + content: "\e918"; +} + +.fe-bar-chart:before { + content: "\e919"; +} + +.fe-bar-chart-2:before { + content: "\e91a"; +} + +.fe-battery:before { + content: "\e91b"; +} + +.fe-battery-charging:before { + content: "\e91c"; +} + +.fe-bell:before { + content: "\e91d"; +} + +.fe-bell-off:before { + content: "\e91e"; +} + +.fe-bluetooth:before { + content: "\e91f"; +} + +.fe-bold:before { + content: "\e920"; +} + +.fe-book:before { + content: "\e921"; +} + +.fe-book-open:before { + content: "\e922"; +} + +.fe-bookmark:before { + content: "\e923"; +} + +.fe-box:before { + content: "\e924"; +} + +.fe-briefcase:before { + content: "\e925"; +} + +.fe-calendar:before { + content: "\e926"; +} + +.fe-camera:before { + content: "\e927"; +} + +.fe-camera-off:before { + content: "\e928"; +} + +.fe-cast:before { + content: "\e929"; +} + +.fe-check:before { + content: "\e92a"; +} + +.fe-check-circle:before { + content: "\e92b"; +} + +.fe-check-square:before { + content: "\e92c"; +} + +.fe-chevron-down:before { + content: "\e92d"; +} + +.fe-chevron-left:before { + content: "\e92e"; +} + +.fe-chevron-right:before { + content: "\e92f"; +} + +.fe-chevron-up:before { + content: "\e930"; +} + +.fe-chevrons-down:before { + content: "\e931"; +} + +.fe-chevrons-left:before { + content: "\e932"; +} + +.fe-chevrons-right:before { + content: "\e933"; +} + +.fe-chevrons-up:before { + content: "\e934"; +} + +.fe-chrome:before { + content: "\e935"; +} + +.fe-circle:before { + content: "\e936"; +} + +.fe-clipboard:before { + content: "\e937"; +} + +.fe-clock:before { + content: "\e938"; +} + +.fe-cloud:before { + content: "\e939"; +} + +.fe-cloud-drizzle:before { + content: "\e93a"; +} + +.fe-cloud-lightning:before { + content: "\e93b"; +} + +.fe-cloud-off:before { + content: "\e93c"; +} + +.fe-cloud-rain:before { + content: "\e93d"; +} + +.fe-cloud-snow:before { + content: "\e93e"; +} + +.fe-code:before { + content: "\e93f"; +} + +.fe-codepen:before { + content: "\e940"; +} + +.fe-command:before { + content: "\e941"; +} + +.fe-compass:before { + content: "\e942"; +} + +.fe-copy:before { + content: "\e943"; +} + +.fe-corner-down-left:before { + content: "\e944"; +} + +.fe-corner-down-right:before { + content: "\e945"; +} + +.fe-corner-left-down:before { + content: "\e946"; +} + +.fe-corner-left-up:before { + content: "\e947"; +} + +.fe-corner-right-down:before { + content: "\e948"; +} + +.fe-corner-right-up:before { + content: "\e949"; +} + +.fe-corner-up-left:before { + content: "\e94a"; +} + +.fe-corner-up-right:before { + content: "\e94b"; +} + +.fe-cpu:before { + content: "\e94c"; +} + +.fe-credit-card:before { + content: "\e94d"; +} + +.fe-crop:before { + content: "\e94e"; +} + +.fe-crosshair:before { + content: "\e94f"; +} + +.fe-database:before { + content: "\e950"; +} + +.fe-delete:before { + content: "\e951"; +} + +.fe-disc:before { + content: "\e952"; +} + +.fe-dollar-sign:before { + content: "\e953"; +} + +.fe-download:before { + content: "\e954"; +} + +.fe-download-cloud:before { + content: "\e955"; +} + +.fe-droplet:before { + content: "\e956"; +} + +.fe-edit:before { + content: "\e957"; +} + +.fe-edit-2:before { + content: "\e958"; +} + +.fe-edit-3:before { + content: "\e959"; +} + +.fe-external-link:before { + content: "\e95a"; +} + +.fe-eye:before { + content: "\e95b"; +} + +.fe-eye-off:before { + content: "\e95c"; +} + +.fe-facebook:before { + content: "\e95d"; +} + +.fe-fast-forward:before { + content: "\e95e"; +} + +.fe-feather:before { + content: "\e95f"; +} + +.fe-file:before { + content: "\e960"; +} + +.fe-file-minus:before { + content: "\e961"; +} + +.fe-file-plus:before { + content: "\e962"; +} + +.fe-file-text:before { + content: "\e963"; +} + +.fe-film:before { + content: "\e964"; +} + +.fe-filter:before { + content: "\e965"; +} + +.fe-flag:before { + content: "\e966"; +} + +.fe-folder:before { + content: "\e967"; +} + +.fe-folder-minus:before { + content: "\e968"; +} + +.fe-folder-plus:before { + content: "\e969"; +} + +.fe-git-branch:before { + content: "\e96a"; +} + +.fe-git-commit:before { + content: "\e96b"; +} + +.fe-git-merge:before { + content: "\e96c"; +} + +.fe-git-pull-request:before { + content: "\e96d"; +} + +.fe-github:before { + content: "\e96e"; +} + +.fe-gitlab:before { + content: "\e96f"; +} + +.fe-globe:before { + content: "\e970"; +} + +.fe-grid:before { + content: "\e971"; +} + +.fe-hard-drive:before { + content: "\e972"; +} + +.fe-hash:before { + content: "\e973"; +} + +.fe-headphones:before { + content: "\e974"; +} + +.fe-heart:before { + content: "\e975"; +} + +.fe-help-circle:before { + content: "\e976"; +} + +.fe-home:before { + content: "\e977"; +} + +.fe-image:before { + content: "\e978"; +} + +.fe-inbox:before { + content: "\e979"; +} + +.fe-info:before { + content: "\e97a"; +} + +.fe-instagram:before { + content: "\e97b"; +} + +.fe-italic:before { + content: "\e97c"; +} + +.fe-layers:before { + content: "\e97d"; +} + +.fe-layout:before { + content: "\e97e"; +} + +.fe-life-buoy:before { + content: "\e97f"; +} + +.fe-link:before { + content: "\e980"; +} + +.fe-link-2:before { + content: "\e981"; +} + +.fe-linkedin:before { + content: "\e982"; +} + +.fe-list:before { + content: "\e983"; +} + +.fe-loader:before { + content: "\e984"; +} + +.fe-lock:before { + content: "\e985"; +} + +.fe-log-in:before { + content: "\e986"; +} + +.fe-log-out:before { + content: "\e987"; +} + +.fe-mail:before { + content: "\e988"; +} + +.fe-map:before { + content: "\e989"; +} + +.fe-map-pin:before { + content: "\e98a"; +} + +.fe-maximize:before { + content: "\e98b"; +} + +.fe-maximize-2:before { + content: "\e98c"; +} + +.fe-menu:before { + content: "\e98d"; +} + +.fe-message-circle:before { + content: "\e98e"; +} + +.fe-message-square:before { + content: "\e98f"; +} + +.fe-mic:before { + content: "\e990"; +} + +.fe-mic-off:before { + content: "\e991"; +} + +.fe-minimize:before { + content: "\e992"; +} + +.fe-minimize-2:before { + content: "\e993"; +} + +.fe-minus:before { + content: "\e994"; +} + +.fe-minus-circle:before { + content: "\e995"; +} + +.fe-minus-square:before { + content: "\e996"; +} + +.fe-monitor:before { + content: "\e997"; +} + +.fe-moon:before { + content: "\e998"; +} + +.fe-more-horizontal:before { + content: "\e999"; +} + +.fe-more-vertical:before { + content: "\e99a"; +} + +.fe-move:before { + content: "\e99b"; +} + +.fe-music:before { + content: "\e99c"; +} + +.fe-navigation:before { + content: "\e99d"; +} + +.fe-navigation-2:before { + content: "\e99e"; +} + +.fe-octagon:before { + content: "\e99f"; +} + +.fe-package:before { + content: "\e9a0"; +} + +.fe-paperclip:before { + content: "\e9a1"; +} + +.fe-pause:before { + content: "\e9a2"; +} + +.fe-pause-circle:before { + content: "\e9a3"; +} + +.fe-percent:before { + content: "\e9a4"; +} + +.fe-phone:before { + content: "\e9a5"; +} + +.fe-phone-call:before { + content: "\e9a6"; +} + +.fe-phone-forwarded:before { + content: "\e9a7"; +} + +.fe-phone-incoming:before { + content: "\e9a8"; +} + +.fe-phone-missed:before { + content: "\e9a9"; +} + +.fe-phone-off:before { + content: "\e9aa"; +} + +.fe-phone-outgoing:before { + content: "\e9ab"; +} + +.fe-pie-chart:before { + content: "\e9ac"; +} + +.fe-play:before { + content: "\e9ad"; +} + +.fe-play-circle:before { + content: "\e9ae"; +} + +.fe-plus:before { + content: "\e9af"; +} + +.fe-plus-circle:before { + content: "\e9b0"; +} + +.fe-plus-square:before { + content: "\e9b1"; +} + +.fe-pocket:before { + content: "\e9b2"; +} + +.fe-power:before { + content: "\e9b3"; +} + +.fe-printer:before { + content: "\e9b4"; +} + +.fe-radio:before { + content: "\e9b5"; +} + +.fe-refresh-ccw:before { + content: "\e9b6"; +} + +.fe-refresh-cw:before { + content: "\e9b7"; +} + +.fe-repeat:before { + content: "\e9b8"; +} + +.fe-rewind:before { + content: "\e9b9"; +} + +.fe-rotate-ccw:before { + content: "\e9ba"; +} + +.fe-rotate-cw:before { + content: "\e9bb"; +} + +.fe-rss:before { + content: "\e9bc"; +} + +.fe-save:before { + content: "\e9bd"; +} + +.fe-scissors:before { + content: "\e9be"; +} + +.fe-search:before { + content: "\e9bf"; +} + +.fe-send:before { + content: "\e9c0"; +} + +.fe-server:before { + content: "\e9c1"; +} + +.fe-settings:before { + content: "\e9c2"; +} + +.fe-share:before { + content: "\e9c3"; +} + +.fe-share-2:before { + content: "\e9c4"; +} + +.fe-shield:before { + content: "\e9c5"; +} + +.fe-shield-off:before { + content: "\e9c6"; +} + +.fe-shopping-bag:before { + content: "\e9c7"; +} + +.fe-shopping-cart:before { + content: "\e9c8"; +} + +.fe-shuffle:before { + content: "\e9c9"; +} + +.fe-sidebar:before { + content: "\e9ca"; +} + +.fe-skip-back:before { + content: "\e9cb"; +} + +.fe-skip-forward:before { + content: "\e9cc"; +} + +.fe-slack:before { + content: "\e9cd"; +} + +.fe-slash:before { + content: "\e9ce"; +} + +.fe-sliders:before { + content: "\e9cf"; +} + +.fe-smartphone:before { + content: "\e9d0"; +} + +.fe-speaker:before { + content: "\e9d1"; +} + +.fe-square:before { + content: "\e9d2"; +} + +.fe-star:before { + content: "\e9d3"; +} + +.fe-stop-circle:before { + content: "\e9d4"; +} + +.fe-sun:before { + content: "\e9d5"; +} + +.fe-sunrise:before { + content: "\e9d6"; +} + +.fe-sunset:before { + content: "\e9d7"; +} + +.fe-tablet:before { + content: "\e9d8"; +} + +.fe-tag:before { + content: "\e9d9"; +} + +.fe-target:before { + content: "\e9da"; +} + +.fe-terminal:before { + content: "\e9db"; +} + +.fe-thermometer:before { + content: "\e9dc"; +} + +.fe-thumbs-down:before { + content: "\e9dd"; +} + +.fe-thumbs-up:before { + content: "\e9de"; +} + +.fe-toggle-left:before { + content: "\e9df"; +} + +.fe-toggle-right:before { + content: "\e9e0"; +} + +.fe-trash:before { + content: "\e9e1"; +} + +.fe-trash-2:before { + content: "\e9e2"; +} + +.fe-trending-down:before { + content: "\e9e3"; +} + +.fe-trending-up:before { + content: "\e9e4"; +} + +.fe-triangle:before { + content: "\e9e5"; +} + +.fe-truck:before { + content: "\e9e6"; +} + +.fe-tv:before { + content: "\e9e7"; +} + +.fe-twitter:before { + content: "\e9e8"; +} + +.fe-type:before { + content: "\e9e9"; +} + +.fe-umbrella:before { + content: "\e9ea"; +} + +.fe-underline:before { + content: "\e9eb"; +} + +.fe-unlock:before { + content: "\e9ec"; +} + +.fe-upload:before { + content: "\e9ed"; +} + +.fe-upload-cloud:before { + content: "\e9ee"; +} + +.fe-user:before { + content: "\e9ef"; +} + +.fe-user-check:before { + content: "\e9f0"; +} + +.fe-user-minus:before { + content: "\e9f1"; +} + +.fe-user-plus:before { + content: "\e9f2"; +} + +.fe-user-x:before { + content: "\e9f3"; +} + +.fe-users:before { + content: "\e9f4"; +} + +.fe-video:before { + content: "\e9f5"; +} + +.fe-video-off:before { + content: "\e9f6"; +} + +.fe-voicemail:before { + content: "\e9f7"; +} + +.fe-volume:before { + content: "\e9f8"; +} + +.fe-volume-1:before { + content: "\e9f9"; +} + +.fe-volume-2:before { + content: "\e9fa"; +} + +.fe-volume-x:before { + content: "\e9fb"; +} + +.fe-watch:before { + content: "\e9fc"; +} + +.fe-wifi:before { + content: "\e9fd"; +} + +.fe-wifi-off:before { + content: "\e9fe"; +} + +.fe-wind:before { + content: "\e9ff"; +} + +.fe-x:before { + content: "\ea00"; +} + +.fe-x-circle:before { + content: "\ea01"; +} + +.fe-x-square:before { + content: "\ea02"; +} + +.fe-zap:before { + content: "\ea03"; +} + +.fe-zap-off:before { + content: "\ea04"; +} + +.fe-zoom-in:before { + content: "\ea05"; +} + +.fe-zoom-out:before { + content: "\ea06"; +} diff --git a/dist/assets/fonts/feather/feather-webfont.eot b/dist/assets/fonts/feather/feather-webfont.eot new file mode 100644 index 000000000..8350e1615 Binary files /dev/null and b/dist/assets/fonts/feather/feather-webfont.eot differ diff --git a/dist/assets/fonts/feather/feather-webfont.svg b/dist/assets/fonts/feather/feather-webfont.svg new file mode 100644 index 000000000..164c09c67 --- /dev/null +++ b/dist/assets/fonts/feather/feather-webfont.svg @@ -0,0 +1,1038 @@ + + + + +Created by FontForge 20170910 at Tue Jan 16 19:54:31 2018 + By jimmywarting + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/dist/assets/fonts/feather/feather-webfont.ttf b/dist/assets/fonts/feather/feather-webfont.ttf new file mode 100644 index 000000000..f75018c80 Binary files /dev/null and b/dist/assets/fonts/feather/feather-webfont.ttf differ diff --git a/dist/assets/fonts/feather/feather-webfont.woff b/dist/assets/fonts/feather/feather-webfont.woff new file mode 100644 index 000000000..8ce9004f7 Binary files /dev/null and b/dist/assets/fonts/feather/feather-webfont.woff differ diff --git a/dist/assets/images/browsers/android-browser.svg b/dist/assets/images/browsers/android-browser.svg new file mode 100644 index 000000000..8065c1c30 --- /dev/null +++ b/dist/assets/images/browsers/android-browser.svg @@ -0,0 +1 @@ +android-browserCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/aol-explorer.svg b/dist/assets/images/browsers/aol-explorer.svg new file mode 100644 index 000000000..77422f434 --- /dev/null +++ b/dist/assets/images/browsers/aol-explorer.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/blackberry.svg b/dist/assets/images/browsers/blackberry.svg new file mode 100644 index 000000000..ea1682cb4 --- /dev/null +++ b/dist/assets/images/browsers/blackberry.svg @@ -0,0 +1 @@ +blackberryCreated with Sketch.Layer 1 \ No newline at end of file diff --git a/dist/assets/images/browsers/camino.svg b/dist/assets/images/browsers/camino.svg new file mode 100644 index 000000000..317a76d3a --- /dev/null +++ b/dist/assets/images/browsers/camino.svg @@ -0,0 +1 @@ +caminoCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/chrome.svg b/dist/assets/images/browsers/chrome.svg new file mode 100644 index 000000000..0a5c3a8b8 --- /dev/null +++ b/dist/assets/images/browsers/chrome.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/chromium.svg b/dist/assets/images/browsers/chromium.svg new file mode 100644 index 000000000..19514f11b --- /dev/null +++ b/dist/assets/images/browsers/chromium.svg @@ -0,0 +1 @@ +image/svg+xml \ No newline at end of file diff --git a/dist/assets/images/browsers/dolphin.svg b/dist/assets/images/browsers/dolphin.svg new file mode 100644 index 000000000..de753f568 --- /dev/null +++ b/dist/assets/images/browsers/dolphin.svg @@ -0,0 +1 @@ +dolphinCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/edge.svg b/dist/assets/images/browsers/edge.svg new file mode 100644 index 000000000..7626d767e --- /dev/null +++ b/dist/assets/images/browsers/edge.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/firefox.svg b/dist/assets/images/browsers/firefox.svg new file mode 100644 index 000000000..6e0299b97 --- /dev/null +++ b/dist/assets/images/browsers/firefox.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/ie.svg b/dist/assets/images/browsers/ie.svg new file mode 100644 index 000000000..015ab2d37 --- /dev/null +++ b/dist/assets/images/browsers/ie.svg @@ -0,0 +1 @@ +image/svg+xml \ No newline at end of file diff --git a/dist/assets/images/browsers/maxthon.svg b/dist/assets/images/browsers/maxthon.svg new file mode 100644 index 000000000..f64fe8de9 --- /dev/null +++ b/dist/assets/images/browsers/maxthon.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/mozilla.svg b/dist/assets/images/browsers/mozilla.svg new file mode 100644 index 000000000..d5774e80c --- /dev/null +++ b/dist/assets/images/browsers/mozilla.svg @@ -0,0 +1 @@ +mozillaCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/netscape.svg b/dist/assets/images/browsers/netscape.svg new file mode 100644 index 000000000..201a165b8 --- /dev/null +++ b/dist/assets/images/browsers/netscape.svg @@ -0,0 +1 @@ +netscapeCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/opera.svg b/dist/assets/images/browsers/opera.svg new file mode 100644 index 000000000..f761fcfcd --- /dev/null +++ b/dist/assets/images/browsers/opera.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/safari.svg b/dist/assets/images/browsers/safari.svg new file mode 100644 index 000000000..3a5b5674f --- /dev/null +++ b/dist/assets/images/browsers/safari.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/browsers/sleipnir.svg b/dist/assets/images/browsers/sleipnir.svg new file mode 100644 index 000000000..a940c5f2d --- /dev/null +++ b/dist/assets/images/browsers/sleipnir.svg @@ -0,0 +1 @@ +slepnir-mobileCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/uc-browser.svg b/dist/assets/images/browsers/uc-browser.svg new file mode 100644 index 000000000..8041f873d --- /dev/null +++ b/dist/assets/images/browsers/uc-browser.svg @@ -0,0 +1 @@ +uc-browserCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/browsers/vivaldi.svg b/dist/assets/images/browsers/vivaldi.svg new file mode 100644 index 000000000..d53054b36 --- /dev/null +++ b/dist/assets/images/browsers/vivaldi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/bitcoin.svg b/dist/assets/images/crypto-currencies/bitcoin.svg new file mode 100644 index 000000000..cae4d6a31 --- /dev/null +++ b/dist/assets/images/crypto-currencies/bitcoin.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/cardano.svg b/dist/assets/images/crypto-currencies/cardano.svg new file mode 100644 index 000000000..b732eef6d --- /dev/null +++ b/dist/assets/images/crypto-currencies/cardano.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/dash.svg b/dist/assets/images/crypto-currencies/dash.svg new file mode 100644 index 000000000..73da05d96 --- /dev/null +++ b/dist/assets/images/crypto-currencies/dash.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/eos.svg b/dist/assets/images/crypto-currencies/eos.svg new file mode 100644 index 000000000..edf882ed4 --- /dev/null +++ b/dist/assets/images/crypto-currencies/eos.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/ethereum.svg b/dist/assets/images/crypto-currencies/ethereum.svg new file mode 100644 index 000000000..45b3820ca --- /dev/null +++ b/dist/assets/images/crypto-currencies/ethereum.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/litecoin.svg b/dist/assets/images/crypto-currencies/litecoin.svg new file mode 100644 index 000000000..109d98dec --- /dev/null +++ b/dist/assets/images/crypto-currencies/litecoin.svg @@ -0,0 +1 @@ +Litecoin \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/nem.svg b/dist/assets/images/crypto-currencies/nem.svg new file mode 100644 index 000000000..327bcab95 --- /dev/null +++ b/dist/assets/images/crypto-currencies/nem.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/crypto-currencies/ripple.svg b/dist/assets/images/crypto-currencies/ripple.svg new file mode 100644 index 000000000..56718617c --- /dev/null +++ b/dist/assets/images/crypto-currencies/ripple.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/faces/female/1.jpg b/dist/assets/images/faces/female/1.jpg new file mode 100755 index 000000000..d873a9a16 Binary files /dev/null and b/dist/assets/images/faces/female/1.jpg differ diff --git a/dist/assets/images/faces/female/10.jpg b/dist/assets/images/faces/female/10.jpg new file mode 100755 index 000000000..f5b6655b5 Binary files /dev/null and b/dist/assets/images/faces/female/10.jpg differ diff --git a/dist/assets/images/faces/female/11.jpg b/dist/assets/images/faces/female/11.jpg new file mode 100755 index 000000000..b51eca5ec Binary files /dev/null and b/dist/assets/images/faces/female/11.jpg differ diff --git a/dist/assets/images/faces/female/12.jpg b/dist/assets/images/faces/female/12.jpg new file mode 100755 index 000000000..c4b48fd39 Binary files /dev/null and b/dist/assets/images/faces/female/12.jpg differ diff --git a/dist/assets/images/faces/female/13.jpg b/dist/assets/images/faces/female/13.jpg new file mode 100755 index 000000000..74d2e3ac9 Binary files /dev/null and b/dist/assets/images/faces/female/13.jpg differ diff --git a/dist/assets/images/faces/female/14.jpg b/dist/assets/images/faces/female/14.jpg new file mode 100755 index 000000000..9e1bbc5bf Binary files /dev/null and b/dist/assets/images/faces/female/14.jpg differ diff --git a/dist/assets/images/faces/female/15.jpg b/dist/assets/images/faces/female/15.jpg new file mode 100755 index 000000000..1a7230a6d Binary files /dev/null and b/dist/assets/images/faces/female/15.jpg differ diff --git a/dist/assets/images/faces/female/16.jpg b/dist/assets/images/faces/female/16.jpg new file mode 100755 index 000000000..284611e8c Binary files /dev/null and b/dist/assets/images/faces/female/16.jpg differ diff --git a/dist/assets/images/faces/female/17.jpg b/dist/assets/images/faces/female/17.jpg new file mode 100755 index 000000000..af26a7a8f Binary files /dev/null and b/dist/assets/images/faces/female/17.jpg differ diff --git a/dist/assets/images/faces/female/18.jpg b/dist/assets/images/faces/female/18.jpg new file mode 100755 index 000000000..d0abd70ac Binary files /dev/null and b/dist/assets/images/faces/female/18.jpg differ diff --git a/dist/assets/images/faces/female/19.jpg b/dist/assets/images/faces/female/19.jpg new file mode 100755 index 000000000..764195ed3 Binary files /dev/null and b/dist/assets/images/faces/female/19.jpg differ diff --git a/dist/assets/images/faces/female/2.jpg b/dist/assets/images/faces/female/2.jpg new file mode 100755 index 000000000..31c2aa075 Binary files /dev/null and b/dist/assets/images/faces/female/2.jpg differ diff --git a/dist/assets/images/faces/female/20.jpg b/dist/assets/images/faces/female/20.jpg new file mode 100755 index 000000000..786465d0a Binary files /dev/null and b/dist/assets/images/faces/female/20.jpg differ diff --git a/dist/assets/images/faces/female/21.jpg b/dist/assets/images/faces/female/21.jpg new file mode 100755 index 000000000..12cc3a044 Binary files /dev/null and b/dist/assets/images/faces/female/21.jpg differ diff --git a/dist/assets/images/faces/female/22.jpg b/dist/assets/images/faces/female/22.jpg new file mode 100755 index 000000000..97fdc8022 Binary files /dev/null and b/dist/assets/images/faces/female/22.jpg differ diff --git a/dist/assets/images/faces/female/23.jpg b/dist/assets/images/faces/female/23.jpg new file mode 100755 index 000000000..d2f501e48 Binary files /dev/null and b/dist/assets/images/faces/female/23.jpg differ diff --git a/dist/assets/images/faces/female/24.jpg b/dist/assets/images/faces/female/24.jpg new file mode 100755 index 000000000..a7509ed31 Binary files /dev/null and b/dist/assets/images/faces/female/24.jpg differ diff --git a/dist/assets/images/faces/female/25.jpg b/dist/assets/images/faces/female/25.jpg new file mode 100755 index 000000000..d939cc624 Binary files /dev/null and b/dist/assets/images/faces/female/25.jpg differ diff --git a/dist/assets/images/faces/female/26.jpg b/dist/assets/images/faces/female/26.jpg new file mode 100755 index 000000000..1276a58bc Binary files /dev/null and b/dist/assets/images/faces/female/26.jpg differ diff --git a/dist/assets/images/faces/female/27.jpg b/dist/assets/images/faces/female/27.jpg new file mode 100755 index 000000000..27c0c75a3 Binary files /dev/null and b/dist/assets/images/faces/female/27.jpg differ diff --git a/dist/assets/images/faces/female/28.jpg b/dist/assets/images/faces/female/28.jpg new file mode 100755 index 000000000..e67a7d2ad Binary files /dev/null and b/dist/assets/images/faces/female/28.jpg differ diff --git a/dist/assets/images/faces/female/29.jpg b/dist/assets/images/faces/female/29.jpg new file mode 100755 index 000000000..277fc94cf Binary files /dev/null and b/dist/assets/images/faces/female/29.jpg differ diff --git a/dist/assets/images/faces/female/3.jpg b/dist/assets/images/faces/female/3.jpg new file mode 100755 index 000000000..6da870fc2 Binary files /dev/null and b/dist/assets/images/faces/female/3.jpg differ diff --git a/dist/assets/images/faces/female/30.jpg b/dist/assets/images/faces/female/30.jpg new file mode 100755 index 000000000..b3047280a Binary files /dev/null and b/dist/assets/images/faces/female/30.jpg differ diff --git a/dist/assets/images/faces/female/31.jpg b/dist/assets/images/faces/female/31.jpg new file mode 100755 index 000000000..9d4b3fd8c Binary files /dev/null and b/dist/assets/images/faces/female/31.jpg differ diff --git a/dist/assets/images/faces/female/32.jpg b/dist/assets/images/faces/female/32.jpg new file mode 100755 index 000000000..89b28cc5d Binary files /dev/null and b/dist/assets/images/faces/female/32.jpg differ diff --git a/dist/assets/images/faces/female/4.jpg b/dist/assets/images/faces/female/4.jpg new file mode 100755 index 000000000..0ecbaf5d5 Binary files /dev/null and b/dist/assets/images/faces/female/4.jpg differ diff --git a/dist/assets/images/faces/female/5.jpg b/dist/assets/images/faces/female/5.jpg new file mode 100755 index 000000000..3399c89ab Binary files /dev/null and b/dist/assets/images/faces/female/5.jpg differ diff --git a/dist/assets/images/faces/female/6.jpg b/dist/assets/images/faces/female/6.jpg new file mode 100755 index 000000000..d8819265c Binary files /dev/null and b/dist/assets/images/faces/female/6.jpg differ diff --git a/dist/assets/images/faces/female/7.jpg b/dist/assets/images/faces/female/7.jpg new file mode 100755 index 000000000..89861700d Binary files /dev/null and b/dist/assets/images/faces/female/7.jpg differ diff --git a/dist/assets/images/faces/female/8.jpg b/dist/assets/images/faces/female/8.jpg new file mode 100755 index 000000000..8c71dcbd8 Binary files /dev/null and b/dist/assets/images/faces/female/8.jpg differ diff --git a/dist/assets/images/faces/female/9.jpg b/dist/assets/images/faces/female/9.jpg new file mode 100755 index 000000000..28deb04d1 Binary files /dev/null and b/dist/assets/images/faces/female/9.jpg differ diff --git a/dist/assets/images/faces/male/1.jpg b/dist/assets/images/faces/male/1.jpg new file mode 100755 index 000000000..d348aea0b Binary files /dev/null and b/dist/assets/images/faces/male/1.jpg differ diff --git a/dist/assets/images/faces/male/10.jpg b/dist/assets/images/faces/male/10.jpg new file mode 100755 index 000000000..db4d3ed8f Binary files /dev/null and b/dist/assets/images/faces/male/10.jpg differ diff --git a/dist/assets/images/faces/male/11.jpg b/dist/assets/images/faces/male/11.jpg new file mode 100755 index 000000000..9ece17cc7 Binary files /dev/null and b/dist/assets/images/faces/male/11.jpg differ diff --git a/dist/assets/images/faces/male/12.jpg b/dist/assets/images/faces/male/12.jpg new file mode 100755 index 000000000..b51193c6a Binary files /dev/null and b/dist/assets/images/faces/male/12.jpg differ diff --git a/dist/assets/images/faces/male/13.jpg b/dist/assets/images/faces/male/13.jpg new file mode 100755 index 000000000..5dcb432ca Binary files /dev/null and b/dist/assets/images/faces/male/13.jpg differ diff --git a/dist/assets/images/faces/male/14.jpg b/dist/assets/images/faces/male/14.jpg new file mode 100755 index 000000000..c418d2a30 Binary files /dev/null and b/dist/assets/images/faces/male/14.jpg differ diff --git a/dist/assets/images/faces/male/15.jpg b/dist/assets/images/faces/male/15.jpg new file mode 100755 index 000000000..129eaeaf2 Binary files /dev/null and b/dist/assets/images/faces/male/15.jpg differ diff --git a/dist/assets/images/faces/male/16.jpg b/dist/assets/images/faces/male/16.jpg new file mode 100755 index 000000000..1257ecaa6 Binary files /dev/null and b/dist/assets/images/faces/male/16.jpg differ diff --git a/dist/assets/images/faces/male/17.jpg b/dist/assets/images/faces/male/17.jpg new file mode 100755 index 000000000..0fbf68eb7 Binary files /dev/null and b/dist/assets/images/faces/male/17.jpg differ diff --git a/dist/assets/images/faces/male/18.jpg b/dist/assets/images/faces/male/18.jpg new file mode 100755 index 000000000..9dbe23555 Binary files /dev/null and b/dist/assets/images/faces/male/18.jpg differ diff --git a/dist/assets/images/faces/male/2.jpg b/dist/assets/images/faces/male/2.jpg new file mode 100755 index 000000000..529b6008e Binary files /dev/null and b/dist/assets/images/faces/male/2.jpg differ diff --git a/dist/assets/images/faces/male/20.jpg b/dist/assets/images/faces/male/20.jpg new file mode 100755 index 000000000..f607f8539 Binary files /dev/null and b/dist/assets/images/faces/male/20.jpg differ diff --git a/dist/assets/images/faces/male/21.jpg b/dist/assets/images/faces/male/21.jpg new file mode 100755 index 000000000..e92da8f3b Binary files /dev/null and b/dist/assets/images/faces/male/21.jpg differ diff --git a/dist/assets/images/faces/male/24.jpg b/dist/assets/images/faces/male/24.jpg new file mode 100755 index 000000000..f83fdd047 Binary files /dev/null and b/dist/assets/images/faces/male/24.jpg differ diff --git a/dist/assets/images/faces/male/25.jpg b/dist/assets/images/faces/male/25.jpg new file mode 100755 index 000000000..45d8ba7b6 Binary files /dev/null and b/dist/assets/images/faces/male/25.jpg differ diff --git a/dist/assets/images/faces/male/26.jpg b/dist/assets/images/faces/male/26.jpg new file mode 100755 index 000000000..a8975089c Binary files /dev/null and b/dist/assets/images/faces/male/26.jpg differ diff --git a/dist/assets/images/faces/male/27.jpg b/dist/assets/images/faces/male/27.jpg new file mode 100755 index 000000000..997f865a2 Binary files /dev/null and b/dist/assets/images/faces/male/27.jpg differ diff --git a/dist/assets/images/faces/male/28.jpg b/dist/assets/images/faces/male/28.jpg new file mode 100755 index 000000000..afa595125 Binary files /dev/null and b/dist/assets/images/faces/male/28.jpg differ diff --git a/dist/assets/images/faces/male/29.jpg b/dist/assets/images/faces/male/29.jpg new file mode 100755 index 000000000..5d626bba9 Binary files /dev/null and b/dist/assets/images/faces/male/29.jpg differ diff --git a/dist/assets/images/faces/male/3.jpg b/dist/assets/images/faces/male/3.jpg new file mode 100755 index 000000000..f623f1bde Binary files /dev/null and b/dist/assets/images/faces/male/3.jpg differ diff --git a/dist/assets/images/faces/male/30.jpg b/dist/assets/images/faces/male/30.jpg new file mode 100755 index 000000000..4231d9c4c Binary files /dev/null and b/dist/assets/images/faces/male/30.jpg differ diff --git a/dist/assets/images/faces/male/31.jpg b/dist/assets/images/faces/male/31.jpg new file mode 100755 index 000000000..ad9290be4 Binary files /dev/null and b/dist/assets/images/faces/male/31.jpg differ diff --git a/dist/assets/images/faces/male/32.jpg b/dist/assets/images/faces/male/32.jpg new file mode 100755 index 000000000..dc266d9d0 Binary files /dev/null and b/dist/assets/images/faces/male/32.jpg differ diff --git a/dist/assets/images/faces/male/33.jpg b/dist/assets/images/faces/male/33.jpg new file mode 100755 index 000000000..38589456c Binary files /dev/null and b/dist/assets/images/faces/male/33.jpg differ diff --git a/dist/assets/images/faces/male/34.jpg b/dist/assets/images/faces/male/34.jpg new file mode 100755 index 000000000..5b9831bd2 Binary files /dev/null and b/dist/assets/images/faces/male/34.jpg differ diff --git a/dist/assets/images/faces/male/35.jpg b/dist/assets/images/faces/male/35.jpg new file mode 100755 index 000000000..34bd94c5b Binary files /dev/null and b/dist/assets/images/faces/male/35.jpg differ diff --git a/dist/assets/images/faces/male/36.jpg b/dist/assets/images/faces/male/36.jpg new file mode 100755 index 000000000..8acb4b1f3 Binary files /dev/null and b/dist/assets/images/faces/male/36.jpg differ diff --git a/dist/assets/images/faces/male/37.jpg b/dist/assets/images/faces/male/37.jpg new file mode 100755 index 000000000..e9d51b4f1 Binary files /dev/null and b/dist/assets/images/faces/male/37.jpg differ diff --git a/dist/assets/images/faces/male/38.jpg b/dist/assets/images/faces/male/38.jpg new file mode 100755 index 000000000..bac7739c8 Binary files /dev/null and b/dist/assets/images/faces/male/38.jpg differ diff --git a/dist/assets/images/faces/male/39.jpg b/dist/assets/images/faces/male/39.jpg new file mode 100755 index 000000000..5eeba7554 Binary files /dev/null and b/dist/assets/images/faces/male/39.jpg differ diff --git a/dist/assets/images/faces/male/4.jpg b/dist/assets/images/faces/male/4.jpg new file mode 100755 index 000000000..3196695c7 Binary files /dev/null and b/dist/assets/images/faces/male/4.jpg differ diff --git a/dist/assets/images/faces/male/40.jpg b/dist/assets/images/faces/male/40.jpg new file mode 100755 index 000000000..06b079b4b Binary files /dev/null and b/dist/assets/images/faces/male/40.jpg differ diff --git a/dist/assets/images/faces/male/41.jpg b/dist/assets/images/faces/male/41.jpg new file mode 100755 index 000000000..c699870cb Binary files /dev/null and b/dist/assets/images/faces/male/41.jpg differ diff --git a/dist/assets/images/faces/male/42.jpg b/dist/assets/images/faces/male/42.jpg new file mode 100755 index 000000000..05a1d936f Binary files /dev/null and b/dist/assets/images/faces/male/42.jpg differ diff --git a/dist/assets/images/faces/male/43.jpg b/dist/assets/images/faces/male/43.jpg new file mode 100755 index 000000000..1e1f91210 Binary files /dev/null and b/dist/assets/images/faces/male/43.jpg differ diff --git a/dist/assets/images/faces/male/5.jpg b/dist/assets/images/faces/male/5.jpg new file mode 100755 index 000000000..6d914cd71 Binary files /dev/null and b/dist/assets/images/faces/male/5.jpg differ diff --git a/dist/assets/images/faces/male/6.jpg b/dist/assets/images/faces/male/6.jpg new file mode 100755 index 000000000..4656f055a Binary files /dev/null and b/dist/assets/images/faces/male/6.jpg differ diff --git a/dist/assets/images/faces/male/7.jpg b/dist/assets/images/faces/male/7.jpg new file mode 100755 index 000000000..88ce147cb Binary files /dev/null and b/dist/assets/images/faces/male/7.jpg differ diff --git a/dist/assets/images/faces/male/8.jpg b/dist/assets/images/faces/male/8.jpg new file mode 100755 index 000000000..ebc9caed7 Binary files /dev/null and b/dist/assets/images/faces/male/8.jpg differ diff --git a/dist/assets/images/faces/male/9.jpg b/dist/assets/images/faces/male/9.jpg new file mode 100755 index 000000000..f48e868ce Binary files /dev/null and b/dist/assets/images/faces/male/9.jpg differ diff --git a/dist/assets/images/flags/ad.svg b/dist/assets/images/flags/ad.svg new file mode 100755 index 000000000..b9ceae5cd --- /dev/null +++ b/dist/assets/images/flags/ad.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ae.svg b/dist/assets/images/flags/ae.svg new file mode 100755 index 000000000..3b88fd0fe --- /dev/null +++ b/dist/assets/images/flags/ae.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/af.svg b/dist/assets/images/flags/af.svg new file mode 100755 index 000000000..16184ee6e --- /dev/null +++ b/dist/assets/images/flags/af.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ag.svg b/dist/assets/images/flags/ag.svg new file mode 100755 index 000000000..7e71e4f40 --- /dev/null +++ b/dist/assets/images/flags/ag.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ai.svg b/dist/assets/images/flags/ai.svg new file mode 100755 index 000000000..302f71227 --- /dev/null +++ b/dist/assets/images/flags/ai.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/al.svg b/dist/assets/images/flags/al.svg new file mode 100755 index 000000000..381148e43 --- /dev/null +++ b/dist/assets/images/flags/al.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/am.svg b/dist/assets/images/flags/am.svg new file mode 100755 index 000000000..fcd656d61 --- /dev/null +++ b/dist/assets/images/flags/am.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ao.svg b/dist/assets/images/flags/ao.svg new file mode 100755 index 000000000..f9370f943 --- /dev/null +++ b/dist/assets/images/flags/ao.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/aq.svg b/dist/assets/images/flags/aq.svg new file mode 100755 index 000000000..c466788a0 --- /dev/null +++ b/dist/assets/images/flags/aq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ar.svg b/dist/assets/images/flags/ar.svg new file mode 100755 index 000000000..5859716bd --- /dev/null +++ b/dist/assets/images/flags/ar.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/as.svg b/dist/assets/images/flags/as.svg new file mode 100755 index 000000000..8cdcfb904 --- /dev/null +++ b/dist/assets/images/flags/as.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/at.svg b/dist/assets/images/flags/at.svg new file mode 100755 index 000000000..87128f223 --- /dev/null +++ b/dist/assets/images/flags/at.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/au.svg b/dist/assets/images/flags/au.svg new file mode 100755 index 000000000..69bb9a469 --- /dev/null +++ b/dist/assets/images/flags/au.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/aw.svg b/dist/assets/images/flags/aw.svg new file mode 100755 index 000000000..13c1a70ac --- /dev/null +++ b/dist/assets/images/flags/aw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ax.svg b/dist/assets/images/flags/ax.svg new file mode 100755 index 000000000..070768303 --- /dev/null +++ b/dist/assets/images/flags/ax.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/az.svg b/dist/assets/images/flags/az.svg new file mode 100755 index 000000000..3e446e7f4 --- /dev/null +++ b/dist/assets/images/flags/az.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ba.svg b/dist/assets/images/flags/ba.svg new file mode 100755 index 000000000..94291a481 --- /dev/null +++ b/dist/assets/images/flags/ba.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bb.svg b/dist/assets/images/flags/bb.svg new file mode 100755 index 000000000..23f3a3363 --- /dev/null +++ b/dist/assets/images/flags/bb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bd.svg b/dist/assets/images/flags/bd.svg new file mode 100755 index 000000000..2e07b68fc --- /dev/null +++ b/dist/assets/images/flags/bd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/be.svg b/dist/assets/images/flags/be.svg new file mode 100755 index 000000000..907e4700b --- /dev/null +++ b/dist/assets/images/flags/be.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bf.svg b/dist/assets/images/flags/bf.svg new file mode 100755 index 000000000..3ea79912a --- /dev/null +++ b/dist/assets/images/flags/bf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bg.svg b/dist/assets/images/flags/bg.svg new file mode 100755 index 000000000..3d76818bc --- /dev/null +++ b/dist/assets/images/flags/bg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bh.svg b/dist/assets/images/flags/bh.svg new file mode 100755 index 000000000..6da13f442 --- /dev/null +++ b/dist/assets/images/flags/bh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bi.svg b/dist/assets/images/flags/bi.svg new file mode 100755 index 000000000..498a27774 --- /dev/null +++ b/dist/assets/images/flags/bi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bj.svg b/dist/assets/images/flags/bj.svg new file mode 100755 index 000000000..fef1eccd0 --- /dev/null +++ b/dist/assets/images/flags/bj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bl.svg b/dist/assets/images/flags/bl.svg new file mode 100755 index 000000000..cd256c5fc --- /dev/null +++ b/dist/assets/images/flags/bl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bm.svg b/dist/assets/images/flags/bm.svg new file mode 100755 index 000000000..3599e0fb7 --- /dev/null +++ b/dist/assets/images/flags/bm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bn.svg b/dist/assets/images/flags/bn.svg new file mode 100755 index 000000000..4e3d0fe7a --- /dev/null +++ b/dist/assets/images/flags/bn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bo.svg b/dist/assets/images/flags/bo.svg new file mode 100755 index 000000000..c208bde39 --- /dev/null +++ b/dist/assets/images/flags/bo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bq.svg b/dist/assets/images/flags/bq.svg new file mode 100755 index 000000000..93446cfd4 --- /dev/null +++ b/dist/assets/images/flags/bq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/br.svg b/dist/assets/images/flags/br.svg new file mode 100755 index 000000000..8561ea7b1 --- /dev/null +++ b/dist/assets/images/flags/br.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bs.svg b/dist/assets/images/flags/bs.svg new file mode 100755 index 000000000..91dc2d7e9 --- /dev/null +++ b/dist/assets/images/flags/bs.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bt.svg b/dist/assets/images/flags/bt.svg new file mode 100755 index 000000000..4d2c5f53e --- /dev/null +++ b/dist/assets/images/flags/bt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bv.svg b/dist/assets/images/flags/bv.svg new file mode 100755 index 000000000..cda48ff69 --- /dev/null +++ b/dist/assets/images/flags/bv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bw.svg b/dist/assets/images/flags/bw.svg new file mode 100755 index 000000000..cc154b992 --- /dev/null +++ b/dist/assets/images/flags/bw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/by.svg b/dist/assets/images/flags/by.svg new file mode 100755 index 000000000..1e7be2507 --- /dev/null +++ b/dist/assets/images/flags/by.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/bz.svg b/dist/assets/images/flags/bz.svg new file mode 100755 index 000000000..0fec282b7 --- /dev/null +++ b/dist/assets/images/flags/bz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ca.svg b/dist/assets/images/flags/ca.svg new file mode 100755 index 000000000..fb542b029 --- /dev/null +++ b/dist/assets/images/flags/ca.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/dist/assets/images/flags/cc.svg b/dist/assets/images/flags/cc.svg new file mode 100755 index 000000000..09958459f --- /dev/null +++ b/dist/assets/images/flags/cc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cd.svg b/dist/assets/images/flags/cd.svg new file mode 100755 index 000000000..a54f831a5 --- /dev/null +++ b/dist/assets/images/flags/cd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cf.svg b/dist/assets/images/flags/cf.svg new file mode 100755 index 000000000..2c64d40f2 --- /dev/null +++ b/dist/assets/images/flags/cf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cg.svg b/dist/assets/images/flags/cg.svg new file mode 100755 index 000000000..3b9a67324 --- /dev/null +++ b/dist/assets/images/flags/cg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ch.svg b/dist/assets/images/flags/ch.svg new file mode 100755 index 000000000..11a20552d --- /dev/null +++ b/dist/assets/images/flags/ch.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ci.svg b/dist/assets/images/flags/ci.svg new file mode 100755 index 000000000..9a82ef37b --- /dev/null +++ b/dist/assets/images/flags/ci.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ck.svg b/dist/assets/images/flags/ck.svg new file mode 100755 index 000000000..a404e2ff9 --- /dev/null +++ b/dist/assets/images/flags/ck.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cl.svg b/dist/assets/images/flags/cl.svg new file mode 100755 index 000000000..60d316c26 --- /dev/null +++ b/dist/assets/images/flags/cl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cm.svg b/dist/assets/images/flags/cm.svg new file mode 100755 index 000000000..f5ec52ae1 --- /dev/null +++ b/dist/assets/images/flags/cm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cn.svg b/dist/assets/images/flags/cn.svg new file mode 100755 index 000000000..e9e74970c --- /dev/null +++ b/dist/assets/images/flags/cn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/co.svg b/dist/assets/images/flags/co.svg new file mode 100755 index 000000000..926d620b4 --- /dev/null +++ b/dist/assets/images/flags/co.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cr.svg b/dist/assets/images/flags/cr.svg new file mode 100755 index 000000000..e5a9cb98c --- /dev/null +++ b/dist/assets/images/flags/cr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cu.svg b/dist/assets/images/flags/cu.svg new file mode 100755 index 000000000..a48cda4db --- /dev/null +++ b/dist/assets/images/flags/cu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cv.svg b/dist/assets/images/flags/cv.svg new file mode 100755 index 000000000..9004e89b8 --- /dev/null +++ b/dist/assets/images/flags/cv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cw.svg b/dist/assets/images/flags/cw.svg new file mode 100755 index 000000000..974c2c0ba --- /dev/null +++ b/dist/assets/images/flags/cw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cx.svg b/dist/assets/images/flags/cx.svg new file mode 100755 index 000000000..117abe2b2 --- /dev/null +++ b/dist/assets/images/flags/cx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cy.svg b/dist/assets/images/flags/cy.svg new file mode 100755 index 000000000..12ef15c38 --- /dev/null +++ b/dist/assets/images/flags/cy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/cz.svg b/dist/assets/images/flags/cz.svg new file mode 100755 index 000000000..b5a58cc13 --- /dev/null +++ b/dist/assets/images/flags/cz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/de.svg b/dist/assets/images/flags/de.svg new file mode 100755 index 000000000..d681fce85 --- /dev/null +++ b/dist/assets/images/flags/de.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/dj.svg b/dist/assets/images/flags/dj.svg new file mode 100755 index 000000000..4e7114cd3 --- /dev/null +++ b/dist/assets/images/flags/dj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/dk.svg b/dist/assets/images/flags/dk.svg new file mode 100755 index 000000000..af7775acf --- /dev/null +++ b/dist/assets/images/flags/dk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/dm.svg b/dist/assets/images/flags/dm.svg new file mode 100755 index 000000000..7bf9a07fd --- /dev/null +++ b/dist/assets/images/flags/dm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/do.svg b/dist/assets/images/flags/do.svg new file mode 100755 index 000000000..5001b18e3 --- /dev/null +++ b/dist/assets/images/flags/do.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/dz.svg b/dist/assets/images/flags/dz.svg new file mode 100755 index 000000000..aa0834c77 --- /dev/null +++ b/dist/assets/images/flags/dz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ec.svg b/dist/assets/images/flags/ec.svg new file mode 100755 index 000000000..7da884fc7 --- /dev/null +++ b/dist/assets/images/flags/ec.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ee.svg b/dist/assets/images/flags/ee.svg new file mode 100755 index 000000000..b0b67006b --- /dev/null +++ b/dist/assets/images/flags/ee.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/eg.svg b/dist/assets/images/flags/eg.svg new file mode 100755 index 000000000..55a7401c6 --- /dev/null +++ b/dist/assets/images/flags/eg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/eh.svg b/dist/assets/images/flags/eh.svg new file mode 100755 index 000000000..3a2c1e6a2 --- /dev/null +++ b/dist/assets/images/flags/eh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/er.svg b/dist/assets/images/flags/er.svg new file mode 100755 index 000000000..5470eb25b --- /dev/null +++ b/dist/assets/images/flags/er.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/es.svg b/dist/assets/images/flags/es.svg new file mode 100755 index 000000000..dbc157882 --- /dev/null +++ b/dist/assets/images/flags/es.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/et.svg b/dist/assets/images/flags/et.svg new file mode 100755 index 000000000..6a4d0cf55 --- /dev/null +++ b/dist/assets/images/flags/et.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/eu.svg b/dist/assets/images/flags/eu.svg new file mode 100755 index 000000000..dbd6971a7 --- /dev/null +++ b/dist/assets/images/flags/eu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fi.svg b/dist/assets/images/flags/fi.svg new file mode 100755 index 000000000..06d3048cf --- /dev/null +++ b/dist/assets/images/flags/fi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fj.svg b/dist/assets/images/flags/fj.svg new file mode 100755 index 000000000..6aab0a7e7 --- /dev/null +++ b/dist/assets/images/flags/fj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fk.svg b/dist/assets/images/flags/fk.svg new file mode 100755 index 000000000..c80f01104 --- /dev/null +++ b/dist/assets/images/flags/fk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fm.svg b/dist/assets/images/flags/fm.svg new file mode 100755 index 000000000..6925a8f23 --- /dev/null +++ b/dist/assets/images/flags/fm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fo.svg b/dist/assets/images/flags/fo.svg new file mode 100755 index 000000000..7ec4a613d --- /dev/null +++ b/dist/assets/images/flags/fo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/fr.svg b/dist/assets/images/flags/fr.svg new file mode 100755 index 000000000..33c456dd3 --- /dev/null +++ b/dist/assets/images/flags/fr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ga.svg b/dist/assets/images/flags/ga.svg new file mode 100755 index 000000000..b8f264a85 --- /dev/null +++ b/dist/assets/images/flags/ga.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gb-eng.svg b/dist/assets/images/flags/gb-eng.svg new file mode 100755 index 000000000..0f6938301 --- /dev/null +++ b/dist/assets/images/flags/gb-eng.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gb-nir.svg b/dist/assets/images/flags/gb-nir.svg new file mode 100755 index 000000000..ac560251e --- /dev/null +++ b/dist/assets/images/flags/gb-nir.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gb-sct.svg b/dist/assets/images/flags/gb-sct.svg new file mode 100755 index 000000000..859e49dbd --- /dev/null +++ b/dist/assets/images/flags/gb-sct.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gb-wls.svg b/dist/assets/images/flags/gb-wls.svg new file mode 100755 index 000000000..bc5d42da1 --- /dev/null +++ b/dist/assets/images/flags/gb-wls.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gb.svg b/dist/assets/images/flags/gb.svg new file mode 100755 index 000000000..001f884bc --- /dev/null +++ b/dist/assets/images/flags/gb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gd.svg b/dist/assets/images/flags/gd.svg new file mode 100755 index 000000000..502ee9286 --- /dev/null +++ b/dist/assets/images/flags/gd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ge.svg b/dist/assets/images/flags/ge.svg new file mode 100755 index 000000000..1c994a7c3 --- /dev/null +++ b/dist/assets/images/flags/ge.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gf.svg b/dist/assets/images/flags/gf.svg new file mode 100755 index 000000000..1bd8664ed --- /dev/null +++ b/dist/assets/images/flags/gf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gg.svg b/dist/assets/images/flags/gg.svg new file mode 100755 index 000000000..de79b30c4 --- /dev/null +++ b/dist/assets/images/flags/gg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gh.svg b/dist/assets/images/flags/gh.svg new file mode 100755 index 000000000..31cf2349f --- /dev/null +++ b/dist/assets/images/flags/gh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gi.svg b/dist/assets/images/flags/gi.svg new file mode 100755 index 000000000..4e7711b1d --- /dev/null +++ b/dist/assets/images/flags/gi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gl.svg b/dist/assets/images/flags/gl.svg new file mode 100755 index 000000000..2239044ab --- /dev/null +++ b/dist/assets/images/flags/gl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gm.svg b/dist/assets/images/flags/gm.svg new file mode 100755 index 000000000..c4dd45b12 --- /dev/null +++ b/dist/assets/images/flags/gm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gn.svg b/dist/assets/images/flags/gn.svg new file mode 100755 index 000000000..c56e03e42 --- /dev/null +++ b/dist/assets/images/flags/gn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gp.svg b/dist/assets/images/flags/gp.svg new file mode 100755 index 000000000..33c456dd3 --- /dev/null +++ b/dist/assets/images/flags/gp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gq.svg b/dist/assets/images/flags/gq.svg new file mode 100755 index 000000000..a72324432 --- /dev/null +++ b/dist/assets/images/flags/gq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gr.svg b/dist/assets/images/flags/gr.svg new file mode 100755 index 000000000..10b87ef6e --- /dev/null +++ b/dist/assets/images/flags/gr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gs.svg b/dist/assets/images/flags/gs.svg new file mode 100755 index 000000000..8b6931241 --- /dev/null +++ b/dist/assets/images/flags/gs.svg @@ -0,0 +1 @@ +LEOTERRRRREOOAAAMPPPITTMG \ No newline at end of file diff --git a/dist/assets/images/flags/gt.svg b/dist/assets/images/flags/gt.svg new file mode 100755 index 000000000..eef9fc936 --- /dev/null +++ b/dist/assets/images/flags/gt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gu.svg b/dist/assets/images/flags/gu.svg new file mode 100755 index 000000000..6993c523c --- /dev/null +++ b/dist/assets/images/flags/gu.svg @@ -0,0 +1 @@ +GUAMGUAM \ No newline at end of file diff --git a/dist/assets/images/flags/gw.svg b/dist/assets/images/flags/gw.svg new file mode 100755 index 000000000..6ffb42029 --- /dev/null +++ b/dist/assets/images/flags/gw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/gy.svg b/dist/assets/images/flags/gy.svg new file mode 100755 index 000000000..571d44c94 --- /dev/null +++ b/dist/assets/images/flags/gy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/hk.svg b/dist/assets/images/flags/hk.svg new file mode 100755 index 000000000..f06e36fe1 --- /dev/null +++ b/dist/assets/images/flags/hk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/hm.svg b/dist/assets/images/flags/hm.svg new file mode 100755 index 000000000..e94952ad6 --- /dev/null +++ b/dist/assets/images/flags/hm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/hn.svg b/dist/assets/images/flags/hn.svg new file mode 100755 index 000000000..1bd8321f6 --- /dev/null +++ b/dist/assets/images/flags/hn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/hr.svg b/dist/assets/images/flags/hr.svg new file mode 100755 index 000000000..2b737ee1c --- /dev/null +++ b/dist/assets/images/flags/hr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ht.svg b/dist/assets/images/flags/ht.svg new file mode 100755 index 000000000..fbdff3aa5 --- /dev/null +++ b/dist/assets/images/flags/ht.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/hu.svg b/dist/assets/images/flags/hu.svg new file mode 100755 index 000000000..c7e187678 --- /dev/null +++ b/dist/assets/images/flags/hu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/id.svg b/dist/assets/images/flags/id.svg new file mode 100755 index 000000000..a0cb094a2 --- /dev/null +++ b/dist/assets/images/flags/id.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ie.svg b/dist/assets/images/flags/ie.svg new file mode 100755 index 000000000..8ca940c9e --- /dev/null +++ b/dist/assets/images/flags/ie.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/il.svg b/dist/assets/images/flags/il.svg new file mode 100755 index 000000000..8fffe6cf8 --- /dev/null +++ b/dist/assets/images/flags/il.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/im.svg b/dist/assets/images/flags/im.svg new file mode 100755 index 000000000..9cb472646 --- /dev/null +++ b/dist/assets/images/flags/im.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/in.svg b/dist/assets/images/flags/in.svg new file mode 100755 index 000000000..50defbf07 --- /dev/null +++ b/dist/assets/images/flags/in.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/io.svg b/dist/assets/images/flags/io.svg new file mode 100755 index 000000000..baa770de0 --- /dev/null +++ b/dist/assets/images/flags/io.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/iq.svg b/dist/assets/images/flags/iq.svg new file mode 100755 index 000000000..bdfe72131 --- /dev/null +++ b/dist/assets/images/flags/iq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ir.svg b/dist/assets/images/flags/ir.svg new file mode 100755 index 000000000..22f97cf69 --- /dev/null +++ b/dist/assets/images/flags/ir.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/is.svg b/dist/assets/images/flags/is.svg new file mode 100755 index 000000000..6545c56ef --- /dev/null +++ b/dist/assets/images/flags/is.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/it.svg b/dist/assets/images/flags/it.svg new file mode 100755 index 000000000..721c0ce55 --- /dev/null +++ b/dist/assets/images/flags/it.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/je.svg b/dist/assets/images/flags/je.svg new file mode 100755 index 000000000..22482efc4 --- /dev/null +++ b/dist/assets/images/flags/je.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/jm.svg b/dist/assets/images/flags/jm.svg new file mode 100755 index 000000000..794ebff31 --- /dev/null +++ b/dist/assets/images/flags/jm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/jo.svg b/dist/assets/images/flags/jo.svg new file mode 100755 index 000000000..e6e924653 --- /dev/null +++ b/dist/assets/images/flags/jo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/jp.svg b/dist/assets/images/flags/jp.svg new file mode 100755 index 000000000..5b8fef559 --- /dev/null +++ b/dist/assets/images/flags/jp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ke.svg b/dist/assets/images/flags/ke.svg new file mode 100755 index 000000000..7c03d523c --- /dev/null +++ b/dist/assets/images/flags/ke.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kg.svg b/dist/assets/images/flags/kg.svg new file mode 100755 index 000000000..bf79897e3 --- /dev/null +++ b/dist/assets/images/flags/kg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kh.svg b/dist/assets/images/flags/kh.svg new file mode 100755 index 000000000..e4192905e --- /dev/null +++ b/dist/assets/images/flags/kh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ki.svg b/dist/assets/images/flags/ki.svg new file mode 100755 index 000000000..f7f76eba8 --- /dev/null +++ b/dist/assets/images/flags/ki.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/km.svg b/dist/assets/images/flags/km.svg new file mode 100755 index 000000000..02cade428 --- /dev/null +++ b/dist/assets/images/flags/km.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kn.svg b/dist/assets/images/flags/kn.svg new file mode 100755 index 000000000..802da76ef --- /dev/null +++ b/dist/assets/images/flags/kn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kp.svg b/dist/assets/images/flags/kp.svg new file mode 100755 index 000000000..5a78b5261 --- /dev/null +++ b/dist/assets/images/flags/kp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kr.svg b/dist/assets/images/flags/kr.svg new file mode 100755 index 000000000..3ba5e92cd --- /dev/null +++ b/dist/assets/images/flags/kr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kw.svg b/dist/assets/images/flags/kw.svg new file mode 100755 index 000000000..24e3a108a --- /dev/null +++ b/dist/assets/images/flags/kw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ky.svg b/dist/assets/images/flags/ky.svg new file mode 100755 index 000000000..bbbc4cd52 --- /dev/null +++ b/dist/assets/images/flags/ky.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/kz.svg b/dist/assets/images/flags/kz.svg new file mode 100755 index 000000000..d9af6f83d --- /dev/null +++ b/dist/assets/images/flags/kz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/la.svg b/dist/assets/images/flags/la.svg new file mode 100755 index 000000000..0fcec31eb --- /dev/null +++ b/dist/assets/images/flags/la.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lb.svg b/dist/assets/images/flags/lb.svg new file mode 100755 index 000000000..e2f6f2b62 --- /dev/null +++ b/dist/assets/images/flags/lb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lc.svg b/dist/assets/images/flags/lc.svg new file mode 100755 index 000000000..d44ffca10 --- /dev/null +++ b/dist/assets/images/flags/lc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/li.svg b/dist/assets/images/flags/li.svg new file mode 100755 index 000000000..245b721e6 --- /dev/null +++ b/dist/assets/images/flags/li.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lk.svg b/dist/assets/images/flags/lk.svg new file mode 100755 index 000000000..d3b5e8206 --- /dev/null +++ b/dist/assets/images/flags/lk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lr.svg b/dist/assets/images/flags/lr.svg new file mode 100755 index 000000000..3386c26aa --- /dev/null +++ b/dist/assets/images/flags/lr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ls.svg b/dist/assets/images/flags/ls.svg new file mode 100755 index 000000000..17bbf6cd0 --- /dev/null +++ b/dist/assets/images/flags/ls.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lt.svg b/dist/assets/images/flags/lt.svg new file mode 100755 index 000000000..6a103ff5a --- /dev/null +++ b/dist/assets/images/flags/lt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lu.svg b/dist/assets/images/flags/lu.svg new file mode 100755 index 000000000..3e657e961 --- /dev/null +++ b/dist/assets/images/flags/lu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/lv.svg b/dist/assets/images/flags/lv.svg new file mode 100755 index 000000000..e6200ea43 --- /dev/null +++ b/dist/assets/images/flags/lv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ly.svg b/dist/assets/images/flags/ly.svg new file mode 100755 index 000000000..0ac041467 --- /dev/null +++ b/dist/assets/images/flags/ly.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ma.svg b/dist/assets/images/flags/ma.svg new file mode 100755 index 000000000..4795e6c61 --- /dev/null +++ b/dist/assets/images/flags/ma.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mc.svg b/dist/assets/images/flags/mc.svg new file mode 100755 index 000000000..53ea91ddd --- /dev/null +++ b/dist/assets/images/flags/mc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/md.svg b/dist/assets/images/flags/md.svg new file mode 100755 index 000000000..b18b49572 --- /dev/null +++ b/dist/assets/images/flags/md.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/me.svg b/dist/assets/images/flags/me.svg new file mode 100755 index 000000000..6624c272b --- /dev/null +++ b/dist/assets/images/flags/me.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mf.svg b/dist/assets/images/flags/mf.svg new file mode 100755 index 000000000..33c456dd3 --- /dev/null +++ b/dist/assets/images/flags/mf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mg.svg b/dist/assets/images/flags/mg.svg new file mode 100755 index 000000000..157d074ed --- /dev/null +++ b/dist/assets/images/flags/mg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mh.svg b/dist/assets/images/flags/mh.svg new file mode 100755 index 000000000..22703ab58 --- /dev/null +++ b/dist/assets/images/flags/mh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mk.svg b/dist/assets/images/flags/mk.svg new file mode 100755 index 000000000..a77d5e8b6 --- /dev/null +++ b/dist/assets/images/flags/mk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ml.svg b/dist/assets/images/flags/ml.svg new file mode 100755 index 000000000..648eede19 --- /dev/null +++ b/dist/assets/images/flags/ml.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mm.svg b/dist/assets/images/flags/mm.svg new file mode 100755 index 000000000..eca1371b6 --- /dev/null +++ b/dist/assets/images/flags/mm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mn.svg b/dist/assets/images/flags/mn.svg new file mode 100755 index 000000000..ef0d3ee9e --- /dev/null +++ b/dist/assets/images/flags/mn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mo.svg b/dist/assets/images/flags/mo.svg new file mode 100755 index 000000000..14b80bd6f --- /dev/null +++ b/dist/assets/images/flags/mo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mp.svg b/dist/assets/images/flags/mp.svg new file mode 100755 index 000000000..38f1009cb --- /dev/null +++ b/dist/assets/images/flags/mp.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mq.svg b/dist/assets/images/flags/mq.svg new file mode 100755 index 000000000..711b04562 --- /dev/null +++ b/dist/assets/images/flags/mq.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mr.svg b/dist/assets/images/flags/mr.svg new file mode 100755 index 000000000..d823a938d --- /dev/null +++ b/dist/assets/images/flags/mr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ms.svg b/dist/assets/images/flags/ms.svg new file mode 100755 index 000000000..2a5951b03 --- /dev/null +++ b/dist/assets/images/flags/ms.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mt.svg b/dist/assets/images/flags/mt.svg new file mode 100755 index 000000000..2777777c1 --- /dev/null +++ b/dist/assets/images/flags/mt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mu.svg b/dist/assets/images/flags/mu.svg new file mode 100755 index 000000000..dcc048cac --- /dev/null +++ b/dist/assets/images/flags/mu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mv.svg b/dist/assets/images/flags/mv.svg new file mode 100755 index 000000000..52938d23e --- /dev/null +++ b/dist/assets/images/flags/mv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mw.svg b/dist/assets/images/flags/mw.svg new file mode 100755 index 000000000..3dc4e80eb --- /dev/null +++ b/dist/assets/images/flags/mw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mx.svg b/dist/assets/images/flags/mx.svg new file mode 100755 index 000000000..61d9aa9d8 --- /dev/null +++ b/dist/assets/images/flags/mx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/my.svg b/dist/assets/images/flags/my.svg new file mode 100755 index 000000000..534a4be00 --- /dev/null +++ b/dist/assets/images/flags/my.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/mz.svg b/dist/assets/images/flags/mz.svg new file mode 100755 index 000000000..ce9e8a804 --- /dev/null +++ b/dist/assets/images/flags/mz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/na.svg b/dist/assets/images/flags/na.svg new file mode 100755 index 000000000..60caec25a --- /dev/null +++ b/dist/assets/images/flags/na.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nc.svg b/dist/assets/images/flags/nc.svg new file mode 100755 index 000000000..6c95ad541 --- /dev/null +++ b/dist/assets/images/flags/nc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ne.svg b/dist/assets/images/flags/ne.svg new file mode 100755 index 000000000..a38708666 --- /dev/null +++ b/dist/assets/images/flags/ne.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nf.svg b/dist/assets/images/flags/nf.svg new file mode 100755 index 000000000..de845bc91 --- /dev/null +++ b/dist/assets/images/flags/nf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ng.svg b/dist/assets/images/flags/ng.svg new file mode 100755 index 000000000..9a2e663ac --- /dev/null +++ b/dist/assets/images/flags/ng.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ni.svg b/dist/assets/images/flags/ni.svg new file mode 100755 index 000000000..91f312405 --- /dev/null +++ b/dist/assets/images/flags/ni.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nl.svg b/dist/assets/images/flags/nl.svg new file mode 100755 index 000000000..37c639008 --- /dev/null +++ b/dist/assets/images/flags/nl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/no.svg b/dist/assets/images/flags/no.svg new file mode 100755 index 000000000..5739ea091 --- /dev/null +++ b/dist/assets/images/flags/no.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/np.svg b/dist/assets/images/flags/np.svg new file mode 100755 index 000000000..85cb38dc7 --- /dev/null +++ b/dist/assets/images/flags/np.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nr.svg b/dist/assets/images/flags/nr.svg new file mode 100755 index 000000000..f33ab737a --- /dev/null +++ b/dist/assets/images/flags/nr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nu.svg b/dist/assets/images/flags/nu.svg new file mode 100755 index 000000000..4834fe8c8 --- /dev/null +++ b/dist/assets/images/flags/nu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/nz.svg b/dist/assets/images/flags/nz.svg new file mode 100755 index 000000000..ddcd5027f --- /dev/null +++ b/dist/assets/images/flags/nz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/om.svg b/dist/assets/images/flags/om.svg new file mode 100755 index 000000000..c5851cbf5 --- /dev/null +++ b/dist/assets/images/flags/om.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pa.svg b/dist/assets/images/flags/pa.svg new file mode 100755 index 000000000..8b6900f6e --- /dev/null +++ b/dist/assets/images/flags/pa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pe.svg b/dist/assets/images/flags/pe.svg new file mode 100755 index 000000000..da10e7df6 --- /dev/null +++ b/dist/assets/images/flags/pe.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pf.svg b/dist/assets/images/flags/pf.svg new file mode 100755 index 000000000..264217fd3 --- /dev/null +++ b/dist/assets/images/flags/pf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pg.svg b/dist/assets/images/flags/pg.svg new file mode 100755 index 000000000..38d067911 --- /dev/null +++ b/dist/assets/images/flags/pg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ph.svg b/dist/assets/images/flags/ph.svg new file mode 100755 index 000000000..f49c92ac4 --- /dev/null +++ b/dist/assets/images/flags/ph.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pk.svg b/dist/assets/images/flags/pk.svg new file mode 100755 index 000000000..0478f54a9 --- /dev/null +++ b/dist/assets/images/flags/pk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pl.svg b/dist/assets/images/flags/pl.svg new file mode 100755 index 000000000..53ec758f5 --- /dev/null +++ b/dist/assets/images/flags/pl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pm.svg b/dist/assets/images/flags/pm.svg new file mode 100755 index 000000000..6c95ad541 --- /dev/null +++ b/dist/assets/images/flags/pm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pn.svg b/dist/assets/images/flags/pn.svg new file mode 100755 index 000000000..e9b37f9dd --- /dev/null +++ b/dist/assets/images/flags/pn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pr.svg b/dist/assets/images/flags/pr.svg new file mode 100755 index 000000000..58e2613f6 --- /dev/null +++ b/dist/assets/images/flags/pr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ps.svg b/dist/assets/images/flags/ps.svg new file mode 100755 index 000000000..77ac5981f --- /dev/null +++ b/dist/assets/images/flags/ps.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pt.svg b/dist/assets/images/flags/pt.svg new file mode 100755 index 000000000..3b8f934bb --- /dev/null +++ b/dist/assets/images/flags/pt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/pw.svg b/dist/assets/images/flags/pw.svg new file mode 100755 index 000000000..91620ba4e --- /dev/null +++ b/dist/assets/images/flags/pw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/py.svg b/dist/assets/images/flags/py.svg new file mode 100755 index 000000000..93800948e --- /dev/null +++ b/dist/assets/images/flags/py.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/qa.svg b/dist/assets/images/flags/qa.svg new file mode 100755 index 000000000..c98d48992 --- /dev/null +++ b/dist/assets/images/flags/qa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/re.svg b/dist/assets/images/flags/re.svg new file mode 100755 index 000000000..6c95ad541 --- /dev/null +++ b/dist/assets/images/flags/re.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ro.svg b/dist/assets/images/flags/ro.svg new file mode 100755 index 000000000..dce850ab2 --- /dev/null +++ b/dist/assets/images/flags/ro.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/rs.svg b/dist/assets/images/flags/rs.svg new file mode 100755 index 000000000..d6a04b350 --- /dev/null +++ b/dist/assets/images/flags/rs.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ru.svg b/dist/assets/images/flags/ru.svg new file mode 100755 index 000000000..273d9bed4 --- /dev/null +++ b/dist/assets/images/flags/ru.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/rw.svg b/dist/assets/images/flags/rw.svg new file mode 100755 index 000000000..990b51c13 --- /dev/null +++ b/dist/assets/images/flags/rw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sa.svg b/dist/assets/images/flags/sa.svg new file mode 100755 index 000000000..a51805812 --- /dev/null +++ b/dist/assets/images/flags/sa.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sb.svg b/dist/assets/images/flags/sb.svg new file mode 100755 index 000000000..a4cb3e686 --- /dev/null +++ b/dist/assets/images/flags/sb.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sc.svg b/dist/assets/images/flags/sc.svg new file mode 100755 index 000000000..480f4bafb --- /dev/null +++ b/dist/assets/images/flags/sc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sd.svg b/dist/assets/images/flags/sd.svg new file mode 100755 index 000000000..b59f65fb8 --- /dev/null +++ b/dist/assets/images/flags/sd.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/se.svg b/dist/assets/images/flags/se.svg new file mode 100755 index 000000000..a1a818fba --- /dev/null +++ b/dist/assets/images/flags/se.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sg.svg b/dist/assets/images/flags/sg.svg new file mode 100755 index 000000000..ea670f9b4 --- /dev/null +++ b/dist/assets/images/flags/sg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sh.svg b/dist/assets/images/flags/sh.svg new file mode 100755 index 000000000..f5ce3d9e6 --- /dev/null +++ b/dist/assets/images/flags/sh.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/si.svg b/dist/assets/images/flags/si.svg new file mode 100755 index 000000000..0b3ee205c --- /dev/null +++ b/dist/assets/images/flags/si.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sj.svg b/dist/assets/images/flags/sj.svg new file mode 100755 index 000000000..5739ea091 --- /dev/null +++ b/dist/assets/images/flags/sj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sk.svg b/dist/assets/images/flags/sk.svg new file mode 100755 index 000000000..357763411 --- /dev/null +++ b/dist/assets/images/flags/sk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sl.svg b/dist/assets/images/flags/sl.svg new file mode 100755 index 000000000..42e0d6210 --- /dev/null +++ b/dist/assets/images/flags/sl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sm.svg b/dist/assets/images/flags/sm.svg new file mode 100755 index 000000000..133ae34cf --- /dev/null +++ b/dist/assets/images/flags/sm.svg @@ -0,0 +1 @@ +LIBERTAS \ No newline at end of file diff --git a/dist/assets/images/flags/sn.svg b/dist/assets/images/flags/sn.svg new file mode 100755 index 000000000..28a1e7fd2 --- /dev/null +++ b/dist/assets/images/flags/sn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/so.svg b/dist/assets/images/flags/so.svg new file mode 100755 index 000000000..651cfee92 --- /dev/null +++ b/dist/assets/images/flags/so.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sr.svg b/dist/assets/images/flags/sr.svg new file mode 100755 index 000000000..d968261e2 --- /dev/null +++ b/dist/assets/images/flags/sr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ss.svg b/dist/assets/images/flags/ss.svg new file mode 100755 index 000000000..c5458ee21 --- /dev/null +++ b/dist/assets/images/flags/ss.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/st.svg b/dist/assets/images/flags/st.svg new file mode 100755 index 000000000..b48da60eb --- /dev/null +++ b/dist/assets/images/flags/st.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sv.svg b/dist/assets/images/flags/sv.svg new file mode 100755 index 000000000..dec1600c9 --- /dev/null +++ b/dist/assets/images/flags/sv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sx.svg b/dist/assets/images/flags/sx.svg new file mode 100755 index 000000000..cea8d7f60 --- /dev/null +++ b/dist/assets/images/flags/sx.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sy.svg b/dist/assets/images/flags/sy.svg new file mode 100755 index 000000000..3ab1b1343 --- /dev/null +++ b/dist/assets/images/flags/sy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/sz.svg b/dist/assets/images/flags/sz.svg new file mode 100755 index 000000000..0b05d5c81 --- /dev/null +++ b/dist/assets/images/flags/sz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tc.svg b/dist/assets/images/flags/tc.svg new file mode 100755 index 000000000..e30c4196c --- /dev/null +++ b/dist/assets/images/flags/tc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/td.svg b/dist/assets/images/flags/td.svg new file mode 100755 index 000000000..b0aeeeca5 --- /dev/null +++ b/dist/assets/images/flags/td.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tf.svg b/dist/assets/images/flags/tf.svg new file mode 100755 index 000000000..effb5adb4 --- /dev/null +++ b/dist/assets/images/flags/tf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tg.svg b/dist/assets/images/flags/tg.svg new file mode 100755 index 000000000..40d569d0f --- /dev/null +++ b/dist/assets/images/flags/tg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/th.svg b/dist/assets/images/flags/th.svg new file mode 100755 index 000000000..753a2cedc --- /dev/null +++ b/dist/assets/images/flags/th.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tj.svg b/dist/assets/images/flags/tj.svg new file mode 100755 index 000000000..b605fe7a8 --- /dev/null +++ b/dist/assets/images/flags/tj.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tk.svg b/dist/assets/images/flags/tk.svg new file mode 100755 index 000000000..570f08e73 --- /dev/null +++ b/dist/assets/images/flags/tk.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tl.svg b/dist/assets/images/flags/tl.svg new file mode 100755 index 000000000..745064c42 --- /dev/null +++ b/dist/assets/images/flags/tl.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tm.svg b/dist/assets/images/flags/tm.svg new file mode 100755 index 000000000..368d8ea87 --- /dev/null +++ b/dist/assets/images/flags/tm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tn.svg b/dist/assets/images/flags/tn.svg new file mode 100755 index 000000000..e3190c9f1 --- /dev/null +++ b/dist/assets/images/flags/tn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/to.svg b/dist/assets/images/flags/to.svg new file mode 100755 index 000000000..ce7f3cf98 --- /dev/null +++ b/dist/assets/images/flags/to.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tr.svg b/dist/assets/images/flags/tr.svg new file mode 100755 index 000000000..db16e185c --- /dev/null +++ b/dist/assets/images/flags/tr.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tt.svg b/dist/assets/images/flags/tt.svg new file mode 100755 index 000000000..6c71f86fd --- /dev/null +++ b/dist/assets/images/flags/tt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tv.svg b/dist/assets/images/flags/tv.svg new file mode 100755 index 000000000..54ca302a7 --- /dev/null +++ b/dist/assets/images/flags/tv.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tw.svg b/dist/assets/images/flags/tw.svg new file mode 100755 index 000000000..d11ddfca1 --- /dev/null +++ b/dist/assets/images/flags/tw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/tz.svg b/dist/assets/images/flags/tz.svg new file mode 100755 index 000000000..b2f7141fc --- /dev/null +++ b/dist/assets/images/flags/tz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ua.svg b/dist/assets/images/flags/ua.svg new file mode 100755 index 000000000..118620957 --- /dev/null +++ b/dist/assets/images/flags/ua.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ug.svg b/dist/assets/images/flags/ug.svg new file mode 100755 index 000000000..e0ed3c68c --- /dev/null +++ b/dist/assets/images/flags/ug.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/um.svg b/dist/assets/images/flags/um.svg new file mode 100755 index 000000000..370cd29e9 --- /dev/null +++ b/dist/assets/images/flags/um.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/un.svg b/dist/assets/images/flags/un.svg new file mode 100755 index 000000000..e95206b54 --- /dev/null +++ b/dist/assets/images/flags/un.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/us.svg b/dist/assets/images/flags/us.svg new file mode 100755 index 000000000..95e707b41 --- /dev/null +++ b/dist/assets/images/flags/us.svg @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/dist/assets/images/flags/uy.svg b/dist/assets/images/flags/uy.svg new file mode 100755 index 000000000..81fc1f16c --- /dev/null +++ b/dist/assets/images/flags/uy.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/uz.svg b/dist/assets/images/flags/uz.svg new file mode 100755 index 000000000..b63fdbf5d --- /dev/null +++ b/dist/assets/images/flags/uz.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/va.svg b/dist/assets/images/flags/va.svg new file mode 100755 index 000000000..00c9eea4c --- /dev/null +++ b/dist/assets/images/flags/va.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/vc.svg b/dist/assets/images/flags/vc.svg new file mode 100755 index 000000000..114280991 --- /dev/null +++ b/dist/assets/images/flags/vc.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ve.svg b/dist/assets/images/flags/ve.svg new file mode 100755 index 000000000..839a6ccc0 --- /dev/null +++ b/dist/assets/images/flags/ve.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/vg.svg b/dist/assets/images/flags/vg.svg new file mode 100755 index 000000000..b46659b3a --- /dev/null +++ b/dist/assets/images/flags/vg.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/vi.svg b/dist/assets/images/flags/vi.svg new file mode 100755 index 000000000..e292e17f7 --- /dev/null +++ b/dist/assets/images/flags/vi.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/vn.svg b/dist/assets/images/flags/vn.svg new file mode 100755 index 000000000..1b546a294 --- /dev/null +++ b/dist/assets/images/flags/vn.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/vu.svg b/dist/assets/images/flags/vu.svg new file mode 100755 index 000000000..f9dbd67f1 --- /dev/null +++ b/dist/assets/images/flags/vu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/wf.svg b/dist/assets/images/flags/wf.svg new file mode 100755 index 000000000..8a3ced1eb --- /dev/null +++ b/dist/assets/images/flags/wf.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ws.svg b/dist/assets/images/flags/ws.svg new file mode 100755 index 000000000..94f42a09c --- /dev/null +++ b/dist/assets/images/flags/ws.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/ye.svg b/dist/assets/images/flags/ye.svg new file mode 100755 index 000000000..00e3500ab --- /dev/null +++ b/dist/assets/images/flags/ye.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/yt.svg b/dist/assets/images/flags/yt.svg new file mode 100755 index 000000000..6c95ad541 --- /dev/null +++ b/dist/assets/images/flags/yt.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/za.svg b/dist/assets/images/flags/za.svg new file mode 100755 index 000000000..273f48f18 --- /dev/null +++ b/dist/assets/images/flags/za.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/zm.svg b/dist/assets/images/flags/zm.svg new file mode 100755 index 000000000..6bb037344 --- /dev/null +++ b/dist/assets/images/flags/zm.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/flags/zw.svg b/dist/assets/images/flags/zw.svg new file mode 100755 index 000000000..138c53582 --- /dev/null +++ b/dist/assets/images/flags/zw.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/logo.svg b/dist/assets/images/logo.svg new file mode 100644 index 000000000..d00c749a9 --- /dev/null +++ b/dist/assets/images/logo.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/dist/assets/images/payments/2checkout-dark.svg b/dist/assets/images/payments/2checkout-dark.svg new file mode 100644 index 000000000..c61fb1407 --- /dev/null +++ b/dist/assets/images/payments/2checkout-dark.svg @@ -0,0 +1 @@ +2checkout-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/2checkout.svg b/dist/assets/images/payments/2checkout.svg new file mode 100644 index 000000000..6dd6537d4 --- /dev/null +++ b/dist/assets/images/payments/2checkout.svg @@ -0,0 +1 @@ +2checkout-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/alipay-dark.svg b/dist/assets/images/payments/alipay-dark.svg new file mode 100644 index 000000000..0959682f8 --- /dev/null +++ b/dist/assets/images/payments/alipay-dark.svg @@ -0,0 +1 @@ +AliPay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/alipay.svg b/dist/assets/images/payments/alipay.svg new file mode 100644 index 000000000..8ac60edad --- /dev/null +++ b/dist/assets/images/payments/alipay.svg @@ -0,0 +1 @@ +AliPay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/amazon-dark.svg b/dist/assets/images/payments/amazon-dark.svg new file mode 100644 index 000000000..1a57e5e8f --- /dev/null +++ b/dist/assets/images/payments/amazon-dark.svg @@ -0,0 +1 @@ +Amazon-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/amazon.svg b/dist/assets/images/payments/amazon.svg new file mode 100644 index 000000000..9c103a950 --- /dev/null +++ b/dist/assets/images/payments/amazon.svg @@ -0,0 +1 @@ +Amazon-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/americanexpress-dark.svg b/dist/assets/images/payments/americanexpress-dark.svg new file mode 100644 index 000000000..574c95830 --- /dev/null +++ b/dist/assets/images/payments/americanexpress-dark.svg @@ -0,0 +1 @@ +AmericanExpress-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/americanexpress.svg b/dist/assets/images/payments/americanexpress.svg new file mode 100644 index 000000000..c300f96d7 --- /dev/null +++ b/dist/assets/images/payments/americanexpress.svg @@ -0,0 +1 @@ +AmericanExpress-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/applepay-dark.svg b/dist/assets/images/payments/applepay-dark.svg new file mode 100644 index 000000000..9f752f6b9 --- /dev/null +++ b/dist/assets/images/payments/applepay-dark.svg @@ -0,0 +1 @@ +ApplePay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/applepay.svg b/dist/assets/images/payments/applepay.svg new file mode 100644 index 000000000..a3bc1c491 --- /dev/null +++ b/dist/assets/images/payments/applepay.svg @@ -0,0 +1 @@ +ApplePay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bancontact-dark.svg b/dist/assets/images/payments/bancontact-dark.svg new file mode 100644 index 000000000..6b84177a2 --- /dev/null +++ b/dist/assets/images/payments/bancontact-dark.svg @@ -0,0 +1 @@ +Bancontact-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bancontact.svg b/dist/assets/images/payments/bancontact.svg new file mode 100644 index 000000000..4f74650cc --- /dev/null +++ b/dist/assets/images/payments/bancontact.svg @@ -0,0 +1 @@ +Bancontact-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bitcoin-dark.svg b/dist/assets/images/payments/bitcoin-dark.svg new file mode 100644 index 000000000..5a871ee09 --- /dev/null +++ b/dist/assets/images/payments/bitcoin-dark.svg @@ -0,0 +1 @@ +Bitcoin-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bitcoin.svg b/dist/assets/images/payments/bitcoin.svg new file mode 100644 index 000000000..e0c065614 --- /dev/null +++ b/dist/assets/images/payments/bitcoin.svg @@ -0,0 +1 @@ +Bitcoin-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bitpay-dark.svg b/dist/assets/images/payments/bitpay-dark.svg new file mode 100644 index 000000000..5954891f6 --- /dev/null +++ b/dist/assets/images/payments/bitpay-dark.svg @@ -0,0 +1 @@ +Bitpay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/bitpay.svg b/dist/assets/images/payments/bitpay.svg new file mode 100644 index 000000000..965363089 --- /dev/null +++ b/dist/assets/images/payments/bitpay.svg @@ -0,0 +1 @@ +Bitpay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/cirrus-dark.svg b/dist/assets/images/payments/cirrus-dark.svg new file mode 100644 index 000000000..28af2a4d4 --- /dev/null +++ b/dist/assets/images/payments/cirrus-dark.svg @@ -0,0 +1 @@ +Cirrus-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/cirrus.svg b/dist/assets/images/payments/cirrus.svg new file mode 100644 index 000000000..56160ef86 --- /dev/null +++ b/dist/assets/images/payments/cirrus.svg @@ -0,0 +1 @@ +Cirrus-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/clickandbuy-dark.svg b/dist/assets/images/payments/clickandbuy-dark.svg new file mode 100644 index 000000000..6e1473502 --- /dev/null +++ b/dist/assets/images/payments/clickandbuy-dark.svg @@ -0,0 +1 @@ +Clickandbuy-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/clickandbuy.svg b/dist/assets/images/payments/clickandbuy.svg new file mode 100644 index 000000000..719fd8822 --- /dev/null +++ b/dist/assets/images/payments/clickandbuy.svg @@ -0,0 +1 @@ +Clickandbuy-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/coinkite-dark.svg b/dist/assets/images/payments/coinkite-dark.svg new file mode 100644 index 000000000..019f934e9 --- /dev/null +++ b/dist/assets/images/payments/coinkite-dark.svg @@ -0,0 +1 @@ +CoinKite-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/coinkite.svg b/dist/assets/images/payments/coinkite.svg new file mode 100644 index 000000000..b31a1bc42 --- /dev/null +++ b/dist/assets/images/payments/coinkite.svg @@ -0,0 +1 @@ +Coinkite-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/dinersclub-dark.svg b/dist/assets/images/payments/dinersclub-dark.svg new file mode 100644 index 000000000..4b15a2107 --- /dev/null +++ b/dist/assets/images/payments/dinersclub-dark.svg @@ -0,0 +1 @@ +DinersClub-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/dinersclub.svg b/dist/assets/images/payments/dinersclub.svg new file mode 100644 index 000000000..c907b0d21 --- /dev/null +++ b/dist/assets/images/payments/dinersclub.svg @@ -0,0 +1 @@ +DinersClub-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/directdebit-dark.svg b/dist/assets/images/payments/directdebit-dark.svg new file mode 100644 index 000000000..4fcacfa1d --- /dev/null +++ b/dist/assets/images/payments/directdebit-dark.svg @@ -0,0 +1 @@ +DirectDebit-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/directdebit.svg b/dist/assets/images/payments/directdebit.svg new file mode 100644 index 000000000..37ad454c5 --- /dev/null +++ b/dist/assets/images/payments/directdebit.svg @@ -0,0 +1 @@ +DirectDebit-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/discover-dark.svg b/dist/assets/images/payments/discover-dark.svg new file mode 100644 index 000000000..bb3ca4cbd --- /dev/null +++ b/dist/assets/images/payments/discover-dark.svg @@ -0,0 +1 @@ +Discover-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/discover.svg b/dist/assets/images/payments/discover.svg new file mode 100644 index 000000000..6e89ad8b4 --- /dev/null +++ b/dist/assets/images/payments/discover.svg @@ -0,0 +1 @@ +Discover-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/dwolla-dark.svg b/dist/assets/images/payments/dwolla-dark.svg new file mode 100644 index 000000000..abfbe8e0e --- /dev/null +++ b/dist/assets/images/payments/dwolla-dark.svg @@ -0,0 +1 @@ +Dwolla-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/dwolla.svg b/dist/assets/images/payments/dwolla.svg new file mode 100644 index 000000000..772c08472 --- /dev/null +++ b/dist/assets/images/payments/dwolla.svg @@ -0,0 +1 @@ +Dwolla-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ebay-dark.svg b/dist/assets/images/payments/ebay-dark.svg new file mode 100644 index 000000000..19f5fbc1a --- /dev/null +++ b/dist/assets/images/payments/ebay-dark.svg @@ -0,0 +1 @@ +Ebay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ebay.svg b/dist/assets/images/payments/ebay.svg new file mode 100644 index 000000000..a50f1d131 --- /dev/null +++ b/dist/assets/images/payments/ebay.svg @@ -0,0 +1 @@ +Ebay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/eway-dark.svg b/dist/assets/images/payments/eway-dark.svg new file mode 100644 index 000000000..9efc3ab29 --- /dev/null +++ b/dist/assets/images/payments/eway-dark.svg @@ -0,0 +1 @@ +Eway-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/eway.svg b/dist/assets/images/payments/eway.svg new file mode 100644 index 000000000..248503bc0 --- /dev/null +++ b/dist/assets/images/payments/eway.svg @@ -0,0 +1 @@ +Eway-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/giropay-dark.svg b/dist/assets/images/payments/giropay-dark.svg new file mode 100644 index 000000000..2e074168e --- /dev/null +++ b/dist/assets/images/payments/giropay-dark.svg @@ -0,0 +1 @@ +GiroPay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/giropay.svg b/dist/assets/images/payments/giropay.svg new file mode 100644 index 000000000..f1da29ce3 --- /dev/null +++ b/dist/assets/images/payments/giropay.svg @@ -0,0 +1 @@ +GiroPay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/googlewallet-dark.svg b/dist/assets/images/payments/googlewallet-dark.svg new file mode 100644 index 000000000..49c32a4b8 --- /dev/null +++ b/dist/assets/images/payments/googlewallet-dark.svg @@ -0,0 +1 @@ +GoogleWallet-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/googlewallet.svg b/dist/assets/images/payments/googlewallet.svg new file mode 100644 index 000000000..4423d9494 --- /dev/null +++ b/dist/assets/images/payments/googlewallet.svg @@ -0,0 +1 @@ +GoogleWallet-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ingenico-dark.svg b/dist/assets/images/payments/ingenico-dark.svg new file mode 100644 index 000000000..ef252951f --- /dev/null +++ b/dist/assets/images/payments/ingenico-dark.svg @@ -0,0 +1 @@ +Ingenico-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ingenico.svg b/dist/assets/images/payments/ingenico.svg new file mode 100644 index 000000000..03f64bf3d --- /dev/null +++ b/dist/assets/images/payments/ingenico.svg @@ -0,0 +1 @@ +Ingenico-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/jcb-dark.svg b/dist/assets/images/payments/jcb-dark.svg new file mode 100644 index 000000000..8fcdd6c01 --- /dev/null +++ b/dist/assets/images/payments/jcb-dark.svg @@ -0,0 +1 @@ +JCB-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/jcb.svg b/dist/assets/images/payments/jcb.svg new file mode 100644 index 000000000..3ecc08430 --- /dev/null +++ b/dist/assets/images/payments/jcb.svg @@ -0,0 +1 @@ +JCB-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/klarna-dark.svg b/dist/assets/images/payments/klarna-dark.svg new file mode 100644 index 000000000..772558a1c --- /dev/null +++ b/dist/assets/images/payments/klarna-dark.svg @@ -0,0 +1 @@ +Klarna-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/klarna.svg b/dist/assets/images/payments/klarna.svg new file mode 100644 index 000000000..47359a383 --- /dev/null +++ b/dist/assets/images/payments/klarna.svg @@ -0,0 +1 @@ +Klarna-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/laser-dark.svg b/dist/assets/images/payments/laser-dark.svg new file mode 100644 index 000000000..682534ccb --- /dev/null +++ b/dist/assets/images/payments/laser-dark.svg @@ -0,0 +1 @@ +Laser-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/laser.svg b/dist/assets/images/payments/laser.svg new file mode 100644 index 000000000..f5754eaa9 --- /dev/null +++ b/dist/assets/images/payments/laser.svg @@ -0,0 +1 @@ +Laser-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/maestro-dark.svg b/dist/assets/images/payments/maestro-dark.svg new file mode 100644 index 000000000..2464d396c --- /dev/null +++ b/dist/assets/images/payments/maestro-dark.svg @@ -0,0 +1 @@ +Maestro-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/maestro.svg b/dist/assets/images/payments/maestro.svg new file mode 100644 index 000000000..b18b89e79 --- /dev/null +++ b/dist/assets/images/payments/maestro.svg @@ -0,0 +1 @@ +Maestro-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/mastercard-dark.svg b/dist/assets/images/payments/mastercard-dark.svg new file mode 100644 index 000000000..c5062ebcb --- /dev/null +++ b/dist/assets/images/payments/mastercard-dark.svg @@ -0,0 +1 @@ +MasterCard-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/mastercard.svg b/dist/assets/images/payments/mastercard.svg new file mode 100644 index 000000000..f70f2572e --- /dev/null +++ b/dist/assets/images/payments/mastercard.svg @@ -0,0 +1 @@ +MasterCard-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/monero-dark.svg b/dist/assets/images/payments/monero-dark.svg new file mode 100644 index 000000000..497dd6013 --- /dev/null +++ b/dist/assets/images/payments/monero-dark.svg @@ -0,0 +1 @@ +Monero-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/monero.svg b/dist/assets/images/payments/monero.svg new file mode 100644 index 000000000..2a1d43417 --- /dev/null +++ b/dist/assets/images/payments/monero.svg @@ -0,0 +1 @@ +Monero-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/neteller-dark.svg b/dist/assets/images/payments/neteller-dark.svg new file mode 100644 index 000000000..f6c76c14c --- /dev/null +++ b/dist/assets/images/payments/neteller-dark.svg @@ -0,0 +1 @@ +Neteller-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/neteller.svg b/dist/assets/images/payments/neteller.svg new file mode 100644 index 000000000..433e3a182 --- /dev/null +++ b/dist/assets/images/payments/neteller.svg @@ -0,0 +1 @@ +Neteller-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ogone-dark.svg b/dist/assets/images/payments/ogone-dark.svg new file mode 100644 index 000000000..5847469fe --- /dev/null +++ b/dist/assets/images/payments/ogone-dark.svg @@ -0,0 +1 @@ +Ogone-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ogone.svg b/dist/assets/images/payments/ogone.svg new file mode 100644 index 000000000..dd0e5157c --- /dev/null +++ b/dist/assets/images/payments/ogone.svg @@ -0,0 +1 @@ +Ogone-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/okpay-dark.svg b/dist/assets/images/payments/okpay-dark.svg new file mode 100644 index 000000000..50a22c35e --- /dev/null +++ b/dist/assets/images/payments/okpay-dark.svg @@ -0,0 +1 @@ +OkPay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/okpay.svg b/dist/assets/images/payments/okpay.svg new file mode 100644 index 000000000..116672820 --- /dev/null +++ b/dist/assets/images/payments/okpay.svg @@ -0,0 +1 @@ +OkPay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paybox-dark.svg b/dist/assets/images/payments/paybox-dark.svg new file mode 100644 index 000000000..464ba31a2 --- /dev/null +++ b/dist/assets/images/payments/paybox-dark.svg @@ -0,0 +1 @@ +Paybox-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paybox.svg b/dist/assets/images/payments/paybox.svg new file mode 100644 index 000000000..8ea00796f --- /dev/null +++ b/dist/assets/images/payments/paybox.svg @@ -0,0 +1 @@ +Paybox-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paymill-dark.svg b/dist/assets/images/payments/paymill-dark.svg new file mode 100644 index 000000000..4c5db48f8 --- /dev/null +++ b/dist/assets/images/payments/paymill-dark.svg @@ -0,0 +1 @@ +Paymill-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paymill.svg b/dist/assets/images/payments/paymill.svg new file mode 100644 index 000000000..fc748735c --- /dev/null +++ b/dist/assets/images/payments/paymill.svg @@ -0,0 +1 @@ +Paymill-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payone-dark.svg b/dist/assets/images/payments/payone-dark.svg new file mode 100644 index 000000000..7d65a78b3 --- /dev/null +++ b/dist/assets/images/payments/payone-dark.svg @@ -0,0 +1 @@ +Payone-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payone.svg b/dist/assets/images/payments/payone.svg new file mode 100644 index 000000000..a0c70b702 --- /dev/null +++ b/dist/assets/images/payments/payone.svg @@ -0,0 +1 @@ +Payone-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payoneer-dark.svg b/dist/assets/images/payments/payoneer-dark.svg new file mode 100644 index 000000000..36b371c26 --- /dev/null +++ b/dist/assets/images/payments/payoneer-dark.svg @@ -0,0 +1 @@ +Payoneer-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payoneer.svg b/dist/assets/images/payments/payoneer.svg new file mode 100644 index 000000000..357d0755f --- /dev/null +++ b/dist/assets/images/payments/payoneer.svg @@ -0,0 +1 @@ +Payoneer-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paypal-dark.svg b/dist/assets/images/payments/paypal-dark.svg new file mode 100644 index 000000000..3d613c51b --- /dev/null +++ b/dist/assets/images/payments/paypal-dark.svg @@ -0,0 +1 @@ +Paypal-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paypal.svg b/dist/assets/images/payments/paypal.svg new file mode 100644 index 000000000..36df6e955 --- /dev/null +++ b/dist/assets/images/payments/paypal.svg @@ -0,0 +1 @@ +Paypal-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paysafecard-dark.svg b/dist/assets/images/payments/paysafecard-dark.svg new file mode 100644 index 000000000..897b7909b --- /dev/null +++ b/dist/assets/images/payments/paysafecard-dark.svg @@ -0,0 +1 @@ +PaysafeCard-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/paysafecard.svg b/dist/assets/images/payments/paysafecard.svg new file mode 100644 index 000000000..f8ad324dc --- /dev/null +++ b/dist/assets/images/payments/paysafecard.svg @@ -0,0 +1 @@ +PaysafeCard-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payu-dark.svg b/dist/assets/images/payments/payu-dark.svg new file mode 100644 index 000000000..aef45df2f --- /dev/null +++ b/dist/assets/images/payments/payu-dark.svg @@ -0,0 +1 @@ +PayU-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payu.svg b/dist/assets/images/payments/payu.svg new file mode 100644 index 000000000..936643757 --- /dev/null +++ b/dist/assets/images/payments/payu.svg @@ -0,0 +1 @@ +PayU-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payza-dark.svg b/dist/assets/images/payments/payza-dark.svg new file mode 100644 index 000000000..419fd550b --- /dev/null +++ b/dist/assets/images/payments/payza-dark.svg @@ -0,0 +1 @@ +Payza-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/payza.svg b/dist/assets/images/payments/payza.svg new file mode 100644 index 000000000..762524316 --- /dev/null +++ b/dist/assets/images/payments/payza.svg @@ -0,0 +1 @@ +Payza-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ripple-dark.svg b/dist/assets/images/payments/ripple-dark.svg new file mode 100644 index 000000000..5fecdd71d --- /dev/null +++ b/dist/assets/images/payments/ripple-dark.svg @@ -0,0 +1 @@ +Ripple-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ripple.svg b/dist/assets/images/payments/ripple.svg new file mode 100644 index 000000000..62c0b588f --- /dev/null +++ b/dist/assets/images/payments/ripple.svg @@ -0,0 +1 @@ +Ripple-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/sage-dark.svg b/dist/assets/images/payments/sage-dark.svg new file mode 100644 index 000000000..84cff147b --- /dev/null +++ b/dist/assets/images/payments/sage-dark.svg @@ -0,0 +1 @@ +Sage-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/sage.svg b/dist/assets/images/payments/sage.svg new file mode 100644 index 000000000..11623bdf7 --- /dev/null +++ b/dist/assets/images/payments/sage.svg @@ -0,0 +1 @@ +Sage-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/sepa-dark.svg b/dist/assets/images/payments/sepa-dark.svg new file mode 100644 index 000000000..5db63235a --- /dev/null +++ b/dist/assets/images/payments/sepa-dark.svg @@ -0,0 +1 @@ +Sepa-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/sepa.svg b/dist/assets/images/payments/sepa.svg new file mode 100644 index 000000000..845952a22 --- /dev/null +++ b/dist/assets/images/payments/sepa.svg @@ -0,0 +1 @@ +Sepa-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/shopify-dark.svg b/dist/assets/images/payments/shopify-dark.svg new file mode 100644 index 000000000..c0265cd1d --- /dev/null +++ b/dist/assets/images/payments/shopify-dark.svg @@ -0,0 +1 @@ +Shopify-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/shopify.svg b/dist/assets/images/payments/shopify.svg new file mode 100644 index 000000000..084fbed86 --- /dev/null +++ b/dist/assets/images/payments/shopify.svg @@ -0,0 +1 @@ +Shopify-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/skrill-dark.svg b/dist/assets/images/payments/skrill-dark.svg new file mode 100644 index 000000000..e1008353a --- /dev/null +++ b/dist/assets/images/payments/skrill-dark.svg @@ -0,0 +1 @@ +Skrill-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/skrill.svg b/dist/assets/images/payments/skrill.svg new file mode 100644 index 000000000..5ad3300b0 --- /dev/null +++ b/dist/assets/images/payments/skrill.svg @@ -0,0 +1 @@ +Skrill-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/solo-dark.svg b/dist/assets/images/payments/solo-dark.svg new file mode 100644 index 000000000..bbe6e3b66 --- /dev/null +++ b/dist/assets/images/payments/solo-dark.svg @@ -0,0 +1 @@ +Solo-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/solo.svg b/dist/assets/images/payments/solo.svg new file mode 100644 index 000000000..344c23b9f --- /dev/null +++ b/dist/assets/images/payments/solo.svg @@ -0,0 +1 @@ +Solo-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/square-dark.svg b/dist/assets/images/payments/square-dark.svg new file mode 100644 index 000000000..acfbca901 --- /dev/null +++ b/dist/assets/images/payments/square-dark.svg @@ -0,0 +1 @@ +Square-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/square.svg b/dist/assets/images/payments/square.svg new file mode 100644 index 000000000..e775d8630 --- /dev/null +++ b/dist/assets/images/payments/square.svg @@ -0,0 +1 @@ +Square-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/stripe-dark.svg b/dist/assets/images/payments/stripe-dark.svg new file mode 100644 index 000000000..466fd87da --- /dev/null +++ b/dist/assets/images/payments/stripe-dark.svg @@ -0,0 +1 @@ +Stripe-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/stripe.svg b/dist/assets/images/payments/stripe.svg new file mode 100644 index 000000000..4bafa86cf --- /dev/null +++ b/dist/assets/images/payments/stripe.svg @@ -0,0 +1 @@ +Stripe-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/switch-dark.svg b/dist/assets/images/payments/switch-dark.svg new file mode 100644 index 000000000..4e8787978 --- /dev/null +++ b/dist/assets/images/payments/switch-dark.svg @@ -0,0 +1 @@ +Switch-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/switch.svg b/dist/assets/images/payments/switch.svg new file mode 100644 index 000000000..e4a8e5b08 --- /dev/null +++ b/dist/assets/images/payments/switch.svg @@ -0,0 +1 @@ +Switch-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ukash-dark.svg b/dist/assets/images/payments/ukash-dark.svg new file mode 100644 index 000000000..f48a474de --- /dev/null +++ b/dist/assets/images/payments/ukash-dark.svg @@ -0,0 +1 @@ +Ukash-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/ukash.svg b/dist/assets/images/payments/ukash.svg new file mode 100644 index 000000000..fd22ed2de --- /dev/null +++ b/dist/assets/images/payments/ukash.svg @@ -0,0 +1 @@ +Ukash-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/unionpay-dark.svg b/dist/assets/images/payments/unionpay-dark.svg new file mode 100644 index 000000000..4665ee938 --- /dev/null +++ b/dist/assets/images/payments/unionpay-dark.svg @@ -0,0 +1 @@ +UnionPay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/unionpay.svg b/dist/assets/images/payments/unionpay.svg new file mode 100644 index 000000000..90bdea517 --- /dev/null +++ b/dist/assets/images/payments/unionpay.svg @@ -0,0 +1 @@ +UnionPay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/verifone-dark.svg b/dist/assets/images/payments/verifone-dark.svg new file mode 100644 index 000000000..9215cc6df --- /dev/null +++ b/dist/assets/images/payments/verifone-dark.svg @@ -0,0 +1 @@ +Verifone-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/verifone.svg b/dist/assets/images/payments/verifone.svg new file mode 100644 index 000000000..f7ffab860 --- /dev/null +++ b/dist/assets/images/payments/verifone.svg @@ -0,0 +1 @@ +Verifone-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/verisign-dark.svg b/dist/assets/images/payments/verisign-dark.svg new file mode 100644 index 000000000..2f47d3a3a --- /dev/null +++ b/dist/assets/images/payments/verisign-dark.svg @@ -0,0 +1 @@ +VeriSign-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/verisign.svg b/dist/assets/images/payments/verisign.svg new file mode 100644 index 000000000..a557a0dd4 --- /dev/null +++ b/dist/assets/images/payments/verisign.svg @@ -0,0 +1 @@ +VeriSign-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/visa-dark.svg b/dist/assets/images/payments/visa-dark.svg new file mode 100644 index 000000000..95619ac38 --- /dev/null +++ b/dist/assets/images/payments/visa-dark.svg @@ -0,0 +1 @@ +Visa-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/visa.svg b/dist/assets/images/payments/visa.svg new file mode 100644 index 000000000..f8d981353 --- /dev/null +++ b/dist/assets/images/payments/visa.svg @@ -0,0 +1 @@ +Visa-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/webmoney-dark.svg b/dist/assets/images/payments/webmoney-dark.svg new file mode 100644 index 000000000..ab37c57ab --- /dev/null +++ b/dist/assets/images/payments/webmoney-dark.svg @@ -0,0 +1 @@ +WebMoney-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/webmoney.svg b/dist/assets/images/payments/webmoney.svg new file mode 100644 index 000000000..c745bffde --- /dev/null +++ b/dist/assets/images/payments/webmoney.svg @@ -0,0 +1 @@ +WebMoney-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/westernunion-dark.svg b/dist/assets/images/payments/westernunion-dark.svg new file mode 100644 index 000000000..a1826ff69 --- /dev/null +++ b/dist/assets/images/payments/westernunion-dark.svg @@ -0,0 +1 @@ +WesternUnion-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/westernunion.svg b/dist/assets/images/payments/westernunion.svg new file mode 100644 index 000000000..5c55f7122 --- /dev/null +++ b/dist/assets/images/payments/westernunion.svg @@ -0,0 +1 @@ +WesternUnion-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/worldpay-dark.svg b/dist/assets/images/payments/worldpay-dark.svg new file mode 100644 index 000000000..a1dc42d5d --- /dev/null +++ b/dist/assets/images/payments/worldpay-dark.svg @@ -0,0 +1 @@ +WorldPay-darkCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/payments/worldpay.svg b/dist/assets/images/payments/worldpay.svg new file mode 100644 index 000000000..d48408b2e --- /dev/null +++ b/dist/assets/images/payments/worldpay.svg @@ -0,0 +1 @@ +WorldPay-lightCreated with Sketch. \ No newline at end of file diff --git a/dist/assets/images/photos/adrian-infernus-281832-1500.jpg b/dist/assets/images/photos/adrian-infernus-281832-1500.jpg new file mode 100644 index 000000000..3ab810842 Binary files /dev/null and b/dist/assets/images/photos/adrian-infernus-281832-1500.jpg differ diff --git a/dist/assets/images/photos/adrian-infernus-281832-500.jpg b/dist/assets/images/photos/adrian-infernus-281832-500.jpg new file mode 100644 index 000000000..6f2e6a955 Binary files /dev/null and b/dist/assets/images/photos/adrian-infernus-281832-500.jpg differ diff --git a/dist/assets/images/photos/ales-krivec-107499-1500.jpg b/dist/assets/images/photos/ales-krivec-107499-1500.jpg new file mode 100644 index 000000000..7157037b8 Binary files /dev/null and b/dist/assets/images/photos/ales-krivec-107499-1500.jpg differ diff --git a/dist/assets/images/photos/ales-krivec-107499-500.jpg b/dist/assets/images/photos/ales-krivec-107499-500.jpg new file mode 100644 index 000000000..bcaad3afa Binary files /dev/null and b/dist/assets/images/photos/ales-krivec-107499-500.jpg differ diff --git a/dist/assets/images/photos/alex-bertha-316137-1500.jpg b/dist/assets/images/photos/alex-bertha-316137-1500.jpg new file mode 100644 index 000000000..f3329a75f Binary files /dev/null and b/dist/assets/images/photos/alex-bertha-316137-1500.jpg differ diff --git a/dist/assets/images/photos/alex-bertha-316137-500.jpg b/dist/assets/images/photos/alex-bertha-316137-500.jpg new file mode 100644 index 000000000..fbdccc70c Binary files /dev/null and b/dist/assets/images/photos/alex-bertha-316137-500.jpg differ diff --git a/dist/assets/images/photos/anders-jilden-307322-1500.jpg b/dist/assets/images/photos/anders-jilden-307322-1500.jpg new file mode 100644 index 000000000..321ff9d0f Binary files /dev/null and b/dist/assets/images/photos/anders-jilden-307322-1500.jpg differ diff --git a/dist/assets/images/photos/anders-jilden-307322-500.jpg b/dist/assets/images/photos/anders-jilden-307322-500.jpg new file mode 100644 index 000000000..2dc8a7594 Binary files /dev/null and b/dist/assets/images/photos/anders-jilden-307322-500.jpg differ diff --git a/dist/assets/images/photos/andrew-neel-141710-1500.jpg b/dist/assets/images/photos/andrew-neel-141710-1500.jpg new file mode 100644 index 000000000..fada86dee Binary files /dev/null and b/dist/assets/images/photos/andrew-neel-141710-1500.jpg differ diff --git a/dist/assets/images/photos/andrew-neel-141710-500.jpg b/dist/assets/images/photos/andrew-neel-141710-500.jpg new file mode 100644 index 000000000..4e3056584 Binary files /dev/null and b/dist/assets/images/photos/andrew-neel-141710-500.jpg differ diff --git a/dist/assets/images/photos/aneta-ivanova-776-1500.jpg b/dist/assets/images/photos/aneta-ivanova-776-1500.jpg new file mode 100644 index 000000000..7244b1f62 Binary files /dev/null and b/dist/assets/images/photos/aneta-ivanova-776-1500.jpg differ diff --git a/dist/assets/images/photos/aneta-ivanova-776-500.jpg b/dist/assets/images/photos/aneta-ivanova-776-500.jpg new file mode 100644 index 000000000..26dc2d44e Binary files /dev/null and b/dist/assets/images/photos/aneta-ivanova-776-500.jpg differ diff --git a/dist/assets/images/photos/anthony-intraversato-257182-1500.jpg b/dist/assets/images/photos/anthony-intraversato-257182-1500.jpg new file mode 100644 index 000000000..beb1ab8f2 Binary files /dev/null and b/dist/assets/images/photos/anthony-intraversato-257182-1500.jpg differ diff --git a/dist/assets/images/photos/anthony-intraversato-257182-500.jpg b/dist/assets/images/photos/anthony-intraversato-257182-500.jpg new file mode 100644 index 000000000..c55d77806 Binary files /dev/null and b/dist/assets/images/photos/anthony-intraversato-257182-500.jpg differ diff --git a/dist/assets/images/photos/artem-sapegin-229391-1500.jpg b/dist/assets/images/photos/artem-sapegin-229391-1500.jpg new file mode 100644 index 000000000..bf6006775 Binary files /dev/null and b/dist/assets/images/photos/artem-sapegin-229391-1500.jpg differ diff --git a/dist/assets/images/photos/artem-sapegin-229391-500.jpg b/dist/assets/images/photos/artem-sapegin-229391-500.jpg new file mode 100644 index 000000000..9112786dd Binary files /dev/null and b/dist/assets/images/photos/artem-sapegin-229391-500.jpg differ diff --git a/dist/assets/images/photos/bobby-burch-145906-1500.jpg b/dist/assets/images/photos/bobby-burch-145906-1500.jpg new file mode 100644 index 000000000..9f1e57ca4 Binary files /dev/null and b/dist/assets/images/photos/bobby-burch-145906-1500.jpg differ diff --git a/dist/assets/images/photos/bobby-burch-145906-500.jpg b/dist/assets/images/photos/bobby-burch-145906-500.jpg new file mode 100644 index 000000000..9460ed7e8 Binary files /dev/null and b/dist/assets/images/photos/bobby-burch-145906-500.jpg differ diff --git a/dist/assets/images/photos/casey-horner-339165-1500.jpg b/dist/assets/images/photos/casey-horner-339165-1500.jpg new file mode 100644 index 000000000..5708aece0 Binary files /dev/null and b/dist/assets/images/photos/casey-horner-339165-1500.jpg differ diff --git a/dist/assets/images/photos/casey-horner-339165-500.jpg b/dist/assets/images/photos/casey-horner-339165-500.jpg new file mode 100644 index 000000000..13826a2d6 Binary files /dev/null and b/dist/assets/images/photos/casey-horner-339165-500.jpg differ diff --git a/dist/assets/images/photos/christian-joudrey-96208-1500.jpg b/dist/assets/images/photos/christian-joudrey-96208-1500.jpg new file mode 100644 index 000000000..579c2c9d3 Binary files /dev/null and b/dist/assets/images/photos/christian-joudrey-96208-1500.jpg differ diff --git a/dist/assets/images/photos/christian-joudrey-96208-500.jpg b/dist/assets/images/photos/christian-joudrey-96208-500.jpg new file mode 100644 index 000000000..048a5e346 Binary files /dev/null and b/dist/assets/images/photos/christian-joudrey-96208-500.jpg differ diff --git a/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-1500.jpg b/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-1500.jpg new file mode 100644 index 000000000..eecea7796 Binary files /dev/null and b/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-1500.jpg differ diff --git a/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-500.jpg b/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-500.jpg new file mode 100644 index 000000000..a2af13432 Binary files /dev/null and b/dist/assets/images/photos/christoph-bengtsson-lissalde-80291-500.jpg differ diff --git a/dist/assets/images/photos/clarisse-meyer-122804-1500.jpg b/dist/assets/images/photos/clarisse-meyer-122804-1500.jpg new file mode 100644 index 000000000..49f4fd9f6 Binary files /dev/null and b/dist/assets/images/photos/clarisse-meyer-122804-1500.jpg differ diff --git a/dist/assets/images/photos/clarisse-meyer-122804-500.jpg b/dist/assets/images/photos/clarisse-meyer-122804-500.jpg new file mode 100644 index 000000000..8f9646df1 Binary files /dev/null and b/dist/assets/images/photos/clarisse-meyer-122804-500.jpg differ diff --git a/dist/assets/images/photos/cristina-gottardi-259243-1500.jpg b/dist/assets/images/photos/cristina-gottardi-259243-1500.jpg new file mode 100644 index 000000000..18c6ceec2 Binary files /dev/null and b/dist/assets/images/photos/cristina-gottardi-259243-1500.jpg differ diff --git a/dist/assets/images/photos/cristina-gottardi-259243-500.jpg b/dist/assets/images/photos/cristina-gottardi-259243-500.jpg new file mode 100644 index 000000000..fb389dfde Binary files /dev/null and b/dist/assets/images/photos/cristina-gottardi-259243-500.jpg differ diff --git a/dist/assets/images/photos/david-klaasen-54203-1500.jpg b/dist/assets/images/photos/david-klaasen-54203-1500.jpg new file mode 100644 index 000000000..e0e5bcd37 Binary files /dev/null and b/dist/assets/images/photos/david-klaasen-54203-1500.jpg differ diff --git a/dist/assets/images/photos/david-klaasen-54203-500.jpg b/dist/assets/images/photos/david-klaasen-54203-500.jpg new file mode 100644 index 000000000..7b71f66cd Binary files /dev/null and b/dist/assets/images/photos/david-klaasen-54203-500.jpg differ diff --git a/dist/assets/images/photos/david-marcu-114194-1500.jpg b/dist/assets/images/photos/david-marcu-114194-1500.jpg new file mode 100644 index 000000000..6d0574a2f Binary files /dev/null and b/dist/assets/images/photos/david-marcu-114194-1500.jpg differ diff --git a/dist/assets/images/photos/david-marcu-114194-500.jpg b/dist/assets/images/photos/david-marcu-114194-500.jpg new file mode 100644 index 000000000..eb353a0ae Binary files /dev/null and b/dist/assets/images/photos/david-marcu-114194-500.jpg differ diff --git a/dist/assets/images/photos/davide-cantelli-139887-1500.jpg b/dist/assets/images/photos/davide-cantelli-139887-1500.jpg new file mode 100644 index 000000000..4378d5179 Binary files /dev/null and b/dist/assets/images/photos/davide-cantelli-139887-1500.jpg differ diff --git a/dist/assets/images/photos/davide-cantelli-139887-500.jpg b/dist/assets/images/photos/davide-cantelli-139887-500.jpg new file mode 100644 index 000000000..46b6f86e3 Binary files /dev/null and b/dist/assets/images/photos/davide-cantelli-139887-500.jpg differ diff --git a/dist/assets/images/photos/dino-reichmuth-84359-1500.jpg b/dist/assets/images/photos/dino-reichmuth-84359-1500.jpg new file mode 100644 index 000000000..7517bfbc2 Binary files /dev/null and b/dist/assets/images/photos/dino-reichmuth-84359-1500.jpg differ diff --git a/dist/assets/images/photos/dino-reichmuth-84359-500.jpg b/dist/assets/images/photos/dino-reichmuth-84359-500.jpg new file mode 100644 index 000000000..64683c469 Binary files /dev/null and b/dist/assets/images/photos/dino-reichmuth-84359-500.jpg differ diff --git a/dist/assets/images/photos/eberhard-grossgasteiger-311213-1500.jpg b/dist/assets/images/photos/eberhard-grossgasteiger-311213-1500.jpg new file mode 100644 index 000000000..1d6c80f42 Binary files /dev/null and b/dist/assets/images/photos/eberhard-grossgasteiger-311213-1500.jpg differ diff --git a/dist/assets/images/photos/eberhard-grossgasteiger-311213-500.jpg b/dist/assets/images/photos/eberhard-grossgasteiger-311213-500.jpg new file mode 100644 index 000000000..2fb1abbf1 Binary files /dev/null and b/dist/assets/images/photos/eberhard-grossgasteiger-311213-500.jpg differ diff --git a/dist/assets/images/photos/geran-de-klerk-290418-1500.jpg b/dist/assets/images/photos/geran-de-klerk-290418-1500.jpg new file mode 100644 index 000000000..ecaf8a8a0 Binary files /dev/null and b/dist/assets/images/photos/geran-de-klerk-290418-1500.jpg differ diff --git a/dist/assets/images/photos/geran-de-klerk-290418-500.jpg b/dist/assets/images/photos/geran-de-klerk-290418-500.jpg new file mode 100644 index 000000000..590a32b1a Binary files /dev/null and b/dist/assets/images/photos/geran-de-klerk-290418-500.jpg differ diff --git a/dist/assets/images/photos/grant-ritchie-338179-1500.jpg b/dist/assets/images/photos/grant-ritchie-338179-1500.jpg new file mode 100644 index 000000000..3db499bbf Binary files /dev/null and b/dist/assets/images/photos/grant-ritchie-338179-1500.jpg differ diff --git a/dist/assets/images/photos/grant-ritchie-338179-500.jpg b/dist/assets/images/photos/grant-ritchie-338179-500.jpg new file mode 100644 index 000000000..9fda83934 Binary files /dev/null and b/dist/assets/images/photos/grant-ritchie-338179-500.jpg differ diff --git a/dist/assets/images/photos/ilnur-kalimullin-218996-1500.jpg b/dist/assets/images/photos/ilnur-kalimullin-218996-1500.jpg new file mode 100644 index 000000000..256f35f6d Binary files /dev/null and b/dist/assets/images/photos/ilnur-kalimullin-218996-1500.jpg differ diff --git a/dist/assets/images/photos/ilnur-kalimullin-218996-500.jpg b/dist/assets/images/photos/ilnur-kalimullin-218996-500.jpg new file mode 100644 index 000000000..b7afdfc4b Binary files /dev/null and b/dist/assets/images/photos/ilnur-kalimullin-218996-500.jpg differ diff --git a/dist/assets/images/photos/jakob-owens-224352-1500.jpg b/dist/assets/images/photos/jakob-owens-224352-1500.jpg new file mode 100644 index 000000000..1ceb3fb7f Binary files /dev/null and b/dist/assets/images/photos/jakob-owens-224352-1500.jpg differ diff --git a/dist/assets/images/photos/jakob-owens-224352-500.jpg b/dist/assets/images/photos/jakob-owens-224352-500.jpg new file mode 100644 index 000000000..e5d22955d Binary files /dev/null and b/dist/assets/images/photos/jakob-owens-224352-500.jpg differ diff --git a/dist/assets/images/photos/jeremy-bishop-330225-1500.jpg b/dist/assets/images/photos/jeremy-bishop-330225-1500.jpg new file mode 100644 index 000000000..f5effe31b Binary files /dev/null and b/dist/assets/images/photos/jeremy-bishop-330225-1500.jpg differ diff --git a/dist/assets/images/photos/jeremy-bishop-330225-500.jpg b/dist/assets/images/photos/jeremy-bishop-330225-500.jpg new file mode 100644 index 000000000..50c2705c2 Binary files /dev/null and b/dist/assets/images/photos/jeremy-bishop-330225-500.jpg differ diff --git a/dist/assets/images/photos/jonatan-pie-226191-1500.jpg b/dist/assets/images/photos/jonatan-pie-226191-1500.jpg new file mode 100644 index 000000000..ab5e246ba Binary files /dev/null and b/dist/assets/images/photos/jonatan-pie-226191-1500.jpg differ diff --git a/dist/assets/images/photos/jonatan-pie-226191-500.jpg b/dist/assets/images/photos/jonatan-pie-226191-500.jpg new file mode 100644 index 000000000..a00109a12 Binary files /dev/null and b/dist/assets/images/photos/jonatan-pie-226191-500.jpg differ diff --git a/dist/assets/images/photos/josh-calabrese-66153-1500.jpg b/dist/assets/images/photos/josh-calabrese-66153-1500.jpg new file mode 100644 index 000000000..b46220bb9 Binary files /dev/null and b/dist/assets/images/photos/josh-calabrese-66153-1500.jpg differ diff --git a/dist/assets/images/photos/josh-calabrese-66153-500.jpg b/dist/assets/images/photos/josh-calabrese-66153-500.jpg new file mode 100644 index 000000000..b8d93710d Binary files /dev/null and b/dist/assets/images/photos/josh-calabrese-66153-500.jpg differ diff --git a/dist/assets/images/photos/joshua-earle-157231-1500.jpg b/dist/assets/images/photos/joshua-earle-157231-1500.jpg new file mode 100644 index 000000000..cb7e23ee9 Binary files /dev/null and b/dist/assets/images/photos/joshua-earle-157231-1500.jpg differ diff --git a/dist/assets/images/photos/joshua-earle-157231-500.jpg b/dist/assets/images/photos/joshua-earle-157231-500.jpg new file mode 100644 index 000000000..c2a60bf40 Binary files /dev/null and b/dist/assets/images/photos/joshua-earle-157231-500.jpg differ diff --git a/dist/assets/images/photos/mahkeo-222765-1500.jpg b/dist/assets/images/photos/mahkeo-222765-1500.jpg new file mode 100644 index 000000000..e8700f911 Binary files /dev/null and b/dist/assets/images/photos/mahkeo-222765-1500.jpg differ diff --git a/dist/assets/images/photos/mahkeo-222765-500.jpg b/dist/assets/images/photos/mahkeo-222765-500.jpg new file mode 100644 index 000000000..a69d6fc99 Binary files /dev/null and b/dist/assets/images/photos/mahkeo-222765-500.jpg differ diff --git a/dist/assets/images/photos/matt-barrett-339981-1500.jpg b/dist/assets/images/photos/matt-barrett-339981-1500.jpg new file mode 100644 index 000000000..699c1b3db Binary files /dev/null and b/dist/assets/images/photos/matt-barrett-339981-1500.jpg differ diff --git a/dist/assets/images/photos/matt-barrett-339981-500.jpg b/dist/assets/images/photos/matt-barrett-339981-500.jpg new file mode 100644 index 000000000..20e627201 Binary files /dev/null and b/dist/assets/images/photos/matt-barrett-339981-500.jpg differ diff --git a/dist/assets/images/photos/nathan-anderson-297460-1500.jpg b/dist/assets/images/photos/nathan-anderson-297460-1500.jpg new file mode 100644 index 000000000..f980853ff Binary files /dev/null and b/dist/assets/images/photos/nathan-anderson-297460-1500.jpg differ diff --git a/dist/assets/images/photos/nathan-anderson-297460-500.jpg b/dist/assets/images/photos/nathan-anderson-297460-500.jpg new file mode 100644 index 000000000..bf011beaf Binary files /dev/null and b/dist/assets/images/photos/nathan-anderson-297460-500.jpg differ diff --git a/dist/assets/images/photos/nathan-anderson-316188-1500.jpg b/dist/assets/images/photos/nathan-anderson-316188-1500.jpg new file mode 100644 index 000000000..47410b994 Binary files /dev/null and b/dist/assets/images/photos/nathan-anderson-316188-1500.jpg differ diff --git a/dist/assets/images/photos/nathan-anderson-316188-500.jpg b/dist/assets/images/photos/nathan-anderson-316188-500.jpg new file mode 100644 index 000000000..069af5afa Binary files /dev/null and b/dist/assets/images/photos/nathan-anderson-316188-500.jpg differ diff --git a/dist/assets/images/photos/nathan-dumlao-287713-1500.jpg b/dist/assets/images/photos/nathan-dumlao-287713-1500.jpg new file mode 100644 index 000000000..97ae0c31c Binary files /dev/null and b/dist/assets/images/photos/nathan-dumlao-287713-1500.jpg differ diff --git a/dist/assets/images/photos/nathan-dumlao-287713-500.jpg b/dist/assets/images/photos/nathan-dumlao-287713-500.jpg new file mode 100644 index 000000000..7f061b3de Binary files /dev/null and b/dist/assets/images/photos/nathan-dumlao-287713-500.jpg differ diff --git a/dist/assets/images/photos/nicolas-picard-208276-1500.jpg b/dist/assets/images/photos/nicolas-picard-208276-1500.jpg new file mode 100644 index 000000000..a20c7583a Binary files /dev/null and b/dist/assets/images/photos/nicolas-picard-208276-1500.jpg differ diff --git a/dist/assets/images/photos/nicolas-picard-208276-500.jpg b/dist/assets/images/photos/nicolas-picard-208276-500.jpg new file mode 100644 index 000000000..17b12c18a Binary files /dev/null and b/dist/assets/images/photos/nicolas-picard-208276-500.jpg differ diff --git a/dist/assets/images/photos/oskar-vertetics-53043-1500.jpg b/dist/assets/images/photos/oskar-vertetics-53043-1500.jpg new file mode 100644 index 000000000..9a8804019 Binary files /dev/null and b/dist/assets/images/photos/oskar-vertetics-53043-1500.jpg differ diff --git a/dist/assets/images/photos/oskar-vertetics-53043-500.jpg b/dist/assets/images/photos/oskar-vertetics-53043-500.jpg new file mode 100644 index 000000000..87c79dd5f Binary files /dev/null and b/dist/assets/images/photos/oskar-vertetics-53043-500.jpg differ diff --git a/dist/assets/images/photos/priscilla-du-preez-181896-1500.jpg b/dist/assets/images/photos/priscilla-du-preez-181896-1500.jpg new file mode 100644 index 000000000..f0bfe74ed Binary files /dev/null and b/dist/assets/images/photos/priscilla-du-preez-181896-1500.jpg differ diff --git a/dist/assets/images/photos/priscilla-du-preez-181896-500.jpg b/dist/assets/images/photos/priscilla-du-preez-181896-500.jpg new file mode 100644 index 000000000..0d83bd1f5 Binary files /dev/null and b/dist/assets/images/photos/priscilla-du-preez-181896-500.jpg differ diff --git a/dist/assets/images/photos/ricardo-gomez-angel-262359-1500.jpg b/dist/assets/images/photos/ricardo-gomez-angel-262359-1500.jpg new file mode 100644 index 000000000..34f4186dc Binary files /dev/null and b/dist/assets/images/photos/ricardo-gomez-angel-262359-1500.jpg differ diff --git a/dist/assets/images/photos/ricardo-gomez-angel-262359-500.jpg b/dist/assets/images/photos/ricardo-gomez-angel-262359-500.jpg new file mode 100644 index 000000000..943068cdb Binary files /dev/null and b/dist/assets/images/photos/ricardo-gomez-angel-262359-500.jpg differ diff --git a/dist/assets/images/photos/sam-ferrara-136526-1500.jpg b/dist/assets/images/photos/sam-ferrara-136526-1500.jpg new file mode 100644 index 000000000..f6ebf969b Binary files /dev/null and b/dist/assets/images/photos/sam-ferrara-136526-1500.jpg differ diff --git a/dist/assets/images/photos/sam-ferrara-136526-500.jpg b/dist/assets/images/photos/sam-ferrara-136526-500.jpg new file mode 100644 index 000000000..b9e134458 Binary files /dev/null and b/dist/assets/images/photos/sam-ferrara-136526-500.jpg differ diff --git a/dist/assets/images/photos/sean-afnan-244576-1500.jpg b/dist/assets/images/photos/sean-afnan-244576-1500.jpg new file mode 100644 index 000000000..fa36f9fe3 Binary files /dev/null and b/dist/assets/images/photos/sean-afnan-244576-1500.jpg differ diff --git a/dist/assets/images/photos/sean-afnan-244576-500.jpg b/dist/assets/images/photos/sean-afnan-244576-500.jpg new file mode 100644 index 000000000..aba57365f Binary files /dev/null and b/dist/assets/images/photos/sean-afnan-244576-500.jpg differ diff --git a/dist/assets/images/photos/sophie-higginbottom-133982-1500.jpg b/dist/assets/images/photos/sophie-higginbottom-133982-1500.jpg new file mode 100644 index 000000000..ee5f400db Binary files /dev/null and b/dist/assets/images/photos/sophie-higginbottom-133982-1500.jpg differ diff --git a/dist/assets/images/photos/sophie-higginbottom-133982-500.jpg b/dist/assets/images/photos/sophie-higginbottom-133982-500.jpg new file mode 100644 index 000000000..dbf699a7a Binary files /dev/null and b/dist/assets/images/photos/sophie-higginbottom-133982-500.jpg differ diff --git a/dist/assets/images/photos/stefan-kunze-26932-1500.jpg b/dist/assets/images/photos/stefan-kunze-26932-1500.jpg new file mode 100644 index 000000000..deff5e7d4 Binary files /dev/null and b/dist/assets/images/photos/stefan-kunze-26932-1500.jpg differ diff --git a/dist/assets/images/photos/stefan-kunze-26932-500.jpg b/dist/assets/images/photos/stefan-kunze-26932-500.jpg new file mode 100644 index 000000000..d7dc8a295 Binary files /dev/null and b/dist/assets/images/photos/stefan-kunze-26932-500.jpg differ diff --git a/dist/assets/images/photos/stefan-stefancik-105376-1500.jpg b/dist/assets/images/photos/stefan-stefancik-105376-1500.jpg new file mode 100644 index 000000000..918fb606d Binary files /dev/null and b/dist/assets/images/photos/stefan-stefancik-105376-1500.jpg differ diff --git a/dist/assets/images/photos/stefan-stefancik-105376-500.jpg b/dist/assets/images/photos/stefan-stefancik-105376-500.jpg new file mode 100644 index 000000000..c7be0b9d0 Binary files /dev/null and b/dist/assets/images/photos/stefan-stefancik-105376-500.jpg differ diff --git a/dist/assets/images/photos/sweet-ice-cream-photography-143023-1500.jpg b/dist/assets/images/photos/sweet-ice-cream-photography-143023-1500.jpg new file mode 100644 index 000000000..f082d64b1 Binary files /dev/null and b/dist/assets/images/photos/sweet-ice-cream-photography-143023-1500.jpg differ diff --git a/dist/assets/images/photos/sweet-ice-cream-photography-143023-500.jpg b/dist/assets/images/photos/sweet-ice-cream-photography-143023-500.jpg new file mode 100644 index 000000000..550305657 Binary files /dev/null and b/dist/assets/images/photos/sweet-ice-cream-photography-143023-500.jpg differ diff --git a/dist/assets/images/photos/tatyana-dobreva-288463-1500.jpg b/dist/assets/images/photos/tatyana-dobreva-288463-1500.jpg new file mode 100644 index 000000000..ce941f2f1 Binary files /dev/null and b/dist/assets/images/photos/tatyana-dobreva-288463-1500.jpg differ diff --git a/dist/assets/images/photos/tatyana-dobreva-288463-500.jpg b/dist/assets/images/photos/tatyana-dobreva-288463-500.jpg new file mode 100644 index 000000000..2ff3ec970 Binary files /dev/null and b/dist/assets/images/photos/tatyana-dobreva-288463-500.jpg differ diff --git a/dist/assets/images/photos/teddy-kelley-109202-1500.jpg b/dist/assets/images/photos/teddy-kelley-109202-1500.jpg new file mode 100644 index 000000000..d3ed45877 Binary files /dev/null and b/dist/assets/images/photos/teddy-kelley-109202-1500.jpg differ diff --git a/dist/assets/images/photos/teddy-kelley-109202-500.jpg b/dist/assets/images/photos/teddy-kelley-109202-500.jpg new file mode 100644 index 000000000..7f0780d89 Binary files /dev/null and b/dist/assets/images/photos/teddy-kelley-109202-500.jpg differ diff --git a/dist/assets/images/photos/tim-bogdanov-97988-1500.jpg b/dist/assets/images/photos/tim-bogdanov-97988-1500.jpg new file mode 100644 index 000000000..054f63236 Binary files /dev/null and b/dist/assets/images/photos/tim-bogdanov-97988-1500.jpg differ diff --git a/dist/assets/images/photos/tim-bogdanov-97988-500.jpg b/dist/assets/images/photos/tim-bogdanov-97988-500.jpg new file mode 100644 index 000000000..3badb6008 Binary files /dev/null and b/dist/assets/images/photos/tim-bogdanov-97988-500.jpg differ diff --git a/dist/assets/images/photos/tim-marshall-173957-1500.jpg b/dist/assets/images/photos/tim-marshall-173957-1500.jpg new file mode 100644 index 000000000..fbb1a98c0 Binary files /dev/null and b/dist/assets/images/photos/tim-marshall-173957-1500.jpg differ diff --git a/dist/assets/images/photos/tim-marshall-173957-500.jpg b/dist/assets/images/photos/tim-marshall-173957-500.jpg new file mode 100644 index 000000000..fddc819b5 Binary files /dev/null and b/dist/assets/images/photos/tim-marshall-173957-500.jpg differ diff --git a/dist/assets/images/photos/tom-barrett-318952-1500.jpg b/dist/assets/images/photos/tom-barrett-318952-1500.jpg new file mode 100644 index 000000000..5ef9c009e Binary files /dev/null and b/dist/assets/images/photos/tom-barrett-318952-1500.jpg differ diff --git a/dist/assets/images/photos/tom-barrett-318952-500.jpg b/dist/assets/images/photos/tom-barrett-318952-500.jpg new file mode 100644 index 000000000..8bb691773 Binary files /dev/null and b/dist/assets/images/photos/tom-barrett-318952-500.jpg differ diff --git a/dist/assets/images/photos/vladimir-kudinov-12761-1500.jpg b/dist/assets/images/photos/vladimir-kudinov-12761-1500.jpg new file mode 100644 index 000000000..bc2517fea Binary files /dev/null and b/dist/assets/images/photos/vladimir-kudinov-12761-1500.jpg differ diff --git a/dist/assets/images/photos/vladimir-kudinov-12761-500.jpg b/dist/assets/images/photos/vladimir-kudinov-12761-500.jpg new file mode 100644 index 000000000..41a1d16ad Binary files /dev/null and b/dist/assets/images/photos/vladimir-kudinov-12761-500.jpg differ diff --git a/dist/assets/images/photos/web-agency-29200-1500.jpg b/dist/assets/images/photos/web-agency-29200-1500.jpg new file mode 100644 index 000000000..ca8538771 Binary files /dev/null and b/dist/assets/images/photos/web-agency-29200-1500.jpg differ diff --git a/dist/assets/images/photos/web-agency-29200-500.jpg b/dist/assets/images/photos/web-agency-29200-500.jpg new file mode 100644 index 000000000..0891898b7 Binary files /dev/null and b/dist/assets/images/photos/web-agency-29200-500.jpg differ diff --git a/dist/assets/images/photos/wil-stewart-18242-1500.jpg b/dist/assets/images/photos/wil-stewart-18242-1500.jpg new file mode 100644 index 000000000..9d05fcccc Binary files /dev/null and b/dist/assets/images/photos/wil-stewart-18242-1500.jpg differ diff --git a/dist/assets/images/photos/wil-stewart-18242-500.jpg b/dist/assets/images/photos/wil-stewart-18242-500.jpg new file mode 100644 index 000000000..a84b71da4 Binary files /dev/null and b/dist/assets/images/photos/wil-stewart-18242-500.jpg differ diff --git a/dist/assets/images/products/apple-iphone7-special.jpg b/dist/assets/images/products/apple-iphone7-special.jpg new file mode 100644 index 000000000..8c8da8c93 Binary files /dev/null and b/dist/assets/images/products/apple-iphone7-special.jpg differ diff --git a/dist/assets/images/products/apple-iphone7.jpg b/dist/assets/images/products/apple-iphone7.jpg new file mode 100644 index 000000000..c9875c2cf Binary files /dev/null and b/dist/assets/images/products/apple-iphone7.jpg differ diff --git a/dist/assets/images/products/apple-macbook-pro.jpg b/dist/assets/images/products/apple-macbook-pro.jpg new file mode 100644 index 000000000..0cd18639b Binary files /dev/null and b/dist/assets/images/products/apple-macbook-pro.jpg differ diff --git a/dist/assets/images/products/gopro-hero.jpg b/dist/assets/images/products/gopro-hero.jpg new file mode 100644 index 000000000..f1640b837 Binary files /dev/null and b/dist/assets/images/products/gopro-hero.jpg differ diff --git a/dist/assets/images/products/huawei-mate.jpg b/dist/assets/images/products/huawei-mate.jpg new file mode 100644 index 000000000..7a3645199 Binary files /dev/null and b/dist/assets/images/products/huawei-mate.jpg differ diff --git a/dist/assets/images/products/lenovo-tab.jpg b/dist/assets/images/products/lenovo-tab.jpg new file mode 100644 index 000000000..0394c678c Binary files /dev/null and b/dist/assets/images/products/lenovo-tab.jpg differ diff --git a/dist/assets/images/products/lg-g6.jpg b/dist/assets/images/products/lg-g6.jpg new file mode 100644 index 000000000..d24283595 Binary files /dev/null and b/dist/assets/images/products/lg-g6.jpg differ diff --git a/dist/assets/images/products/msi.jpg b/dist/assets/images/products/msi.jpg new file mode 100644 index 000000000..6ccf8dafc Binary files /dev/null and b/dist/assets/images/products/msi.jpg differ diff --git a/dist/assets/images/products/samsung-galaxy.jpg b/dist/assets/images/products/samsung-galaxy.jpg new file mode 100644 index 000000000..325b5ecfc Binary files /dev/null and b/dist/assets/images/products/samsung-galaxy.jpg differ diff --git a/dist/assets/images/products/sony-kd.jpg b/dist/assets/images/products/sony-kd.jpg new file mode 100644 index 000000000..63ccf6cfb Binary files /dev/null and b/dist/assets/images/products/sony-kd.jpg differ diff --git a/dist/assets/images/products/xiaomi-mi.jpg b/dist/assets/images/products/xiaomi-mi.jpg new file mode 100644 index 000000000..3ca37482e Binary files /dev/null and b/dist/assets/images/products/xiaomi-mi.jpg differ diff --git a/dist/assets/images/staticmap.png b/dist/assets/images/staticmap.png new file mode 100755 index 000000000..1ea5a38fb Binary files /dev/null and b/dist/assets/images/staticmap.png differ diff --git a/dist/assets/images/teams/fc-barcelona.png b/dist/assets/images/teams/fc-barcelona.png new file mode 100644 index 000000000..7f6a237b7 Binary files /dev/null and b/dist/assets/images/teams/fc-barcelona.png differ diff --git a/dist/assets/images/teams/real-madrid.png b/dist/assets/images/teams/real-madrid.png new file mode 100644 index 000000000..61fdc3d93 Binary files /dev/null and b/dist/assets/images/teams/real-madrid.png differ diff --git a/dist/assets/js/core.js b/dist/assets/js/core.js new file mode 100644 index 000000000..a45309707 --- /dev/null +++ b/dist/assets/js/core.js @@ -0,0 +1,101 @@ +var hexToRgba = function(hex, opacity) { + var result = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i.exec(hex); + var rgb = result ? { + r: parseInt(result[1], 16), + g: parseInt(result[2], 16), + b: parseInt(result[3], 16) + } : null; + + return 'rgba(' + rgb.r + ', ' + rgb.g + ', ' + rgb.b + ', '+ opacity + ')'; +}; + +$(document).ready(function () { + + // Initialize tooltips + $('[data-toggle="tooltip"]').tooltip(); + + // Initialize popovers + $('[data-toggle="popover"]').popover({ + html: true + }); + + // Function for remove card + $('[data-toggle="card-remove"]').on('click', function (e) { + var $card = $(this).closest('div.card'); + $card.remove(); + + e.preventDefault(); + return false; + }); + + // Function for collapse card + $('[data-toggle="card-collapse"]').on('click', function (e) { + var $this = $(this), + $card = $this.closest('div.card'); + + $card.toggleClass('card-collapsed'); + + e.preventDefault(); + return false; + }); + + // Function for fullscreen card + $('[data-toggle="card-fullscreen"]').on('click', function(e) { + var $card = $(this).closest('div.card'); + + $card.toggleClass('card-fullscreen').removeClass('card-collapsed'); + + e.preventDefault(); + return false; + }); + + if($('[data-sparkline]').length) { + var generateSparkline = function($elem, data, params) { + $elem.sparkline(data, { + type: $elem.attr('data-sparkline-type'), + height: '100%', + barColor: params.color, + lineColor: params.color, + fillColor: 'transparent', + spotColor: params.color, + spotRadius: 0, + lineWidth: 2, + highlightColor: hexToRgba(params.color, .6), + highlightLineColor: '#666', + defaultPixelsPerValue: 5 + }); + }; + + require(['sparkline'], function(){ + $('[data-sparkline]').each(function(){ + var $chart = $(this); + + generateSparkline($chart, JSON.parse($chart.attr('data-sparkline')), { + color: $chart.attr('data-sparkline-color') + }); + }); + }); + } + + + if($('.chart-circle').length) { + require(['circle-progress'], function () { + $('.chart-circle').each(function () { + var $this = $(this); + $this.circleProgress({ + fill: { + color: tabler.colors[$this.attr('data-color')] || tabler.colors.blue + }, + size: $this.height(), + startAngle: -Math.PI / 4 * 2, + emptyFill: '#F4F4F4', + lineCap: 'round' + }); + }); + }); + } + + + + +}); \ No newline at end of file diff --git a/dist/assets/js/dashboard.js b/dist/assets/js/dashboard.js new file mode 100644 index 000000000..c065a8640 --- /dev/null +++ b/dist/assets/js/dashboard.js @@ -0,0 +1,47 @@ +require.config({ + shim: { + 'bootstrap': ['jquery'], + 'sparkline': ['jquery'], + 'tablesorter': ['jquery'], + 'vector-map': ['jquery'], + 'vector-map-de': ['vector-map', 'jquery'], + 'vector-map-world': ['vector-map', 'jquery'], + 'core': ['bootstrap'], + }, + paths: { + 'core': 'assets/js/core', + 'jquery': 'assets/js/vendors/jquery-3.2.1.min', + 'popper': 'assets/js/vendors/popper.min', + 'chart': 'assets/js/vendors/chart.bundle.min', + 'bootstrap': 'assets/js/vendors/bootstrap.min', + 'sparkline': 'assets/js/vendors/jquery.sparkline.min', + 'selectize': 'assets/js/vendors/selectize.min', + 'tablesorter': 'assets/js/vendors/jquery.tablesorter.min', + 'vector-map': 'assets/js/vendors/jquery-jvectormap-2.0.3.min', + 'vector-map-de': 'assets/js/vendors/jquery-jvectormap-de-merc', + 'vector-map-world': 'assets/js/vendors/jquery-jvectormap-world-mill', + 'circle-progress': 'assets/js/vendors/circle-progress.min', + } +}); + +window.tabler = { + colors: { + "blue": "#467fcf", + "azure": "#45aaf2", + "indigo": "#6574cd", + "purple": "#a55eea", + "pink": "#f66d9b", + "red": "#e74c3c", + "orange": "#fd9644", + "yellow": "#f1c40f", + "lime": "#7bd235", + "green": "#5eba00", + "teal": "#2bcbba", + "cyan": "#17a2b8", + "gray": "#868e96", + "gray-dark": "#343a40" + + } +}; + +require(['core']); \ No newline at end of file diff --git a/dist/assets/js/require.min.js b/dist/assets/js/require.min.js new file mode 100644 index 000000000..a3ca583b9 --- /dev/null +++ b/dist/assets/js/require.min.js @@ -0,0 +1,5 @@ +/** vim: et:ts=4:sw=4:sts=4 + * @license RequireJS 2.3.5 Copyright jQuery Foundation and other contributors. + * Released under MIT license, https://github.com/requirejs/requirejs/blob/master/LICENSE + */ +var requirejs,require,define;!function(global,setTimeout){function commentReplace(e,t){return t||""}function isFunction(e){return"[object Function]"===ostring.call(e)}function isArray(e){return"[object Array]"===ostring.call(e)}function each(e,t){if(e){var i;for(i=0;i-1&&(!e[i]||!t(e[i],i,e));i-=1);}}function hasProp(e,t){return hasOwn.call(e,t)}function getOwn(e,t){return hasProp(e,t)&&e[t]}function eachProp(e,t){var i;for(i in e)if(hasProp(e,i)&&t(e[i],i))break}function mixin(e,t,i,r){return t&&eachProp(t,function(t,n){!i&&hasProp(e,n)||(!r||"object"!=typeof t||!t||isArray(t)||isFunction(t)||t instanceof RegExp?e[n]=t:(e[n]||(e[n]={}),mixin(e[n],t,i,r)))}),e}function bind(e,t){return function(){return t.apply(e,arguments)}}function scripts(){return document.getElementsByTagName("script")}function defaultOnError(e){throw e}function getGlobal(e){if(!e)return e;var t=global;return each(e.split("."),function(e){t=t[e]}),t}function makeError(e,t,i,r){var n=new Error(t+"\nhttp://requirejs.org/docs/errors.html#"+e);return n.requireType=e,n.requireModules=r,i&&(n.originalError=i),n}function newContext(e){function t(e){var t,i;for(t=0;t0&&(e.splice(t-1,2),t-=2)}}function i(e,i,r){var n,o,a,s,u,c,d,p,f,l,h=i&&i.split("/"),m=y.map,g=m&&m["*"];if(e&&(c=(e=e.split("/")).length-1,y.nodeIdCompat&&jsSuffixRegExp.test(e[c])&&(e[c]=e[c].replace(jsSuffixRegExp,"")),"."===e[0].charAt(0)&&h&&(e=h.slice(0,h.length-1).concat(e)),t(e),e=e.join("/")),r&&m&&(h||g)){e:for(a=(o=e.split("/")).length;a>0;a-=1){if(u=o.slice(0,a).join("/"),h)for(s=h.length;s>0;s-=1)if((n=getOwn(m,h.slice(0,s).join("/")))&&(n=getOwn(n,u))){d=n,p=a;break e}!f&&g&&getOwn(g,u)&&(f=getOwn(g,u),l=a)}!d&&f&&(d=f,p=l),d&&(o.splice(0,p,d),e=o.join("/"))}return getOwn(y.pkgs,e)||e}function r(e){isBrowser&&each(scripts(),function(t){if(t.getAttribute("data-requiremodule")===e&&t.getAttribute("data-requirecontext")===q.contextName)return t.parentNode.removeChild(t),!0})}function n(e){var t=getOwn(y.paths,e);if(t&&isArray(t)&&t.length>1)return t.shift(),q.require.undef(e),q.makeRequire(null,{skipMap:!0})([e]),!0}function o(e){var t,i=e?e.indexOf("!"):-1;return i>-1&&(t=e.substring(0,i),e=e.substring(i+1,e.length)),[t,e]}function a(e,t,r,n){var a,s,u,c,d=null,p=t?t.name:null,f=e,l=!0,h="";return e||(l=!1,e="_@r"+(T+=1)),c=o(e),d=c[0],e=c[1],d&&(d=i(d,p,n),s=getOwn(j,d)),e&&(d?h=r?e:s&&s.normalize?s.normalize(e,function(e){return i(e,p,n)}):-1===e.indexOf("!")?i(e,p,n):e:(d=(c=o(h=i(e,p,n)))[0],h=c[1],r=!0,a=q.nameToUrl(h))),u=!d||s||r?"":"_unnormalized"+(A+=1),{prefix:d,name:h,parentMap:t,unnormalized:!!u,url:a,originalName:f,isDefine:l,id:(d?d+"!"+h:h)+u}}function s(e){var t=e.id,i=getOwn(S,t);return i||(i=S[t]=new q.Module(e)),i}function u(e,t,i){var r=e.id,n=getOwn(S,r);!hasProp(j,r)||n&&!n.defineEmitComplete?(n=s(e)).error&&"error"===t?i(n.error):n.on(t,i):"defined"===t&&i(j[r])}function c(e,t){var i=e.requireModules,r=!1;t?t(e):(each(i,function(t){var i=getOwn(S,t);i&&(i.error=e,i.events.error&&(r=!0,i.emit("error",e)))}),r||req.onError(e))}function d(){globalDefQueue.length&&(each(globalDefQueue,function(e){var t=e[0];"string"==typeof t&&(q.defQueueMap[t]=!0),O.push(e)}),globalDefQueue=[])}function p(e){delete S[e],delete k[e]}function f(e,t,i){var r=e.map.id;e.error?e.emit("error",e.error):(t[r]=!0,each(e.depMaps,function(r,n){var o=r.id,a=getOwn(S,o);!a||e.depMatched[n]||i[o]||(getOwn(t,o)?(e.defineDep(n,j[o]),e.check()):f(a,t,i))}),i[r]=!0)}function l(){var e,t,i=1e3*y.waitSeconds,o=i&&q.startTime+i<(new Date).getTime(),a=[],s=[],u=!1,d=!0;if(!x){if(x=!0,eachProp(k,function(e){var i=e.map,c=i.id;if(e.enabled&&(i.isDefine||s.push(e),!e.error))if(!e.inited&&o)n(c)?(t=!0,u=!0):(a.push(c),r(c));else if(!e.inited&&e.fetched&&i.isDefine&&(u=!0,!i.prefix))return d=!1}),o&&a.length)return e=makeError("timeout","Load timeout for modules: "+a,null,a),e.contextName=q.contextName,c(e);d&&each(s,function(e){f(e,{},{})}),o&&!t||!u||!isBrowser&&!isWebWorker||w||(w=setTimeout(function(){w=0,l()},50)),x=!1}}function h(e){hasProp(j,e[0])||s(a(e[0],null,!0)).init(e[1],e[2])}function m(e,t,i,r){e.detachEvent&&!isOpera?r&&e.detachEvent(r,t):e.removeEventListener(i,t,!1)}function g(e){var t=e.currentTarget||e.srcElement;return m(t,q.onScriptLoad,"load","onreadystatechange"),m(t,q.onScriptError,"error"),{node:t,id:t&&t.getAttribute("data-requiremodule")}}function v(){var e;for(d();O.length;){if(null===(e=O.shift())[0])return c(makeError("mismatch","Mismatched anonymous define() module: "+e[e.length-1]));h(e)}q.defQueueMap={}}var x,b,q,E,w,y={waitSeconds:7,baseUrl:"./",paths:{},bundles:{},pkgs:{},shim:{},config:{}},S={},k={},M={},O=[],j={},P={},R={},T=1,A=1;return E={require:function(e){return e.require?e.require:e.require=q.makeRequire(e.map)},exports:function(e){if(e.usingExports=!0,e.map.isDefine)return e.exports?j[e.map.id]=e.exports:e.exports=j[e.map.id]={}},module:function(e){return e.module?e.module:e.module={id:e.map.id,uri:e.map.url,config:function(){return getOwn(y.config,e.map.id)||{}},exports:e.exports||(e.exports={})}}},b=function(e){this.events=getOwn(M,e.id)||{},this.map=e,this.shim=getOwn(y.shim,e.id),this.depExports=[],this.depMaps=[],this.depMatched=[],this.pluginMaps={},this.depCount=0},b.prototype={init:function(e,t,i,r){r=r||{},this.inited||(this.factory=t,i?this.on("error",i):this.events.error&&(i=bind(this,function(e){this.emit("error",e)})),this.depMaps=e&&e.slice(0),this.errback=i,this.inited=!0,this.ignore=r.ignore,r.enabled||this.enabled?this.enable():this.check())},defineDep:function(e,t){this.depMatched[e]||(this.depMatched[e]=!0,this.depCount-=1,this.depExports[e]=t)},fetch:function(){if(!this.fetched){this.fetched=!0,q.startTime=(new Date).getTime();var e=this.map;if(!this.shim)return e.prefix?this.callPlugin():this.load();q.makeRequire(this.map,{enableBuildCallback:!0})(this.shim.deps||[],bind(this,function(){return e.prefix?this.callPlugin():this.load()}))}},load:function(){var e=this.map.url;P[e]||(P[e]=!0,q.load(this.map.id,e))},check:function(){if(this.enabled&&!this.enabling){var e,t,i=this.map.id,r=this.depExports,n=this.exports,o=this.factory;if(this.inited){if(this.error)this.emit("error",this.error);else if(!this.defining){if(this.defining=!0,this.depCount<1&&!this.defined){if(isFunction(o)){if(this.events.error&&this.map.isDefine||req.onError!==defaultOnError)try{n=q.execCb(i,o,r,n)}catch(t){e=t}else n=q.execCb(i,o,r,n);if(this.map.isDefine&&void 0===n&&((t=this.module)?n=t.exports:this.usingExports&&(n=this.exports)),e)return e.requireMap=this.map,e.requireModules=this.map.isDefine?[this.map.id]:null,e.requireType=this.map.isDefine?"define":"require",c(this.error=e)}else n=o;if(this.exports=n,this.map.isDefine&&!this.ignore&&(j[i]=n,req.onResourceLoad)){var a=[];each(this.depMaps,function(e){a.push(e.normalizedMap||e)}),req.onResourceLoad(q,this.map,a)}p(i),this.defined=!0}this.defining=!1,this.defined&&!this.defineEmitted&&(this.defineEmitted=!0,this.emit("defined",this.exports),this.defineEmitComplete=!0)}}else hasProp(q.defQueueMap,i)||this.fetch()}},callPlugin:function(){var e=this.map,t=e.id,r=a(e.prefix);this.depMaps.push(r),u(r,"defined",bind(this,function(r){var n,o,d,f=getOwn(R,this.map.id),l=this.map.name,h=this.map.parentMap?this.map.parentMap.name:null,m=q.makeRequire(e.parentMap,{enableBuildCallback:!0});return this.map.unnormalized?(r.normalize&&(l=r.normalize(l,function(e){return i(e,h,!0)})||""),o=a(e.prefix+"!"+l,this.map.parentMap,!0),u(o,"defined",bind(this,function(e){this.map.normalizedMap=o,this.init([],function(){return e},null,{enabled:!0,ignore:!0})})),void((d=getOwn(S,o.id))&&(this.depMaps.push(o),this.events.error&&d.on("error",bind(this,function(e){this.emit("error",e)})),d.enable()))):f?(this.map.url=q.nameToUrl(f),void this.load()):((n=bind(this,function(e){this.init([],function(){return e},null,{enabled:!0})})).error=bind(this,function(e){this.inited=!0,this.error=e,e.requireModules=[t],eachProp(S,function(e){0===e.map.id.indexOf(t+"_unnormalized")&&p(e.map.id)}),c(e)}),n.fromText=bind(this,function(i,r){var o=e.name,u=a(o),d=useInteractive;r&&(i=r),d&&(useInteractive=!1),s(u),hasProp(y.config,t)&&(y.config[o]=y.config[t]);try{req.exec(i)}catch(e){return c(makeError("fromtexteval","fromText eval for "+t+" failed: "+e,e,[t]))}d&&(useInteractive=!0),this.depMaps.push(u),q.completeLoad(o),m([o],n)}),void r.load(e.name,m,n,y))})),q.enable(r,this),this.pluginMaps[r.id]=r},enable:function(){k[this.map.id]=this,this.enabled=!0,this.enabling=!0,each(this.depMaps,bind(this,function(e,t){var i,r,n;if("string"==typeof e){if(e=a(e,this.map.isDefine?this.map:this.map.parentMap,!1,!this.skipMap),this.depMaps[t]=e,n=getOwn(E,e.id))return void(this.depExports[t]=n(this));this.depCount+=1,u(e,"defined",bind(this,function(e){this.undefed||(this.defineDep(t,e),this.check())})),this.errback?u(e,"error",bind(this,this.errback)):this.events.error&&u(e,"error",bind(this,function(e){this.emit("error",e)}))}i=e.id,r=S[i],hasProp(E,i)||!r||r.enabled||q.enable(e,this)})),eachProp(this.pluginMaps,bind(this,function(e){var t=getOwn(S,e.id);t&&!t.enabled&&q.enable(e,this)})),this.enabling=!1,this.check()},on:function(e,t){var i=this.events[e];i||(i=this.events[e]=[]),i.push(t)},emit:function(e,t){each(this.events[e],function(e){e(t)}),"error"===e&&delete this.events[e]}},q={config:y,contextName:e,registry:S,defined:j,urlFetched:P,defQueue:O,defQueueMap:{},Module:b,makeModuleMap:a,nextTick:req.nextTick,onError:c,configure:function(e){if(e.baseUrl&&"/"!==e.baseUrl.charAt(e.baseUrl.length-1)&&(e.baseUrl+="/"),"string"==typeof e.urlArgs){var t=e.urlArgs;e.urlArgs=function(e,i){return(-1===i.indexOf("?")?"?":"&")+t}}var i=y.shim,r={paths:!0,bundles:!0,config:!0,map:!0};eachProp(e,function(e,t){r[t]?(y[t]||(y[t]={}),mixin(y[t],e,!0,!0)):y[t]=e}),e.bundles&&eachProp(e.bundles,function(e,t){each(e,function(e){e!==t&&(R[e]=t)})}),e.shim&&(eachProp(e.shim,function(e,t){isArray(e)&&(e={deps:e}),!e.exports&&!e.init||e.exportsFn||(e.exportsFn=q.makeShimExports(e)),i[t]=e}),y.shim=i),e.packages&&each(e.packages,function(e){var t;t=(e="string"==typeof e?{name:e}:e).name,e.location&&(y.paths[t]=e.location),y.pkgs[t]=e.name+"/"+(e.main||"main").replace(currDirRegExp,"").replace(jsSuffixRegExp,"")}),eachProp(S,function(e,t){e.inited||e.map.unnormalized||(e.map=a(t,null,!0))}),(e.deps||e.callback)&&q.require(e.deps||[],e.callback)},makeShimExports:function(e){return function(){var t;return e.init&&(t=e.init.apply(global,arguments)),t||e.exports&&getGlobal(e.exports)}},makeRequire:function(t,n){function o(i,r,u){var d,p,f;return n.enableBuildCallback&&r&&isFunction(r)&&(r.__requireJsBuild=!0),"string"==typeof i?isFunction(r)?c(makeError("requireargs","Invalid require call"),u):t&&hasProp(E,i)?E[i](S[t.id]):req.get?req.get(q,i,t,o):(p=a(i,t,!1,!0),d=p.id,hasProp(j,d)?j[d]:c(makeError("notloaded",'Module name "'+d+'" has not been loaded yet for context: '+e+(t?"":". Use require([])")))):(v(),q.nextTick(function(){v(),(f=s(a(null,t))).skipMap=n.skipMap,f.init(i,r,u,{enabled:!0}),l()}),o)}return n=n||{},mixin(o,{isBrowser:isBrowser,toUrl:function(e){var r,n=e.lastIndexOf("."),o=e.split("/")[0],a="."===o||".."===o;return-1!==n&&(!a||n>1)&&(r=e.substring(n,e.length),e=e.substring(0,n)),q.nameToUrl(i(e,t&&t.id,!0),r,!0)},defined:function(e){return hasProp(j,a(e,t,!1,!0).id)},specified:function(e){return e=a(e,t,!1,!0).id,hasProp(j,e)||hasProp(S,e)}}),t||(o.undef=function(e){d();var i=a(e,t,!0),n=getOwn(S,e);n.undefed=!0,r(e),delete j[e],delete P[i.url],delete M[e],eachReverse(O,function(t,i){t[0]===e&&O.splice(i,1)}),delete q.defQueueMap[e],n&&(n.events.defined&&(M[e]=n.events),p(e))}),o},enable:function(e){getOwn(S,e.id)&&s(e).enable()},completeLoad:function(e){var t,i,r,o=getOwn(y.shim,e)||{},a=o.exports;for(d();O.length;){if(null===(i=O.shift())[0]){if(i[0]=e,t)break;t=!0}else i[0]===e&&(t=!0);h(i)}if(q.defQueueMap={},r=getOwn(S,e),!t&&!hasProp(j,e)&&r&&!r.inited){if(!(!y.enforceDefine||a&&getGlobal(a)))return n(e)?void 0:c(makeError("nodefine","No define call for "+e,null,[e]));h([e,o.deps||[],o.exportsFn])}l()},nameToUrl:function(e,t,i){var r,n,o,a,s,u,c,d=getOwn(y.pkgs,e);if(d&&(e=d),c=getOwn(R,e))return q.nameToUrl(c,t,i);if(req.jsExtRegExp.test(e))s=e+(t||"");else{for(r=y.paths,o=(n=e.split("/")).length;o>0;o-=1)if(a=n.slice(0,o).join("/"),u=getOwn(r,a)){isArray(u)&&(u=u[0]),n.splice(0,o,u);break}s=n.join("/"),s=("/"===(s+=t||(/^data\:|^blob\:|\?/.test(s)||i?"":".js")).charAt(0)||s.match(/^[\w\+\.\-]+:/)?"":y.baseUrl)+s}return y.urlArgs&&!/^blob\:/.test(s)?s+y.urlArgs(e,s):s},load:function(e,t){req.load(q,e,t)},execCb:function(e,t,i,r){return t.apply(r,i)},onScriptLoad:function(e){if("load"===e.type||readyRegExp.test((e.currentTarget||e.srcElement).readyState)){interactiveScript=null;var t=g(e);q.completeLoad(t.id)}},onScriptError:function(e){var t=g(e);if(!n(t.id)){var i=[];return eachProp(S,function(e,r){0!==r.indexOf("_@r")&&each(e.depMaps,function(e){if(e.id===t.id)return i.push(r),!0})}),c(makeError("scripterror",'Script error for "'+t.id+(i.length?'", needed by: '+i.join(", "):'"'),e,[t.id]))}}},q.require=q.makeRequire(),q}function getInteractiveScript(){return interactiveScript&&"interactive"===interactiveScript.readyState?interactiveScript:(eachReverse(scripts(),function(e){if("interactive"===e.readyState)return interactiveScript=e}),interactiveScript)}var req,s,head,baseElement,dataMain,src,interactiveScript,currentlyAddingScript,mainScript,subPath,version="2.3.5",commentRegExp=/\/\*[\s\S]*?\*\/|([^:"'=]|^)\/\/.*$/gm,cjsRequireRegExp=/[^.]\s*require\s*\(\s*["']([^'"\s]+)["']\s*\)/g,jsSuffixRegExp=/\.js$/,currDirRegExp=/^\.\//,op=Object.prototype,ostring=op.toString,hasOwn=op.hasOwnProperty,isBrowser=!("undefined"==typeof window||"undefined"==typeof navigator||!window.document),isWebWorker=!isBrowser&&"undefined"!=typeof importScripts,readyRegExp=isBrowser&&"PLAYSTATION 3"===navigator.platform?/^complete$/:/^(complete|loaded)$/,defContextName="_",isOpera="undefined"!=typeof opera&&"[object Opera]"===opera.toString(),contexts={},cfg={},globalDefQueue=[],useInteractive=!1;if(void 0===define){if(void 0!==requirejs){if(isFunction(requirejs))return;cfg=requirejs,requirejs=void 0}void 0===require||isFunction(require)||(cfg=require,require=void 0),req=requirejs=function(e,t,i,r){var n,o,a=defContextName;return isArray(e)||"string"==typeof e||(o=e,isArray(t)?(e=t,t=i,i=r):e=[]),o&&o.context&&(a=o.context),(n=getOwn(contexts,a))||(n=contexts[a]=req.s.newContext(a)),o&&n.configure(o),n.require(e,t,i)},req.config=function(e){return req(e)},req.nextTick=void 0!==setTimeout?function(e){setTimeout(e,4)}:function(e){e()},require||(require=req),req.version=version,req.jsExtRegExp=/^\/|:|\?|\.js$/,req.isBrowser=isBrowser,s=req.s={contexts:contexts,newContext:newContext},req({}),each(["toUrl","undef","defined","specified"],function(e){req[e]=function(){var t=contexts[defContextName];return t.require[e].apply(t,arguments)}}),isBrowser&&(head=s.head=document.getElementsByTagName("head")[0],(baseElement=document.getElementsByTagName("base")[0])&&(head=s.head=baseElement.parentNode)),req.onError=defaultOnError,req.createNode=function(e,t,i){var r=e.xhtml?document.createElementNS("http://www.w3.org/1999/xhtml","html:script"):document.createElement("script");return r.type=e.scriptType||"text/javascript",r.charset="utf-8",r.async=!0,r},req.load=function(e,t,i){var r,n=e&&e.config||{};if(isBrowser)return(r=req.createNode(n,t,i)).setAttribute("data-requirecontext",e.contextName),r.setAttribute("data-requiremodule",t),!r.attachEvent||r.attachEvent.toString&&r.attachEvent.toString().indexOf("[native code")<0||isOpera?(r.addEventListener("load",e.onScriptLoad,!1),r.addEventListener("error",e.onScriptError,!1)):(useInteractive=!0,r.attachEvent("onreadystatechange",e.onScriptLoad)),r.src=i,n.onNodeCreated&&n.onNodeCreated(r,n,t,i),currentlyAddingScript=r,baseElement?head.insertBefore(r,baseElement):head.appendChild(r),currentlyAddingScript=null,r;if(isWebWorker)try{setTimeout(function(){},0),importScripts(i),e.completeLoad(t)}catch(r){e.onError(makeError("importscripts","importScripts failed for "+t+" at "+i,r,[t]))}},isBrowser&&!cfg.skipDataMain&&eachReverse(scripts(),function(e){if(head||(head=e.parentNode),dataMain=e.getAttribute("data-main"))return mainScript=dataMain,cfg.baseUrl||-1!==mainScript.indexOf("!")||(src=mainScript.split("/"),mainScript=src.pop(),subPath=src.length?src.join("/")+"/":"./",cfg.baseUrl=subPath),mainScript=mainScript.replace(jsSuffixRegExp,""),req.jsExtRegExp.test(mainScript)&&(mainScript=dataMain),cfg.deps=cfg.deps?cfg.deps.concat(mainScript):[mainScript],!0}),define=function(e,t,i){var r,n;"string"!=typeof e&&(i=t,t=e,e=null),isArray(t)||(i=t,t=null),!t&&isFunction(i)&&(t=[],i.length&&(i.toString().replace(commentRegExp,commentReplace).replace(cjsRequireRegExp,function(e,i){t.push(i)}),t=(1===i.length?["require"]:["require","exports","module"]).concat(t))),useInteractive&&(r=currentlyAddingScript||getInteractiveScript())&&(e||(e=r.getAttribute("data-requiremodule")),n=contexts[r.getAttribute("data-requirecontext")]),n?(n.defQueue.push([e,t,i]),n.defQueueMap[e]=!0):globalDefQueue.push([e,t,i])},define.amd={jQuery:!0},req.exec=function(text){return eval(text)},req(cfg)}}(this,"undefined"==typeof setTimeout?void 0:setTimeout); \ No newline at end of file diff --git a/dist/assets/js/vendors/bootstrap.min.js b/dist/assets/js/vendors/bootstrap.min.js new file mode 100755 index 000000000..1c87dab57 --- /dev/null +++ b/dist/assets/js/vendors/bootstrap.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v4.0.0 (https://getbootstrap.com) + * Copyright 2011-2018 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?e(exports,require("jquery")):"function"==typeof define&&define.amd?define(["exports","jquery"],e):e(t.bootstrap={},t.jQuery)}(this,function(t,e){"use strict";function n(t,e){for(var n=0;n0?i:null}catch(t){return null}},reflow:function(t){return t.offsetHeight},triggerTransitionEnd:function(n){t(n).trigger(e.end)},supportsTransitionEnd:function(){return Boolean(e)},isElement:function(t){return(t[0]||t).nodeType},typeCheckConfig:function(t,e,n){for(var r in n)if(Object.prototype.hasOwnProperty.call(n,r)){var o=n[r],s=e[r],a=s&&i.isElement(s)?"element":(l=s,{}.toString.call(l).match(/\s([a-zA-Z]+)/)[1].toLowerCase());if(!new RegExp(o).test(a))throw new Error(t.toUpperCase()+': Option "'+r+'" provided type "'+a+'" but expected type "'+o+'".')}var l}};return e=("undefined"==typeof window||!window.QUnit)&&{end:"transitionend"},t.fn.emulateTransitionEnd=n,i.supportsTransitionEnd()&&(t.event.special[i.TRANSITION_END]={bindType:e.end,delegateType:e.end,handle:function(e){if(t(e.target).is(this))return e.handleObj.handler.apply(this,arguments)}}),i}(e=e&&e.hasOwnProperty("default")?e.default:e),L=(s="alert",l="."+(a="bs.alert"),c=(o=e).fn[s],h={CLOSE:"close"+l,CLOSED:"closed"+l,CLICK_DATA_API:"click"+l+".data-api"},f="alert",u="fade",d="show",p=function(){function t(t){this._element=t}var e=t.prototype;return e.close=function(t){t=t||this._element;var e=this._getRootElement(t);this._triggerCloseEvent(e).isDefaultPrevented()||this._removeElement(e)},e.dispose=function(){o.removeData(this._element,a),this._element=null},e._getRootElement=function(t){var e=k.getSelectorFromElement(t),n=!1;return e&&(n=o(e)[0]),n||(n=o(t).closest("."+f)[0]),n},e._triggerCloseEvent=function(t){var e=o.Event(h.CLOSE);return o(t).trigger(e),e},e._removeElement=function(t){var e=this;o(t).removeClass(d),k.supportsTransitionEnd()&&o(t).hasClass(u)?o(t).one(k.TRANSITION_END,function(n){return e._destroyElement(t,n)}).emulateTransitionEnd(150):this._destroyElement(t)},e._destroyElement=function(t){o(t).detach().trigger(h.CLOSED).remove()},t._jQueryInterface=function(e){return this.each(function(){var n=o(this),i=n.data(a);i||(i=new t(this),n.data(a,i)),"close"===e&&i[e](this)})},t._handleDismiss=function(t){return function(e){e&&e.preventDefault(),t.close(this)}},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),o(document).on(h.CLICK_DATA_API,'[data-dismiss="alert"]',p._handleDismiss(new p)),o.fn[s]=p._jQueryInterface,o.fn[s].Constructor=p,o.fn[s].noConflict=function(){return o.fn[s]=c,p._jQueryInterface},p),P=(m="button",v="."+(_="bs.button"),E=".data-api",y=(g=e).fn[m],b="active",T="btn",C="focus",w='[data-toggle^="button"]',I='[data-toggle="buttons"]',A="input",D=".active",S=".btn",O={CLICK_DATA_API:"click"+v+E,FOCUS_BLUR_DATA_API:"focus"+v+E+" blur"+v+E},N=function(){function t(t){this._element=t}var e=t.prototype;return e.toggle=function(){var t=!0,e=!0,n=g(this._element).closest(I)[0];if(n){var i=g(this._element).find(A)[0];if(i){if("radio"===i.type)if(i.checked&&g(this._element).hasClass(b))t=!1;else{var r=g(n).find(D)[0];r&&g(r).removeClass(b)}if(t){if(i.hasAttribute("disabled")||n.hasAttribute("disabled")||i.classList.contains("disabled")||n.classList.contains("disabled"))return;i.checked=!g(this._element).hasClass(b),g(i).trigger("change")}i.focus(),e=!1}}e&&this._element.setAttribute("aria-pressed",!g(this._element).hasClass(b)),t&&g(this._element).toggleClass(b)},e.dispose=function(){g.removeData(this._element,_),this._element=null},t._jQueryInterface=function(e){return this.each(function(){var n=g(this).data(_);n||(n=new t(this),g(this).data(_,n)),"toggle"===e&&n[e]()})},i(t,null,[{key:"VERSION",get:function(){return"4.0.0"}}]),t}(),g(document).on(O.CLICK_DATA_API,w,function(t){t.preventDefault();var e=t.target;g(e).hasClass(T)||(e=g(e).closest(S)),N._jQueryInterface.call(g(e),"toggle")}).on(O.FOCUS_BLUR_DATA_API,w,function(t){var e=g(t.target).closest(S)[0];g(e).toggleClass(C,/^focus(in)?$/.test(t.type))}),g.fn[m]=N._jQueryInterface,g.fn[m].Constructor=N,g.fn[m].noConflict=function(){return g.fn[m]=y,N._jQueryInterface},N),x=function(t){var e="carousel",n="bs.carousel",o="."+n,s=t.fn[e],a={interval:5e3,keyboard:!0,slide:!1,pause:"hover",wrap:!0},l={interval:"(number|boolean)",keyboard:"boolean",slide:"(boolean|string)",pause:"(string|boolean)",wrap:"boolean"},c="next",h="prev",f="left",u="right",d={SLIDE:"slide"+o,SLID:"slid"+o,KEYDOWN:"keydown"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o,TOUCHEND:"touchend"+o,LOAD_DATA_API:"load"+o+".data-api",CLICK_DATA_API:"click"+o+".data-api"},p="carousel",g="active",m="slide",_="carousel-item-right",v="carousel-item-left",E="carousel-item-next",y="carousel-item-prev",b={ACTIVE:".active",ACTIVE_ITEM:".active.carousel-item",ITEM:".carousel-item",NEXT_PREV:".carousel-item-next, .carousel-item-prev",INDICATORS:".carousel-indicators",DATA_SLIDE:"[data-slide], [data-slide-to]",DATA_RIDE:'[data-ride="carousel"]'},T=function(){function s(e,n){this._items=null,this._interval=null,this._activeElement=null,this._isPaused=!1,this._isSliding=!1,this.touchTimeout=null,this._config=this._getConfig(n),this._element=t(e)[0],this._indicatorsElement=t(this._element).find(b.INDICATORS)[0],this._addEventListeners()}var T=s.prototype;return T.next=function(){this._isSliding||this._slide(c)},T.nextWhenVisible=function(){!document.hidden&&t(this._element).is(":visible")&&"hidden"!==t(this._element).css("visibility")&&this.next()},T.prev=function(){this._isSliding||this._slide(h)},T.pause=function(e){e||(this._isPaused=!0),t(this._element).find(b.NEXT_PREV)[0]&&k.supportsTransitionEnd()&&(k.triggerTransitionEnd(this._element),this.cycle(!0)),clearInterval(this._interval),this._interval=null},T.cycle=function(t){t||(this._isPaused=!1),this._interval&&(clearInterval(this._interval),this._interval=null),this._config.interval&&!this._isPaused&&(this._interval=setInterval((document.visibilityState?this.nextWhenVisible:this.next).bind(this),this._config.interval))},T.to=function(e){var n=this;this._activeElement=t(this._element).find(b.ACTIVE_ITEM)[0];var i=this._getItemIndex(this._activeElement);if(!(e>this._items.length-1||e<0))if(this._isSliding)t(this._element).one(d.SLID,function(){return n.to(e)});else{if(i===e)return this.pause(),void this.cycle();var r=e>i?c:h;this._slide(r,this._items[e])}},T.dispose=function(){t(this._element).off(o),t.removeData(this._element,n),this._items=null,this._config=null,this._element=null,this._interval=null,this._isPaused=null,this._isSliding=null,this._activeElement=null,this._indicatorsElement=null},T._getConfig=function(t){return t=r({},a,t),k.typeCheckConfig(e,t,l),t},T._addEventListeners=function(){var e=this;this._config.keyboard&&t(this._element).on(d.KEYDOWN,function(t){return e._keydown(t)}),"hover"===this._config.pause&&(t(this._element).on(d.MOUSEENTER,function(t){return e.pause(t)}).on(d.MOUSELEAVE,function(t){return e.cycle(t)}),"ontouchstart"in document.documentElement&&t(this._element).on(d.TOUCHEND,function(){e.pause(),e.touchTimeout&&clearTimeout(e.touchTimeout),e.touchTimeout=setTimeout(function(t){return e.cycle(t)},500+e._config.interval)}))},T._keydown=function(t){if(!/input|textarea/i.test(t.target.tagName))switch(t.which){case 37:t.preventDefault(),this.prev();break;case 39:t.preventDefault(),this.next()}},T._getItemIndex=function(e){return this._items=t.makeArray(t(e).parent().find(b.ITEM)),this._items.indexOf(e)},T._getItemByDirection=function(t,e){var n=t===c,i=t===h,r=this._getItemIndex(e),o=this._items.length-1;if((i&&0===r||n&&r===o)&&!this._config.wrap)return e;var s=(r+(t===h?-1:1))%this._items.length;return-1===s?this._items[this._items.length-1]:this._items[s]},T._triggerSlideEvent=function(e,n){var i=this._getItemIndex(e),r=this._getItemIndex(t(this._element).find(b.ACTIVE_ITEM)[0]),o=t.Event(d.SLIDE,{relatedTarget:e,direction:n,from:r,to:i});return t(this._element).trigger(o),o},T._setActiveIndicatorElement=function(e){if(this._indicatorsElement){t(this._indicatorsElement).find(b.ACTIVE).removeClass(g);var n=this._indicatorsElement.children[this._getItemIndex(e)];n&&t(n).addClass(g)}},T._slide=function(e,n){var i,r,o,s=this,a=t(this._element).find(b.ACTIVE_ITEM)[0],l=this._getItemIndex(a),h=n||a&&this._getItemByDirection(e,a),p=this._getItemIndex(h),T=Boolean(this._interval);if(e===c?(i=v,r=E,o=f):(i=_,r=y,o=u),h&&t(h).hasClass(g))this._isSliding=!1;else if(!this._triggerSlideEvent(h,o).isDefaultPrevented()&&a&&h){this._isSliding=!0,T&&this.pause(),this._setActiveIndicatorElement(h);var C=t.Event(d.SLID,{relatedTarget:h,direction:o,from:l,to:p});k.supportsTransitionEnd()&&t(this._element).hasClass(m)?(t(h).addClass(r),k.reflow(h),t(a).addClass(i),t(h).addClass(i),t(a).one(k.TRANSITION_END,function(){t(h).removeClass(i+" "+r).addClass(g),t(a).removeClass(g+" "+r+" "+i),s._isSliding=!1,setTimeout(function(){return t(s._element).trigger(C)},0)}).emulateTransitionEnd(600)):(t(a).removeClass(g),t(h).addClass(g),this._isSliding=!1,t(this._element).trigger(C)),T&&this.cycle()}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),o=r({},a,t(this).data());"object"==typeof e&&(o=r({},o,e));var l="string"==typeof e?e:o.slide;if(i||(i=new s(this,o),t(this).data(n,i)),"number"==typeof e)i.to(e);else if("string"==typeof l){if("undefined"==typeof i[l])throw new TypeError('No method named "'+l+'"');i[l]()}else o.interval&&(i.pause(),i.cycle())})},s._dataApiClickHandler=function(e){var i=k.getSelectorFromElement(this);if(i){var o=t(i)[0];if(o&&t(o).hasClass(p)){var a=r({},t(o).data(),t(this).data()),l=this.getAttribute("data-slide-to");l&&(a.interval=!1),s._jQueryInterface.call(t(o),a),l&&t(o).data(n).to(l),e.preventDefault()}}},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),s}();return t(document).on(d.CLICK_DATA_API,b.DATA_SLIDE,T._dataApiClickHandler),t(window).on(d.LOAD_DATA_API,function(){t(b.DATA_RIDE).each(function(){var e=t(this);T._jQueryInterface.call(e,e.data())})}),t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),R=function(t){var e="collapse",n="bs.collapse",o="."+n,s=t.fn[e],a={toggle:!0,parent:""},l={toggle:"boolean",parent:"(string|element)"},c={SHOW:"show"+o,SHOWN:"shown"+o,HIDE:"hide"+o,HIDDEN:"hidden"+o,CLICK_DATA_API:"click"+o+".data-api"},h="show",f="collapse",u="collapsing",d="collapsed",p="width",g="height",m={ACTIVES:".show, .collapsing",DATA_TOGGLE:'[data-toggle="collapse"]'},_=function(){function o(e,n){this._isTransitioning=!1,this._element=e,this._config=this._getConfig(n),this._triggerArray=t.makeArray(t('[data-toggle="collapse"][href="#'+e.id+'"],[data-toggle="collapse"][data-target="#'+e.id+'"]'));for(var i=t(m.DATA_TOGGLE),r=0;r0&&(this._selector=s,this._triggerArray.push(o))}this._parent=this._config.parent?this._getParent():null,this._config.parent||this._addAriaAndCollapsedClass(this._element,this._triggerArray),this._config.toggle&&this.toggle()}var s=o.prototype;return s.toggle=function(){t(this._element).hasClass(h)?this.hide():this.show()},s.show=function(){var e,i,r=this;if(!this._isTransitioning&&!t(this._element).hasClass(h)&&(this._parent&&0===(e=t.makeArray(t(this._parent).find(m.ACTIVES).filter('[data-parent="'+this._config.parent+'"]'))).length&&(e=null),!(e&&(i=t(e).not(this._selector).data(n))&&i._isTransitioning))){var s=t.Event(c.SHOW);if(t(this._element).trigger(s),!s.isDefaultPrevented()){e&&(o._jQueryInterface.call(t(e).not(this._selector),"hide"),i||t(e).data(n,null));var a=this._getDimension();t(this._element).removeClass(f).addClass(u),this._element.style[a]=0,this._triggerArray.length>0&&t(this._triggerArray).removeClass(d).attr("aria-expanded",!0),this.setTransitioning(!0);var l=function(){t(r._element).removeClass(u).addClass(f).addClass(h),r._element.style[a]="",r.setTransitioning(!1),t(r._element).trigger(c.SHOWN)};if(k.supportsTransitionEnd()){var p="scroll"+(a[0].toUpperCase()+a.slice(1));t(this._element).one(k.TRANSITION_END,l).emulateTransitionEnd(600),this._element.style[a]=this._element[p]+"px"}else l()}}},s.hide=function(){var e=this;if(!this._isTransitioning&&t(this._element).hasClass(h)){var n=t.Event(c.HIDE);if(t(this._element).trigger(n),!n.isDefaultPrevented()){var i=this._getDimension();if(this._element.style[i]=this._element.getBoundingClientRect()[i]+"px",k.reflow(this._element),t(this._element).addClass(u).removeClass(f).removeClass(h),this._triggerArray.length>0)for(var r=0;r0&&t(n).toggleClass(d,!i).attr("aria-expanded",i)}},o._getTargetFromElement=function(e){var n=k.getSelectorFromElement(e);return n?t(n)[0]:null},o._jQueryInterface=function(e){return this.each(function(){var i=t(this),s=i.data(n),l=r({},a,i.data(),"object"==typeof e&&e);if(!s&&l.toggle&&/show|hide/.test(e)&&(l.toggle=!1),s||(s=new o(this,l),i.data(n,s)),"string"==typeof e){if("undefined"==typeof s[e])throw new TypeError('No method named "'+e+'"');s[e]()}})},i(o,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return a}}]),o}();return t(document).on(c.CLICK_DATA_API,m.DATA_TOGGLE,function(e){"A"===e.currentTarget.tagName&&e.preventDefault();var i=t(this),r=k.getSelectorFromElement(this);t(r).each(function(){var e=t(this),r=e.data(n)?"toggle":i.data();_._jQueryInterface.call(e,r)})}),t.fn[e]=_._jQueryInterface,t.fn[e].Constructor=_,t.fn[e].noConflict=function(){return t.fn[e]=s,_._jQueryInterface},_}(e),j="undefined"!=typeof window&&"undefined"!=typeof document,H=["Edge","Trident","Firefox"],M=0,W=0;W=0){M=1;break}var U=j&&window.Promise?function(t){var e=!1;return function(){e||(e=!0,window.Promise.resolve().then(function(){e=!1,t()}))}}:function(t){var e=!1;return function(){e||(e=!0,setTimeout(function(){e=!1,t()},M))}};function B(t){return t&&"[object Function]"==={}.toString.call(t)}function F(t,e){if(1!==t.nodeType)return[];var n=getComputedStyle(t,null);return e?n[e]:n}function K(t){return"HTML"===t.nodeName?t:t.parentNode||t.host}function V(t){if(!t)return document.body;switch(t.nodeName){case"HTML":case"BODY":return t.ownerDocument.body;case"#document":return t.body}var e=F(t),n=e.overflow,i=e.overflowX,r=e.overflowY;return/(auto|scroll)/.test(n+r+i)?t:V(K(t))}function Q(t){var e=t&&t.offsetParent,n=e&&e.nodeName;return n&&"BODY"!==n&&"HTML"!==n?-1!==["TD","TABLE"].indexOf(e.nodeName)&&"static"===F(e,"position")?Q(e):e:t?t.ownerDocument.documentElement:document.documentElement}function Y(t){return null!==t.parentNode?Y(t.parentNode):t}function G(t,e){if(!(t&&t.nodeType&&e&&e.nodeType))return document.documentElement;var n=t.compareDocumentPosition(e)&Node.DOCUMENT_POSITION_FOLLOWING,i=n?t:e,r=n?e:t,o=document.createRange();o.setStart(i,0),o.setEnd(r,0);var s,a,l=o.commonAncestorContainer;if(t!==l&&e!==l||i.contains(r))return"BODY"===(a=(s=l).nodeName)||"HTML"!==a&&Q(s.firstElementChild)!==s?Q(l):l;var c=Y(t);return c.host?G(c.host,e):G(t,Y(e).host)}function q(t){var e="top"===(arguments.length>1&&void 0!==arguments[1]?arguments[1]:"top")?"scrollTop":"scrollLeft",n=t.nodeName;if("BODY"===n||"HTML"===n){var i=t.ownerDocument.documentElement;return(t.ownerDocument.scrollingElement||i)[e]}return t[e]}function z(t,e){var n="x"===e?"Left":"Top",i="Left"===n?"Right":"Bottom";return parseFloat(t["border"+n+"Width"],10)+parseFloat(t["border"+i+"Width"],10)}var X=void 0,Z=function(){return void 0===X&&(X=-1!==navigator.appVersion.indexOf("MSIE 10")),X};function J(t,e,n,i){return Math.max(e["offset"+t],e["scroll"+t],n["client"+t],n["offset"+t],n["scroll"+t],Z()?n["offset"+t]+i["margin"+("Height"===t?"Top":"Left")]+i["margin"+("Height"===t?"Bottom":"Right")]:0)}function $(){var t=document.body,e=document.documentElement,n=Z()&&getComputedStyle(e);return{height:J("Height",t,e,n),width:J("Width",t,e,n)}}var tt=function(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")},et=function(){function t(t,e){for(var n=0;n2&&void 0!==arguments[2]&&arguments[2],i=q(e,"top"),r=q(e,"left"),o=n?-1:1;return t.top+=i*o,t.bottom+=i*o,t.left+=r*o,t.right+=r*o,t}(h,e)),h}function at(t,e,n,i){var r,o,s,a,l,c,h,f={top:0,left:0},u=G(t,e);if("viewport"===i)o=(r=u).ownerDocument.documentElement,s=st(r,o),a=Math.max(o.clientWidth,window.innerWidth||0),l=Math.max(o.clientHeight,window.innerHeight||0),c=q(o),h=q(o,"left"),f=rt({top:c-s.top+s.marginTop,left:h-s.left+s.marginLeft,width:a,height:l});else{var d=void 0;"scrollParent"===i?"BODY"===(d=V(K(e))).nodeName&&(d=t.ownerDocument.documentElement):d="window"===i?t.ownerDocument.documentElement:i;var p=st(d,u);if("HTML"!==d.nodeName||function t(e){var n=e.nodeName;return"BODY"!==n&&"HTML"!==n&&("fixed"===F(e,"position")||t(K(e)))}(u))f=p;else{var g=$(),m=g.height,_=g.width;f.top+=p.top-p.marginTop,f.bottom=m+p.top,f.left+=p.left-p.marginLeft,f.right=_+p.left}}return f.left+=n,f.top+=n,f.right-=n,f.bottom-=n,f}function lt(t,e,n,i,r){var o=arguments.length>5&&void 0!==arguments[5]?arguments[5]:0;if(-1===t.indexOf("auto"))return t;var s=at(n,i,o,r),a={top:{width:s.width,height:e.top-s.top},right:{width:s.right-e.right,height:s.height},bottom:{width:s.width,height:s.bottom-e.bottom},left:{width:e.left-s.left,height:s.height}},l=Object.keys(a).map(function(t){return it({key:t},a[t],{area:(e=a[t],e.width*e.height)});var e}).sort(function(t,e){return e.area-t.area}),c=l.filter(function(t){var e=t.width,i=t.height;return e>=n.clientWidth&&i>=n.clientHeight}),h=c.length>0?c[0].key:l[0].key,f=t.split("-")[1];return h+(f?"-"+f:"")}function ct(t,e,n){return st(n,G(e,n))}function ht(t){var e=getComputedStyle(t),n=parseFloat(e.marginTop)+parseFloat(e.marginBottom),i=parseFloat(e.marginLeft)+parseFloat(e.marginRight);return{width:t.offsetWidth+i,height:t.offsetHeight+n}}function ft(t){var e={left:"right",right:"left",bottom:"top",top:"bottom"};return t.replace(/left|right|bottom|top/g,function(t){return e[t]})}function ut(t,e,n){n=n.split("-")[0];var i=ht(t),r={width:i.width,height:i.height},o=-1!==["right","left"].indexOf(n),s=o?"top":"left",a=o?"left":"top",l=o?"height":"width",c=o?"width":"height";return r[s]=e[s]+e[l]/2-i[l]/2,r[a]=n===a?e[a]-i[c]:e[ft(a)],r}function dt(t,e){return Array.prototype.find?t.find(e):t.filter(e)[0]}function pt(t,e,n){return(void 0===n?t:t.slice(0,function(t,e,n){if(Array.prototype.findIndex)return t.findIndex(function(t){return t[e]===n});var i=dt(t,function(t){return t[e]===n});return t.indexOf(i)}(t,"name",n))).forEach(function(t){t.function&&console.warn("`modifier.function` is deprecated, use `modifier.fn`!");var n=t.function||t.fn;t.enabled&&B(n)&&(e.offsets.popper=rt(e.offsets.popper),e.offsets.reference=rt(e.offsets.reference),e=n(e,t))}),e}function gt(t,e){return t.some(function(t){var n=t.name;return t.enabled&&n===e})}function mt(t){for(var e=[!1,"ms","Webkit","Moz","O"],n=t.charAt(0).toUpperCase()+t.slice(1),i=0;i1&&void 0!==arguments[1]&&arguments[1],n=wt.indexOf(t),i=wt.slice(n+1).concat(wt.slice(0,n));return e?i.reverse():i}var At={FLIP:"flip",CLOCKWISE:"clockwise",COUNTERCLOCKWISE:"counterclockwise"};function Dt(t,e,n,i){var r=[0,0],o=-1!==["right","left"].indexOf(i),s=t.split(/(\+|\-)/).map(function(t){return t.trim()}),a=s.indexOf(dt(s,function(t){return-1!==t.search(/,|\s/)}));s[a]&&-1===s[a].indexOf(",")&&console.warn("Offsets separated by white space(s) are deprecated, use a comma (,) instead.");var l=/\s*,\s*|\s+/,c=-1!==a?[s.slice(0,a).concat([s[a].split(l)[0]]),[s[a].split(l)[1]].concat(s.slice(a+1))]:[s];return(c=c.map(function(t,i){var r=(1===i?!o:o)?"height":"width",s=!1;return t.reduce(function(t,e){return""===t[t.length-1]&&-1!==["+","-"].indexOf(e)?(t[t.length-1]=e,s=!0,t):s?(t[t.length-1]+=e,s=!1,t):t.concat(e)},[]).map(function(t){return function(t,e,n,i){var r=t.match(/((?:\-|\+)?\d*\.?\d*)(.*)/),o=+r[1],s=r[2];if(!o)return t;if(0===s.indexOf("%")){var a=void 0;switch(s){case"%p":a=n;break;case"%":case"%r":default:a=i}return rt(a)[e]/100*o}if("vh"===s||"vw"===s)return("vh"===s?Math.max(document.documentElement.clientHeight,window.innerHeight||0):Math.max(document.documentElement.clientWidth,window.innerWidth||0))/100*o;return o}(t,r,e,n)})})).forEach(function(t,e){t.forEach(function(n,i){yt(n)&&(r[e]+=n*("-"===t[i-1]?-1:1))})}),r}var St={placement:"bottom",eventsEnabled:!0,removeOnDestroy:!1,onCreate:function(){},onUpdate:function(){},modifiers:{shift:{order:100,enabled:!0,fn:function(t){var e=t.placement,n=e.split("-")[0],i=e.split("-")[1];if(i){var r=t.offsets,o=r.reference,s=r.popper,a=-1!==["bottom","top"].indexOf(n),l=a?"left":"top",c=a?"width":"height",h={start:nt({},l,o[l]),end:nt({},l,o[l]+o[c]-s[c])};t.offsets.popper=it({},s,h[i])}return t}},offset:{order:200,enabled:!0,fn:function(t,e){var n=e.offset,i=t.placement,r=t.offsets,o=r.popper,s=r.reference,a=i.split("-")[0],l=void 0;return l=yt(+n)?[+n,0]:Dt(n,o,s,a),"left"===a?(o.top+=l[0],o.left-=l[1]):"right"===a?(o.top+=l[0],o.left+=l[1]):"top"===a?(o.left+=l[0],o.top-=l[1]):"bottom"===a&&(o.left+=l[0],o.top+=l[1]),t.popper=o,t},offset:0},preventOverflow:{order:300,enabled:!0,fn:function(t,e){var n=e.boundariesElement||Q(t.instance.popper);t.instance.reference===n&&(n=Q(n));var i=at(t.instance.popper,t.instance.reference,e.padding,n);e.boundaries=i;var r=e.priority,o=t.offsets.popper,s={primary:function(t){var n=o[t];return o[t]i[t]&&!e.escapeWithReference&&(r=Math.min(o[n],i[t]-("right"===t?o.width:o.height))),nt({},n,r)}};return r.forEach(function(t){var e=-1!==["left","top"].indexOf(t)?"primary":"secondary";o=it({},o,s[e](t))}),t.offsets.popper=o,t},priority:["left","right","top","bottom"],padding:5,boundariesElement:"scrollParent"},keepTogether:{order:400,enabled:!0,fn:function(t){var e=t.offsets,n=e.popper,i=e.reference,r=t.placement.split("-")[0],o=Math.floor,s=-1!==["top","bottom"].indexOf(r),a=s?"right":"bottom",l=s?"left":"top",c=s?"width":"height";return n[a]o(i[a])&&(t.offsets.popper[l]=o(i[a])),t}},arrow:{order:500,enabled:!0,fn:function(t,e){var n;if(!Tt(t.instance.modifiers,"arrow","keepTogether"))return t;var i=e.element;if("string"==typeof i){if(!(i=t.instance.popper.querySelector(i)))return t}else if(!t.instance.popper.contains(i))return console.warn("WARNING: `arrow.element` must be child of its popper element!"),t;var r=t.placement.split("-")[0],o=t.offsets,s=o.popper,a=o.reference,l=-1!==["left","right"].indexOf(r),c=l?"height":"width",h=l?"Top":"Left",f=h.toLowerCase(),u=l?"left":"top",d=l?"bottom":"right",p=ht(i)[c];a[d]-ps[d]&&(t.offsets.popper[f]+=a[f]+p-s[d]),t.offsets.popper=rt(t.offsets.popper);var g=a[f]+a[c]/2-p/2,m=F(t.instance.popper),_=parseFloat(m["margin"+h],10),v=parseFloat(m["border"+h+"Width"],10),E=g-t.offsets.popper[f]-_-v;return E=Math.max(Math.min(s[c]-p,E),0),t.arrowElement=i,t.offsets.arrow=(nt(n={},f,Math.round(E)),nt(n,u,""),n),t},element:"[x-arrow]"},flip:{order:600,enabled:!0,fn:function(t,e){if(gt(t.instance.modifiers,"inner"))return t;if(t.flipped&&t.placement===t.originalPlacement)return t;var n=at(t.instance.popper,t.instance.reference,e.padding,e.boundariesElement),i=t.placement.split("-")[0],r=ft(i),o=t.placement.split("-")[1]||"",s=[];switch(e.behavior){case At.FLIP:s=[i,r];break;case At.CLOCKWISE:s=It(i);break;case At.COUNTERCLOCKWISE:s=It(i,!0);break;default:s=e.behavior}return s.forEach(function(a,l){if(i!==a||s.length===l+1)return t;i=t.placement.split("-")[0],r=ft(i);var c,h=t.offsets.popper,f=t.offsets.reference,u=Math.floor,d="left"===i&&u(h.right)>u(f.left)||"right"===i&&u(h.left)u(f.top)||"bottom"===i&&u(h.top)u(n.right),m=u(h.top)u(n.bottom),v="left"===i&&p||"right"===i&&g||"top"===i&&m||"bottom"===i&&_,E=-1!==["top","bottom"].indexOf(i),y=!!e.flipVariations&&(E&&"start"===o&&p||E&&"end"===o&&g||!E&&"start"===o&&m||!E&&"end"===o&&_);(d||v||y)&&(t.flipped=!0,(d||v)&&(i=s[l+1]),y&&(o="end"===(c=o)?"start":"start"===c?"end":c),t.placement=i+(o?"-"+o:""),t.offsets.popper=it({},t.offsets.popper,ut(t.instance.popper,t.offsets.reference,t.placement)),t=pt(t.instance.modifiers,t,"flip"))}),t},behavior:"flip",padding:5,boundariesElement:"viewport"},inner:{order:700,enabled:!1,fn:function(t){var e=t.placement,n=e.split("-")[0],i=t.offsets,r=i.popper,o=i.reference,s=-1!==["left","right"].indexOf(n),a=-1===["top","left"].indexOf(n);return r[s?"left":"top"]=o[n]-(a?r[s?"width":"height"]:0),t.placement=ft(e),t.offsets.popper=rt(r),t}},hide:{order:800,enabled:!0,fn:function(t){if(!Tt(t.instance.modifiers,"hide","preventOverflow"))return t;var e=t.offsets.reference,n=dt(t.instance.modifiers,function(t){return"preventOverflow"===t.name}).boundaries;if(e.bottomn.right||e.top>n.bottom||e.right2&&void 0!==arguments[2]?arguments[2]:{};tt(this,t),this.scheduleUpdate=function(){return requestAnimationFrame(i.update)},this.update=U(this.update.bind(this)),this.options=it({},t.Defaults,r),this.state={isDestroyed:!1,isCreated:!1,scrollParents:[]},this.reference=e&&e.jquery?e[0]:e,this.popper=n&&n.jquery?n[0]:n,this.options.modifiers={},Object.keys(it({},t.Defaults.modifiers,r.modifiers)).forEach(function(e){i.options.modifiers[e]=it({},t.Defaults.modifiers[e]||{},r.modifiers?r.modifiers[e]:{})}),this.modifiers=Object.keys(this.options.modifiers).map(function(t){return it({name:t},i.options.modifiers[t])}).sort(function(t,e){return t.order-e.order}),this.modifiers.forEach(function(t){t.enabled&&B(t.onLoad)&&t.onLoad(i.reference,i.popper,i.options,t,i.state)}),this.update();var o=this.options.eventsEnabled;o&&this.enableEventListeners(),this.state.eventsEnabled=o}return et(t,[{key:"update",value:function(){return function(){if(!this.state.isDestroyed){var t={instance:this,styles:{},arrowStyles:{},attributes:{},flipped:!1,offsets:{}};t.offsets.reference=ct(this.state,this.popper,this.reference),t.placement=lt(this.options.placement,t.offsets.reference,this.popper,this.reference,this.options.modifiers.flip.boundariesElement,this.options.modifiers.flip.padding),t.originalPlacement=t.placement,t.offsets.popper=ut(this.popper,t.offsets.reference,t.placement),t.offsets.popper.position="absolute",t=pt(this.modifiers,t),this.state.isCreated?this.options.onUpdate(t):(this.state.isCreated=!0,this.options.onCreate(t))}}.call(this)}},{key:"destroy",value:function(){return function(){return this.state.isDestroyed=!0,gt(this.modifiers,"applyStyle")&&(this.popper.removeAttribute("x-placement"),this.popper.style.left="",this.popper.style.position="",this.popper.style.top="",this.popper.style[mt("transform")]=""),this.disableEventListeners(),this.options.removeOnDestroy&&this.popper.parentNode.removeChild(this.popper),this}.call(this)}},{key:"enableEventListeners",value:function(){return function(){this.state.eventsEnabled||(this.state=vt(this.reference,this.options,this.state,this.scheduleUpdate))}.call(this)}},{key:"disableEventListeners",value:function(){return Et.call(this)}}]),t}();Ot.Utils=("undefined"!=typeof window?window:global).PopperUtils,Ot.placements=Ct,Ot.Defaults=St;var Nt=function(t){var e="dropdown",n="bs.dropdown",o="."+n,s=t.fn[e],a=new RegExp("38|40|27"),l={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,CLICK:"click"+o,CLICK_DATA_API:"click"+o+".data-api",KEYDOWN_DATA_API:"keydown"+o+".data-api",KEYUP_DATA_API:"keyup"+o+".data-api"},c="disabled",h="show",f="dropup",u="dropright",d="dropleft",p="dropdown-menu-right",g="dropdown-menu-left",m="position-static",_='[data-toggle="dropdown"]',v=".dropdown form",E=".dropdown-menu",y=".navbar-nav",b=".dropdown-menu .dropdown-item:not(.disabled)",T="top-start",C="top-end",w="bottom-start",I="bottom-end",A="right-start",D="left-start",S={offset:0,flip:!0,boundary:"scrollParent"},O={offset:"(number|string|function)",flip:"boolean",boundary:"(string|element)"},N=function(){function s(t,e){this._element=t,this._popper=null,this._config=this._getConfig(e),this._menu=this._getMenuElement(),this._inNavbar=this._detectNavbar(),this._addEventListeners()}var v=s.prototype;return v.toggle=function(){if(!this._element.disabled&&!t(this._element).hasClass(c)){var e=s._getParentFromElement(this._element),n=t(this._menu).hasClass(h);if(s._clearMenus(),!n){var i={relatedTarget:this._element},r=t.Event(l.SHOW,i);if(t(e).trigger(r),!r.isDefaultPrevented()){if(!this._inNavbar){if("undefined"==typeof Ot)throw new TypeError("Bootstrap dropdown require Popper.js (https://popper.js.org)");var o=this._element;t(e).hasClass(f)&&(t(this._menu).hasClass(g)||t(this._menu).hasClass(p))&&(o=e),"scrollParent"!==this._config.boundary&&t(e).addClass(m),this._popper=new Ot(o,this._menu,this._getPopperConfig())}"ontouchstart"in document.documentElement&&0===t(e).closest(y).length&&t("body").children().on("mouseover",null,t.noop),this._element.focus(),this._element.setAttribute("aria-expanded",!0),t(this._menu).toggleClass(h),t(e).toggleClass(h).trigger(t.Event(l.SHOWN,i))}}}},v.dispose=function(){t.removeData(this._element,n),t(this._element).off(o),this._element=null,this._menu=null,null!==this._popper&&(this._popper.destroy(),this._popper=null)},v.update=function(){this._inNavbar=this._detectNavbar(),null!==this._popper&&this._popper.scheduleUpdate()},v._addEventListeners=function(){var e=this;t(this._element).on(l.CLICK,function(t){t.preventDefault(),t.stopPropagation(),e.toggle()})},v._getConfig=function(n){return n=r({},this.constructor.Default,t(this._element).data(),n),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},v._getMenuElement=function(){if(!this._menu){var e=s._getParentFromElement(this._element);this._menu=t(e).find(E)[0]}return this._menu},v._getPlacement=function(){var e=t(this._element).parent(),n=w;return e.hasClass(f)?(n=T,t(this._menu).hasClass(p)&&(n=C)):e.hasClass(u)?n=A:e.hasClass(d)?n=D:t(this._menu).hasClass(p)&&(n=I),n},v._detectNavbar=function(){return t(this._element).closest(".navbar").length>0},v._getPopperConfig=function(){var t=this,e={};return"function"==typeof this._config.offset?e.fn=function(e){return e.offsets=r({},e.offsets,t._config.offset(e.offsets)||{}),e}:e.offset=this._config.offset,{placement:this._getPlacement(),modifiers:{offset:e,flip:{enabled:this._config.flip},preventOverflow:{boundariesElement:this._config.boundary}}}},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n);if(i||(i=new s(this,"object"==typeof e?e:null),t(this).data(n,i)),"string"==typeof e){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},s._clearMenus=function(e){if(!e||3!==e.which&&("keyup"!==e.type||9===e.which))for(var i=t.makeArray(t(_)),r=0;r0&&o--,40===e.which&&odocument.documentElement.clientHeight;!this._isBodyOverflowing&&t&&(this._element.style.paddingLeft=this._scrollbarWidth+"px"),this._isBodyOverflowing&&!t&&(this._element.style.paddingRight=this._scrollbarWidth+"px")},g._resetAdjustments=function(){this._element.style.paddingLeft="",this._element.style.paddingRight=""},g._checkScrollbar=function(){var t=document.body.getBoundingClientRect();this._isBodyOverflowing=t.left+t.right
',trigger:"hover focus",title:"",delay:0,html:!1,selector:!1,placement:"top",offset:0,container:!1,fallbackPlacement:"flip",boundary:"scrollParent"},f="show",u="out",d={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},p="fade",g="show",m=".tooltip-inner",_=".arrow",v="hover",E="focus",y="click",b="manual",T=function(){function s(t,e){if("undefined"==typeof Ot)throw new TypeError("Bootstrap tooltips require Popper.js (https://popper.js.org)");this._isEnabled=!0,this._timeout=0,this._hoverState="",this._activeTrigger={},this._popper=null,this.element=t,this.config=this._getConfig(e),this.tip=null,this._setListeners()}var T=s.prototype;return T.enable=function(){this._isEnabled=!0},T.disable=function(){this._isEnabled=!1},T.toggleEnabled=function(){this._isEnabled=!this._isEnabled},T.toggle=function(e){if(this._isEnabled)if(e){var n=this.constructor.DATA_KEY,i=t(e.currentTarget).data(n);i||(i=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(n,i)),i._activeTrigger.click=!i._activeTrigger.click,i._isWithActiveTrigger()?i._enter(null,i):i._leave(null,i)}else{if(t(this.getTipElement()).hasClass(g))return void this._leave(null,this);this._enter(null,this)}},T.dispose=function(){clearTimeout(this._timeout),t.removeData(this.element,this.constructor.DATA_KEY),t(this.element).off(this.constructor.EVENT_KEY),t(this.element).closest(".modal").off("hide.bs.modal"),this.tip&&t(this.tip).remove(),this._isEnabled=null,this._timeout=null,this._hoverState=null,this._activeTrigger=null,null!==this._popper&&this._popper.destroy(),this._popper=null,this.element=null,this.config=null,this.tip=null},T.show=function(){var e=this;if("none"===t(this.element).css("display"))throw new Error("Please use show on visible elements");var n=t.Event(this.constructor.Event.SHOW);if(this.isWithContent()&&this._isEnabled){t(this.element).trigger(n);var i=t.contains(this.element.ownerDocument.documentElement,this.element);if(n.isDefaultPrevented()||!i)return;var r=this.getTipElement(),o=k.getUID(this.constructor.NAME);r.setAttribute("id",o),this.element.setAttribute("aria-describedby",o),this.setContent(),this.config.animation&&t(r).addClass(p);var a="function"==typeof this.config.placement?this.config.placement.call(this,r,this.element):this.config.placement,l=this._getAttachment(a);this.addAttachmentClass(l);var c=!1===this.config.container?document.body:t(this.config.container);t(r).data(this.constructor.DATA_KEY,this),t.contains(this.element.ownerDocument.documentElement,this.tip)||t(r).appendTo(c),t(this.element).trigger(this.constructor.Event.INSERTED),this._popper=new Ot(this.element,r,{placement:l,modifiers:{offset:{offset:this.config.offset},flip:{behavior:this.config.fallbackPlacement},arrow:{element:_},preventOverflow:{boundariesElement:this.config.boundary}},onCreate:function(t){t.originalPlacement!==t.placement&&e._handlePopperPlacementChange(t)},onUpdate:function(t){e._handlePopperPlacementChange(t)}}),t(r).addClass(g),"ontouchstart"in document.documentElement&&t("body").children().on("mouseover",null,t.noop);var h=function(){e.config.animation&&e._fixTransition();var n=e._hoverState;e._hoverState=null,t(e.element).trigger(e.constructor.Event.SHOWN),n===u&&e._leave(null,e)};k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(this.tip).one(k.TRANSITION_END,h).emulateTransitionEnd(s._TRANSITION_DURATION):h()}},T.hide=function(e){var n=this,i=this.getTipElement(),r=t.Event(this.constructor.Event.HIDE),o=function(){n._hoverState!==f&&i.parentNode&&i.parentNode.removeChild(i),n._cleanTipClass(),n.element.removeAttribute("aria-describedby"),t(n.element).trigger(n.constructor.Event.HIDDEN),null!==n._popper&&n._popper.destroy(),e&&e()};t(this.element).trigger(r),r.isDefaultPrevented()||(t(i).removeClass(g),"ontouchstart"in document.documentElement&&t("body").children().off("mouseover",null,t.noop),this._activeTrigger[y]=!1,this._activeTrigger[E]=!1,this._activeTrigger[v]=!1,k.supportsTransitionEnd()&&t(this.tip).hasClass(p)?t(i).one(k.TRANSITION_END,o).emulateTransitionEnd(150):o(),this._hoverState="")},T.update=function(){null!==this._popper&&this._popper.scheduleUpdate()},T.isWithContent=function(){return Boolean(this.getTitle())},T.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-tooltip-"+e)},T.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},T.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(m),this.getTitle()),e.removeClass(p+" "+g)},T.setElementContent=function(e,n){var i=this.config.html;"object"==typeof n&&(n.nodeType||n.jquery)?i?t(n).parent().is(e)||e.empty().append(n):e.text(t(n).text()):e[i?"html":"text"](n)},T.getTitle=function(){var t=this.element.getAttribute("data-original-title");return t||(t="function"==typeof this.config.title?this.config.title.call(this.element):this.config.title),t},T._getAttachment=function(t){return c[t.toUpperCase()]},T._setListeners=function(){var e=this;this.config.trigger.split(" ").forEach(function(n){if("click"===n)t(e.element).on(e.constructor.Event.CLICK,e.config.selector,function(t){return e.toggle(t)});else if(n!==b){var i=n===v?e.constructor.Event.MOUSEENTER:e.constructor.Event.FOCUSIN,r=n===v?e.constructor.Event.MOUSELEAVE:e.constructor.Event.FOCUSOUT;t(e.element).on(i,e.config.selector,function(t){return e._enter(t)}).on(r,e.config.selector,function(t){return e._leave(t)})}t(e.element).closest(".modal").on("hide.bs.modal",function(){return e.hide()})}),this.config.selector?this.config=r({},this.config,{trigger:"manual",selector:""}):this._fixTitle()},T._fixTitle=function(){var t=typeof this.element.getAttribute("data-original-title");(this.element.getAttribute("title")||"string"!==t)&&(this.element.setAttribute("data-original-title",this.element.getAttribute("title")||""),this.element.setAttribute("title",""))},T._enter=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusin"===e.type?E:v]=!0),t(n.getTipElement()).hasClass(g)||n._hoverState===f?n._hoverState=f:(clearTimeout(n._timeout),n._hoverState=f,n.config.delay&&n.config.delay.show?n._timeout=setTimeout(function(){n._hoverState===f&&n.show()},n.config.delay.show):n.show())},T._leave=function(e,n){var i=this.constructor.DATA_KEY;(n=n||t(e.currentTarget).data(i))||(n=new this.constructor(e.currentTarget,this._getDelegateConfig()),t(e.currentTarget).data(i,n)),e&&(n._activeTrigger["focusout"===e.type?E:v]=!1),n._isWithActiveTrigger()||(clearTimeout(n._timeout),n._hoverState=u,n.config.delay&&n.config.delay.hide?n._timeout=setTimeout(function(){n._hoverState===u&&n.hide()},n.config.delay.hide):n.hide())},T._isWithActiveTrigger=function(){for(var t in this._activeTrigger)if(this._activeTrigger[t])return!0;return!1},T._getConfig=function(n){return"number"==typeof(n=r({},this.constructor.Default,t(this.element).data(),n)).delay&&(n.delay={show:n.delay,hide:n.delay}),"number"==typeof n.title&&(n.title=n.title.toString()),"number"==typeof n.content&&(n.content=n.content.toString()),k.typeCheckConfig(e,n,this.constructor.DefaultType),n},T._getDelegateConfig=function(){var t={};if(this.config)for(var e in this.config)this.constructor.Default[e]!==this.config[e]&&(t[e]=this.config[e]);return t},T._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},T._handlePopperPlacementChange=function(t){this._cleanTipClass(),this.addAttachmentClass(this._getAttachment(t.placement))},T._fixTransition=function(){var e=this.getTipElement(),n=this.config.animation;null===e.getAttribute("x-placement")&&(t(e).removeClass(p),this.config.animation=!1,this.hide(),this.show(),this.config.animation=n)},s._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e&&e;if((i||!/dispose|hide/.test(e))&&(i||(i=new s(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(s,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return h}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return d}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return l}}]),s}();return t.fn[e]=T._jQueryInterface,t.fn[e].Constructor=T,t.fn[e].noConflict=function(){return t.fn[e]=s,T._jQueryInterface},T}(e),Pt=function(t){var e="popover",n="bs.popover",o="."+n,s=t.fn[e],a=new RegExp("(^|\\s)bs-popover\\S+","g"),l=r({},Lt.Default,{placement:"right",trigger:"click",content:"",template:''}),c=r({},Lt.DefaultType,{content:"(string|element|function)"}),h="fade",f="show",u=".popover-header",d=".popover-body",p={HIDE:"hide"+o,HIDDEN:"hidden"+o,SHOW:"show"+o,SHOWN:"shown"+o,INSERTED:"inserted"+o,CLICK:"click"+o,FOCUSIN:"focusin"+o,FOCUSOUT:"focusout"+o,MOUSEENTER:"mouseenter"+o,MOUSELEAVE:"mouseleave"+o},g=function(r){var s,g;function m(){return r.apply(this,arguments)||this}g=r,(s=m).prototype=Object.create(g.prototype),s.prototype.constructor=s,s.__proto__=g;var _=m.prototype;return _.isWithContent=function(){return this.getTitle()||this._getContent()},_.addAttachmentClass=function(e){t(this.getTipElement()).addClass("bs-popover-"+e)},_.getTipElement=function(){return this.tip=this.tip||t(this.config.template)[0],this.tip},_.setContent=function(){var e=t(this.getTipElement());this.setElementContent(e.find(u),this.getTitle());var n=this._getContent();"function"==typeof n&&(n=n.call(this.element)),this.setElementContent(e.find(d),n),e.removeClass(h+" "+f)},_._getContent=function(){return this.element.getAttribute("data-content")||this.config.content},_._cleanTipClass=function(){var e=t(this.getTipElement()),n=e.attr("class").match(a);null!==n&&n.length>0&&e.removeClass(n.join(""))},m._jQueryInterface=function(e){return this.each(function(){var i=t(this).data(n),r="object"==typeof e?e:null;if((i||!/destroy|hide/.test(e))&&(i||(i=new m(this,r),t(this).data(n,i)),"string"==typeof e)){if("undefined"==typeof i[e])throw new TypeError('No method named "'+e+'"');i[e]()}})},i(m,null,[{key:"VERSION",get:function(){return"4.0.0"}},{key:"Default",get:function(){return l}},{key:"NAME",get:function(){return e}},{key:"DATA_KEY",get:function(){return n}},{key:"Event",get:function(){return p}},{key:"EVENT_KEY",get:function(){return o}},{key:"DefaultType",get:function(){return c}}]),m}(Lt);return t.fn[e]=g._jQueryInterface,t.fn[e].Constructor=g,t.fn[e].noConflict=function(){return t.fn[e]=s,g._jQueryInterface},g}(e),xt=function(t){var e="scrollspy",n="bs.scrollspy",o="."+n,s=t.fn[e],a={offset:10,method:"auto",target:""},l={offset:"number",method:"string",target:"(string|element)"},c={ACTIVATE:"activate"+o,SCROLL:"scroll"+o,LOAD_DATA_API:"load"+o+".data-api"},h="dropdown-item",f="active",u={DATA_SPY:'[data-spy="scroll"]',ACTIVE:".active",NAV_LIST_GROUP:".nav, .list-group",NAV_LINKS:".nav-link",NAV_ITEMS:".nav-item",LIST_ITEMS:".list-group-item",DROPDOWN:".dropdown",DROPDOWN_ITEMS:".dropdown-item",DROPDOWN_TOGGLE:".dropdown-toggle"},d="offset",p="position",g=function(){function s(e,n){var i=this;this._element=e,this._scrollElement="BODY"===e.tagName?window:e,this._config=this._getConfig(n),this._selector=this._config.target+" "+u.NAV_LINKS+","+this._config.target+" "+u.LIST_ITEMS+","+this._config.target+" "+u.DROPDOWN_ITEMS,this._offsets=[],this._targets=[],this._activeTarget=null,this._scrollHeight=0,t(this._scrollElement).on(c.SCROLL,function(t){return i._process(t)}),this.refresh(),this._process()}var g=s.prototype;return g.refresh=function(){var e=this,n=this._scrollElement===this._scrollElement.window?d:p,i="auto"===this._config.method?n:this._config.method,r=i===p?this._getScrollTop():0;this._offsets=[],this._targets=[],this._scrollHeight=this._getScrollHeight(),t.makeArray(t(this._selector)).map(function(e){var n,o=k.getSelectorFromElement(e);if(o&&(n=t(o)[0]),n){var s=n.getBoundingClientRect();if(s.width||s.height)return[t(n)[i]().top+r,o]}return null}).filter(function(t){return t}).sort(function(t,e){return t[0]-e[0]}).forEach(function(t){e._offsets.push(t[0]),e._targets.push(t[1])})},g.dispose=function(){t.removeData(this._element,n),t(this._scrollElement).off(o),this._element=null,this._scrollElement=null,this._config=null,this._selector=null,this._offsets=null,this._targets=null,this._activeTarget=null,this._scrollHeight=null},g._getConfig=function(n){if("string"!=typeof(n=r({},a,n)).target){var i=t(n.target).attr("id");i||(i=k.getUID(e),t(n.target).attr("id",i)),n.target="#"+i}return k.typeCheckConfig(e,n,l),n},g._getScrollTop=function(){return this._scrollElement===window?this._scrollElement.pageYOffset:this._scrollElement.scrollTop},g._getScrollHeight=function(){return this._scrollElement.scrollHeight||Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)},g._getOffsetHeight=function(){return this._scrollElement===window?window.innerHeight:this._scrollElement.getBoundingClientRect().height},g._process=function(){var t=this._getScrollTop()+this._config.offset,e=this._getScrollHeight(),n=this._config.offset+e-this._getOffsetHeight();if(this._scrollHeight!==e&&this.refresh(),t>=n){var i=this._targets[this._targets.length-1];this._activeTarget!==i&&this._activate(i)}else{if(this._activeTarget&&t0)return this._activeTarget=null,void this._clear();for(var r=this._offsets.length;r--;){this._activeTarget!==this._targets[r]&&t>=this._offsets[r]&&("undefined"==typeof this._offsets[r+1]||t=4)throw new Error("Bootstrap's JavaScript requires at least jQuery v1.9.1 but less than v4.0.0")}(e),t.Util=k,t.Alert=L,t.Button=P,t.Carousel=x,t.Collapse=R,t.Dropdown=Nt,t.Modal=kt,t.Popover=Pt,t.Scrollspy=xt,t.Tab=Rt,t.Tooltip=Lt,Object.defineProperty(t,"__esModule",{value:!0})}); +//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file diff --git a/dist/assets/js/vendors/chart.bundle.min.js b/dist/assets/js/vendors/chart.bundle.min.js new file mode 100644 index 000000000..efb0b2a97 --- /dev/null +++ b/dist/assets/js/vendors/chart.bundle.min.js @@ -0,0 +1,10 @@ +/*! + * Chart.js + * http://chartjs.org/ + * Version: 2.7.0 + * + * Copyright 2017 Nick Downie + * Released under the MIT license + * https://github.com/chartjs/Chart.js/blob/master/LICENSE.md + */ +!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{("undefined"!=typeof window?window:"undefined"!=typeof global?global:"undefined"!=typeof self?self:this).Chart=t()}}(function(){return function t(e,n,i){function a(o,s){if(!n[o]){if(!e[o]){var l="function"==typeof require&&require;if(!s&&l)return l(o,!0);if(r)return r(o,!0);var u=new Error("Cannot find module '"+o+"'");throw u.code="MODULE_NOT_FOUND",u}var d=n[o]={exports:{}};e[o][0].call(d.exports,function(t){var n=e[o][1][t];return a(n||t)},d,d.exports,t,e,n,i)}return n[o].exports}for(var r="function"==typeof require&&require,o=0;on?(e+.05)/(n+.05):(n+.05)/(e+.05)},level:function(t){var e=this.contrast(t);return e>=7.1?"AAA":e>=4.5?"AA":""},dark:function(){var t=this.values.rgb;return(299*t[0]+587*t[1]+114*t[2])/1e3<128},light:function(){return!this.dark()},negate:function(){for(var t=[],e=0;e<3;e++)t[e]=255-this.values.rgb[e];return this.setValues("rgb",t),this},lighten:function(t){var e=this.values.hsl;return e[2]+=e[2]*t,this.setValues("hsl",e),this},darken:function(t){var e=this.values.hsl;return e[2]-=e[2]*t,this.setValues("hsl",e),this},saturate:function(t){var e=this.values.hsl;return e[1]+=e[1]*t,this.setValues("hsl",e),this},desaturate:function(t){var e=this.values.hsl;return e[1]-=e[1]*t,this.setValues("hsl",e),this},whiten:function(t){var e=this.values.hwb;return e[1]+=e[1]*t,this.setValues("hwb",e),this},blacken:function(t){var e=this.values.hwb;return e[2]+=e[2]*t,this.setValues("hwb",e),this},greyscale:function(){var t=this.values.rgb,e=.3*t[0]+.59*t[1]+.11*t[2];return this.setValues("rgb",[e,e,e]),this},clearer:function(t){var e=this.values.alpha;return this.setValues("alpha",e-e*t),this},opaquer:function(t){var e=this.values.alpha;return this.setValues("alpha",e+e*t),this},rotate:function(t){var e=this.values.hsl,n=(e[0]+t)%360;return e[0]=n<0?360+n:n,this.setValues("hsl",e),this},mix:function(t,e){var n=this,i=t,a=void 0===e?.5:e,r=2*a-1,o=n.alpha()-i.alpha(),s=((r*o==-1?r:(r+o)/(1+r*o))+1)/2,l=1-s;return this.rgb(s*n.red()+l*i.red(),s*n.green()+l*i.green(),s*n.blue()+l*i.blue()).alpha(n.alpha()*a+i.alpha()*(1-a))},toJSON:function(){return this.rgb()},clone:function(){var t,e,n=new r,i=this.values,a=n.values;for(var o in i)i.hasOwnProperty(o)&&(t=i[o],"[object Array]"===(e={}.toString.call(t))?a[o]=t.slice(0):"[object Number]"===e?a[o]=t:console.error("unexpected color value:",t));return n}},r.prototype.spaces={rgb:["red","green","blue"],hsl:["hue","saturation","lightness"],hsv:["hue","saturation","value"],hwb:["hue","whiteness","blackness"],cmyk:["cyan","magenta","yellow","black"]},r.prototype.maxes={rgb:[255,255,255],hsl:[360,100,100],hsv:[360,100,100],hwb:[360,100,100],cmyk:[100,100,100,100]},r.prototype.getValues=function(t){for(var e=this.values,n={},i=0;i.04045?Math.pow((e+.055)/1.055,2.4):e/12.92)+.3576*(n=n>.04045?Math.pow((n+.055)/1.055,2.4):n/12.92)+.1805*(i=i>.04045?Math.pow((i+.055)/1.055,2.4):i/12.92)),100*(.2126*e+.7152*n+.0722*i),100*(.0193*e+.1192*n+.9505*i)]}function d(t){var e,n,i,a=u(t),r=a[0],o=a[1],s=a[2];return r/=95.047,o/=100,s/=108.883,r=r>.008856?Math.pow(r,1/3):7.787*r+16/116,o=o>.008856?Math.pow(o,1/3):7.787*o+16/116,s=s>.008856?Math.pow(s,1/3):7.787*s+16/116,e=116*o-16,n=500*(r-o),i=200*(o-s),[e,n,i]}function c(t){var e,n,i,a,r,o=t[0]/360,s=t[1]/100,l=t[2]/100;if(0==s)return r=255*l,[r,r,r];e=2*l-(n=l<.5?l*(1+s):l+s-l*s),a=[0,0,0];for(var u=0;u<3;u++)(i=o+1/3*-(u-1))<0&&i++,i>1&&i--,r=6*i<1?e+6*(n-e)*i:2*i<1?n:3*i<2?e+(n-e)*(2/3-i)*6:e,a[u]=255*r;return a}function h(t){var e=t[0]/60,n=t[1]/100,i=t[2]/100,a=Math.floor(e)%6,r=e-Math.floor(e),o=255*i*(1-n),s=255*i*(1-n*r),l=255*i*(1-n*(1-r)),i=255*i;switch(a){case 0:return[i,l,o];case 1:return[s,i,o];case 2:return[o,i,l];case 3:return[o,s,i];case 4:return[l,o,i];case 5:return[i,o,s]}}function f(t){var e,n,i,a,o=t[0]/360,s=t[1]/100,l=t[2]/100,u=s+l;switch(u>1&&(s/=u,l/=u),e=Math.floor(6*o),n=1-l,i=6*o-e,0!=(1&e)&&(i=1-i),a=s+i*(n-s),e){default:case 6:case 0:r=n,g=a,b=s;break;case 1:r=a,g=n,b=s;break;case 2:r=s,g=n,b=a;break;case 3:r=s,g=a,b=n;break;case 4:r=a,g=s,b=n;break;case 5:r=n,g=s,b=a}return[255*r,255*g,255*b]}function m(t){var e,n,i,a=t[0]/100,r=t[1]/100,o=t[2]/100,s=t[3]/100;return e=1-Math.min(1,a*(1-s)+s),n=1-Math.min(1,r*(1-s)+s),i=1-Math.min(1,o*(1-s)+s),[255*e,255*n,255*i]}function p(t){var e,n,i,a=t[0]/100,r=t[1]/100,o=t[2]/100;return e=3.2406*a+-1.5372*r+-.4986*o,n=-.9689*a+1.8758*r+.0415*o,i=.0557*a+-.204*r+1.057*o,e=e>.0031308?1.055*Math.pow(e,1/2.4)-.055:e*=12.92,n=n>.0031308?1.055*Math.pow(n,1/2.4)-.055:n*=12.92,i=i>.0031308?1.055*Math.pow(i,1/2.4)-.055:i*=12.92,e=Math.min(Math.max(0,e),1),n=Math.min(Math.max(0,n),1),i=Math.min(Math.max(0,i),1),[255*e,255*n,255*i]}function v(t){var e,n,i,a=t[0],r=t[1],o=t[2];return a/=95.047,r/=100,o/=108.883,a=a>.008856?Math.pow(a,1/3):7.787*a+16/116,r=r>.008856?Math.pow(r,1/3):7.787*r+16/116,o=o>.008856?Math.pow(o,1/3):7.787*o+16/116,e=116*r-16,n=500*(a-r),i=200*(r-o),[e,n,i]}function y(t){var e,n,i,a,r=t[0],o=t[1],s=t[2];return r<=8?a=(n=100*r/903.3)/100*7.787+16/116:(n=100*Math.pow((r+16)/116,3),a=Math.pow(n/100,1/3)),e=e/95.047<=.008856?e=95.047*(o/500+a-16/116)/7.787:95.047*Math.pow(o/500+a,3),i=i/108.883<=.008859?i=108.883*(a-s/200-16/116)/7.787:108.883*Math.pow(a-s/200,3),[e,n,i]}function x(t){var e,n,i,a=t[0],r=t[1],o=t[2];return e=Math.atan2(o,r),(n=360*e/2/Math.PI)<0&&(n+=360),i=Math.sqrt(r*r+o*o),[a,i,n]}function _(t){return p(y(t))}function k(t){var e,n,i,a=t[0],r=t[1];return i=t[2]/360*2*Math.PI,e=r*Math.cos(i),n=r*Math.sin(i),[a,e,n]}function w(t){return M[t]}e.exports={rgb2hsl:i,rgb2hsv:a,rgb2hwb:o,rgb2cmyk:s,rgb2keyword:l,rgb2xyz:u,rgb2lab:d,rgb2lch:function(t){return x(d(t))},hsl2rgb:c,hsl2hsv:function(t){var e,n,i=t[0],a=t[1]/100,r=t[2]/100;return 0===r?[0,0,0]:(r*=2,a*=r<=1?r:2-r,n=(r+a)/2,e=2*a/(r+a),[i,100*e,100*n])},hsl2hwb:function(t){return o(c(t))},hsl2cmyk:function(t){return s(c(t))},hsl2keyword:function(t){return l(c(t))},hsv2rgb:h,hsv2hsl:function(t){var e,n,i=t[0],a=t[1]/100,r=t[2]/100;return n=(2-a)*r,e=a*r,e/=n<=1?n:2-n,e=e||0,n/=2,[i,100*e,100*n]},hsv2hwb:function(t){return o(h(t))},hsv2cmyk:function(t){return s(h(t))},hsv2keyword:function(t){return l(h(t))},hwb2rgb:f,hwb2hsl:function(t){return i(f(t))},hwb2hsv:function(t){return a(f(t))},hwb2cmyk:function(t){return s(f(t))},hwb2keyword:function(t){return l(f(t))},cmyk2rgb:m,cmyk2hsl:function(t){return i(m(t))},cmyk2hsv:function(t){return a(m(t))},cmyk2hwb:function(t){return o(m(t))},cmyk2keyword:function(t){return l(m(t))},keyword2rgb:w,keyword2hsl:function(t){return i(w(t))},keyword2hsv:function(t){return a(w(t))},keyword2hwb:function(t){return o(w(t))},keyword2cmyk:function(t){return s(w(t))},keyword2lab:function(t){return d(w(t))},keyword2xyz:function(t){return u(w(t))},xyz2rgb:p,xyz2lab:v,xyz2lch:function(t){return x(v(t))},lab2xyz:y,lab2rgb:_,lab2lch:x,lch2lab:k,lch2xyz:function(t){return y(k(t))},lch2rgb:function(t){return _(k(t))}};var M={aliceblue:[240,248,255],antiquewhite:[250,235,215],aqua:[0,255,255],aquamarine:[127,255,212],azure:[240,255,255],beige:[245,245,220],bisque:[255,228,196],black:[0,0,0],blanchedalmond:[255,235,205],blue:[0,0,255],blueviolet:[138,43,226],brown:[165,42,42],burlywood:[222,184,135],cadetblue:[95,158,160],chartreuse:[127,255,0],chocolate:[210,105,30],coral:[255,127,80],cornflowerblue:[100,149,237],cornsilk:[255,248,220],crimson:[220,20,60],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgoldenrod:[184,134,11],darkgray:[169,169,169],darkgreen:[0,100,0],darkgrey:[169,169,169],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkseagreen:[143,188,143],darkslateblue:[72,61,139],darkslategray:[47,79,79],darkslategrey:[47,79,79],darkturquoise:[0,206,209],darkviolet:[148,0,211],deeppink:[255,20,147],deepskyblue:[0,191,255],dimgray:[105,105,105],dimgrey:[105,105,105],dodgerblue:[30,144,255],firebrick:[178,34,34],floralwhite:[255,250,240],forestgreen:[34,139,34],fuchsia:[255,0,255],gainsboro:[220,220,220],ghostwhite:[248,248,255],gold:[255,215,0],goldenrod:[218,165,32],gray:[128,128,128],green:[0,128,0],greenyellow:[173,255,47],grey:[128,128,128],honeydew:[240,255,240],hotpink:[255,105,180],indianred:[205,92,92],indigo:[75,0,130],ivory:[255,255,240],khaki:[240,230,140],lavender:[230,230,250],lavenderblush:[255,240,245],lawngreen:[124,252,0],lemonchiffon:[255,250,205],lightblue:[173,216,230],lightcoral:[240,128,128],lightcyan:[224,255,255],lightgoldenrodyellow:[250,250,210],lightgray:[211,211,211],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightsalmon:[255,160,122],lightseagreen:[32,178,170],lightskyblue:[135,206,250],lightslategray:[119,136,153],lightslategrey:[119,136,153],lightsteelblue:[176,196,222],lightyellow:[255,255,224],lime:[0,255,0],limegreen:[50,205,50],linen:[250,240,230],magenta:[255,0,255],maroon:[128,0,0],mediumaquamarine:[102,205,170],mediumblue:[0,0,205],mediumorchid:[186,85,211],mediumpurple:[147,112,219],mediumseagreen:[60,179,113],mediumslateblue:[123,104,238],mediumspringgreen:[0,250,154],mediumturquoise:[72,209,204],mediumvioletred:[199,21,133],midnightblue:[25,25,112],mintcream:[245,255,250],mistyrose:[255,228,225],moccasin:[255,228,181],navajowhite:[255,222,173],navy:[0,0,128],oldlace:[253,245,230],olive:[128,128,0],olivedrab:[107,142,35],orange:[255,165,0],orangered:[255,69,0],orchid:[218,112,214],palegoldenrod:[238,232,170],palegreen:[152,251,152],paleturquoise:[175,238,238],palevioletred:[219,112,147],papayawhip:[255,239,213],peachpuff:[255,218,185],peru:[205,133,63],pink:[255,192,203],plum:[221,160,221],powderblue:[176,224,230],purple:[128,0,128],rebeccapurple:[102,51,153],red:[255,0,0],rosybrown:[188,143,143],royalblue:[65,105,225],saddlebrown:[139,69,19],salmon:[250,128,114],sandybrown:[244,164,96],seagreen:[46,139,87],seashell:[255,245,238],sienna:[160,82,45],silver:[192,192,192],skyblue:[135,206,235],slateblue:[106,90,205],slategray:[112,128,144],slategrey:[112,128,144],snow:[255,250,250],springgreen:[0,255,127],steelblue:[70,130,180],tan:[210,180,140],teal:[0,128,128],thistle:[216,191,216],tomato:[255,99,71],turquoise:[64,224,208],violet:[238,130,238],wheat:[245,222,179],white:[255,255,255],whitesmoke:[245,245,245],yellow:[255,255,0],yellowgreen:[154,205,50]},S={};for(var D in M)S[JSON.stringify(M[D])]=D},{}],4:[function(t,e,n){var i=t(3),a=function(){return new u};for(var r in i){a[r+"Raw"]=function(t){return function(e){return"number"==typeof e&&(e=Array.prototype.slice.call(arguments)),i[t](e)}}(r);var o=/(\w+)2(\w+)/.exec(r),s=o[1],l=o[2];(a[s]=a[s]||{})[l]=a[r]=function(t){return function(e){"number"==typeof e&&(e=Array.prototype.slice.call(arguments));var n=i[t](e);if("string"==typeof n||void 0===n)return n;for(var a=0;a0)for(n=0;n=0?n?"+":"":"-")+Math.pow(10,Math.max(0,a)).toString().substr(1)+i}function N(t,e,n,i){var a=i;"string"==typeof i&&(a=function(){return this[i]()}),t&&(Ne[t]=a),e&&(Ne[e[0]]=function(){return Y(a.apply(this,arguments),e[1],e[2])}),n&&(Ne[n]=function(){return this.localeData().ordinal(a.apply(this,arguments),t)})}function z(t){return t.match(/\[[\s\S]/)?t.replace(/^\[|\]$/g,""):t.replace(/\\/g,"")}function B(t){var e,n,i=t.match(Le);for(e=0,n=i.length;e=0&&We.test(t);)t=t.replace(We,function(t){return e.longDateFormat(t)||t}),We.lastIndex=0,n-=1;return t}function E(t,e,n){nn[t]=D(e)?e:function(t,i){return t&&n?n:e}}function j(t,e){return d(nn,t)?nn[t](e._strict,e._locale):new RegExp(U(t))}function U(t){return q(t.replace("\\","").replace(/\\(\[)|\\(\])|\[([^\]\[]*)\]|\\(.)/g,function(t,e,n,i,a){return e||n||i||a}))}function q(t){return t.replace(/[-\/\\^$*+?.()|[\]{}]/g,"\\$&")}function G(t,e){var n,i=e;for("string"==typeof t&&(t=[t]),s(e)&&(i=function(t,n){n[e]=_(t)}),n=0;n=0&&isFinite(s.getFullYear())&&s.setFullYear(t),s}function at(t){var e=new Date(Date.UTC.apply(null,arguments));return t<100&&t>=0&&isFinite(e.getUTCFullYear())&&e.setUTCFullYear(t),e}function rt(t,e,n){var i=7+e-n;return-((7+at(t,0,i).getUTCDay()-e)%7)+i-1}function ot(t,e,n,i,a){var r,o,s=1+7*(e-1)+(7+n-i)%7+rt(t,i,a);return s<=0?o=et(r=t-1)+s:s>et(t)?(r=t+1,o=s-et(t)):(r=t,o=s),{year:r,dayOfYear:o}}function st(t,e,n){var i,a,r=rt(t.year(),e,n),o=Math.floor((t.dayOfYear()-r-1)/7)+1;return o<1?i=o+lt(a=t.year()-1,e,n):o>lt(t.year(),e,n)?(i=o-lt(t.year(),e,n),a=t.year()+1):(a=t.year(),i=o),{week:i,year:a}}function lt(t,e,n){var i=rt(t,e,n),a=rt(t+1,e,n);return(et(t)-i+a)/7}function ut(t,e){return"string"!=typeof t?t:isNaN(t)?"number"==typeof(t=e.weekdaysParse(t))?t:null:parseInt(t,10)}function dt(t,e){return"string"==typeof t?e.weekdaysParse(t)%7||7:isNaN(t)?null:t}function ct(t,e,n){var i,a,r,o=t.toLocaleLowerCase();if(!this._weekdaysParse)for(this._weekdaysParse=[],this._shortWeekdaysParse=[],this._minWeekdaysParse=[],i=0;i<7;++i)r=h([2e3,1]).day(i),this._minWeekdaysParse[i]=this.weekdaysMin(r,"").toLocaleLowerCase(),this._shortWeekdaysParse[i]=this.weekdaysShort(r,"").toLocaleLowerCase(),this._weekdaysParse[i]=this.weekdays(r,"").toLocaleLowerCase();return n?"dddd"===e?-1!==(a=gn.call(this._weekdaysParse,o))?a:null:"ddd"===e?-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:null:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:"dddd"===e?-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:"ddd"===e?-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:null:-1!==(a=gn.call(this._minWeekdaysParse,o))?a:-1!==(a=gn.call(this._weekdaysParse,o))?a:-1!==(a=gn.call(this._shortWeekdaysParse,o))?a:null}function ht(){function t(t,e){return e.length-t.length}var e,n,i,a,r,o=[],s=[],l=[],u=[];for(e=0;e<7;e++)n=h([2e3,1]).day(e),i=this.weekdaysMin(n,""),a=this.weekdaysShort(n,""),r=this.weekdays(n,""),o.push(i),s.push(a),l.push(r),u.push(i),u.push(a),u.push(r);for(o.sort(t),s.sort(t),l.sort(t),u.sort(t),e=0;e<7;e++)s[e]=q(s[e]),l[e]=q(l[e]),u[e]=q(u[e]);this._weekdaysRegex=new RegExp("^("+u.join("|")+")","i"),this._weekdaysShortRegex=this._weekdaysRegex,this._weekdaysMinRegex=this._weekdaysRegex,this._weekdaysStrictRegex=new RegExp("^("+l.join("|")+")","i"),this._weekdaysShortStrictRegex=new RegExp("^("+s.join("|")+")","i"),this._weekdaysMinStrictRegex=new RegExp("^("+o.join("|")+")","i")}function ft(){return this.hours()%12||12}function gt(t,e){N(t,0,0,function(){return this.localeData().meridiem(this.hours(),this.minutes(),e)})}function mt(t,e){return e._meridiemParse}function pt(t){return t?t.toLowerCase().replace("_","-"):t}function vt(t){for(var e,n,i,a,r=0;r0;){if(i=yt(a.slice(0,e).join("-")))return i;if(n&&n.length>=e&&k(a,n,!0)>=e-1)break;e--}r++}return null}function yt(n){var i=null;if(!On[n]&&void 0!==e&&e&&e.exports)try{i=Pn._abbr,t("./locale/"+n),bt(i)}catch(t){}return On[n]}function bt(t,e){var n;return t&&(n=o(e)?_t(t):xt(t,e))&&(Pn=n),Pn._abbr}function xt(t,e){if(null!==e){var n=An;if(e.abbr=t,null!=On[t])S("defineLocaleOverride","use moment.updateLocale(localeName, config) to change an existing locale. moment.defineLocale(localeName, config) should only be used for creating a new locale See http://momentjs.com/guides/#/warnings/define-locale/ for more info."),n=On[t]._config;else if(null!=e.parentLocale){if(null==On[e.parentLocale])return Fn[e.parentLocale]||(Fn[e.parentLocale]=[]),Fn[e.parentLocale].push({name:t,config:e}),null;n=On[e.parentLocale]._config}return On[t]=new P(C(n,e)),Fn[t]&&Fn[t].forEach(function(t){xt(t.name,t.config)}),bt(t),On[t]}return delete On[t],null}function _t(t){var e;if(t&&t._locale&&t._locale._abbr&&(t=t._locale._abbr),!t)return Pn;if(!i(t)){if(e=yt(t))return e;t=[t]}return vt(t)}function kt(t){var e,n=t._a;return n&&-2===g(t).overflow&&(e=n[on]<0||n[on]>11?on:n[sn]<1||n[sn]>J(n[rn],n[on])?sn:n[ln]<0||n[ln]>24||24===n[ln]&&(0!==n[un]||0!==n[dn]||0!==n[cn])?ln:n[un]<0||n[un]>59?un:n[dn]<0||n[dn]>59?dn:n[cn]<0||n[cn]>999?cn:-1,g(t)._overflowDayOfYear&&(esn)&&(e=sn),g(t)._overflowWeeks&&-1===e&&(e=hn),g(t)._overflowWeekday&&-1===e&&(e=fn),g(t).overflow=e),t}function wt(t){var e,n,i,a,r,o,s=t._i,l=Rn.exec(s)||Ln.exec(s);if(l){for(g(t).iso=!0,e=0,n=Yn.length;e10?"YYYY ":"YY "),r="HH:mm"+(n[4]?":ss":""),n[1]){var d=["Sun","Mon","Tue","Wed","Thu","Fri","Sat"][new Date(n[2]).getDay()];if(n[1].substr(0,3)!==d)return g(t).weekdayMismatch=!0,void(t._isValid=!1)}switch(n[5].length){case 2:s=0===l?" +0000":((l="YXWVUTSRQPONZABCDEFGHIKLM".indexOf(n[5][1].toUpperCase())-12)<0?" -":" +")+(""+l).replace(/^-?/,"0").match(/..$/)[0]+"00";break;case 4:s=u[n[5]];break;default:s=u[" GMT"]}n[5]=s,t._i=n.splice(1).join(""),o=" ZZ",t._f=i+a+r+o,It(t),g(t).rfc2822=!0}else t._isValid=!1}function St(t){var e=zn.exec(t._i);null===e?(wt(t),!1===t._isValid&&(delete t._isValid,Mt(t),!1===t._isValid&&(delete t._isValid,n.createFromInputFallback(t)))):t._d=new Date(+e[1])}function Dt(t,e,n){return null!=t?t:null!=e?e:n}function Ct(t){var e=new Date(n.now());return t._useUTC?[e.getUTCFullYear(),e.getUTCMonth(),e.getUTCDate()]:[e.getFullYear(),e.getMonth(),e.getDate()]}function Pt(t){var e,n,i,a,r=[];if(!t._d){for(i=Ct(t),t._w&&null==t._a[sn]&&null==t._a[on]&&Tt(t),null!=t._dayOfYear&&(a=Dt(t._a[rn],i[rn]),(t._dayOfYear>et(a)||0===t._dayOfYear)&&(g(t)._overflowDayOfYear=!0),n=at(a,0,t._dayOfYear),t._a[on]=n.getUTCMonth(),t._a[sn]=n.getUTCDate()),e=0;e<3&&null==t._a[e];++e)t._a[e]=r[e]=i[e];for(;e<7;e++)t._a[e]=r[e]=null==t._a[e]?2===e?1:0:t._a[e];24===t._a[ln]&&0===t._a[un]&&0===t._a[dn]&&0===t._a[cn]&&(t._nextDay=!0,t._a[ln]=0),t._d=(t._useUTC?at:it).apply(null,r),null!=t._tzm&&t._d.setUTCMinutes(t._d.getUTCMinutes()-t._tzm),t._nextDay&&(t._a[ln]=24)}}function Tt(t){var e,n,i,a,r,o,s,l;if(null!=(e=t._w).GG||null!=e.W||null!=e.E)r=1,o=4,n=Dt(e.GG,t._a[rn],st(Nt(),1,4).year),i=Dt(e.W,1),((a=Dt(e.E,1))<1||a>7)&&(l=!0);else{r=t._locale._week.dow,o=t._locale._week.doy;var u=st(Nt(),r,o);n=Dt(e.gg,t._a[rn],u.year),i=Dt(e.w,u.week),null!=e.d?((a=e.d)<0||a>6)&&(l=!0):null!=e.e?(a=e.e+r,(e.e<0||e.e>6)&&(l=!0)):a=r}i<1||i>lt(n,r,o)?g(t)._overflowWeeks=!0:null!=l?g(t)._overflowWeekday=!0:(s=ot(n,i,a,r,o),t._a[rn]=s.year,t._dayOfYear=s.dayOfYear)}function It(t){if(t._f!==n.ISO_8601)if(t._f!==n.RFC_2822){t._a=[],g(t).empty=!0;var e,i,a,r,o,s=""+t._i,l=s.length,u=0;for(a=H(t._f,t._locale).match(Le)||[],e=0;e0&&g(t).unusedInput.push(o),s=s.slice(s.indexOf(i)+i.length),u+=i.length),Ne[r]?(i?g(t).empty=!1:g(t).unusedTokens.push(r),X(r,i,t)):t._strict&&!i&&g(t).unusedTokens.push(r);g(t).charsLeftOver=l-u,s.length>0&&g(t).unusedInput.push(s),t._a[ln]<=12&&!0===g(t).bigHour&&t._a[ln]>0&&(g(t).bigHour=void 0),g(t).parsedDateParts=t._a.slice(0),g(t).meridiem=t._meridiem,t._a[ln]=At(t._locale,t._a[ln],t._meridiem),Pt(t),kt(t)}else Mt(t);else wt(t)}function At(t,e,n){var i;return null==n?e:null!=t.meridiemHour?t.meridiemHour(e,n):null!=t.isPM?((i=t.isPM(n))&&e<12&&(e+=12),i||12!==e||(e=0),e):e}function Ot(t){var e,n,i,a,r;if(0===t._f.length)return g(t).invalidFormat=!0,void(t._d=new Date(NaN));for(a=0;ar&&(e=r),oe.call(this,t,e,n,i,a))}function oe(t,e,n,i,a){var r=ot(t,e,n,i,a),o=at(r.year,0,r.dayOfYear);return this.year(o.getUTCFullYear()),this.month(o.getUTCMonth()),this.date(o.getUTCDate()),this}function se(t){return t}function le(t,e,n,i){var a=_t(),r=h().set(i,e);return a[n](r,t)}function ue(t,e,n){if(s(t)&&(e=t,t=void 0),t=t||"",null!=e)return le(t,e,n,"month");var i,a=[];for(i=0;i<12;i++)a[i]=le(t,i,n,"month");return a}function de(t,e,n,i){"boolean"==typeof t?(s(e)&&(n=e,e=void 0),e=e||""):(n=e=t,t=!1,s(e)&&(n=e,e=void 0),e=e||"");var a=_t(),r=t?a._week.dow:0;if(null!=n)return le(e,(n+r)%7,i,"day");var o,l=[];for(o=0;o<7;o++)l[o]=le(e,(o+r)%7,i,"day");return l}function ce(t,e,n,i){var a=Xt(e,n);return t._milliseconds+=i*a._milliseconds,t._days+=i*a._days,t._months+=i*a._months,t._bubble()}function he(t){return t<0?Math.floor(t):Math.ceil(t)}function fe(t){return 4800*t/146097}function ge(t){return 146097*t/4800}function me(t){return function(){return this.as(t)}}function pe(t){return function(){return this.isValid()?this._data[t]:NaN}}function ve(t,e,n,i,a){return a.relativeTime(e||1,!!n,t,i)}function ye(t,e,n){var i=Xt(t).abs(),a=bi(i.as("s")),r=bi(i.as("m")),o=bi(i.as("h")),s=bi(i.as("d")),l=bi(i.as("M")),u=bi(i.as("y")),d=a<=xi.ss&&["s",a]||a0,d[4]=n,ve.apply(null,d)}function be(){if(!this.isValid())return this.localeData().invalidDate();var t,e,n,i=_i(this._milliseconds)/1e3,a=_i(this._days),r=_i(this._months);e=x((t=x(i/60))/60),i%=60,t%=60;var o=n=x(r/12),s=r%=12,l=a,u=e,d=t,c=i,h=this.asSeconds();return h?(h<0?"-":"")+"P"+(o?o+"Y":"")+(s?s+"M":"")+(l?l+"D":"")+(u||d||c?"T":"")+(u?u+"H":"")+(d?d+"M":"")+(c?c+"S":""):"P0D"}var xe,_e,ke=_e=Array.prototype.some?Array.prototype.some:function(t){for(var e=Object(this),n=e.length>>>0,i=0;i68?1900:2e3)};var xn=R("FullYear",!0);N("w",["ww",2],"wo","week"),N("W",["WW",2],"Wo","isoWeek"),T("week","w"),T("isoWeek","W"),O("week",5),O("isoWeek",5),E("w",je),E("ww",je,Be),E("W",je),E("WW",je,Be),Z(["w","ww","W","WW"],function(t,e,n,i){e[i.substr(0,1)]=_(t)});var _n={dow:0,doy:6};N("d",0,"do","day"),N("dd",0,0,function(t){return this.localeData().weekdaysMin(this,t)}),N("ddd",0,0,function(t){return this.localeData().weekdaysShort(this,t)}),N("dddd",0,0,function(t){return this.localeData().weekdays(this,t)}),N("e",0,0,"weekday"),N("E",0,0,"isoWeekday"),T("day","d"),T("weekday","e"),T("isoWeekday","E"),O("day",11),O("weekday",11),O("isoWeekday",11),E("d",je),E("e",je),E("E",je),E("dd",function(t,e){return e.weekdaysMinRegex(t)}),E("ddd",function(t,e){return e.weekdaysShortRegex(t)}),E("dddd",function(t,e){return e.weekdaysRegex(t)}),Z(["dd","ddd","dddd"],function(t,e,n,i){var a=n._locale.weekdaysParse(t,i,n._strict);null!=a?e.d=a:g(n).invalidWeekday=t}),Z(["d","e","E"],function(t,e,n,i){e[i]=_(t)});var kn="Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),wn="Sun_Mon_Tue_Wed_Thu_Fri_Sat".split("_"),Mn="Su_Mo_Tu_We_Th_Fr_Sa".split("_"),Sn=en,Dn=en,Cn=en;N("H",["HH",2],0,"hour"),N("h",["hh",2],0,ft),N("k",["kk",2],0,function(){return this.hours()||24}),N("hmm",0,0,function(){return""+ft.apply(this)+Y(this.minutes(),2)}),N("hmmss",0,0,function(){return""+ft.apply(this)+Y(this.minutes(),2)+Y(this.seconds(),2)}),N("Hmm",0,0,function(){return""+this.hours()+Y(this.minutes(),2)}),N("Hmmss",0,0,function(){return""+this.hours()+Y(this.minutes(),2)+Y(this.seconds(),2)}),gt("a",!0),gt("A",!1),T("hour","h"),O("hour",13),E("a",mt),E("A",mt),E("H",je),E("h",je),E("k",je),E("HH",je,Be),E("hh",je,Be),E("kk",je,Be),E("hmm",Ue),E("hmmss",qe),E("Hmm",Ue),E("Hmmss",qe),G(["H","HH"],ln),G(["k","kk"],function(t,e,n){var i=_(t);e[ln]=24===i?0:i}),G(["a","A"],function(t,e,n){n._isPm=n._locale.isPM(t),n._meridiem=t}),G(["h","hh"],function(t,e,n){e[ln]=_(t),g(n).bigHour=!0}),G("hmm",function(t,e,n){var i=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i)),g(n).bigHour=!0}),G("hmmss",function(t,e,n){var i=t.length-4,a=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i,2)),e[dn]=_(t.substr(a)),g(n).bigHour=!0}),G("Hmm",function(t,e,n){var i=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i))}),G("Hmmss",function(t,e,n){var i=t.length-4,a=t.length-2;e[ln]=_(t.substr(0,i)),e[un]=_(t.substr(i,2)),e[dn]=_(t.substr(a))});var Pn,Tn=/[ap]\.?m?\.?/i,In=R("Hours",!0),An={calendar:Te,longDateFormat:Ie,invalidDate:"Invalid date",ordinal:"%d",dayOfMonthOrdinalParse:Ae,relativeTime:Oe,months:pn,monthsShort:vn,week:_n,weekdays:kn,weekdaysMin:Mn,weekdaysShort:wn,meridiemParse:Tn},On={},Fn={},Rn=/^\s*((?:[+-]\d{6}|\d{4})-(?:\d\d-\d\d|W\d\d-\d|W\d\d|\d\d\d|\d\d))(?:(T| )(\d\d(?::\d\d(?::\d\d(?:[.,]\d+)?)?)?)([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/,Ln=/^\s*((?:[+-]\d{6}|\d{4})(?:\d\d\d\d|W\d\d\d|W\d\d|\d\d\d|\d\d))(?:(T| )(\d\d(?:\d\d(?:\d\d(?:[.,]\d+)?)?)?)([\+\-]\d\d(?::?\d\d)?|\s*Z)?)?$/,Wn=/Z|[+-]\d\d(?::?\d\d)?/,Yn=[["YYYYYY-MM-DD",/[+-]\d{6}-\d\d-\d\d/],["YYYY-MM-DD",/\d{4}-\d\d-\d\d/],["GGGG-[W]WW-E",/\d{4}-W\d\d-\d/],["GGGG-[W]WW",/\d{4}-W\d\d/,!1],["YYYY-DDD",/\d{4}-\d{3}/],["YYYY-MM",/\d{4}-\d\d/,!1],["YYYYYYMMDD",/[+-]\d{10}/],["YYYYMMDD",/\d{8}/],["GGGG[W]WWE",/\d{4}W\d{3}/],["GGGG[W]WW",/\d{4}W\d{2}/,!1],["YYYYDDD",/\d{7}/]],Nn=[["HH:mm:ss.SSSS",/\d\d:\d\d:\d\d\.\d+/],["HH:mm:ss,SSSS",/\d\d:\d\d:\d\d,\d+/],["HH:mm:ss",/\d\d:\d\d:\d\d/],["HH:mm",/\d\d:\d\d/],["HHmmss.SSSS",/\d\d\d\d\d\d\.\d+/],["HHmmss,SSSS",/\d\d\d\d\d\d,\d+/],["HHmmss",/\d\d\d\d\d\d/],["HHmm",/\d\d\d\d/],["HH",/\d\d/]],zn=/^\/?Date\((\-?\d+)/i,Bn=/^((?:Mon|Tue|Wed|Thu|Fri|Sat|Sun),?\s)?(\d?\d\s(?:Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)\s(?:\d\d)?\d\d\s)(\d\d:\d\d)(\:\d\d)?(\s(?:UT|GMT|[ECMP][SD]T|[A-IK-Za-ik-z]|[+-]\d{4}))$/;n.createFromInputFallback=M("value provided is not in a recognized RFC2822 or ISO format. moment construction falls back to js Date(), which is not reliable across all browsers and versions. Non RFC2822/ISO date formats are discouraged and will be removed in an upcoming major release. Please refer to http://momentjs.com/guides/#/warnings/js-date/ for more info.",function(t){t._d=new Date(t._i+(t._useUTC?" UTC":""))}),n.ISO_8601=function(){},n.RFC_2822=function(){};var Vn=M("moment().min is deprecated, use moment.max instead. http://momentjs.com/guides/#/warnings/min-max/",function(){var t=Nt.apply(null,arguments);return this.isValid()&&t.isValid()?tthis?this:t:p()}),En=["year","quarter","month","week","day","hour","minute","second","millisecond"];jt("Z",":"),jt("ZZ",""),E("Z",$e),E("ZZ",$e),G(["Z","ZZ"],function(t,e,n){n._useUTC=!0,n._tzm=Ut($e,t)});var jn=/([\+\-]|\d\d)/gi;n.updateOffset=function(){};var Un=/^(\-)?(?:(\d*)[. ])?(\d+)\:(\d+)(?:\:(\d+)(\.\d*)?)?$/,qn=/^(-)?P(?:(-?[0-9,.]*)Y)?(?:(-?[0-9,.]*)M)?(?:(-?[0-9,.]*)W)?(?:(-?[0-9,.]*)D)?(?:T(?:(-?[0-9,.]*)H)?(?:(-?[0-9,.]*)M)?(?:(-?[0-9,.]*)S)?)?$/;Xt.fn=Vt.prototype,Xt.invalid=function(){return Xt(NaN)};var Gn=$t(1,"add"),Zn=$t(-1,"subtract");n.defaultFormat="YYYY-MM-DDTHH:mm:ssZ",n.defaultFormatUtc="YYYY-MM-DDTHH:mm:ss[Z]";var Xn=M("moment().lang() is deprecated. Instead, use moment().localeData() to get the language configuration. Use moment().locale() to change languages.",function(t){return void 0===t?this.localeData():this.locale(t)});N(0,["gg",2],0,function(){return this.weekYear()%100}),N(0,["GG",2],0,function(){return this.isoWeekYear()%100}),ae("gggg","weekYear"),ae("ggggg","weekYear"),ae("GGGG","isoWeekYear"),ae("GGGGG","isoWeekYear"),T("weekYear","gg"),T("isoWeekYear","GG"),O("weekYear",1),O("isoWeekYear",1),E("G",Ke),E("g",Ke),E("GG",je,Be),E("gg",je,Be),E("GGGG",Ze,He),E("gggg",Ze,He),E("GGGGG",Xe,Ee),E("ggggg",Xe,Ee),Z(["gggg","ggggg","GGGG","GGGGG"],function(t,e,n,i){e[i.substr(0,2)]=_(t)}),Z(["gg","GG"],function(t,e,i,a){e[a]=n.parseTwoDigitYear(t)}),N("Q",0,"Qo","quarter"),T("quarter","Q"),O("quarter",7),E("Q",ze),G("Q",function(t,e){e[on]=3*(_(t)-1)}),N("D",["DD",2],"Do","date"),T("date","D"),O("date",9),E("D",je),E("DD",je,Be),E("Do",function(t,e){return t?e._dayOfMonthOrdinalParse||e._ordinalParse:e._dayOfMonthOrdinalParseLenient}),G(["D","DD"],sn),G("Do",function(t,e){e[sn]=_(t.match(je)[0],10)});var Jn=R("Date",!0);N("DDD",["DDDD",3],"DDDo","dayOfYear"),T("dayOfYear","DDD"),O("dayOfYear",4),E("DDD",Ge),E("DDDD",Ve),G(["DDD","DDDD"],function(t,e,n){n._dayOfYear=_(t)}),N("m",["mm",2],0,"minute"),T("minute","m"),O("minute",14),E("m",je),E("mm",je,Be),G(["m","mm"],un);var Kn=R("Minutes",!1);N("s",["ss",2],0,"second"),T("second","s"),O("second",15),E("s",je),E("ss",je,Be),G(["s","ss"],dn);var Qn=R("Seconds",!1);N("S",0,0,function(){return~~(this.millisecond()/100)}),N(0,["SS",2],0,function(){return~~(this.millisecond()/10)}),N(0,["SSS",3],0,"millisecond"),N(0,["SSSS",4],0,function(){return 10*this.millisecond()}),N(0,["SSSSS",5],0,function(){return 100*this.millisecond()}),N(0,["SSSSSS",6],0,function(){return 1e3*this.millisecond()}),N(0,["SSSSSSS",7],0,function(){return 1e4*this.millisecond()}),N(0,["SSSSSSSS",8],0,function(){return 1e5*this.millisecond()}),N(0,["SSSSSSSSS",9],0,function(){return 1e6*this.millisecond()}),T("millisecond","ms"),O("millisecond",16),E("S",Ge,ze),E("SS",Ge,Be),E("SSS",Ge,Ve);var $n;for($n="SSSS";$n.length<=9;$n+="S")E($n,Je);for($n="S";$n.length<=9;$n+="S")G($n,function(t,e){e[cn]=_(1e3*("0."+t))});var ti=R("Milliseconds",!1);N("z",0,0,"zoneAbbr"),N("zz",0,0,"zoneName");var ei=y.prototype;ei.add=Gn,ei.calendar=function(t,e){var i=t||Nt(),a=qt(i,this).startOf("day"),r=n.calendarFormat(this,a)||"sameElse",o=e&&(D(e[r])?e[r].call(this,i):e[r]);return this.format(o||this.localeData().calendar(r,this,Nt(i)))},ei.clone=function(){return new y(this)},ei.diff=function(t,e,n){var i,a,r,o;return this.isValid()&&(i=qt(t,this)).isValid()?(a=6e4*(i.utcOffset()-this.utcOffset()),"year"===(e=I(e))||"month"===e||"quarter"===e?(o=ee(this,i),"quarter"===e?o/=3:"year"===e&&(o/=12)):(r=this-i,o="second"===e?r/1e3:"minute"===e?r/6e4:"hour"===e?r/36e5:"day"===e?(r-a)/864e5:"week"===e?(r-a)/6048e5:r),n?o:x(o)):NaN},ei.endOf=function(t){return void 0===(t=I(t))||"millisecond"===t?this:("date"===t&&(t="day"),this.startOf(t).add(1,"isoWeek"===t?"week":t).subtract(1,"ms"))},ei.format=function(t){t||(t=this.isUtc()?n.defaultFormatUtc:n.defaultFormat);var e=V(this,t);return this.localeData().postformat(e)},ei.from=function(t,e){return this.isValid()&&(b(t)&&t.isValid()||Nt(t).isValid())?Xt({to:this,from:t}).locale(this.locale()).humanize(!e):this.localeData().invalidDate()},ei.fromNow=function(t){return this.from(Nt(),t)},ei.to=function(t,e){return this.isValid()&&(b(t)&&t.isValid()||Nt(t).isValid())?Xt({from:this,to:t}).locale(this.locale()).humanize(!e):this.localeData().invalidDate()},ei.toNow=function(t){return this.to(Nt(),t)},ei.get=function(t){return t=I(t),D(this[t])?this[t]():this},ei.invalidAt=function(){return g(this).overflow},ei.isAfter=function(t,e){var n=b(t)?t:Nt(t);return!(!this.isValid()||!n.isValid())&&("millisecond"===(e=I(o(e)?"millisecond":e))?this.valueOf()>n.valueOf():n.valueOf()9999?V(t,"YYYYYY-MM-DD[T]HH:mm:ss.SSS[Z]"):D(Date.prototype.toISOString)?this.toDate().toISOString():V(t,"YYYY-MM-DD[T]HH:mm:ss.SSS[Z]")},ei.inspect=function(){if(!this.isValid())return"moment.invalid(/* "+this._i+" */)";var t="moment",e="";this.isLocal()||(t=0===this.utcOffset()?"moment.utc":"moment.parseZone",e="Z");var n="["+t+'("]',i=0<=this.year()&&this.year()<=9999?"YYYY":"YYYYYY",a=e+'[")]';return this.format(n+i+"-MM-DD[T]HH:mm:ss.SSS"+a)},ei.toJSON=function(){return this.isValid()?this.toISOString():null},ei.toString=function(){return this.clone().locale("en").format("ddd MMM DD YYYY HH:mm:ss [GMT]ZZ")},ei.unix=function(){return Math.floor(this.valueOf()/1e3)},ei.valueOf=function(){return this._d.valueOf()-6e4*(this._offset||0)},ei.creationData=function(){return{input:this._i,format:this._f,locale:this._locale,isUTC:this._isUTC,strict:this._strict}},ei.year=xn,ei.isLeapYear=function(){return nt(this.year())},ei.weekYear=function(t){return re.call(this,t,this.week(),this.weekday(),this.localeData()._week.dow,this.localeData()._week.doy)},ei.isoWeekYear=function(t){return re.call(this,t,this.isoWeek(),this.isoWeekday(),1,4)},ei.quarter=ei.quarters=function(t){return null==t?Math.ceil((this.month()+1)/3):this.month(3*(t-1)+this.month()%3)},ei.month=$,ei.daysInMonth=function(){return J(this.year(),this.month())},ei.week=ei.weeks=function(t){var e=this.localeData().week(this);return null==t?e:this.add(7*(t-e),"d")},ei.isoWeek=ei.isoWeeks=function(t){var e=st(this,1,4).week;return null==t?e:this.add(7*(t-e),"d")},ei.weeksInYear=function(){var t=this.localeData()._week;return lt(this.year(),t.dow,t.doy)},ei.isoWeeksInYear=function(){return lt(this.year(),1,4)},ei.date=Jn,ei.day=ei.days=function(t){if(!this.isValid())return null!=t?this:NaN;var e=this._isUTC?this._d.getUTCDay():this._d.getDay();return null!=t?(t=ut(t,this.localeData()),this.add(t-e,"d")):e},ei.weekday=function(t){if(!this.isValid())return null!=t?this:NaN;var e=(this.day()+7-this.localeData()._week.dow)%7;return null==t?e:this.add(t-e,"d")},ei.isoWeekday=function(t){if(!this.isValid())return null!=t?this:NaN;if(null!=t){var e=dt(t,this.localeData());return this.day(this.day()%7?e:e-7)}return this.day()||7},ei.dayOfYear=function(t){var e=Math.round((this.clone().startOf("day")-this.clone().startOf("year"))/864e5)+1;return null==t?e:this.add(t-e,"d")},ei.hour=ei.hours=In,ei.minute=ei.minutes=Kn,ei.second=ei.seconds=Qn,ei.millisecond=ei.milliseconds=ti,ei.utcOffset=function(t,e,i){var a,r=this._offset||0;if(!this.isValid())return null!=t?this:NaN;if(null!=t){if("string"==typeof t){if(null===(t=Ut($e,t)))return this}else Math.abs(t)<16&&!i&&(t*=60);return!this._isUTC&&e&&(a=Gt(this)),this._offset=t,this._isUTC=!0,null!=a&&this.add(a,"m"),r!==t&&(!e||this._changeInProgress?te(this,Xt(t-r,"m"),1,!1):this._changeInProgress||(this._changeInProgress=!0,n.updateOffset(this,!0),this._changeInProgress=null)),this}return this._isUTC?r:Gt(this)},ei.utc=function(t){return this.utcOffset(0,t)},ei.local=function(t){return this._isUTC&&(this.utcOffset(0,t),this._isUTC=!1,t&&this.subtract(Gt(this),"m")),this},ei.parseZone=function(){if(null!=this._tzm)this.utcOffset(this._tzm,!1,!0);else if("string"==typeof this._i){var t=Ut(Qe,this._i);null!=t?this.utcOffset(t):this.utcOffset(0,!0)}return this},ei.hasAlignedHourOffset=function(t){return!!this.isValid()&&(t=t?Nt(t).utcOffset():0,(this.utcOffset()-t)%60==0)},ei.isDST=function(){return this.utcOffset()>this.clone().month(0).utcOffset()||this.utcOffset()>this.clone().month(5).utcOffset()},ei.isLocal=function(){return!!this.isValid()&&!this._isUTC},ei.isUtcOffset=function(){return!!this.isValid()&&this._isUTC},ei.isUtc=Zt,ei.isUTC=Zt,ei.zoneAbbr=function(){return this._isUTC?"UTC":""},ei.zoneName=function(){return this._isUTC?"Coordinated Universal Time":""},ei.dates=M("dates accessor is deprecated. Use date instead.",Jn),ei.months=M("months accessor is deprecated. Use month instead",$),ei.years=M("years accessor is deprecated. Use year instead",xn),ei.zone=M("moment().zone is deprecated, use moment().utcOffset instead. http://momentjs.com/guides/#/warnings/zone/",function(t,e){return null!=t?("string"!=typeof t&&(t=-t),this.utcOffset(t,e),this):-this.utcOffset()}),ei.isDSTShifted=M("isDSTShifted is deprecated. See http://momentjs.com/guides/#/warnings/dst-shifted/ for more information",function(){if(!o(this._isDSTShifted))return this._isDSTShifted;var t={};if(v(t,this),(t=Lt(t))._a){var e=t._isUTC?h(t._a):Nt(t._a);this._isDSTShifted=this.isValid()&&k(t._a,e.toArray())>0}else this._isDSTShifted=!1;return this._isDSTShifted});var ni=P.prototype;ni.calendar=function(t,e,n){var i=this._calendar[t]||this._calendar.sameElse;return D(i)?i.call(e,n):i},ni.longDateFormat=function(t){var e=this._longDateFormat[t],n=this._longDateFormat[t.toUpperCase()];return e||!n?e:(this._longDateFormat[t]=n.replace(/MMMM|MM|DD|dddd/g,function(t){return t.slice(1)}),this._longDateFormat[t])},ni.invalidDate=function(){return this._invalidDate},ni.ordinal=function(t){return this._ordinal.replace("%d",t)},ni.preparse=se,ni.postformat=se,ni.relativeTime=function(t,e,n,i){var a=this._relativeTime[n];return D(a)?a(t,e,n,i):a.replace(/%d/i,t)},ni.pastFuture=function(t,e){var n=this._relativeTime[t>0?"future":"past"];return D(n)?n(e):n.replace(/%s/i,e)},ni.set=function(t){var e,n;for(n in t)D(e=t[n])?this[n]=e:this["_"+n]=e;this._config=t,this._dayOfMonthOrdinalParseLenient=new RegExp((this._dayOfMonthOrdinalParse.source||this._ordinalParse.source)+"|"+/\d{1,2}/.source)},ni.months=function(t,e){return t?i(this._months)?this._months[t.month()]:this._months[(this._months.isFormat||mn).test(e)?"format":"standalone"][t.month()]:i(this._months)?this._months:this._months.standalone},ni.monthsShort=function(t,e){return t?i(this._monthsShort)?this._monthsShort[t.month()]:this._monthsShort[mn.test(e)?"format":"standalone"][t.month()]:i(this._monthsShort)?this._monthsShort:this._monthsShort.standalone},ni.monthsParse=function(t,e,n){var i,a,r;if(this._monthsParseExact)return K.call(this,t,e,n);for(this._monthsParse||(this._monthsParse=[],this._longMonthsParse=[],this._shortMonthsParse=[]),i=0;i<12;i++){if(a=h([2e3,i]),n&&!this._longMonthsParse[i]&&(this._longMonthsParse[i]=new RegExp("^"+this.months(a,"").replace(".","")+"$","i"),this._shortMonthsParse[i]=new RegExp("^"+this.monthsShort(a,"").replace(".","")+"$","i")),n||this._monthsParse[i]||(r="^"+this.months(a,"")+"|^"+this.monthsShort(a,""),this._monthsParse[i]=new RegExp(r.replace(".",""),"i")),n&&"MMMM"===e&&this._longMonthsParse[i].test(t))return i;if(n&&"MMM"===e&&this._shortMonthsParse[i].test(t))return i;if(!n&&this._monthsParse[i].test(t))return i}},ni.monthsRegex=function(t){return this._monthsParseExact?(d(this,"_monthsRegex")||tt.call(this),t?this._monthsStrictRegex:this._monthsRegex):(d(this,"_monthsRegex")||(this._monthsRegex=bn),this._monthsStrictRegex&&t?this._monthsStrictRegex:this._monthsRegex)},ni.monthsShortRegex=function(t){return this._monthsParseExact?(d(this,"_monthsRegex")||tt.call(this),t?this._monthsShortStrictRegex:this._monthsShortRegex):(d(this,"_monthsShortRegex")||(this._monthsShortRegex=yn),this._monthsShortStrictRegex&&t?this._monthsShortStrictRegex:this._monthsShortRegex)},ni.week=function(t){return st(t,this._week.dow,this._week.doy).week},ni.firstDayOfYear=function(){return this._week.doy},ni.firstDayOfWeek=function(){return this._week.dow},ni.weekdays=function(t,e){return t?i(this._weekdays)?this._weekdays[t.day()]:this._weekdays[this._weekdays.isFormat.test(e)?"format":"standalone"][t.day()]:i(this._weekdays)?this._weekdays:this._weekdays.standalone},ni.weekdaysMin=function(t){return t?this._weekdaysMin[t.day()]:this._weekdaysMin},ni.weekdaysShort=function(t){return t?this._weekdaysShort[t.day()]:this._weekdaysShort},ni.weekdaysParse=function(t,e,n){var i,a,r;if(this._weekdaysParseExact)return ct.call(this,t,e,n);for(this._weekdaysParse||(this._weekdaysParse=[],this._minWeekdaysParse=[],this._shortWeekdaysParse=[],this._fullWeekdaysParse=[]),i=0;i<7;i++){if(a=h([2e3,1]).day(i),n&&!this._fullWeekdaysParse[i]&&(this._fullWeekdaysParse[i]=new RegExp("^"+this.weekdays(a,"").replace(".",".?")+"$","i"),this._shortWeekdaysParse[i]=new RegExp("^"+this.weekdaysShort(a,"").replace(".",".?")+"$","i"),this._minWeekdaysParse[i]=new RegExp("^"+this.weekdaysMin(a,"").replace(".",".?")+"$","i")),this._weekdaysParse[i]||(r="^"+this.weekdays(a,"")+"|^"+this.weekdaysShort(a,"")+"|^"+this.weekdaysMin(a,""),this._weekdaysParse[i]=new RegExp(r.replace(".",""),"i")),n&&"dddd"===e&&this._fullWeekdaysParse[i].test(t))return i;if(n&&"ddd"===e&&this._shortWeekdaysParse[i].test(t))return i;if(n&&"dd"===e&&this._minWeekdaysParse[i].test(t))return i;if(!n&&this._weekdaysParse[i].test(t))return i}},ni.weekdaysRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysStrictRegex:this._weekdaysRegex):(d(this,"_weekdaysRegex")||(this._weekdaysRegex=Sn),this._weekdaysStrictRegex&&t?this._weekdaysStrictRegex:this._weekdaysRegex)},ni.weekdaysShortRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysShortStrictRegex:this._weekdaysShortRegex):(d(this,"_weekdaysShortRegex")||(this._weekdaysShortRegex=Dn),this._weekdaysShortStrictRegex&&t?this._weekdaysShortStrictRegex:this._weekdaysShortRegex)},ni.weekdaysMinRegex=function(t){return this._weekdaysParseExact?(d(this,"_weekdaysRegex")||ht.call(this),t?this._weekdaysMinStrictRegex:this._weekdaysMinRegex):(d(this,"_weekdaysMinRegex")||(this._weekdaysMinRegex=Cn),this._weekdaysMinStrictRegex&&t?this._weekdaysMinStrictRegex:this._weekdaysMinRegex)},ni.isPM=function(t){return"p"===(t+"").toLowerCase().charAt(0)},ni.meridiem=function(t,e,n){return t>11?n?"pm":"PM":n?"am":"AM"},bt("en",{dayOfMonthOrdinalParse:/\d{1,2}(th|st|nd|rd)/,ordinal:function(t){var e=t%10;return t+(1===_(t%100/10)?"th":1===e?"st":2===e?"nd":3===e?"rd":"th")}}),n.lang=M("moment.lang is deprecated. Use moment.locale instead.",bt),n.langData=M("moment.langData is deprecated. Use moment.localeData instead.",_t);var ii=Math.abs,ai=me("ms"),ri=me("s"),oi=me("m"),si=me("h"),li=me("d"),ui=me("w"),di=me("M"),ci=me("y"),hi=pe("milliseconds"),fi=pe("seconds"),gi=pe("minutes"),mi=pe("hours"),pi=pe("days"),vi=pe("months"),yi=pe("years"),bi=Math.round,xi={ss:44,s:45,m:45,h:22,d:26,M:11},_i=Math.abs,ki=Vt.prototype;return ki.isValid=function(){return this._isValid},ki.abs=function(){var t=this._data;return this._milliseconds=ii(this._milliseconds),this._days=ii(this._days),this._months=ii(this._months),t.milliseconds=ii(t.milliseconds),t.seconds=ii(t.seconds),t.minutes=ii(t.minutes),t.hours=ii(t.hours),t.months=ii(t.months),t.years=ii(t.years),this},ki.add=function(t,e){return ce(this,t,e,1)},ki.subtract=function(t,e){return ce(this,t,e,-1)},ki.as=function(t){if(!this.isValid())return NaN;var e,n,i=this._milliseconds;if("month"===(t=I(t))||"year"===t)return e=this._days+i/864e5,n=this._months+fe(e),"month"===t?n:n/12;switch(e=this._days+Math.round(ge(this._months)),t){case"week":return e/7+i/6048e5;case"day":return e+i/864e5;case"hour":return 24*e+i/36e5;case"minute":return 1440*e+i/6e4;case"second":return 86400*e+i/1e3;case"millisecond":return Math.floor(864e5*e)+i;default:throw new Error("Unknown unit "+t)}},ki.asMilliseconds=ai,ki.asSeconds=ri,ki.asMinutes=oi,ki.asHours=si,ki.asDays=li,ki.asWeeks=ui,ki.asMonths=di,ki.asYears=ci,ki.valueOf=function(){return this.isValid()?this._milliseconds+864e5*this._days+this._months%12*2592e6+31536e6*_(this._months/12):NaN},ki._bubble=function(){var t,e,n,i,a,r=this._milliseconds,o=this._days,s=this._months,l=this._data;return r>=0&&o>=0&&s>=0||r<=0&&o<=0&&s<=0||(r+=864e5*he(ge(s)+o),o=0,s=0),l.milliseconds=r%1e3,t=x(r/1e3),l.seconds=t%60,e=x(t/60),l.minutes=e%60,n=x(e/60),l.hours=n%24,o+=x(n/24),a=x(fe(o)),s+=a,o-=he(ge(a)),i=x(s/12),s%=12,l.days=o,l.months=s,l.years=i,this},ki.get=function(t){return t=I(t),this.isValid()?this[t+"s"]():NaN},ki.milliseconds=hi,ki.seconds=fi,ki.minutes=gi,ki.hours=mi,ki.days=pi,ki.weeks=function(){return x(this.days()/7)},ki.months=vi,ki.years=yi,ki.humanize=function(t){if(!this.isValid())return this.localeData().invalidDate();var e=this.localeData(),n=ye(this,!t,e);return t&&(n=e.pastFuture(+this,n)),e.postformat(n)},ki.toISOString=be,ki.toString=be,ki.toJSON=be,ki.locale=ne,ki.localeData=ie,ki.toIsoString=M("toIsoString() is deprecated. Please use toISOString() instead (notice the capitals)",be),ki.lang=Xn,N("X",0,0,"unix"),N("x",0,0,"valueOf"),E("x",Ke),E("X",tn),G("X",function(t,e,n){n._d=new Date(1e3*parseFloat(t,10))}),G("x",function(t,e,n){n._d=new Date(_(t))}),n.version="2.18.1",function(t){xe=t}(Nt),n.fn=ei,n.min=function(){return zt("isBefore",[].slice.call(arguments,0))},n.max=function(){return zt("isAfter",[].slice.call(arguments,0))},n.now=function(){return Date.now?Date.now():+new Date},n.utc=h,n.unix=function(t){return Nt(1e3*t)},n.months=function(t,e){return ue(t,e,"months")},n.isDate=l,n.locale=bt,n.invalid=p,n.duration=Xt,n.isMoment=b,n.weekdays=function(t,e,n){return de(t,e,n,"weekdays")},n.parseZone=function(){return Nt.apply(null,arguments).parseZone()},n.localeData=_t,n.isDuration=Ht,n.monthsShort=function(t,e){return ue(t,e,"monthsShort")},n.weekdaysMin=function(t,e,n){return de(t,e,n,"weekdaysMin")},n.defineLocale=xt,n.updateLocale=function(t,e){if(null!=e){var n,i=An;null!=On[t]&&(i=On[t]._config),(n=new P(e=C(i,e))).parentLocale=On[t],On[t]=n,bt(t)}else null!=On[t]&&(null!=On[t].parentLocale?On[t]=On[t].parentLocale:null!=On[t]&&delete On[t]);return On[t]},n.locales=function(){return Pe(On)},n.weekdaysShort=function(t,e,n){return de(t,e,n,"weekdaysShort")},n.normalizeUnits=I,n.relativeTimeRounding=function(t){return void 0===t?bi:"function"==typeof t&&(bi=t,!0)},n.relativeTimeThreshold=function(t,e){return void 0!==xi[t]&&(void 0===e?xi[t]:(xi[t]=e,"s"===t&&(xi.ss=e-1),!0))},n.calendarFormat=function(t,e){var n=t.diff(e,"days",!0);return n<-6?"sameElse":n<-1?"lastWeek":n<0?"lastDay":n<1?"sameDay":n<2?"nextDay":n<7?"nextWeek":"sameElse"},n.prototype=ei,n})},{}],7:[function(t,e,n){var i=t(29)();i.helpers=t(45),t(27)(i),i.defaults=t(25),i.Element=t(26),i.elements=t(40),i.Interaction=t(28),i.platform=t(48),t(31)(i),t(22)(i),t(23)(i),t(24)(i),t(30)(i),t(33)(i),t(32)(i),t(35)(i),t(54)(i),t(52)(i),t(53)(i),t(55)(i),t(56)(i),t(57)(i),t(15)(i),t(16)(i),t(17)(i),t(18)(i),t(19)(i),t(20)(i),t(21)(i),t(8)(i),t(9)(i),t(10)(i),t(11)(i),t(12)(i),t(13)(i),t(14)(i);var a=[];a.push(t(49)(i),t(50)(i),t(51)(i)),i.plugins.register(a),i.platform.initialize(),e.exports=i,"undefined"!=typeof window&&(window.Chart=i),i.canvasHelpers=i.helpers.canvas},{10:10,11:11,12:12,13:13,14:14,15:15,16:16,17:17,18:18,19:19,20:20,21:21,22:22,23:23,24:24,25:25,26:26,27:27,28:28,29:29,30:30,31:31,32:32,33:33,35:35,40:40,45:45,48:48,49:49,50:50,51:51,52:52,53:53,54:54,55:55,56:56,57:57,8:8,9:9}],8:[function(t,e,n){"use strict";e.exports=function(t){t.Bar=function(e,n){return n.type="bar",new t(e,n)}}},{}],9:[function(t,e,n){"use strict";e.exports=function(t){t.Bubble=function(e,n){return n.type="bubble",new t(e,n)}}},{}],10:[function(t,e,n){"use strict";e.exports=function(t){t.Doughnut=function(e,n){return n.type="doughnut",new t(e,n)}}},{}],11:[function(t,e,n){"use strict";e.exports=function(t){t.Line=function(e,n){return n.type="line",new t(e,n)}}},{}],12:[function(t,e,n){"use strict";e.exports=function(t){t.PolarArea=function(e,n){return n.type="polarArea",new t(e,n)}}},{}],13:[function(t,e,n){"use strict";e.exports=function(t){t.Radar=function(e,n){return n.type="radar",new t(e,n)}}},{}],14:[function(t,e,n){"use strict";e.exports=function(t){t.Scatter=function(e,n){return n.type="scatter",new t(e,n)}}},{}],15:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("bar",{hover:{mode:"label"},scales:{xAxes:[{type:"category",categoryPercentage:.8,barPercentage:.9,offset:!0,gridLines:{offsetGridLines:!0}}],yAxes:[{type:"linear"}]}}),i._set("horizontalBar",{hover:{mode:"index",axis:"y"},scales:{xAxes:[{type:"linear",position:"bottom"}],yAxes:[{position:"left",type:"category",categoryPercentage:.8,barPercentage:.9,offset:!0,gridLines:{offsetGridLines:!0}}]},elements:{rectangle:{borderSkipped:"left"}},tooltips:{callbacks:{title:function(t,e){var n="";return t.length>0&&(t[0].yLabel?n=t[0].yLabel:e.labels.length>0&&t[0].index=0&&a>0)&&(p+=a));return r=c.getPixelForValue(p),o=c.getPixelForValue(p+f),s=(o-r)/2,{size:s,base:r,head:o,center:o+s/2}},calculateBarIndexPixels:function(t,e,n){var i,a,o,s,l,u,d=this,c=n.scale.options,h=d.getStackIndex(t),f=n.pixels,g=f[e],m=f.length,p=n.start,v=n.end;return 1===m?(i=g>p?g-p:v-g,a=g0&&(i=(g-f[e-1])/2,e===m-1&&(a=i)),e');var n=t.data,i=n.datasets,a=n.labels;if(i.length)for(var r=0;r'),a[r]&&e.push(a[r]),e.push("");return e.push(""),e.join("")},legend:{labels:{generateLabels:function(t){var e=t.data;return e.labels.length&&e.datasets.length?e.labels.map(function(n,i){var a=t.getDatasetMeta(0),o=e.datasets[0],s=a.data[i],l=s&&s.custom||{},u=r.valueAtIndexOrDefault,d=t.options.elements.arc;return{text:n,fillStyle:l.backgroundColor?l.backgroundColor:u(o.backgroundColor,i,d.backgroundColor),strokeStyle:l.borderColor?l.borderColor:u(o.borderColor,i,d.borderColor),lineWidth:l.borderWidth?l.borderWidth:u(o.borderWidth,i,d.borderWidth),hidden:isNaN(o.data[i])||a.data[i].hidden,index:i}}):[]}},onClick:function(t,e){var n,i,a,r=e.index,o=this.chart;for(n=0,i=(o.data.datasets||[]).length;n=Math.PI?-1:g<-Math.PI?1:0))+f,p={x:Math.cos(g),y:Math.sin(g)},v={x:Math.cos(m),y:Math.sin(m)},y=g<=0&&m>=0||g<=2*Math.PI&&2*Math.PI<=m,b=g<=.5*Math.PI&&.5*Math.PI<=m||g<=2.5*Math.PI&&2.5*Math.PI<=m,x=g<=-Math.PI&&-Math.PI<=m||g<=Math.PI&&Math.PI<=m,_=g<=.5*-Math.PI&&.5*-Math.PI<=m||g<=1.5*Math.PI&&1.5*Math.PI<=m,k=h/100,w={x:x?-1:Math.min(p.x*(p.x<0?1:k),v.x*(v.x<0?1:k)),y:_?-1:Math.min(p.y*(p.y<0?1:k),v.y*(v.y<0?1:k))},M={x:y?1:Math.max(p.x*(p.x>0?1:k),v.x*(v.x>0?1:k)),y:b?1:Math.max(p.y*(p.y>0?1:k),v.y*(v.y>0?1:k))},S={width:.5*(M.x-w.x),height:.5*(M.y-w.y)};u=Math.min(s/S.width,l/S.height),d={x:-.5*(M.x+w.x),y:-.5*(M.y+w.y)}}n.borderWidth=e.getMaxBorderWidth(c.data),n.outerRadius=Math.max((u-n.borderWidth)/2,0),n.innerRadius=Math.max(h?n.outerRadius/100*h:0,0),n.radiusLength=(n.outerRadius-n.innerRadius)/n.getVisibleDatasetCount(),n.offsetX=d.x*n.outerRadius,n.offsetY=d.y*n.outerRadius,c.total=e.calculateTotal(),e.outerRadius=n.outerRadius-n.radiusLength*e.getRingIndex(e.index),e.innerRadius=Math.max(e.outerRadius-n.radiusLength,0),r.each(c.data,function(n,i){e.updateElement(n,i,t)})},updateElement:function(t,e,n){var i=this,a=i.chart,o=a.chartArea,s=a.options,l=s.animation,u=(o.left+o.right)/2,d=(o.top+o.bottom)/2,c=s.rotation,h=s.rotation,f=i.getDataset(),g=n&&l.animateRotate?0:t.hidden?0:i.calculateCircumference(f.data[e])*(s.circumference/(2*Math.PI)),m=n&&l.animateScale?0:i.innerRadius,p=n&&l.animateScale?0:i.outerRadius,v=r.valueAtIndexOrDefault;r.extend(t,{_datasetIndex:i.index,_index:e,_model:{x:u+a.offsetX,y:d+a.offsetY,startAngle:c,endAngle:h,circumference:g,outerRadius:p,innerRadius:m,label:v(f.label,e,a.data.labels[e])}});var y=t._model;this.removeHoverStyle(t),n&&l.animateRotate||(y.startAngle=0===e?s.rotation:i.getMeta().data[e-1]._model.endAngle,y.endAngle=y.startAngle+y.circumference),t.pivot()},removeHoverStyle:function(e){t.DatasetController.prototype.removeHoverStyle.call(this,e,this.chart.options.elements.arc)},calculateTotal:function(){var t,e=this.getDataset(),n=this.getMeta(),i=0;return r.each(n.data,function(n,a){t=e.data[a],isNaN(t)||n.hidden||(i+=Math.abs(t))}),i},calculateCircumference:function(t){var e=this.getMeta().total;return e>0&&!isNaN(t)?2*Math.PI*(t/e):0},getMaxBorderWidth:function(t){for(var e,n,i=0,a=this.index,r=t.length,o=0;o(i=e>i?e:i)?n:i;return i}})}},{25:25,40:40,45:45}],18:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("line",{showLines:!0,spanGaps:!1,hover:{mode:"label"},scales:{xAxes:[{type:"category",id:"x-axis-0"}],yAxes:[{type:"linear",id:"y-axis-0"}]}}),e.exports=function(t){function e(t,e){return r.valueOrDefault(t.showLine,e.showLines)}t.controllers.line=t.DatasetController.extend({datasetElementType:a.Line,dataElementType:a.Point,update:function(t){var n,i,a,o=this,s=o.getMeta(),l=s.dataset,u=s.data||[],d=o.chart.options,c=d.elements.line,h=o.getScaleForId(s.yAxisID),f=o.getDataset(),g=e(f,d);for(g&&(a=l.custom||{},void 0!==f.tension&&void 0===f.lineTension&&(f.lineTension=f.tension),l._scale=h,l._datasetIndex=o.index,l._children=u,l._model={spanGaps:f.spanGaps?f.spanGaps:d.spanGaps,tension:a.tension?a.tension:r.valueOrDefault(f.lineTension,c.tension),backgroundColor:a.backgroundColor?a.backgroundColor:f.backgroundColor||c.backgroundColor,borderWidth:a.borderWidth?a.borderWidth:f.borderWidth||c.borderWidth,borderColor:a.borderColor?a.borderColor:f.borderColor||c.borderColor,borderCapStyle:a.borderCapStyle?a.borderCapStyle:f.borderCapStyle||c.borderCapStyle,borderDash:a.borderDash?a.borderDash:f.borderDash||c.borderDash,borderDashOffset:a.borderDashOffset?a.borderDashOffset:f.borderDashOffset||c.borderDashOffset,borderJoinStyle:a.borderJoinStyle?a.borderJoinStyle:f.borderJoinStyle||c.borderJoinStyle,fill:a.fill?a.fill:void 0!==f.fill?f.fill:c.fill,steppedLine:a.steppedLine?a.steppedLine:r.valueOrDefault(f.steppedLine,c.stepped),cubicInterpolationMode:a.cubicInterpolationMode?a.cubicInterpolationMode:r.valueOrDefault(f.cubicInterpolationMode,c.cubicInterpolationMode)},l.pivot()),n=0,i=u.length;n');var n=t.data,i=n.datasets,a=n.labels;if(i.length)for(var r=0;r'),a[r]&&e.push(a[r]),e.push("");return e.push(""),e.join("")},legend:{labels:{generateLabels:function(t){var e=t.data;return e.labels.length&&e.datasets.length?e.labels.map(function(n,i){var a=t.getDatasetMeta(0),o=e.datasets[0],s=a.data[i].custom||{},l=r.valueAtIndexOrDefault,u=t.options.elements.arc;return{text:n,fillStyle:s.backgroundColor?s.backgroundColor:l(o.backgroundColor,i,u.backgroundColor),strokeStyle:s.borderColor?s.borderColor:l(o.borderColor,i,u.borderColor),lineWidth:s.borderWidth?s.borderWidth:l(o.borderWidth,i,u.borderWidth),hidden:isNaN(o.data[i])||a.data[i].hidden,index:i}}):[]}},onClick:function(t,e){var n,i,a,r=e.index,o=this.chart;for(n=0,i=(o.data.datasets||[]).length;n0&&!isNaN(t)?2*Math.PI/e:0}})}},{25:25,40:40,45:45}],20:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("radar",{scale:{type:"radialLinear"},elements:{line:{tension:0}}}),e.exports=function(t){t.controllers.radar=t.DatasetController.extend({datasetElementType:a.Line,dataElementType:a.Point,linkScales:r.noop,update:function(t){var e=this,n=e.getMeta(),i=n.dataset,a=n.data,o=i.custom||{},s=e.getDataset(),l=e.chart.options.elements.line,u=e.chart.scale;void 0!==s.tension&&void 0===s.lineTension&&(s.lineTension=s.tension),r.extend(n.dataset,{_datasetIndex:e.index,_scale:u,_children:a,_loop:!0,_model:{tension:o.tension?o.tension:r.valueOrDefault(s.lineTension,l.tension),backgroundColor:o.backgroundColor?o.backgroundColor:s.backgroundColor||l.backgroundColor,borderWidth:o.borderWidth?o.borderWidth:s.borderWidth||l.borderWidth,borderColor:o.borderColor?o.borderColor:s.borderColor||l.borderColor,fill:o.fill?o.fill:void 0!==s.fill?s.fill:l.fill,borderCapStyle:o.borderCapStyle?o.borderCapStyle:s.borderCapStyle||l.borderCapStyle,borderDash:o.borderDash?o.borderDash:s.borderDash||l.borderDash,borderDashOffset:o.borderDashOffset?o.borderDashOffset:s.borderDashOffset||l.borderDashOffset,borderJoinStyle:o.borderJoinStyle?o.borderJoinStyle:s.borderJoinStyle||l.borderJoinStyle}}),n.dataset.pivot(),r.each(a,function(n,i){e.updateElement(n,i,t)},e),e.updateBezierControlPoints()},updateElement:function(t,e,n){var i=this,a=t.custom||{},o=i.getDataset(),s=i.chart.scale,l=i.chart.options.elements.point,u=s.getPointPositionForValue(e,o.data[e]);void 0!==o.radius&&void 0===o.pointRadius&&(o.pointRadius=o.radius),void 0!==o.hitRadius&&void 0===o.pointHitRadius&&(o.pointHitRadius=o.hitRadius),r.extend(t,{_datasetIndex:i.index,_index:e,_scale:s,_model:{x:n?s.xCenter:u.x,y:n?s.yCenter:u.y,tension:a.tension?a.tension:r.valueOrDefault(o.lineTension,i.chart.options.elements.line.tension),radius:a.radius?a.radius:r.valueAtIndexOrDefault(o.pointRadius,e,l.radius),backgroundColor:a.backgroundColor?a.backgroundColor:r.valueAtIndexOrDefault(o.pointBackgroundColor,e,l.backgroundColor),borderColor:a.borderColor?a.borderColor:r.valueAtIndexOrDefault(o.pointBorderColor,e,l.borderColor),borderWidth:a.borderWidth?a.borderWidth:r.valueAtIndexOrDefault(o.pointBorderWidth,e,l.borderWidth),pointStyle:a.pointStyle?a.pointStyle:r.valueAtIndexOrDefault(o.pointStyle,e,l.pointStyle),hitRadius:a.hitRadius?a.hitRadius:r.valueAtIndexOrDefault(o.pointHitRadius,e,l.hitRadius)}}),t._model.skip=a.skip?a.skip:isNaN(t._model.x)||isNaN(t._model.y)},updateBezierControlPoints:function(){var t=this.chart.chartArea,e=this.getMeta();r.each(e.data,function(n,i){var a=n._model,o=r.splineCurve(r.previousItem(e.data,i,!0)._model,a,r.nextItem(e.data,i,!0)._model,a.tension);a.controlPointPreviousX=Math.max(Math.min(o.previous.x,t.right),t.left),a.controlPointPreviousY=Math.max(Math.min(o.previous.y,t.bottom),t.top),a.controlPointNextX=Math.max(Math.min(o.next.x,t.right),t.left),a.controlPointNextY=Math.max(Math.min(o.next.y,t.bottom),t.top),n.pivot()})},setHoverStyle:function(t){var e=this.chart.data.datasets[t._datasetIndex],n=t.custom||{},i=t._index,a=t._model;a.radius=n.hoverRadius?n.hoverRadius:r.valueAtIndexOrDefault(e.pointHoverRadius,i,this.chart.options.elements.point.hoverRadius),a.backgroundColor=n.hoverBackgroundColor?n.hoverBackgroundColor:r.valueAtIndexOrDefault(e.pointHoverBackgroundColor,i,r.getHoverColor(a.backgroundColor)),a.borderColor=n.hoverBorderColor?n.hoverBorderColor:r.valueAtIndexOrDefault(e.pointHoverBorderColor,i,r.getHoverColor(a.borderColor)),a.borderWidth=n.hoverBorderWidth?n.hoverBorderWidth:r.valueAtIndexOrDefault(e.pointHoverBorderWidth,i,a.borderWidth)},removeHoverStyle:function(t){var e=this.chart.data.datasets[t._datasetIndex],n=t.custom||{},i=t._index,a=t._model,o=this.chart.options.elements.point;a.radius=n.radius?n.radius:r.valueAtIndexOrDefault(e.pointRadius,i,o.radius),a.backgroundColor=n.backgroundColor?n.backgroundColor:r.valueAtIndexOrDefault(e.pointBackgroundColor,i,o.backgroundColor),a.borderColor=n.borderColor?n.borderColor:r.valueAtIndexOrDefault(e.pointBorderColor,i,o.borderColor),a.borderWidth=n.borderWidth?n.borderWidth:r.valueAtIndexOrDefault(e.pointBorderWidth,i,o.borderWidth)}})}},{25:25,40:40,45:45}],21:[function(t,e,n){"use strict";t(25)._set("scatter",{hover:{mode:"single"},scales:{xAxes:[{id:"x-axis-1",type:"linear",position:"bottom"}],yAxes:[{id:"y-axis-1",type:"linear",position:"left"}]},showLines:!1,tooltips:{callbacks:{title:function(){return""},label:function(t){return"("+t.xLabel+", "+t.yLabel+")"}}}}),e.exports=function(t){t.controllers.scatter=t.controllers.line}},{25:25}],22:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{animation:{duration:1e3,easing:"easeOutQuart",onProgress:r.noop,onComplete:r.noop}}),e.exports=function(t){t.Animation=a.extend({chart:null,currentStep:0,numSteps:60,easing:"",render:null,onAnimationProgress:null,onAnimationComplete:null}),t.animationService={frameDuration:17,animations:[],dropFrames:0,request:null,addAnimation:function(t,e,n,i){var a,r,o=this.animations;for(e.chart=t,i||(t.animating=!0),a=0,r=o.length;a1&&(n=Math.floor(t.dropFrames),t.dropFrames=t.dropFrames%1),t.advance(1+n);var i=Date.now();t.dropFrames+=(i-e)/t.frameDuration,t.animations.length>0&&t.requestAnimationFrame()},advance:function(t){for(var e,n,i=this.animations,a=0;a=e.numSteps?(r.callback(e.onAnimationComplete,[e],n),n.animating=!1,i.splice(a,1)):++a}},Object.defineProperty(t.Animation.prototype,"animationObject",{get:function(){return this}}),Object.defineProperty(t.Animation.prototype,"chartInstance",{get:function(){return this.chart},set:function(t){this.chart=t}})}},{25:25,26:26,45:45}],23:[function(t,e,n){"use strict";var i=t(25),a=t(45),r=t(28),o=t(48);e.exports=function(t){function e(t){var e=(t=t||{}).data=t.data||{};return e.datasets=e.datasets||[],e.labels=e.labels||[],t.options=a.configMerge(i.global,i[t.type],t.options||{}),t}function n(t){var e=t.options;e.scale?t.scale.options=e.scale:e.scales&&e.scales.xAxes.concat(e.scales.yAxes).forEach(function(e){t.scales[e.id].options=e}),t.tooltip._options=e.tooltips}function s(t){return"top"===t||"bottom"===t}var l=t.plugins;t.types={},t.instances={},t.controllers={},a.extend(t.prototype,{construct:function(n,i){var r=this;i=e(i);var s=o.acquireContext(n,i),l=s&&s.canvas,u=l&&l.height,d=l&&l.width;r.id=a.uid(),r.ctx=s,r.canvas=l,r.config=i,r.width=d,r.height=u,r.aspectRatio=u?d/u:null,r.options=i.options,r._bufferedRender=!1,r.chart=r,r.controller=r,t.instances[r.id]=r,Object.defineProperty(r,"data",{get:function(){return r.config.data},set:function(t){r.config.data=t}}),s&&l?(r.initialize(),r.update()):console.error("Failed to create chart: can't acquire context from the given item")},initialize:function(){var t=this;return l.notify(t,"beforeInit"),a.retinaScale(t,t.options.devicePixelRatio),t.bindEvents(),t.options.responsive&&t.resize(!0),t.ensureScalesHaveIDs(),t.buildScales(),t.initToolTip(),l.notify(t,"afterInit"),t},clear:function(){return a.canvas.clear(this),this},stop:function(){return t.animationService.cancelAnimation(this),this},resize:function(t){var e=this,n=e.options,i=e.canvas,r=n.maintainAspectRatio&&e.aspectRatio||null,o=Math.max(0,Math.floor(a.getMaximumWidth(i))),s=Math.max(0,Math.floor(r?o/r:a.getMaximumHeight(i)));if((e.width!==o||e.height!==s)&&(i.width=e.width=o,i.height=e.height=s,i.style.width=o+"px",i.style.height=s+"px",a.retinaScale(e,n.devicePixelRatio),!t)){var u={width:o,height:s};l.notify(e,"resize",[u]),e.options.onResize&&e.options.onResize(e,u),e.stop(),e.update(e.options.responsiveAnimationDuration)}},ensureScalesHaveIDs:function(){var t=this.options,e=t.scales||{},n=t.scale;a.each(e.xAxes,function(t,e){t.id=t.id||"x-axis-"+e}),a.each(e.yAxes,function(t,e){t.id=t.id||"y-axis-"+e}),n&&(n.id=n.id||"scale")},buildScales:function(){var e=this,n=e.options,i=e.scales={},r=[];n.scales&&(r=r.concat((n.scales.xAxes||[]).map(function(t){return{options:t,dtype:"category",dposition:"bottom"}}),(n.scales.yAxes||[]).map(function(t){return{options:t,dtype:"linear",dposition:"left"}}))),n.scale&&r.push({options:n.scale,dtype:"radialLinear",isDefault:!0,dposition:"chartArea"}),a.each(r,function(n){var r=n.options,o=a.valueOrDefault(r.type,n.dtype),l=t.scaleService.getScaleConstructor(o);if(l){s(r.position)!==s(n.dposition)&&(r.position=n.dposition);var u=new l({id:r.id,options:r,ctx:e.ctx,chart:e});i[u.id]=u,u.mergeTicksOptions(),n.isDefault&&(e.scale=u)}}),t.scaleService.addScalesToLayout(this)},buildOrUpdateControllers:function(){var e=this,n=[],i=[];return a.each(e.data.datasets,function(a,r){var o=e.getDatasetMeta(r),s=a.type||e.config.type;if(o.type&&o.type!==s&&(e.destroyDatasetMeta(r),o=e.getDatasetMeta(r)),o.type=s,n.push(o.type),o.controller)o.controller.updateIndex(r);else{var l=t.controllers[o.type];if(void 0===l)throw new Error('"'+o.type+'" is not a chart type.');o.controller=new l(e,r),i.push(o.controller)}},e),i},resetElements:function(){var t=this;a.each(t.data.datasets,function(e,n){t.getDatasetMeta(n).controller.reset()},t)},reset:function(){this.resetElements(),this.tooltip.initialize()},update:function(t){var e=this;if(t&&"object"==typeof t||(t={duration:t,lazy:arguments[1]}),n(e),!1!==l.notify(e,"beforeUpdate")){e.tooltip._data=e.data;var i=e.buildOrUpdateControllers();a.each(e.data.datasets,function(t,n){e.getDatasetMeta(n).controller.buildOrUpdateElements()},e),e.updateLayout(),a.each(i,function(t){t.reset()}),e.updateDatasets(),l.notify(e,"afterUpdate"),e._bufferedRender?e._bufferedRequest={duration:t.duration,easing:t.easing,lazy:t.lazy}:e.render(t)}},updateLayout:function(){var e=this;!1!==l.notify(e,"beforeLayout")&&(t.layoutService.update(this,this.width,this.height),l.notify(e,"afterScaleUpdate"),l.notify(e,"afterLayout"))},updateDatasets:function(){var t=this;if(!1!==l.notify(t,"beforeDatasetsUpdate")){for(var e=0,n=t.data.datasets.length;e=0;--n)e.isDatasetVisible(n)&&e.drawDataset(n,t);l.notify(e,"afterDatasetsDraw",[t])}},drawDataset:function(t,e){var n=this,i=n.getDatasetMeta(t),a={meta:i,index:t,easingValue:e};!1!==l.notify(n,"beforeDatasetDraw",[a])&&(i.controller.draw(e),l.notify(n,"afterDatasetDraw",[a]))},getElementAtEvent:function(t){return r.modes.single(this,t)},getElementsAtEvent:function(t){return r.modes.label(this,t,{intersect:!0})},getElementsAtXAxis:function(t){return r.modes["x-axis"](this,t,{intersect:!0})},getElementsAtEventForMode:function(t,e,n){var i=r.modes[e];return"function"==typeof i?i(this,t,n):[]},getDatasetAtEvent:function(t){return r.modes.dataset(this,t,{intersect:!0})},getDatasetMeta:function(t){var e=this,n=e.data.datasets[t];n._meta||(n._meta={});var i=n._meta[e.id];return i||(i=n._meta[e.id]={type:null,data:[],dataset:null,controller:null,hidden:null,xAxisID:null,yAxisID:null}),i},getVisibleDatasetCount:function(){for(var t=0,e=0,n=this.data.datasets.length;e0||(a.forEach(function(e){delete t[e]}),delete t._chartjs)}}var a=["push","pop","shift","splice","unshift"];t.DatasetController=function(t,e){this.initialize(t,e)},i.extend(t.DatasetController.prototype,{datasetElementType:null,dataElementType:null,initialize:function(t,e){var n=this;n.chart=t,n.index=e,n.linkScales(),n.addElements()},updateIndex:function(t){this.index=t},linkScales:function(){var t=this,e=t.getMeta(),n=t.getDataset();null===e.xAxisID&&(e.xAxisID=n.xAxisID||t.chart.options.scales.xAxes[0].id),null===e.yAxisID&&(e.yAxisID=n.yAxisID||t.chart.options.scales.yAxes[0].id)},getDataset:function(){return this.chart.data.datasets[this.index]},getMeta:function(){return this.chart.getDatasetMeta(this.index)},getScaleForId:function(t){return this.chart.scales[t]},reset:function(){this.update(!0)},destroy:function(){this._data&&n(this._data,this)},createMetaDataset:function(){var t=this,e=t.datasetElementType;return e&&new e({_chart:t.chart,_datasetIndex:t.index})},createMetaData:function(t){var e=this,n=e.dataElementType;return n&&new n({_chart:e.chart,_datasetIndex:e.index,_index:t})},addElements:function(){var t,e,n=this,i=n.getMeta(),a=n.getDataset().data||[],r=i.data;for(t=0,e=a.length;ti&&t.insertElements(i,a-i)},insertElements:function(t,e){for(var n=0;n=n[e].length&&n[e].push({}),!n[e][o].type||l.type&&l.type!==n[e][o].type?r.merge(n[e][o],[t.scaleService.getScaleDefaults(s),l]):r.merge(n[e][o],l)}else r._merger(e,n,i,a)}})},r.where=function(t,e){if(r.isArray(t)&&Array.prototype.filter)return t.filter(e);var n=[];return r.each(t,function(t){e(t)&&n.push(t)}),n},r.findIndex=Array.prototype.findIndex?function(t,e,n){return t.findIndex(e,n)}:function(t,e,n){n=void 0===n?t:n;for(var i=0,a=t.length;i=0;i--){var a=t[i];if(e(a))return a}},r.inherits=function(t){var e=this,n=t&&t.hasOwnProperty("constructor")?t.constructor:function(){return e.apply(this,arguments)},i=function(){this.constructor=n};return i.prototype=e.prototype,n.prototype=new i,n.extend=r.inherits,t&&r.extend(n.prototype,t),n.__super__=e.prototype,n},r.isNumber=function(t){return!isNaN(parseFloat(t))&&isFinite(t)},r.almostEquals=function(t,e,n){return Math.abs(t-e)t},r.max=function(t){return t.reduce(function(t,e){return isNaN(e)?t:Math.max(t,e)},Number.NEGATIVE_INFINITY)},r.min=function(t){return t.reduce(function(t,e){return isNaN(e)?t:Math.min(t,e)},Number.POSITIVE_INFINITY)},r.sign=Math.sign?function(t){return Math.sign(t)}:function(t){return 0==(t=+t)||isNaN(t)?t:t>0?1:-1},r.log10=Math.log10?function(t){return Math.log10(t)}:function(t){return Math.log(t)/Math.LN10},r.toRadians=function(t){return t*(Math.PI/180)},r.toDegrees=function(t){return t*(180/Math.PI)},r.getAngleFromPoint=function(t,e){var n=e.x-t.x,i=e.y-t.y,a=Math.sqrt(n*n+i*i),r=Math.atan2(i,n);return r<-.5*Math.PI&&(r+=2*Math.PI),{angle:r,distance:a}},r.distanceBetweenPoints=function(t,e){return Math.sqrt(Math.pow(e.x-t.x,2)+Math.pow(e.y-t.y,2))},r.aliasPixel=function(t){return t%2==0?0:.5},r.splineCurve=function(t,e,n,i){var a=t.skip?e:t,r=e,o=n.skip?e:n,s=Math.sqrt(Math.pow(r.x-a.x,2)+Math.pow(r.y-a.y,2)),l=Math.sqrt(Math.pow(o.x-r.x,2)+Math.pow(o.y-r.y,2)),u=s/(s+l),d=l/(s+l),c=i*(u=isNaN(u)?0:u),h=i*(d=isNaN(d)?0:d);return{previous:{x:r.x-c*(o.x-a.x),y:r.y-c*(o.y-a.y)},next:{x:r.x+h*(o.x-a.x),y:r.y+h*(o.y-a.y)}}},r.EPSILON=Number.EPSILON||1e-14,r.splineCurveMonotone=function(t){var e,n,i,a,o=(t||[]).map(function(t){return{model:t._model,deltaK:0,mK:0}}),s=o.length;for(e=0;e0?o[e-1]:null,(a=e0?o[e-1]:null,a=e=t.length-1?t[0]:t[e+1]:e>=t.length-1?t[t.length-1]:t[e+1]},r.previousItem=function(t,e,n){return n?e<=0?t[t.length-1]:t[e-1]:e<=0?t[0]:t[e-1]},r.niceNum=function(t,e){var n=Math.floor(r.log10(t)),i=t/Math.pow(10,n);return(e?i<1.5?1:i<3?2:i<7?5:10:i<=1?1:i<=2?2:i<=5?5:10)*Math.pow(10,n)},r.requestAnimFrame="undefined"==typeof window?function(t){t()}:window.requestAnimationFrame||window.webkitRequestAnimationFrame||window.mozRequestAnimationFrame||window.oRequestAnimationFrame||window.msRequestAnimationFrame||function(t){return window.setTimeout(t,1e3/60)},r.getRelativePosition=function(t,e){var n,i,a=t.originalEvent||t,o=t.currentTarget||t.srcElement,s=o.getBoundingClientRect(),l=a.touches;l&&l.length>0?(n=l[0].clientX,i=l[0].clientY):(n=a.clientX,i=a.clientY);var u=parseFloat(r.getStyle(o,"padding-left")),d=parseFloat(r.getStyle(o,"padding-top")),c=parseFloat(r.getStyle(o,"padding-right")),h=parseFloat(r.getStyle(o,"padding-bottom")),f=s.right-s.left-u-c,g=s.bottom-s.top-d-h;return n=Math.round((n-s.left-u)/f*o.width/e.currentDevicePixelRatio),i=Math.round((i-s.top-d)/g*o.height/e.currentDevicePixelRatio),{x:n,y:i}},r.getConstraintWidth=function(t){return o(t,"max-width","clientWidth")},r.getConstraintHeight=function(t){return o(t,"max-height","clientHeight")},r.getMaximumWidth=function(t){var e=t.parentNode;if(!e)return t.clientWidth;var n=parseInt(r.getStyle(e,"padding-left"),10),i=parseInt(r.getStyle(e,"padding-right"),10),a=e.clientWidth-n-i,o=r.getConstraintWidth(t);return isNaN(o)?a:Math.min(a,o)},r.getMaximumHeight=function(t){var e=t.parentNode;if(!e)return t.clientHeight;var n=parseInt(r.getStyle(e,"padding-top"),10),i=parseInt(r.getStyle(e,"padding-bottom"),10),a=e.clientHeight-n-i,o=r.getConstraintHeight(t);return isNaN(o)?a:Math.min(a,o)},r.getStyle=function(t,e){return t.currentStyle?t.currentStyle[e]:document.defaultView.getComputedStyle(t,null).getPropertyValue(e)},r.retinaScale=function(t,e){var n=t.currentDevicePixelRatio=e||window.devicePixelRatio||1;if(1!==n){var i=t.canvas,a=t.height,r=t.width;i.height=a*n,i.width=r*n,t.ctx.scale(n,n),i.style.height=a+"px",i.style.width=r+"px"}},r.fontString=function(t,e,n){return e+" "+t+"px "+n},r.longestText=function(t,e,n,i){var a=(i=i||{}).data=i.data||{},o=i.garbageCollect=i.garbageCollect||[];i.font!==e&&(a=i.data={},o=i.garbageCollect=[],i.font=e),t.font=e;var s=0;r.each(n,function(e){void 0!==e&&null!==e&&!0!==r.isArray(e)?s=r.measureText(t,a,o,s,e):r.isArray(e)&&r.each(e,function(e){void 0===e||null===e||r.isArray(e)||(s=r.measureText(t,a,o,s,e))})});var l=o.length/2;if(l>n.length){for(var u=0;ui&&(i=r),i},r.numberOfLabelLines=function(t){var e=1;return r.each(t,function(t){r.isArray(t)&&t.length>e&&(e=t.length)}),e},r.color=i?function(t){return t instanceof CanvasGradient&&(t=a.global.defaultColor),i(t)}:function(t){return console.error("Color.js not found!"),t},r.getHoverColor=function(t){return t instanceof CanvasPattern?t:r.color(t).saturate(.5).darken(.1).rgbString()}}},{2:2,25:25,45:45}],28:[function(t,e,n){"use strict";function i(t,e){return t.native?{x:t.x,y:t.y}:u.getRelativePosition(t,e)}function a(t,e){var n,i,a,r,o;for(i=0,r=t.data.datasets.length;i0&&(u=t.getDatasetMeta(u[0]._datasetIndex).data),u},"x-axis":function(t,e){return l(t,e,{intersect:!0})},point:function(t,e){return r(t,i(e,t))},nearest:function(t,e,n){var a=i(e,t);n.axis=n.axis||"xy";var r=s(n.axis),l=o(t,a,n.intersect,r);return l.length>1&&l.sort(function(t,e){var n=t.getArea()-e.getArea();return 0===n&&(n=t._datasetIndex-e._datasetIndex),n}),l.slice(0,1)},x:function(t,e,n){var r=i(e,t),o=[],s=!1;return a(t,function(t){t.inXRange(r.x)&&o.push(t),t.inRange(r.x,r.y)&&(s=!0)}),n.intersect&&!s&&(o=[]),o},y:function(t,e,n){var r=i(e,t),o=[],s=!1;return a(t,function(t){t.inYRange(r.y)&&o.push(t),t.inRange(r.x,r.y)&&(s=!0)}),n.intersect&&!s&&(o=[]),o}}}},{45:45}],29:[function(t,e,n){"use strict";t(25)._set("global",{responsive:!0,responsiveAnimationDuration:0,maintainAspectRatio:!0,events:["mousemove","mouseout","click","touchstart","touchmove"],hover:{onHover:null,mode:"nearest",intersect:!0,animationDuration:400},onClick:null,defaultColor:"rgba(0,0,0,0.1)",defaultFontColor:"#666",defaultFontFamily:"'Helvetica Neue', 'Helvetica', 'Arial', sans-serif",defaultFontSize:12,defaultFontStyle:"normal",showLines:!0,elements:{},layout:{padding:{top:0,right:0,bottom:0,left:0}}}),e.exports=function(){var t=function(t,e){return this.construct(t,e),this};return t.Chart=t,t}},{25:25}],30:[function(t,e,n){"use strict";var i=t(45);e.exports=function(t){function e(t,e){return i.where(t,function(t){return t.position===e})}function n(t,e){t.forEach(function(t,e){return t._tmpIndex_=e,t}),t.sort(function(t,n){var i=e?n:t,a=e?t:n;return i.weight===a.weight?i._tmpIndex_-a._tmpIndex_:i.weight-a.weight}),t.forEach(function(t){delete t._tmpIndex_})}t.layoutService={defaults:{},addBox:function(t,e){t.boxes||(t.boxes=[]),e.fullWidth=e.fullWidth||!1,e.position=e.position||"top",e.weight=e.weight||0,t.boxes.push(e)},removeBox:function(t,e){var n=t.boxes?t.boxes.indexOf(e):-1;-1!==n&&t.boxes.splice(n,1)},configure:function(t,e,n){for(var i,a=["fullWidth","position","weight"],r=a.length,o=0;oh&&lt.maxHeight){l--;break}l++,c=u*d}t.labelRotation=l},afterCalculateTickRotation:function(){s.callback(this.options.afterCalculateTickRotation,[this])},beforeFit:function(){s.callback(this.options.beforeFit,[this])},fit:function(){var t=this,a=t.minSize={width:0,height:0},r=i(t._ticks),o=t.options,u=o.ticks,d=o.scaleLabel,c=o.gridLines,h=o.display,f=t.isHorizontal(),g=n(u),m=o.gridLines.tickMarkLength;if(a.width=f?t.isFullWidth()?t.maxWidth-t.margins.left-t.margins.right:t.maxWidth:h&&c.drawTicks?m:0,a.height=f?h&&c.drawTicks?m:0:t.maxHeight,d.display&&h){var p=l(d)+s.options.toPadding(d.padding).height;f?a.height+=p:a.width+=p}if(u.display&&h){var v=s.longestText(t.ctx,g.font,r,t.longestTextCache),y=s.numberOfLabelLines(r),b=.5*g.size,x=t.options.ticks.padding;if(f){t.longestLabelWidth=v;var _=s.toRadians(t.labelRotation),k=Math.cos(_),w=Math.sin(_)*v+g.size*y+b*(y-1)+b;a.height=Math.min(t.maxHeight,a.height+w+x),t.ctx.font=g.font;var M=e(t.ctx,r[0],g.font),S=e(t.ctx,r[r.length-1],g.font);0!==t.labelRotation?(t.paddingLeft="bottom"===o.position?k*M+3:k*b+3,t.paddingRight="bottom"===o.position?k*b+3:k*S+3):(t.paddingLeft=M/2+3,t.paddingRight=S/2+3)}else u.mirror?v=0:v+=x+b,a.width=Math.min(t.maxWidth,a.width+v),t.paddingTop=g.size/2,t.paddingBottom=g.size/2}t.handleMargins(),t.width=a.width,t.height=a.height},handleMargins:function(){var t=this;t.margins&&(t.paddingLeft=Math.max(t.paddingLeft-t.margins.left,0),t.paddingTop=Math.max(t.paddingTop-t.margins.top,0),t.paddingRight=Math.max(t.paddingRight-t.margins.right,0),t.paddingBottom=Math.max(t.paddingBottom-t.margins.bottom,0))},afterFit:function(){s.callback(this.options.afterFit,[this])},isHorizontal:function(){return"top"===this.options.position||"bottom"===this.options.position},isFullWidth:function(){return this.options.fullWidth},getRightValue:function(t){if(s.isNullOrUndef(t))return NaN;if("number"==typeof t&&!isFinite(t))return NaN;if(t)if(this.isHorizontal()){if(void 0!==t.x)return this.getRightValue(t.x)}else if(void 0!==t.y)return this.getRightValue(t.y);return t},getLabelForIndex:s.noop,getPixelForValue:s.noop,getValueForPixel:s.noop,getPixelForTick:function(t){var e=this,n=e.options.offset;if(e.isHorizontal()){var i=(e.width-(e.paddingLeft+e.paddingRight))/Math.max(e._ticks.length-(n?0:1),1),a=i*t+e.paddingLeft;n&&(a+=i/2);var r=e.left+Math.round(a);return r+=e.isFullWidth()?e.margins.left:0}var o=e.height-(e.paddingTop+e.paddingBottom);return e.top+t*(o/(e._ticks.length-1))},getPixelForDecimal:function(t){var e=this;if(e.isHorizontal()){var n=(e.width-(e.paddingLeft+e.paddingRight))*t+e.paddingLeft,i=e.left+Math.round(n);return i+=e.isFullWidth()?e.margins.left:0}return e.top+t*e.height},getBasePixel:function(){return this.getPixelForValue(this.getBaseValue())},getBaseValue:function(){var t=this,e=t.min,n=t.max;return t.beginAtZero?0:e<0&&n<0?n:e>0&&n>0?e:0},_autoSkip:function(t){var e,n,i,a,r=this,o=r.isHorizontal(),l=r.options.ticks.minor,u=t.length,d=s.toRadians(r.labelRotation),c=Math.cos(d),h=r.longestLabelWidth*c,f=[];for(l.maxTicksLimit&&(a=l.maxTicksLimit),o&&(e=!1,(h+l.autoSkipPadding)*u>r.width-(r.paddingLeft+r.paddingRight)&&(e=1+Math.floor((h+l.autoSkipPadding)*u/(r.width-(r.paddingLeft+r.paddingRight)))),a&&u>a&&(e=Math.max(e,Math.floor(u/a)))),n=0;n1&&n%e>0||n%e==0&&n+e>=u)&&n!==u-1||s.isNullOrUndef(i.label))&&delete i.label,f.push(i);return f},draw:function(t){var e=this,i=e.options;if(i.display){var o=e.ctx,u=r.global,d=i.ticks.minor,c=i.ticks.major||d,h=i.gridLines,f=i.scaleLabel,g=0!==e.labelRotation,m=e.isHorizontal(),p=d.autoSkip?e._autoSkip(e.getTicks()):e.getTicks(),v=s.valueOrDefault(d.fontColor,u.defaultFontColor),y=n(d),b=s.valueOrDefault(c.fontColor,u.defaultFontColor),x=n(c),_=h.drawTicks?h.tickMarkLength:0,k=s.valueOrDefault(f.fontColor,u.defaultFontColor),w=n(f),M=s.options.toPadding(f.padding),S=s.toRadians(e.labelRotation),D=[],C="right"===i.position?e.left:e.right-_,P="right"===i.position?e.left+_:e.right,T="bottom"===i.position?e.top:e.bottom-_,I="bottom"===i.position?e.top+_:e.bottom;if(s.each(p,function(n,r){if(void 0!==n.label){var o,l,c,f,v=n.label;r===e.zeroLineIndex&&i.offset===h.offsetGridLines?(o=h.zeroLineWidth,l=h.zeroLineColor,c=h.zeroLineBorderDash,f=h.zeroLineBorderDashOffset):(o=s.valueAtIndexOrDefault(h.lineWidth,r),l=s.valueAtIndexOrDefault(h.color,r),c=s.valueOrDefault(h.borderDash,u.borderDash),f=s.valueOrDefault(h.borderDashOffset,u.borderDashOffset));var y,b,x,k,w,M,A,O,F,R,L="middle",W="middle",Y=d.padding;if(m){var N=_+Y;"bottom"===i.position?(W=g?"middle":"top",L=g?"right":"center",R=e.top+N):(W=g?"middle":"bottom",L=g?"left":"center",R=e.bottom-N);var z=a(e,r,h.offsetGridLines&&p.length>1);z1);H0)n=t.stepSize;else{var r=i.niceNum(e.max-e.min,!1);n=i.niceNum(r/(t.maxTicks-1),!0)}var o=Math.floor(e.min/n)*n,s=Math.ceil(e.max/n)*n;t.min&&t.max&&t.stepSize&&i.almostWhole((t.max-t.min)/t.stepSize,n/1e3)&&(o=t.min,s=t.max);var l=(s-o)/n;l=i.almostEquals(l,Math.round(l),n/1e3)?Math.round(l):Math.ceil(l),a.push(void 0!==t.min?t.min:o);for(var u=1;u3?n[2]-n[1]:n[1]-n[0];Math.abs(a)>1&&t!==Math.floor(t)&&(a=t-Math.floor(t));var r=i.log10(Math.abs(a)),o="";if(0!==t){var s=-1*Math.floor(r);s=Math.max(Math.min(s,20),0),o=t.toFixed(s)}else o="0";return o},logarithmic:function(t,e,n){var a=t/Math.pow(10,Math.floor(i.log10(t)));return 0===t?"0":1===a||2===a||5===a||0===e||e===n.length-1?t.toExponential():""}}}},{45:45}],35:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{tooltips:{enabled:!0,custom:null,mode:"nearest",position:"average",intersect:!0,backgroundColor:"rgba(0,0,0,0.8)",titleFontStyle:"bold",titleSpacing:2,titleMarginBottom:6,titleFontColor:"#fff",titleAlign:"left",bodySpacing:2,bodyFontColor:"#fff",bodyAlign:"left",footerFontStyle:"bold",footerSpacing:2,footerMarginTop:6,footerFontColor:"#fff",footerAlign:"left",yPadding:6,xPadding:6,caretPadding:2,caretSize:5,cornerRadius:6,multiKeyBackground:"#fff",displayColors:!0,borderColor:"rgba(0,0,0,0)",borderWidth:0,callbacks:{beforeTitle:r.noop,title:function(t,e){var n="",i=e.labels,a=i?i.length:0;if(t.length>0){var r=t[0];r.xLabel?n=r.xLabel:a>0&&r.indexi.height-e.height&&(o="bottom");var s,l,u,d,c,h=(a.left+a.right)/2,f=(a.top+a.bottom)/2;"center"===o?(s=function(t){return t<=h},l=function(t){return t>h}):(s=function(t){return t<=e.width/2},l=function(t){return t>=i.width-e.width/2}),u=function(t){return t+e.width>i.width},d=function(t){return t-e.width<0},c=function(t){return t<=f?"top":"bottom"},s(n.x)?(r="left",u(n.x)&&(r="center",o=c(n.y))):l(n.x)&&(r="right",d(n.x)&&(r="center",o=c(n.y)));var g=t._options;return{xAlign:g.xAlign?g.xAlign:r,yAlign:g.yAlign?g.yAlign:o}}function d(t,e,n){var i=t.x,a=t.y,r=t.caretSize,o=t.caretPadding,s=t.cornerRadius,l=n.xAlign,u=n.yAlign,d=r+o,c=s+o;return"right"===l?i-=e.width:"center"===l&&(i-=e.width/2),"top"===u?a+=d:a-="bottom"===u?e.height+d:e.height/2,"center"===u?"left"===l?i+=d:"right"===l&&(i-=d):"left"===l?i-=c:"right"===l&&(i+=c),{x:i,y:a}}t.Tooltip=a.extend({initialize:function(){this._model=s(this._options)},getTitle:function(){var t=this,e=t._options.callbacks,i=e.beforeTitle.apply(t,arguments),a=e.title.apply(t,arguments),r=e.afterTitle.apply(t,arguments),o=[];return o=n(o,i),o=n(o,a),o=n(o,r)},getBeforeBody:function(){var t=this._options.callbacks.beforeBody.apply(this,arguments);return r.isArray(t)?t:void 0!==t?[t]:[]},getBody:function(t,e){var i=this,a=i._options.callbacks,o=[];return r.each(t,function(t){var r={before:[],lines:[],after:[]};n(r.before,a.beforeLabel.call(i,t,e)),n(r.lines,a.label.call(i,t,e)),n(r.after,a.afterLabel.call(i,t,e)),o.push(r)}),o},getAfterBody:function(){var t=this._options.callbacks.afterBody.apply(this,arguments);return r.isArray(t)?t:void 0!==t?[t]:[]},getFooter:function(){var t=this,e=t._options.callbacks,i=e.beforeFooter.apply(t,arguments),a=e.footer.apply(t,arguments),r=e.afterFooter.apply(t,arguments),o=[];return o=n(o,i),o=n(o,a),o=n(o,r)},update:function(e){var n,i,a=this,c=a._options,h=a._model,f=a._model=s(c),g=a._active,m=a._data,p={xAlign:h.xAlign,yAlign:h.yAlign},v={x:h.x,y:h.y},y={width:h.width,height:h.height},b={x:h.caretX,y:h.caretY};if(g.length){f.opacity=1;var x=[],_=[];b=t.Tooltip.positioners[c.position](g,a._eventPosition);var k=[];for(n=0,i=g.length;n0&&i.stroke()},draw:function(){var t=this._chart.ctx,e=this._view;if(0!==e.opacity){var n={width:e.width,height:e.height},i={x:e.x,y:e.y},a=Math.abs(e.opacity<.001)?0:e.opacity,r=e.title.length||e.beforeBody.length||e.body.length||e.afterBody.length||e.footer.length;this._options.enabled&&r&&(this.drawBackground(i,e,t,n,a),i.x+=e.xPadding,i.y+=e.yPadding,this.drawTitle(i,e,t,a),this.drawBody(i,e,t,a),this.drawFooter(i,e,t,a))}},handleEvent:function(t){var e=this,n=e._options,i=!1;if(e._lastActive=e._lastActive||[],"mouseout"===t.type?e._active=[]:e._active=e._chart.getElementsAtEventForMode(t,n.mode,n),!(i=!r.arrayEquals(e._active,e._lastActive)))return!1;if(e._lastActive=e._active,n.enabled||n.custom){e._eventPosition={x:t.x,y:t.y};var a=e._model;e.update(!0),e.pivot(),i|=a.x!==e._model.x||a.y!==e._model.y}return i}}),t.Tooltip.positioners={average:function(t){if(!t.length)return!1;var e,n,i=0,a=0,r=0;for(e=0,n=t.length;el;)a-=2*Math.PI;for(;a=s&&a<=l,d=o>=n.innerRadius&&o<=n.outerRadius;return u&&d}return!1},getCenterPoint:function(){var t=this._view,e=(t.startAngle+t.endAngle)/2,n=(t.innerRadius+t.outerRadius)/2;return{x:t.x+Math.cos(e)*n,y:t.y+Math.sin(e)*n}},getArea:function(){var t=this._view;return Math.PI*((t.endAngle-t.startAngle)/(2*Math.PI))*(Math.pow(t.outerRadius,2)-Math.pow(t.innerRadius,2))},tooltipPosition:function(){var t=this._view,e=t.startAngle+(t.endAngle-t.startAngle)/2,n=(t.outerRadius-t.innerRadius)/2+t.innerRadius;return{x:t.x+Math.cos(e)*n,y:t.y+Math.sin(e)*n}},draw:function(){var t=this._chart.ctx,e=this._view,n=e.startAngle,i=e.endAngle;t.beginPath(),t.arc(e.x,e.y,e.outerRadius,n,i),t.arc(e.x,e.y,e.innerRadius,i,n,!0),t.closePath(),t.strokeStyle=e.borderColor,t.lineWidth=e.borderWidth,t.fillStyle=e.backgroundColor,t.fill(),t.lineJoin="bevel",e.borderWidth&&t.stroke()}})},{25:25,26:26,45:45}],37:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45),o=i.global;i._set("global",{elements:{line:{tension:.4,backgroundColor:o.defaultColor,borderWidth:3,borderColor:o.defaultColor,borderCapStyle:"butt",borderDash:[],borderDashOffset:0,borderJoinStyle:"miter",capBezierPoints:!0,fill:!0}}}),e.exports=a.extend({draw:function(){var t,e,n,i,a=this,s=a._view,l=a._chart.ctx,u=s.spanGaps,d=a._children.slice(),c=o.elements.line,h=-1;for(a._loop&&d.length&&d.push(d[0]),l.save(),l.lineCap=s.borderCapStyle||c.borderCapStyle,l.setLineDash&&l.setLineDash(s.borderDash||c.borderDash),l.lineDashOffset=s.borderDashOffset||c.borderDashOffset,l.lineJoin=s.borderJoinStyle||c.borderJoinStyle,l.lineWidth=s.borderWidth||c.borderWidth,l.strokeStyle=s.borderColor||o.defaultColor,l.beginPath(),h=-1,t=0;te?1:-1,o=1,s=u.borderSkipped||"left"):(e=u.x-u.width/2,n=u.x+u.width/2,i=u.y,r=1,o=(a=u.base)>i?1:-1,s=u.borderSkipped||"bottom"),d){var c=Math.min(Math.abs(e-n),Math.abs(i-a)),h=(d=d>c?c:d)/2,f=e+("left"!==s?h*r:0),g=n+("right"!==s?-h*r:0),m=i+("top"!==s?h*o:0),p=a+("bottom"!==s?-h*o:0);f!==g&&(i=m,a=p),m!==p&&(e=f,n=g)}l.beginPath(),l.fillStyle=u.backgroundColor,l.strokeStyle=u.borderColor,l.lineWidth=d;var v=[[e,a],[e,i],[n,i],[n,a]],y=["bottom","left","top","right"].indexOf(s,0);-1===y&&(y=0);var b=t(0);l.moveTo(b[0],b[1]);for(var x=1;x<4;x++)b=t(x),l.lineTo(b[0],b[1]);l.fill(),d&&l.stroke()},height:function(){var t=this._view;return t.base-t.y},inRange:function(t,e){var n=!1;if(this._view){var i=a(this);n=t>=i.left&&t<=i.right&&e>=i.top&&e<=i.bottom}return n},inLabelRange:function(t,e){var n=this;if(!n._view)return!1;var r=a(n);return i(n)?t>=r.left&&t<=r.right:e>=r.top&&e<=r.bottom},inXRange:function(t){var e=a(this);return t>=e.left&&t<=e.right},inYRange:function(t){var e=a(this);return t>=e.top&&t<=e.bottom},getCenterPoint:function(){var t,e,n=this._view;return i(this)?(t=n.x,e=(n.y+n.base)/2):(t=(n.x+n.base)/2,e=n.y),{x:t,y:e}},getArea:function(){var t=this._view;return t.width*Math.abs(t.y-t.base)},tooltipPosition:function(){var t=this._view;return{x:t.x,y:t.y}}})},{25:25,26:26}],40:[function(t,e,n){"use strict";e.exports={},e.exports.Arc=t(36),e.exports.Line=t(37),e.exports.Point=t(38),e.exports.Rectangle=t(39)},{36:36,37:37,38:38,39:39}],41:[function(t,e,n){"use strict";var i=t(42),n=e.exports={clear:function(t){t.ctx.clearRect(0,0,t.width,t.height)},roundedRect:function(t,e,n,i,a,r){if(r){var o=Math.min(r,i/2),s=Math.min(r,a/2);t.moveTo(e+o,n),t.lineTo(e+i-o,n),t.quadraticCurveTo(e+i,n,e+i,n+s),t.lineTo(e+i,n+a-s),t.quadraticCurveTo(e+i,n+a,e+i-o,n+a),t.lineTo(e+o,n+a),t.quadraticCurveTo(e,n+a,e,n+a-s),t.lineTo(e,n+s),t.quadraticCurveTo(e,n,e+o,n)}else t.rect(e,n,i,a)},drawPoint:function(t,e,n,i,a){var r,o,s,l,u,d;if("object"!=typeof e||"[object HTMLImageElement]"!==(r=e.toString())&&"[object HTMLCanvasElement]"!==r){if(!(isNaN(n)||n<=0)){switch(e){default:t.beginPath(),t.arc(i,a,n,0,2*Math.PI),t.closePath(),t.fill();break;case"triangle":t.beginPath(),u=(o=3*n/Math.sqrt(3))*Math.sqrt(3)/2,t.moveTo(i-o/2,a+u/3),t.lineTo(i+o/2,a+u/3),t.lineTo(i,a-2*u/3),t.closePath(),t.fill();break;case"rect":d=1/Math.SQRT2*n,t.beginPath(),t.fillRect(i-d,a-d,2*d,2*d),t.strokeRect(i-d,a-d,2*d,2*d);break;case"rectRounded":var c=n/Math.SQRT2,h=i-c,f=a-c,g=Math.SQRT2*n;t.beginPath(),this.roundedRect(t,h,f,g,g,n/2),t.closePath(),t.fill();break;case"rectRot":d=1/Math.SQRT2*n,t.beginPath(),t.moveTo(i-d,a),t.lineTo(i,a+d),t.lineTo(i+d,a),t.lineTo(i,a-d),t.closePath(),t.fill();break;case"cross":t.beginPath(),t.moveTo(i,a+n),t.lineTo(i,a-n),t.moveTo(i-n,a),t.lineTo(i+n,a),t.closePath();break;case"crossRot":t.beginPath(),s=Math.cos(Math.PI/4)*n,l=Math.sin(Math.PI/4)*n,t.moveTo(i-s,a-l),t.lineTo(i+s,a+l),t.moveTo(i-s,a+l),t.lineTo(i+s,a-l),t.closePath();break;case"star":t.beginPath(),t.moveTo(i,a+n),t.lineTo(i,a-n),t.moveTo(i-n,a),t.lineTo(i+n,a),s=Math.cos(Math.PI/4)*n,l=Math.sin(Math.PI/4)*n,t.moveTo(i-s,a-l),t.lineTo(i+s,a+l),t.moveTo(i-s,a+l),t.lineTo(i+s,a-l),t.closePath();break;case"line":t.beginPath(),t.moveTo(i-n,a),t.lineTo(i+n,a),t.closePath();break;case"dash":t.beginPath(),t.moveTo(i,a),t.lineTo(i+n,a),t.closePath()}t.stroke()}}else t.drawImage(e,i-e.width/2,a-e.height/2,e.width,e.height)},clipArea:function(t,e){t.save(),t.beginPath(),t.rect(e.left,e.top,e.right-e.left,e.bottom-e.top),t.clip()},unclipArea:function(t){t.restore()},lineTo:function(t,e,n,i){if(n.steppedLine)return"after"===n.steppedLine&&!i||"after"!==n.steppedLine&&i?t.lineTo(e.x,n.y):t.lineTo(n.x,e.y),void t.lineTo(n.x,n.y);n.tension?t.bezierCurveTo(i?e.controlPointPreviousX:e.controlPointNextX,i?e.controlPointPreviousY:e.controlPointNextY,i?n.controlPointNextX:n.controlPointPreviousX,i?n.controlPointNextY:n.controlPointPreviousY,n.x,n.y):t.lineTo(n.x,n.y)}};i.clear=n.clear,i.drawRoundedRectangle=function(t){t.beginPath(),n.roundedRect.apply(n,arguments),t.closePath()}},{42:42}],42:[function(t,e,n){"use strict";var i={noop:function(){},uid:function(){var t=0;return function(){return t++}}(),isNullOrUndef:function(t){return null===t||void 0===t},isArray:Array.isArray?Array.isArray:function(t){return"[object Array]"===Object.prototype.toString.call(t)},isObject:function(t){return null!==t&&"[object Object]"===Object.prototype.toString.call(t)},valueOrDefault:function(t,e){return void 0===t?e:t},valueAtIndexOrDefault:function(t,e,n){return i.valueOrDefault(i.isArray(t)?t[e]:t,n)},callback:function(t,e,n){if(t&&"function"==typeof t.call)return t.apply(n,e)},each:function(t,e,n,a){var r,o,s;if(i.isArray(t))if(o=t.length,a)for(r=o-1;r>=0;r--)e.call(n,t[r],r);else for(r=0;r=1?t:-(Math.sqrt(1-t*t)-1)},easeOutCirc:function(t){return Math.sqrt(1-(t-=1)*t)},easeInOutCirc:function(t){return(t/=.5)<1?-.5*(Math.sqrt(1-t*t)-1):.5*(Math.sqrt(1-(t-=2)*t)+1)},easeInElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:1===t?1:(n||(n=.3),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),-i*Math.pow(2,10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n))},easeOutElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:1===t?1:(n||(n=.3),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),i*Math.pow(2,-10*t)*Math.sin((t-e)*(2*Math.PI)/n)+1)},easeInOutElastic:function(t){var e=1.70158,n=0,i=1;return 0===t?0:2==(t/=.5)?1:(n||(n=.45),i<1?(i=1,e=n/4):e=n/(2*Math.PI)*Math.asin(1/i),t<1?i*Math.pow(2,10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n)*-.5:i*Math.pow(2,-10*(t-=1))*Math.sin((t-e)*(2*Math.PI)/n)*.5+1)},easeInBack:function(t){var e=1.70158;return t*t*((e+1)*t-e)},easeOutBack:function(t){var e=1.70158;return(t-=1)*t*((e+1)*t+e)+1},easeInOutBack:function(t){var e=1.70158;return(t/=.5)<1?t*t*((1+(e*=1.525))*t-e)*.5:.5*((t-=2)*t*((1+(e*=1.525))*t+e)+2)},easeInBounce:function(t){return 1-a.easeOutBounce(1-t)},easeOutBounce:function(t){return t<1/2.75?7.5625*t*t:t<2/2.75?7.5625*(t-=1.5/2.75)*t+.75:t<2.5/2.75?7.5625*(t-=2.25/2.75)*t+.9375:7.5625*(t-=2.625/2.75)*t+.984375},easeInOutBounce:function(t){return t<.5?.5*a.easeInBounce(2*t):.5*a.easeOutBounce(2*t-1)+.5}};e.exports={effects:a},i.easingEffects=a},{42:42}],44:[function(t,e,n){"use strict";var i=t(42);e.exports={toLineHeight:function(t,e){var n=(""+t).match(/^(normal|(\d+(?:\.\d+)?)(px|em|%)?)$/);if(!n||"normal"===n[1])return 1.2*e;switch(t=+n[2],n[3]){case"px":return t;case"%":t/=100}return e*t},toPadding:function(t){var e,n,a,r;return i.isObject(t)?(e=+t.top||0,n=+t.right||0,a=+t.bottom||0,r=+t.left||0):e=n=a=r=+t||0,{top:e,right:n,bottom:a,left:r,height:e+a,width:r+n}},resolve:function(t,e,n){var a,r,o;for(a=0,r=t.length;a
';var a=e.childNodes[0],o=e.childNodes[1];e._reset=function(){a.scrollLeft=1e6,a.scrollTop=1e6,o.scrollLeft=1e6,o.scrollTop=1e6};var s=function(){e._reset(),t()};return r(a,"scroll",s.bind(a,"expand")),r(o,"scroll",s.bind(o,"shrink")),e}function c(t,e){var n=(t[v]||(t[v]={})).renderProxy=function(t){t.animationName===x&&e()};p.each(_,function(e){r(t,e,n)}),t.classList.add(b)}function h(t){var e=t[v]||{},n=e.renderProxy;n&&(p.each(_,function(e){o(t,e,n)}),delete e.renderProxy),t.classList.remove(b)}function f(t,e,n){var i=t[v]||(t[v]={}),a=i.resizer=d(u(function(){if(i.resizer)return e(s("resize",n))}));c(t,function(){if(i.resizer){var e=t.parentNode;e&&e!==a.parentNode&&e.insertBefore(a,e.firstChild),a._reset()}})}function g(t){var e=t[v]||{},n=e.resizer;delete e.resizer,h(t),n&&n.parentNode&&n.parentNode.removeChild(n)}function m(t,e){var n=t._style||document.createElement("style");t._style||(t._style=n,e="/* Chart.js */\n"+e,n.setAttribute("type","text/css"),document.getElementsByTagName("head")[0].appendChild(n)),n.appendChild(document.createTextNode(e))}var p=t(45),v="$chartjs",y="chartjs-",b=y+"render-monitor",x=y+"render-animation",_=["animationstart","webkitAnimationStart"],k={touchstart:"mousedown",touchmove:"mousemove",touchend:"mouseup",pointerenter:"mouseenter",pointerdown:"mousedown",pointermove:"mousemove",pointerup:"mouseup",pointerleave:"mouseout",pointerout:"mouseout"},w=!!function(){var t=!1;try{var e=Object.defineProperty({},"passive",{get:function(){t=!0}});window.addEventListener("e",null,e)}catch(t){}return t}()&&{passive:!0};e.exports={_enabled:"undefined"!=typeof window&&"undefined"!=typeof document,initialize:function(){var t="from{opacity:0.99}to{opacity:1}";m(this,"@-webkit-keyframes "+x+"{"+t+"}@keyframes "+x+"{"+t+"}."+b+"{-webkit-animation:"+x+" 0.001s;animation:"+x+" 0.001s;}")},acquireContext:function(t,e){"string"==typeof t?t=document.getElementById(t):t.length&&(t=t[0]),t&&t.canvas&&(t=t.canvas);var n=t&&t.getContext&&t.getContext("2d");return n&&n.canvas===t?(a(t,e),n):null},releaseContext:function(t){var e=t.canvas;if(e[v]){var n=e[v].initial;["height","width"].forEach(function(t){var i=n[t];p.isNullOrUndef(i)?e.removeAttribute(t):e.setAttribute(t,i)}),p.each(n.style||{},function(t,n){e.style[n]=t}),e.width=e.width,delete e[v]}},addEventListener:function(t,e,n){var i=t.canvas;if("resize"!==e){var a=n[v]||(n[v]={});r(i,e,(a.proxies||(a.proxies={}))[t.id+"_"+e]=function(e){n(l(e,t))})}else f(i,n,t)},removeEventListener:function(t,e,n){var i=t.canvas;if("resize"!==e){var a=((n[v]||{}).proxies||{})[t.id+"_"+e];a&&o(i,e,a)}else g(i)}},p.addEvent=r,p.removeEvent=o},{45:45}],48:[function(t,e,n){"use strict";var i=t(45),a=t(46),r=t(47),o=r._enabled?r:a;e.exports=i.extend({initialize:function(){},acquireContext:function(){},releaseContext:function(){},addEventListener:function(){},removeEventListener:function(){}},o)},{45:45,46:46,47:47}],49:[function(t,e,n){"use strict";var i=t(25),a=t(40),r=t(45);i._set("global",{plugins:{filler:{propagate:!0}}}),e.exports=function(){function t(t,e,n){var i,a=t._model||{},r=a.fill;if(void 0===r&&(r=!!a.backgroundColor),!1===r||null===r)return!1;if(!0===r)return"origin";if(i=parseFloat(r,10),isFinite(i)&&Math.floor(i)===i)return"-"!==r[0]&&"+"!==r[0]||(i=e+i),!(i===e||i<0||i>=n)&&i;switch(r){case"bottom":return"start";case"top":return"end";case"zero":return"origin";case"origin":case"start":case"end":return r;default:return!1}}function e(t){var e,n=t.el._model||{},i=t.el._scale||{},a=t.fill,r=null;if(isFinite(a))return null;if("start"===a?r=void 0===n.scaleBottom?i.bottom:n.scaleBottom:"end"===a?r=void 0===n.scaleTop?i.top:n.scaleTop:void 0!==n.scaleZero?r=n.scaleZero:i.getBasePosition?r=i.getBasePosition():i.getBasePixel&&(r=i.getBasePixel()),void 0!==r&&null!==r){if(void 0!==r.x&&void 0!==r.y)return r;if("number"==typeof r&&isFinite(r))return e=i.isHorizontal(),{x:e?r:null,y:e?null:r}}return null}function n(t,e,n){var i,a=t[e].fill,r=[e];if(!n)return a;for(;!1!==a&&-1===r.indexOf(a);){if(!isFinite(a))return a;if(!(i=t[a]))return!1;if(i.visible)return a;r.push(a),a=i.fill}return!1}function o(t){var e=t.fill,n="dataset";return!1===e?null:(isFinite(e)||(n="boundary"),d[n](t))}function s(t){return t&&!t.skip}function l(t,e,n,i,a){var o;if(i&&a){for(t.moveTo(e[0].x,e[0].y),o=1;o0;--o)r.canvas.lineTo(t,n[o],n[o-1],!0)}}function u(t,e,n,i,a,r){var o,u,d,c,h,f,g,m=e.length,p=i.spanGaps,v=[],y=[],b=0,x=0;for(t.beginPath(),o=0,u=m+!!r;o');for(var n=0;n'),t.data.datasets[n].label&&e.push(t.data.datasets[n].label),e.push("");return e.push(""),e.join("")}}),e.exports=function(t){function e(t,e){return t.usePointStyle?e*Math.SQRT2:t.boxWidth}function n(e,n){var i=new t.Legend({ctx:e.ctx,options:n,chart:e});o.configure(e,i,n),o.addBox(e,i),e.legend=i}var o=t.layoutService,s=r.noop;return t.Legend=a.extend({initialize:function(t){r.extend(this,t),this.legendHitBoxes=[],this.doughnutMode=!1},beforeUpdate:s,update:function(t,e,n){var i=this;return i.beforeUpdate(),i.maxWidth=t,i.maxHeight=e,i.margins=n,i.beforeSetDimensions(),i.setDimensions(),i.afterSetDimensions(),i.beforeBuildLabels(),i.buildLabels(),i.afterBuildLabels(),i.beforeFit(),i.fit(),i.afterFit(),i.afterUpdate(),i.minSize},afterUpdate:s,beforeSetDimensions:s,setDimensions:function(){var t=this;t.isHorizontal()?(t.width=t.maxWidth,t.left=0,t.right=t.width):(t.height=t.maxHeight,t.top=0,t.bottom=t.height),t.paddingLeft=0,t.paddingTop=0,t.paddingRight=0,t.paddingBottom=0,t.minSize={width:0,height:0}},afterSetDimensions:s,beforeBuildLabels:s,buildLabels:function(){var t=this,e=t.options.labels||{},n=r.callback(e.generateLabels,[t.chart],t)||[];e.filter&&(n=n.filter(function(n){return e.filter(n,t.chart.data)})),t.options.reverse&&n.reverse(),t.legendItems=n},afterBuildLabels:s,beforeFit:s,fit:function(){var t=this,n=t.options,a=n.labels,o=n.display,s=t.ctx,l=i.global,u=r.valueOrDefault,d=u(a.fontSize,l.defaultFontSize),c=u(a.fontStyle,l.defaultFontStyle),h=u(a.fontFamily,l.defaultFontFamily),f=r.fontString(d,c,h),g=t.legendHitBoxes=[],m=t.minSize,p=t.isHorizontal();if(p?(m.width=t.maxWidth,m.height=o?10:0):(m.width=o?10:0,m.height=t.maxHeight),o)if(s.font=f,p){var v=t.lineWidths=[0],y=t.legendItems.length?d+a.padding:0;s.textAlign="left",s.textBaseline="top",r.each(t.legendItems,function(n,i){var r=e(a,d)+d/2+s.measureText(n.text).width;v[v.length-1]+r+a.padding>=t.width&&(y+=d+a.padding,v[v.length]=t.left),g[i]={left:0,top:0,width:r,height:d},v[v.length-1]+=r+a.padding}),m.height+=y}else{var b=a.padding,x=t.columnWidths=[],_=a.padding,k=0,w=0,M=d+b;r.each(t.legendItems,function(t,n){var i=e(a,d)+d/2+s.measureText(t.text).width;w+M>m.height&&(_+=k+a.padding,x.push(k),k=0,w=0),k=Math.max(k,i),w+=M,g[n]={left:0,top:0,width:i,height:d}}),_+=k,x.push(k),m.width+=_}t.width=m.width,t.height=m.height},afterFit:s,isHorizontal:function(){return"top"===this.options.position||"bottom"===this.options.position},draw:function(){var t=this,n=t.options,a=n.labels,o=i.global,s=o.elements.line,l=t.width,u=t.lineWidths;if(n.display){var d,c=t.ctx,h=r.valueOrDefault,f=h(a.fontColor,o.defaultFontColor),g=h(a.fontSize,o.defaultFontSize),m=h(a.fontStyle,o.defaultFontStyle),p=h(a.fontFamily,o.defaultFontFamily),v=r.fontString(g,m,p);c.textAlign="left",c.textBaseline="middle",c.lineWidth=.5,c.strokeStyle=f,c.fillStyle=f,c.font=v;var y=e(a,g),b=t.legendHitBoxes,x=function(t,e,i){if(!(isNaN(y)||y<=0)){c.save(),c.fillStyle=h(i.fillStyle,o.defaultColor),c.lineCap=h(i.lineCap,s.borderCapStyle),c.lineDashOffset=h(i.lineDashOffset,s.borderDashOffset),c.lineJoin=h(i.lineJoin,s.borderJoinStyle),c.lineWidth=h(i.lineWidth,s.borderWidth),c.strokeStyle=h(i.strokeStyle,o.defaultColor);var a=0===h(i.lineWidth,s.borderWidth);if(c.setLineDash&&c.setLineDash(h(i.lineDash,s.borderDash)),n.labels&&n.labels.usePointStyle){var l=g*Math.SQRT2/2,u=l/Math.SQRT2,d=t+u,f=e+u;r.canvas.drawPoint(c,i.pointStyle,l,d,f)}else a||c.strokeRect(t,e,y,g),c.fillRect(t,e,y,g);c.restore()}},_=function(t,e,n,i){var a=g/2,r=y+a+t,o=e+a;c.fillText(n.text,r,o),n.hidden&&(c.beginPath(),c.lineWidth=2,c.moveTo(r,o),c.lineTo(r+i,o),c.stroke())},k=t.isHorizontal();d=k?{x:t.left+(l-u[0])/2,y:t.top+a.padding,line:0}:{x:t.left+a.padding,y:t.top+a.padding,line:0};var w=g+a.padding;r.each(t.legendItems,function(e,n){var i=c.measureText(e.text).width,r=y+g/2+i,o=d.x,s=d.y;k?o+r>=l&&(s=d.y+=w,d.line++,o=d.x=t.left+(l-u[d.line])/2):s+w>t.bottom&&(o=d.x=o+t.columnWidths[d.line]+a.padding,s=d.y=t.top+a.padding,d.line++),x(o,s,e),b[n].left=o,b[n].top=s,_(o,s,e,i),k?d.x+=r+a.padding:d.y+=w})}},handleEvent:function(t){var e=this,n=e.options,i="mouseup"===t.type?"click":t.type,a=!1;if("mousemove"===i){if(!n.onHover)return}else{if("click"!==i)return;if(!n.onClick)return}var r=t.x,o=t.y;if(r>=e.left&&r<=e.right&&o>=e.top&&o<=e.bottom)for(var s=e.legendHitBoxes,l=0;l=u.left&&r<=u.left+u.width&&o>=u.top&&o<=u.top+u.height){if("click"===i){n.onClick.call(e,t.native,e.legendItems[l]),a=!0;break}if("mousemove"===i){n.onHover.call(e,t.native,e.legendItems[l]),a=!0;break}}}return a}}),{id:"legend",beforeInit:function(t){var e=t.options.legend;e&&n(t,e)},beforeUpdate:function(t){var e=t.options.legend,a=t.legend;e?(r.mergeIf(e,i.global.legend),a?(o.configure(t,a,e),a.options=e):n(t,e)):a&&(o.removeBox(t,a),delete t.legend)},afterEvent:function(t,e){var n=t.legend;n&&n.handleEvent(e)}}}},{25:25,26:26,45:45}],51:[function(t,e,n){"use strict";var i=t(25),a=t(26),r=t(45);i._set("global",{title:{display:!1,fontStyle:"bold",fullWidth:!0,lineHeight:1.2,padding:10,position:"top",text:"",weight:2e3}}),e.exports=function(t){function e(e,i){var a=new t.Title({ctx:e.ctx,options:i,chart:e});n.configure(e,a,i),n.addBox(e,a),e.titleBlock=a}var n=t.layoutService,o=r.noop;return t.Title=a.extend({initialize:function(t){var e=this;r.extend(e,t),e.legendHitBoxes=[]},beforeUpdate:o,update:function(t,e,n){var i=this;return i.beforeUpdate(),i.maxWidth=t,i.maxHeight=e,i.margins=n,i.beforeSetDimensions(),i.setDimensions(),i.afterSetDimensions(),i.beforeBuildLabels(),i.buildLabels(),i.afterBuildLabels(),i.beforeFit(),i.fit(),i.afterFit(),i.afterUpdate(),i.minSize},afterUpdate:o,beforeSetDimensions:o,setDimensions:function(){var t=this;t.isHorizontal()?(t.width=t.maxWidth,t.left=0,t.right=t.width):(t.height=t.maxHeight,t.top=0,t.bottom=t.height),t.paddingLeft=0,t.paddingTop=0,t.paddingRight=0,t.paddingBottom=0,t.minSize={width:0,height:0}},afterSetDimensions:o,beforeBuildLabels:o,buildLabels:o,afterBuildLabels:o,beforeFit:o,fit:function(){var t=this,e=r.valueOrDefault,n=t.options,a=n.display,o=e(n.fontSize,i.global.defaultFontSize),s=t.minSize,l=r.isArray(n.text)?n.text.length:1,u=r.options.toLineHeight(n.lineHeight,o),d=a?l*u+2*n.padding:0;t.isHorizontal()?(s.width=t.maxWidth,s.height=d):(s.width=d,s.height=t.maxHeight),t.width=s.width,t.height=s.height},afterFit:o,isHorizontal:function(){var t=this.options.position;return"top"===t||"bottom"===t},draw:function(){var t=this,e=t.ctx,n=r.valueOrDefault,a=t.options,o=i.global;if(a.display){var s,l,u,d=n(a.fontSize,o.defaultFontSize),c=n(a.fontStyle,o.defaultFontStyle),h=n(a.fontFamily,o.defaultFontFamily),f=r.fontString(d,c,h),g=r.options.toLineHeight(a.lineHeight,d),m=g/2+a.padding,p=0,v=t.top,y=t.left,b=t.bottom,x=t.right;e.fillStyle=n(a.fontColor,o.defaultFontColor),e.font=f,t.isHorizontal()?(l=y+(x-y)/2,u=v+m,s=x-y):(l="left"===a.position?y+m:x-m,u=v+(b-v)/2,s=b-v,p=Math.PI*("left"===a.position?-.5:.5)),e.save(),e.translate(l,u),e.rotate(p),e.textAlign="center",e.textBaseline="middle";var _=a.text;if(r.isArray(_))for(var k=0,w=0;w<_.length;++w)e.fillText(_[w],0,k,s),k+=g;else e.fillText(_,0,0,s);e.restore()}}}),{id:"title",beforeInit:function(t){var n=t.options.title;n&&e(t,n)},beforeUpdate:function(a){var o=a.options.title,s=a.titleBlock;o?(r.mergeIf(o,i.global.title),s?(n.configure(a,s,o),s.options=o):e(a,o)):s&&(t.layoutService.removeBox(a,s),delete a.titleBlock)}}}},{25:25,26:26,45:45}],52:[function(t,e,n){"use strict";e.exports=function(t){var e={position:"bottom"},n=t.Scale.extend({getLabels:function(){var t=this.chart.data;return this.options.labels||(this.isHorizontal()?t.xLabels:t.yLabels)||t.labels},determineDataLimits:function(){var t=this,e=t.getLabels();t.minIndex=0,t.maxIndex=e.length-1;var n;void 0!==t.options.ticks.min&&(n=e.indexOf(t.options.ticks.min),t.minIndex=-1!==n?n:t.minIndex),void 0!==t.options.ticks.max&&(n=e.indexOf(t.options.ticks.max),t.maxIndex=-1!==n?n:t.maxIndex),t.min=e[t.minIndex],t.max=e[t.maxIndex]},buildTicks:function(){var t=this,e=t.getLabels();t.ticks=0===t.minIndex&&t.maxIndex===e.length-1?e:e.slice(t.minIndex,t.maxIndex+1)},getLabelForIndex:function(t,e){var n=this,i=n.chart.data,a=n.isHorizontal();return i.yLabels&&!a?n.getRightValue(i.datasets[e].data[t]):n.ticks[t-n.minIndex]},getPixelForValue:function(t,e){var n,i=this,a=i.options.offset,r=Math.max(i.maxIndex+1-i.minIndex-(a?0:1),1);if(void 0!==t&&null!==t&&(n=i.isHorizontal()?t.x:t.y),void 0!==n||void 0!==t&&isNaN(e)){var o=i.getLabels();t=n||t;var s=o.indexOf(t);e=-1!==s?s:e}if(i.isHorizontal()){var l=i.width/r,u=l*(e-i.minIndex);return a&&(u+=l/2),i.left+Math.round(u)}var d=i.height/r,c=d*(e-i.minIndex);return a&&(c+=d/2),i.top+Math.round(c)},getPixelForTick:function(t){return this.getPixelForValue(this.ticks[t],t+this.minIndex,null)},getValueForPixel:function(t){var e=this,n=e.options.offset,i=Math.max(e._ticks.length-(n?0:1),1),a=e.isHorizontal(),r=(a?e.width:e.height)/i;return t-=a?e.left:e.top,n&&(t-=r/2),(t<=0?0:Math.round(t/r))+e.minIndex},getBasePixel:function(){return this.bottom}});t.scaleService.registerScaleType("category",n,e)}},{}],53:[function(t,e,n){"use strict";var i=t(25),a=t(45),r=t(34);e.exports=function(t){var e={position:"left",ticks:{callback:r.formatters.linear}},n=t.LinearScaleBase.extend({determineDataLimits:function(){function t(t){return o?t.xAxisID===e.id:t.yAxisID===e.id}var e=this,n=e.options,i=e.chart,r=i.data.datasets,o=e.isHorizontal();e.min=null,e.max=null;var s=n.stacked;if(void 0===s&&a.each(r,function(e,n){if(!s){var a=i.getDatasetMeta(n);i.isDatasetVisible(n)&&t(a)&&void 0!==a.stack&&(s=!0)}}),n.stacked||s){var l={};a.each(r,function(r,o){var s=i.getDatasetMeta(o),u=[s.type,void 0===n.stacked&&void 0===s.stack?o:"",s.stack].join(".");void 0===l[u]&&(l[u]={positiveValues:[],negativeValues:[]});var d=l[u].positiveValues,c=l[u].negativeValues;i.isDatasetVisible(o)&&t(s)&&a.each(r.data,function(t,i){var a=+e.getRightValue(t);isNaN(a)||s.data[i].hidden||(d[i]=d[i]||0,c[i]=c[i]||0,n.relativePoints?d[i]=100:a<0?c[i]+=a:d[i]+=a)})}),a.each(l,function(t){var n=t.positiveValues.concat(t.negativeValues),i=a.min(n),r=a.max(n);e.min=null===e.min?i:Math.min(e.min,i),e.max=null===e.max?r:Math.max(e.max,r)})}else a.each(r,function(n,r){var o=i.getDatasetMeta(r);i.isDatasetVisible(r)&&t(o)&&a.each(n.data,function(t,n){var i=+e.getRightValue(t);isNaN(i)||o.data[n].hidden||(null===e.min?e.min=i:ie.max&&(e.max=i))})});e.min=isFinite(e.min)&&!isNaN(e.min)?e.min:0,e.max=isFinite(e.max)&&!isNaN(e.max)?e.max:1,this.handleTickRangeOptions()},getTickLimit:function(){var t,e=this,n=e.options.ticks;if(e.isHorizontal())t=Math.min(n.maxTicksLimit?n.maxTicksLimit:11,Math.ceil(e.width/50));else{var r=a.valueOrDefault(n.fontSize,i.global.defaultFontSize);t=Math.min(n.maxTicksLimit?n.maxTicksLimit:11,Math.ceil(e.height/(2*r)))}return t},handleDirectionalChanges:function(){this.isHorizontal()||this.ticks.reverse()},getLabelForIndex:function(t,e){return+this.getRightValue(this.chart.data.datasets[e].data[t])},getPixelForValue:function(t){var e,n=this,i=n.start,a=+n.getRightValue(t),r=n.end-i;return n.isHorizontal()?(e=n.left+n.width/r*(a-i),Math.round(e)):(e=n.bottom-n.height/r*(a-i),Math.round(e))},getValueForPixel:function(t){var e=this,n=e.isHorizontal(),i=n?e.width:e.height,a=(n?t-e.left:e.bottom-t)/i;return e.start+(e.end-e.start)*a},getPixelForTick:function(t){return this.getPixelForValue(this.ticksAsNumbers[t])}});t.scaleService.registerScaleType("linear",n,e)}},{25:25,34:34,45:45}],54:[function(t,e,n){"use strict";var i=t(45),a=t(34);e.exports=function(t){var e=i.noop;t.LinearScaleBase=t.Scale.extend({getRightValue:function(e){return"string"==typeof e?+e:t.Scale.prototype.getRightValue.call(this,e)},handleTickRangeOptions:function(){var t=this,e=t.options.ticks;if(e.beginAtZero){var n=i.sign(t.min),a=i.sign(t.max);n<0&&a<0?t.max=0:n>0&&a>0&&(t.min=0)}var r=void 0!==e.min||void 0!==e.suggestedMin,o=void 0!==e.max||void 0!==e.suggestedMax;void 0!==e.min?t.min=e.min:void 0!==e.suggestedMin&&(null===t.min?t.min=e.suggestedMin:t.min=Math.min(t.min,e.suggestedMin)),void 0!==e.max?t.max=e.max:void 0!==e.suggestedMax&&(null===t.max?t.max=e.suggestedMax:t.max=Math.max(t.max,e.suggestedMax)),r!==o&&t.min>=t.max&&(r?t.max=t.min+1:t.min=t.max-1),t.min===t.max&&(t.max++,e.beginAtZero||t.min--)},getTickLimit:e,handleDirectionalChanges:e,buildTicks:function(){var t=this,e=t.options.ticks,n=t.getTickLimit(),r={maxTicks:n=Math.max(2,n),min:e.min,max:e.max,stepSize:i.valueOrDefault(e.fixedStepSize,e.stepSize)},o=t.ticks=a.generators.linear(r,t);t.handleDirectionalChanges(),t.max=i.max(o),t.min=i.min(o),e.reverse?(o.reverse(),t.start=t.max,t.end=t.min):(t.start=t.min,t.end=t.max)},convertTicksToLabels:function(){var e=this;e.ticksAsNumbers=e.ticks.slice(),e.zeroLineIndex=e.ticks.indexOf(0),t.Scale.prototype.convertTicksToLabels.call(e)}})}},{34:34,45:45}],55:[function(t,e,n){"use strict";var i=t(45),a=t(34);e.exports=function(t){var e={position:"left",ticks:{callback:a.formatters.logarithmic}},n=t.Scale.extend({determineDataLimits:function(){function t(t){return l?t.xAxisID===e.id:t.yAxisID===e.id}var e=this,n=e.options,a=n.ticks,r=e.chart,o=r.data.datasets,s=i.valueOrDefault,l=e.isHorizontal();e.min=null,e.max=null,e.minNotZero=null;var u=n.stacked;if(void 0===u&&i.each(o,function(e,n){if(!u){var i=r.getDatasetMeta(n);r.isDatasetVisible(n)&&t(i)&&void 0!==i.stack&&(u=!0)}}),n.stacked||u){var d={};i.each(o,function(a,o){var s=r.getDatasetMeta(o),l=[s.type,void 0===n.stacked&&void 0===s.stack?o:"",s.stack].join(".");r.isDatasetVisible(o)&&t(s)&&(void 0===d[l]&&(d[l]=[]),i.each(a.data,function(t,i){var a=d[l],r=+e.getRightValue(t);isNaN(r)||s.data[i].hidden||(a[i]=a[i]||0,n.relativePoints?a[i]=100:a[i]+=r)}))}),i.each(d,function(t){var n=i.min(t),a=i.max(t);e.min=null===e.min?n:Math.min(e.min,n),e.max=null===e.max?a:Math.max(e.max,a)})}else i.each(o,function(n,a){var o=r.getDatasetMeta(a);r.isDatasetVisible(a)&&t(o)&&i.each(n.data,function(t,n){var i=+e.getRightValue(t);isNaN(i)||o.data[n].hidden||(null===e.min?e.min=i:ie.max&&(e.max=i),0!==i&&(null===e.minNotZero||ia?{start:e-n-5,end:e}:{start:e,end:e+n+5}}function l(t){var i,r,l,u=n(t),d=Math.min(t.height/2,t.width/2),c={r:t.width,l:0,t:t.height,b:0},h={};t.ctx.font=u.font,t._pointLabelSizes=[];var f=e(t);for(i=0;ic.r&&(c.r=p.end,h.r=g),v.startc.b&&(c.b=v.end,h.b=g)}t.setReductions(d,c,h)}function u(t){var e=Math.min(t.height/2,t.width/2);t.drawingArea=Math.round(e),t.setCenterPoint(0,0,0,0)}function d(t){return 0===t||180===t?"center":t<180?"left":"right"}function c(t,e,n,i){if(a.isArray(e))for(var r=n.y,o=1.5*i,s=0;s270||t<90)&&(n.y-=e.h)}function f(t){var i=t.ctx,r=a.valueOrDefault,o=t.options,s=o.angleLines,l=o.pointLabels;i.lineWidth=s.lineWidth,i.strokeStyle=s.color;var u=t.getDistanceFromCenterForValue(o.ticks.reverse?t.min:t.max),f=n(t);i.textBaseline="top";for(var g=e(t)-1;g>=0;g--){if(s.display){var m=t.getPointPosition(g,u);i.beginPath(),i.moveTo(t.xCenter,t.yCenter),i.lineTo(m.x,m.y),i.stroke(),i.closePath()}if(l.display){var v=t.getPointPosition(g,u+5),y=r(l.fontColor,p.defaultFontColor);i.font=f.font,i.fillStyle=y;var b=t.getIndexAngle(g),x=a.toDegrees(b);i.textAlign=d(x),h(x,t._pointLabelSizes[g],v),c(i,t.pointLabels[g]||"",v,f.size)}}}function g(t,n,i,r){var o=t.ctx;if(o.strokeStyle=a.valueAtIndexOrDefault(n.color,r-1),o.lineWidth=a.valueAtIndexOrDefault(n.lineWidth,r-1),t.options.gridLines.circular)o.beginPath(),o.arc(t.xCenter,t.yCenter,i,0,2*Math.PI),o.closePath(),o.stroke();else{var s=e(t);if(0===s)return;o.beginPath();var l=t.getPointPosition(0,i);o.moveTo(l.x,l.y);for(var u=1;u0&&n>0?e:0)},draw:function(){var t=this,e=t.options,n=e.gridLines,i=e.ticks,r=a.valueOrDefault;if(e.display){var o=t.ctx,s=this.getIndexAngle(0),l=r(i.fontSize,p.defaultFontSize),u=r(i.fontStyle,p.defaultFontStyle),d=r(i.fontFamily,p.defaultFontFamily),c=a.fontString(l,u,d);a.each(t.ticks,function(e,a){if(a>0||i.reverse){var u=t.getDistanceFromCenterForValue(t.ticksAsNumbers[a]);if(n.display&&0!==a&&g(t,n,u,a),i.display){var d=r(i.fontColor,p.defaultFontColor);if(o.font=c,o.save(),o.translate(t.xCenter,t.yCenter),o.rotate(s),i.showLabelBackdrop){var h=o.measureText(e).width;o.fillStyle=i.backdropColor,o.fillRect(-h/2-i.backdropPaddingX,-u-l/2-i.backdropPaddingY,h+2*i.backdropPaddingX,l+2*i.backdropPaddingY)}o.textAlign="center",o.textBaseline="middle",o.fillStyle=d,o.fillText(e,0,-u),o.restore()}}}),(e.angleLines.display||e.pointLabels.display)&&f(t)}}});t.scaleService.registerScaleType("radialLinear",y,v)}},{25:25,34:34,45:45}],57:[function(t,e,n){"use strict";function i(t,e){return t-e}function a(t){var e,n,i,a={},r=[];for(e=0,n=t.length;ee&&s=0&&o<=s;){if(i=o+s>>1,a=t[i-1]||null,r=t[i],!a)return{lo:null,hi:r};if(r[e]n))return{lo:a,hi:r};s=i-1}}return{lo:r,hi:null}}function s(t,e,n,i){var a=o(t,e,n),r=a.lo?a.hi?a.lo:t[t.length-2]:t[0],s=a.lo?a.hi?a.hi:t[t.length-1]:t[1],l=s[e]-r[e],u=l?(n-r[e])/l:0,d=(s[i]-r[i])*u;return r[i]+d}function l(t,e){var n=e.parser,i=e.parser||e.format;return"function"==typeof n?n(t):"string"==typeof t&&"string"==typeof i?p(t,i):(t instanceof p||(t=p(t)),t.isValid()?t:"function"==typeof i?i(t):t)}function u(t,e){if(y.isNullOrUndef(t))return null;var n=e.options.time,i=l(e.getRightValue(t),n);return i.isValid()?(n.round&&i.startOf(n.round),i.valueOf()):null}function d(t,e,n,i){var a,r,o,s=e-t,l=_[n],u=l.size,d=l.steps;if(!d)return Math.ceil(s/((i||1)*u));for(a=0,r=d.length;a1?e[1]:i,o=e[0],l=(s(t,"time",r,"pos")-s(t,"time",o,"pos"))/2),a.time.max||(r=e[e.length-1],o=e.length>1?e[e.length-2]:n,u=(s(t,"time",r,"pos")-s(t,"time",o,"pos"))/2)),{left:l,right:u}}function m(t,e){var n,i,a,r,o=[];for(n=0,i=t.length;n=a&&n<=o&&x.push(n);return i.min=a,i.max=o,i._unit=v,i._majorUnit=y,i._minorFormat=d[v],i._majorFormat=d[y],i._table=r(i._timestamps.data,a,o,s.distribution),i._offsets=g(i._table,x,a,o,s),m(x,y)},getLabelForIndex:function(t,e){var n=this,i=n.chart.data,a=n.options.time,r=i.labels&&t=0&&t + * @version 1.2.2 + * @licence MIT + * @preserve + */ +!function(i){if("function"==typeof define&&define.amd)define(["jquery"],i);else if("object"==typeof module&&module.exports){var t=require("jquery");i(t),module.exports=t}else i(jQuery)}(function(i){function t(i){this.init(i)}t.prototype={value:0,size:100,startAngle:-Math.PI,thickness:"auto",fill:{gradient:["#3aeabb","#fdd250"]},emptyFill:"rgba(0, 0, 0, .1)",animation:{duration:1200,easing:"circleProgressEasing"},animationStartValue:0,reverse:!1,lineCap:"butt",insertMode:"prepend",constructor:t,el:null,canvas:null,ctx:null,radius:0,arcFill:null,lastFrameValue:0,init:function(t){i.extend(this,t),this.radius=this.size/2,this.initWidget(),this.initFill(),this.draw(),this.el.trigger("circle-inited")},initWidget:function(){this.canvas||(this.canvas=i("")["prepend"==this.insertMode?"prependTo":"appendTo"](this.el)[0]);var t=this.canvas;if(t.width=this.size,t.height=this.size,this.ctx=t.getContext("2d"),window.devicePixelRatio>1){var e=window.devicePixelRatio;t.style.width=t.style.height=this.size+"px",t.width=t.height=this.size*e,this.ctx.scale(e,e)}},initFill:function(){function t(){var t=i("")[0];t.width=e.size,t.height=e.size,t.getContext("2d").drawImage(g,0,0,r,r),e.arcFill=e.ctx.createPattern(t,"no-repeat"),e.drawFrame(e.lastFrameValue)}var e=this,a=this.fill,n=this.ctx,r=this.size;if(!a)throw Error("The fill is not specified!");if("string"==typeof a&&(a={color:a}),a.color&&(this.arcFill=a.color),a.gradient){var s=a.gradient;if(1==s.length)this.arcFill=s[0];else if(s.length>1){for(var l=a.gradientAngle||0,o=a.gradientDirection||[r/2*(1-Math.cos(l)),r/2*(1+Math.sin(l)),r/2*(1+Math.cos(l)),r/2*(1-Math.sin(l))],h=n.createLinearGradient.apply(n,o),c=0;c=0&&c0&&b-1 in a)}var x=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ha(),z=ha(),A=ha(),B=function(a,b){return a===b&&(l=!0),0},C={}.hasOwnProperty,D=[],E=D.pop,F=D.push,G=D.push,H=D.slice,I=function(a,b){for(var c=0,d=a.length;c+~]|"+K+")"+K+"*"),S=new RegExp("="+K+"*([^\\]'\"]*?)"+K+"*\\]","g"),T=new RegExp(N),U=new RegExp("^"+L+"$"),V={ID:new RegExp("^#("+L+")"),CLASS:new RegExp("^\\.("+L+")"),TAG:new RegExp("^("+L+"|[*])"),ATTR:new RegExp("^"+M),PSEUDO:new RegExp("^"+N),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+K+"*(even|odd|(([+-]|)(\\d*)n|)"+K+"*(?:([+-]|)"+K+"*(\\d+)|))"+K+"*\\)|)","i"),bool:new RegExp("^(?:"+J+")$","i"),needsContext:new RegExp("^"+K+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+K+"*((?:-\\d)?\\d*)"+K+"*\\)|)(?=[^-]|$)","i")},W=/^(?:input|select|textarea|button)$/i,X=/^h\d$/i,Y=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,$=/[+~]/,_=new RegExp("\\\\([\\da-f]{1,6}"+K+"?|("+K+")|.)","ig"),aa=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:d<0?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},ba=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ca=function(a,b){return b?"\0"===a?"\ufffd":a.slice(0,-1)+"\\"+a.charCodeAt(a.length-1).toString(16)+" ":"\\"+a},da=function(){m()},ea=ta(function(a){return a.disabled===!0&&("form"in a||"label"in a)},{dir:"parentNode",next:"legend"});try{G.apply(D=H.call(v.childNodes),v.childNodes),D[v.childNodes.length].nodeType}catch(fa){G={apply:D.length?function(a,b){F.apply(a,H.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function ga(a,b,d,e){var f,h,j,k,l,o,r,s=b&&b.ownerDocument,w=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==w&&9!==w&&11!==w)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==w&&(l=Z.exec(a)))if(f=l[1]){if(9===w){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(s&&(j=s.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(l[2])return G.apply(d,b.getElementsByTagName(a)),d;if((f=l[3])&&c.getElementsByClassName&&b.getElementsByClassName)return G.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==w)s=b,r=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(ba,ca):b.setAttribute("id",k=u),o=g(a),h=o.length;while(h--)o[h]="#"+k+" "+sa(o[h]);r=o.join(","),s=$.test(a)&&qa(b.parentNode)||b}if(r)try{return G.apply(d,s.querySelectorAll(r)),d}catch(x){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(P,"$1"),b,d,e)}function ha(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ia(a){return a[u]=!0,a}function ja(a){var b=n.createElement("fieldset");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ka(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function la(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&a.sourceIndex-b.sourceIndex;if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function na(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function oa(a){return function(b){return"form"in b?b.parentNode&&b.disabled===!1?"label"in b?"label"in b.parentNode?b.parentNode.disabled===a:b.disabled===a:b.isDisabled===a||b.isDisabled!==!a&&ea(b)===a:b.disabled===a:"label"in b&&b.disabled===a}}function pa(a){return ia(function(b){return b=+b,ia(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function qa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=ga.support={},f=ga.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return!!b&&"HTML"!==b.nodeName},m=ga.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),v!==n&&(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ja(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ja(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Y.test(n.getElementsByClassName),c.getById=ja(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){return a.getAttribute("id")===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}}):(d.filter.ID=function(a){var b=a.replace(_,aa);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}},d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c,d,e,f=b.getElementById(a);if(f){if(c=f.getAttributeNode("id"),c&&c.value===a)return[f];e=b.getElementsByName(a),d=0;while(f=e[d++])if(c=f.getAttributeNode("id"),c&&c.value===a)return[f]}return[]}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){if("undefined"!=typeof b.getElementsByClassName&&p)return b.getElementsByClassName(a)},r=[],q=[],(c.qsa=Y.test(n.querySelectorAll))&&(ja(function(a){o.appendChild(a).innerHTML="",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+K+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+K+"*(?:value|"+J+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ja(function(a){a.innerHTML="";var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+K+"*[*^$|!~]?="),2!==a.querySelectorAll(":enabled").length&&q.push(":enabled",":disabled"),o.appendChild(a).disabled=!0,2!==a.querySelectorAll(":disabled").length&&q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Y.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ja(function(a){c.disconnectedMatch=s.call(a,"*"),s.call(a,"[s!='']:x"),r.push("!=",N)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Y.test(o.compareDocumentPosition),t=b||Y.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?I(k,a)-I(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?I(k,a)-I(k,b):0;if(e===f)return la(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?la(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},ga.matches=function(a,b){return ga(a,null,null,b)},ga.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(S,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return ga(b,n,null,[a]).length>0},ga.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},ga.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&C.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},ga.escape=function(a){return(a+"").replace(ba,ca)},ga.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},ga.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=ga.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=ga.selectors={cacheLength:50,createPseudo:ia,match:V,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(_,aa),a[3]=(a[3]||a[4]||a[5]||"").replace(_,aa),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||ga.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&ga.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return V.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&T.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(_,aa).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+K+")"+a+"("+K+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=ga.attr(d,a);return null==e?"!="===b:!b||(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(O," ")+" ").indexOf(c)>-1:"|="===b&&(e===c||e.slice(0,c.length+1)===c+"-"))}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),t===!1)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return t-=e,t===d||t%d===0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||ga.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ia(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=I(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ia(function(a){var b=[],c=[],d=h(a.replace(P,"$1"));return d[u]?ia(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ia(function(a){return function(b){return ga(a,b).length>0}}),contains:ia(function(a){return a=a.replace(_,aa),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ia(function(a){return U.test(a||"")||ga.error("unsupported lang: "+a),a=a.replace(_,aa).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:oa(!1),disabled:oa(!0),checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return X.test(a.nodeName)},input:function(a){return W.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:pa(function(){return[0]}),last:pa(function(a,b){return[b-1]}),eq:pa(function(a,b,c){return[c<0?c+b:c]}),even:pa(function(a,b){for(var c=0;c=0;)a.push(d);return a}),gt:pa(function(a,b,c){for(var d=c<0?c+b:c;++d1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function va(a,b,c){for(var d=0,e=b.length;d-1&&(f[j]=!(g[j]=l))}}else r=wa(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):G.apply(g,r)})}function ya(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=ta(function(a){return a===b},h,!0),l=ta(function(a){return I(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];i1&&ua(m),i>1&&sa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(P,"$1"),c,i0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=E.call(i));u=wa(u)}G.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&ga.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ia(f):f}return h=ga.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=ya(b[c]),f[u]?d.push(f):e.push(f);f=A(a,za(e,d)),f.selector=a}return f},i=ga.select=function(a,b,c,e){var f,i,j,k,l,m="function"==typeof a&&a,n=!e&&g(a=m.selector||a);if(c=c||[],1===n.length){if(i=n[0]=n[0].slice(0),i.length>2&&"ID"===(j=i[0]).type&&9===b.nodeType&&p&&d.relative[i[1].type]){if(b=(d.find.ID(j.matches[0].replace(_,aa),b)||[])[0],!b)return c;m&&(b=b.parentNode),a=a.slice(i.shift().value.length)}f=V.needsContext.test(a)?0:i.length;while(f--){if(j=i[f],d.relative[k=j.type])break;if((l=d.find[k])&&(e=l(j.matches[0].replace(_,aa),$.test(i[0].type)&&qa(b.parentNode)||b))){if(i.splice(f,1),a=e.length&&sa(i),!a)return G.apply(c,e),c;break}}}return(m||h(a,n))(e,b,!p,c,!b||$.test(a)&&qa(b.parentNode)||b),c},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ja(function(a){return 1&a.compareDocumentPosition(n.createElement("fieldset"))}),ja(function(a){return a.innerHTML="","#"===a.firstChild.getAttribute("href")})||ka("type|href|height|width",function(a,b,c){if(!c)return a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ja(function(a){return a.innerHTML="",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ka("value",function(a,b,c){if(!c&&"input"===a.nodeName.toLowerCase())return a.defaultValue}),ja(function(a){return null==a.getAttribute("disabled")})||ka(J,function(a,b,c){var d;if(!c)return a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),ga}(a);r.find=x,r.expr=x.selectors,r.expr[":"]=r.expr.pseudos,r.uniqueSort=r.unique=x.uniqueSort,r.text=x.getText,r.isXMLDoc=x.isXML,r.contains=x.contains,r.escapeSelector=x.escape;var y=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&r(a).is(c))break;d.push(a)}return d},z=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},A=r.expr.match.needsContext;function B(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()}var C=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i,D=/^.[^:#\[\.,]*$/;function E(a,b,c){return r.isFunction(b)?r.grep(a,function(a,d){return!!b.call(a,d,a)!==c}):b.nodeType?r.grep(a,function(a){return a===b!==c}):"string"!=typeof b?r.grep(a,function(a){return i.call(b,a)>-1!==c}):D.test(b)?r.filter(b,a,c):(b=r.filter(b,a),r.grep(a,function(a){return i.call(b,a)>-1!==c&&1===a.nodeType}))}r.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?r.find.matchesSelector(d,a)?[d]:[]:r.find.matches(a,r.grep(b,function(a){return 1===a.nodeType}))},r.fn.extend({find:function(a){var b,c,d=this.length,e=this;if("string"!=typeof a)return this.pushStack(r(a).filter(function(){for(b=0;b1?r.uniqueSort(c):c},filter:function(a){return this.pushStack(E(this,a||[],!1))},not:function(a){return this.pushStack(E(this,a||[],!0))},is:function(a){return!!E(this,"string"==typeof a&&A.test(a)?r(a):a||[],!1).length}});var F,G=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,H=r.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||F,"string"==typeof a){if(e="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:G.exec(a),!e||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof r?b[0]:b,r.merge(this,r.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),C.test(e[1])&&r.isPlainObject(b))for(e in b)r.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}return f=d.getElementById(e[2]),f&&(this[0]=f,this.length=1),this}return a.nodeType?(this[0]=a,this.length=1,this):r.isFunction(a)?void 0!==c.ready?c.ready(a):a(r):r.makeArray(a,this)};H.prototype=r.fn,F=r(d);var I=/^(?:parents|prev(?:Until|All))/,J={children:!0,contents:!0,next:!0,prev:!0};r.fn.extend({has:function(a){var b=r(a,this),c=b.length;return this.filter(function(){for(var a=0;a-1:1===c.nodeType&&r.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?r.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?i.call(r(a),this[0]):i.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(r.uniqueSort(r.merge(this.get(),r(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function K(a,b){while((a=a[b])&&1!==a.nodeType);return a}r.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return y(a,"parentNode")},parentsUntil:function(a,b,c){return y(a,"parentNode",c)},next:function(a){return K(a,"nextSibling")},prev:function(a){return K(a,"previousSibling")},nextAll:function(a){return y(a,"nextSibling")},prevAll:function(a){return y(a,"previousSibling")},nextUntil:function(a,b,c){return y(a,"nextSibling",c)},prevUntil:function(a,b,c){return y(a,"previousSibling",c)},siblings:function(a){return z((a.parentNode||{}).firstChild,a)},children:function(a){return z(a.firstChild)},contents:function(a){return B(a,"iframe")?a.contentDocument:(B(a,"template")&&(a=a.content||a),r.merge([],a.childNodes))}},function(a,b){r.fn[a]=function(c,d){var e=r.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=r.filter(d,e)),this.length>1&&(J[a]||r.uniqueSort(e),I.test(a)&&e.reverse()),this.pushStack(e)}});var L=/[^\x20\t\r\n\f]+/g;function M(a){var b={};return r.each(a.match(L)||[],function(a,c){b[c]=!0}),b}r.Callbacks=function(a){a="string"==typeof a?M(a):r.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=e||a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h-1)f.splice(c,1),c<=h&&h--}),this},has:function(a){return a?r.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=g=[],c||b||(f=c=""),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j};function N(a){return a}function O(a){throw a}function P(a,b,c,d){var e;try{a&&r.isFunction(e=a.promise)?e.call(a).done(b).fail(c):a&&r.isFunction(e=a.then)?e.call(a,b,c):b.apply(void 0,[a].slice(d))}catch(a){c.apply(void 0,[a])}}r.extend({Deferred:function(b){var c=[["notify","progress",r.Callbacks("memory"),r.Callbacks("memory"),2],["resolve","done",r.Callbacks("once memory"),r.Callbacks("once memory"),0,"resolved"],["reject","fail",r.Callbacks("once memory"),r.Callbacks("once memory"),1,"rejected"]],d="pending",e={state:function(){return d},always:function(){return f.done(arguments).fail(arguments),this},"catch":function(a){return e.then(null,a)},pipe:function(){var a=arguments;return r.Deferred(function(b){r.each(c,function(c,d){var e=r.isFunction(a[d[4]])&&a[d[4]];f[d[1]](function(){var a=e&&e.apply(this,arguments);a&&r.isFunction(a.promise)?a.promise().progress(b.notify).done(b.resolve).fail(b.reject):b[d[0]+"With"](this,e?[a]:arguments)})}),a=null}).promise()},then:function(b,d,e){var f=0;function g(b,c,d,e){return function(){var h=this,i=arguments,j=function(){var a,j;if(!(b=f&&(d!==O&&(h=void 0,i=[a]),c.rejectWith(h,i))}};b?k():(r.Deferred.getStackHook&&(k.stackTrace=r.Deferred.getStackHook()),a.setTimeout(k))}}return r.Deferred(function(a){c[0][3].add(g(0,a,r.isFunction(e)?e:N,a.notifyWith)),c[1][3].add(g(0,a,r.isFunction(b)?b:N)),c[2][3].add(g(0,a,r.isFunction(d)?d:O))}).promise()},promise:function(a){return null!=a?r.extend(a,e):e}},f={};return r.each(c,function(a,b){var g=b[2],h=b[5];e[b[1]]=g.add,h&&g.add(function(){d=h},c[3-a][2].disable,c[0][2].lock),g.add(b[3].fire),f[b[0]]=function(){return f[b[0]+"With"](this===f?void 0:this,arguments),this},f[b[0]+"With"]=g.fireWith}),e.promise(f),b&&b.call(f,f),f},when:function(a){var b=arguments.length,c=b,d=Array(c),e=f.call(arguments),g=r.Deferred(),h=function(a){return function(c){d[a]=this,e[a]=arguments.length>1?f.call(arguments):c,--b||g.resolveWith(d,e)}};if(b<=1&&(P(a,g.done(h(c)).resolve,g.reject,!b),"pending"===g.state()||r.isFunction(e[c]&&e[c].then)))return g.then();while(c--)P(e[c],h(c),g.reject);return g.promise()}});var Q=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;r.Deferred.exceptionHook=function(b,c){a.console&&a.console.warn&&b&&Q.test(b.name)&&a.console.warn("jQuery.Deferred exception: "+b.message,b.stack,c)},r.readyException=function(b){a.setTimeout(function(){throw b})};var R=r.Deferred();r.fn.ready=function(a){return R.then(a)["catch"](function(a){r.readyException(a)}),this},r.extend({isReady:!1,readyWait:1,ready:function(a){(a===!0?--r.readyWait:r.isReady)||(r.isReady=!0,a!==!0&&--r.readyWait>0||R.resolveWith(d,[r]))}}),r.ready.then=R.then;function S(){d.removeEventListener("DOMContentLoaded",S), +a.removeEventListener("load",S),r.ready()}"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll?a.setTimeout(r.ready):(d.addEventListener("DOMContentLoaded",S),a.addEventListener("load",S));var T=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===r.type(c)){e=!0;for(h in c)T(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,r.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(r(a),c)})),b))for(;h1,null,!0)},removeData:function(a){return this.each(function(){X.remove(this,a)})}}),r.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=W.get(a,b),c&&(!d||Array.isArray(c)?d=W.access(a,b,r.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=r.queue(a,b),d=c.length,e=c.shift(),f=r._queueHooks(a,b),g=function(){r.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return W.get(a,c)||W.access(a,c,{empty:r.Callbacks("once memory").add(function(){W.remove(a,[b+"queue",c])})})}}),r.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length\x20\t\r\n\f]+)/i,la=/^$|\/(?:java|ecma)script/i,ma={option:[1,""],thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};ma.optgroup=ma.option,ma.tbody=ma.tfoot=ma.colgroup=ma.caption=ma.thead,ma.th=ma.td;function na(a,b){var c;return c="undefined"!=typeof a.getElementsByTagName?a.getElementsByTagName(b||"*"):"undefined"!=typeof a.querySelectorAll?a.querySelectorAll(b||"*"):[],void 0===b||b&&B(a,b)?r.merge([a],c):c}function oa(a,b){for(var c=0,d=a.length;c-1)e&&e.push(f);else if(j=r.contains(f.ownerDocument,f),g=na(l.appendChild(f),"script"),j&&oa(g),c){k=0;while(f=g[k++])la.test(f.type||"")&&c.push(f)}return l}!function(){var a=d.createDocumentFragment(),b=a.appendChild(d.createElement("div")),c=d.createElement("input");c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),b.appendChild(c),o.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="",o.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var ra=d.documentElement,sa=/^key/,ta=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ua=/^([^.]*)(?:\.(.+)|)/;function va(){return!0}function wa(){return!1}function xa(){try{return d.activeElement}catch(a){}}function ya(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ya(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),e===!1)e=wa;else if(!e)return a;return 1===f&&(g=e,e=function(a){return r().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=r.guid++)),a.each(function(){r.event.add(this,b,e,d,c)})}r.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.get(a);if(q){c.handler&&(f=c,c=f.handler,e=f.selector),e&&r.find.matchesSelector(ra,e),c.guid||(c.guid=r.guid++),(i=q.events)||(i=q.events={}),(g=q.handle)||(g=q.handle=function(b){return"undefined"!=typeof r&&r.event.triggered!==b.type?r.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(L)||[""],j=b.length;while(j--)h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n&&(l=r.event.special[n]||{},n=(e?l.delegateType:l.bindType)||n,l=r.event.special[n]||{},k=r.extend({type:n,origType:p,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&r.expr.match.needsContext.test(e),namespace:o.join(".")},f),(m=i[n])||(m=i[n]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,o,g)!==!1||a.addEventListener&&a.addEventListener(n,g)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),r.event.global[n]=!0)}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,n,o,p,q=W.hasData(a)&&W.get(a);if(q&&(i=q.events)){b=(b||"").match(L)||[""],j=b.length;while(j--)if(h=ua.exec(b[j])||[],n=p=h[1],o=(h[2]||"").split(".").sort(),n){l=r.event.special[n]||{},n=(d?l.delegateType:l.bindType)||n,m=i[n]||[],h=h[2]&&new RegExp("(^|\\.)"+o.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;while(f--)k=m[f],!e&&p!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,o,q.handle)!==!1||r.removeEvent(a,n,q.handle),delete i[n])}else for(n in i)r.event.remove(a,n+b[j],c,d,!0);r.isEmptyObject(i)&&W.remove(a,"handle events")}},dispatch:function(a){var b=r.event.fix(a),c,d,e,f,g,h,i=new Array(arguments.length),j=(W.get(this,"events")||{})[b.type]||[],k=r.event.special[b.type]||{};for(i[0]=b,c=1;c=1))for(;j!==this;j=j.parentNode||this)if(1===j.nodeType&&("click"!==a.type||j.disabled!==!0)){for(f=[],g={},c=0;c-1:r.find(e,this,null,[j]).length),g[e]&&f.push(d);f.length&&h.push({elem:j,handlers:f})}return j=this,i\x20\t\r\n\f]*)[^>]*)\/>/gi,Aa=/\s*$/g;function Ea(a,b){return B(a,"table")&&B(11!==b.nodeType?b:b.firstChild,"tr")?r(">tbody",a)[0]||a:a}function Fa(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function Ga(a){var b=Ca.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function Ha(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(W.hasData(a)&&(f=W.access(a),g=W.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;c1&&"string"==typeof q&&!o.checkClone&&Ba.test(q))return a.each(function(e){var f=a.eq(e);s&&(b[0]=q.call(this,e,f.html())),Ja(f,b,c,d)});if(m&&(e=qa(b,a[0].ownerDocument,!1,a,d),f=e.firstChild,1===e.childNodes.length&&(e=f),f||d)){for(h=r.map(na(e,"script"),Fa),i=h.length;l")},clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=r.contains(a.ownerDocument,a);if(!(o.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||r.isXMLDoc(a)))for(g=na(h),f=na(a),d=0,e=f.length;d0&&oa(g,!i&&na(a,"script")),h},cleanData:function(a){for(var b,c,d,e=r.event.special,f=0;void 0!==(c=a[f]);f++)if(U(c)){if(b=c[W.expando]){if(b.events)for(d in b.events)e[d]?r.event.remove(c,d):r.removeEvent(c,d,b.handle);c[W.expando]=void 0}c[X.expando]&&(c[X.expando]=void 0)}}}),r.fn.extend({detach:function(a){return Ka(this,a,!0)},remove:function(a){return Ka(this,a)},text:function(a){return T(this,function(a){return void 0===a?r.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=a)})},null,a,arguments.length)},append:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.appendChild(a)}})},prepend:function(){return Ja(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ea(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return Ja(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(r.cleanData(na(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null!=a&&a,b=null==b?a:b,this.map(function(){return r.clone(this,a,b)})},html:function(a){return T(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!Aa.test(a)&&!ma[(ka.exec(a)||["",""])[1].toLowerCase()]){a=r.htmlPrefilter(a);try{for(;c1)}});function _a(a,b,c,d,e){return new _a.prototype.init(a,b,c,d,e)}r.Tween=_a,_a.prototype={constructor:_a,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||r.easing._default,this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(r.cssNumber[c]?"":"px")},cur:function(){var a=_a.propHooks[this.prop];return a&&a.get?a.get(this):_a.propHooks._default.get(this)},run:function(a){var b,c=_a.propHooks[this.prop];return this.options.duration?this.pos=b=r.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):_a.propHooks._default.set(this),this}},_a.prototype.init.prototype=_a.prototype,_a.propHooks={_default:{get:function(a){var b;return 1!==a.elem.nodeType||null!=a.elem[a.prop]&&null==a.elem.style[a.prop]?a.elem[a.prop]:(b=r.css(a.elem,a.prop,""),b&&"auto"!==b?b:0)},set:function(a){r.fx.step[a.prop]?r.fx.step[a.prop](a):1!==a.elem.nodeType||null==a.elem.style[r.cssProps[a.prop]]&&!r.cssHooks[a.prop]?a.elem[a.prop]=a.now:r.style(a.elem,a.prop,a.now+a.unit)}}},_a.propHooks.scrollTop=_a.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},r.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},_default:"swing"},r.fx=_a.prototype.init,r.fx.step={};var ab,bb,cb=/^(?:toggle|show|hide)$/,db=/queueHooks$/;function eb(){bb&&(d.hidden===!1&&a.requestAnimationFrame?a.requestAnimationFrame(eb):a.setTimeout(eb,r.fx.interval),r.fx.tick())}function fb(){return a.setTimeout(function(){ab=void 0}),ab=r.now()}function gb(a,b){var c,d=0,e={height:a};for(b=b?1:0;d<4;d+=2-b)c=ca[d],e["margin"+c]=e["padding"+c]=a;return b&&(e.opacity=e.width=a),e}function hb(a,b,c){for(var d,e=(kb.tweeners[b]||[]).concat(kb.tweeners["*"]),f=0,g=e.length;f1)},removeAttr:function(a){return this.each(function(){r.removeAttr(this,a)})}}),r.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return"undefined"==typeof a.getAttribute?r.prop(a,b,c):(1===f&&r.isXMLDoc(a)||(e=r.attrHooks[b.toLowerCase()]||(r.expr.match.bool.test(b)?lb:void 0)),void 0!==c?null===c?void r.removeAttr(a,b):e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:(a.setAttribute(b,c+""),c):e&&"get"in e&&null!==(d=e.get(a,b))?d:(d=r.find.attr(a,b), +null==d?void 0:d))},attrHooks:{type:{set:function(a,b){if(!o.radioValue&&"radio"===b&&B(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}},removeAttr:function(a,b){var c,d=0,e=b&&b.match(L);if(e&&1===a.nodeType)while(c=e[d++])a.removeAttribute(c)}}),lb={set:function(a,b,c){return b===!1?r.removeAttr(a,c):a.setAttribute(c,c),c}},r.each(r.expr.match.bool.source.match(/\w+/g),function(a,b){var c=mb[b]||r.find.attr;mb[b]=function(a,b,d){var e,f,g=b.toLowerCase();return d||(f=mb[g],mb[g]=e,e=null!=c(a,b,d)?g:null,mb[g]=f),e}});var nb=/^(?:input|select|textarea|button)$/i,ob=/^(?:a|area)$/i;r.fn.extend({prop:function(a,b){return T(this,r.prop,a,b,arguments.length>1)},removeProp:function(a){return this.each(function(){delete this[r.propFix[a]||a]})}}),r.extend({prop:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return 1===f&&r.isXMLDoc(a)||(b=r.propFix[b]||b,e=r.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=r.find.attr(a,"tabindex");return b?parseInt(b,10):nb.test(a.nodeName)||ob.test(a.nodeName)&&a.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),o.optSelected||(r.propHooks.selected={get:function(a){var b=a.parentNode;return b&&b.parentNode&&b.parentNode.selectedIndex,null},set:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}}),r.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){r.propFix[this.toLowerCase()]=this});function pb(a){var b=a.match(L)||[];return b.join(" ")}function qb(a){return a.getAttribute&&a.getAttribute("class")||""}r.fn.extend({addClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).addClass(a.call(this,b,qb(this)))});if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])d.indexOf(" "+f+" ")<0&&(d+=f+" ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},removeClass:function(a){var b,c,d,e,f,g,h,i=0;if(r.isFunction(a))return this.each(function(b){r(this).removeClass(a.call(this,b,qb(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof a&&a){b=a.match(L)||[];while(c=this[i++])if(e=qb(c),d=1===c.nodeType&&" "+pb(e)+" "){g=0;while(f=b[g++])while(d.indexOf(" "+f+" ")>-1)d=d.replace(" "+f+" "," ");h=pb(d),e!==h&&c.setAttribute("class",h)}}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):r.isFunction(a)?this.each(function(c){r(this).toggleClass(a.call(this,c,qb(this),b),b)}):this.each(function(){var b,d,e,f;if("string"===c){d=0,e=r(this),f=a.match(L)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else void 0!==a&&"boolean"!==c||(b=qb(this),b&&W.set(this,"__className__",b),this.setAttribute&&this.setAttribute("class",b||a===!1?"":W.get(this,"__className__")||""))})},hasClass:function(a){var b,c,d=0;b=" "+a+" ";while(c=this[d++])if(1===c.nodeType&&(" "+pb(qb(c))+" ").indexOf(b)>-1)return!0;return!1}});var rb=/\r/g;r.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=r.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,r(this).val()):a,null==e?e="":"number"==typeof e?e+="":Array.isArray(e)&&(e=r.map(e,function(a){return null==a?"":a+""})),b=r.valHooks[this.type]||r.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=r.valHooks[e.type]||r.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(rb,""):null==c?"":c)}}}),r.extend({valHooks:{option:{get:function(a){var b=r.find.attr(a,"value");return null!=b?b:pb(r.text(a))}},select:{get:function(a){var b,c,d,e=a.options,f=a.selectedIndex,g="select-one"===a.type,h=g?null:[],i=g?f+1:e.length;for(d=f<0?i:g?f:0;d-1)&&(c=!0);return c||(a.selectedIndex=-1),f}}}}),r.each(["radio","checkbox"],function(){r.valHooks[this]={set:function(a,b){if(Array.isArray(b))return a.checked=r.inArray(r(a).val(),b)>-1}},o.checkOn||(r.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var sb=/^(?:focusinfocus|focusoutblur)$/;r.extend(r.event,{trigger:function(b,c,e,f){var g,h,i,j,k,m,n,o=[e||d],p=l.call(b,"type")?b.type:b,q=l.call(b,"namespace")?b.namespace.split("."):[];if(h=i=e=e||d,3!==e.nodeType&&8!==e.nodeType&&!sb.test(p+r.event.triggered)&&(p.indexOf(".")>-1&&(q=p.split("."),p=q.shift(),q.sort()),k=p.indexOf(":")<0&&"on"+p,b=b[r.expando]?b:new r.Event(p,"object"==typeof b&&b),b.isTrigger=f?2:3,b.namespace=q.join("."),b.rnamespace=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=e),c=null==c?[b]:r.makeArray(c,[b]),n=r.event.special[p]||{},f||!n.trigger||n.trigger.apply(e,c)!==!1)){if(!f&&!n.noBubble&&!r.isWindow(e)){for(j=n.delegateType||p,sb.test(j+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),i=h;i===(e.ownerDocument||d)&&o.push(i.defaultView||i.parentWindow||a)}g=0;while((h=o[g++])&&!b.isPropagationStopped())b.type=g>1?j:n.bindType||p,m=(W.get(h,"events")||{})[b.type]&&W.get(h,"handle"),m&&m.apply(h,c),m=k&&h[k],m&&m.apply&&U(h)&&(b.result=m.apply(h,c),b.result===!1&&b.preventDefault());return b.type=p,f||b.isDefaultPrevented()||n._default&&n._default.apply(o.pop(),c)!==!1||!U(e)||k&&r.isFunction(e[p])&&!r.isWindow(e)&&(i=e[k],i&&(e[k]=null),r.event.triggered=p,e[p](),r.event.triggered=void 0,i&&(e[k]=i)),b.result}},simulate:function(a,b,c){var d=r.extend(new r.Event,c,{type:a,isSimulated:!0});r.event.trigger(d,null,b)}}),r.fn.extend({trigger:function(a,b){return this.each(function(){r.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];if(c)return r.event.trigger(a,b,c,!0)}}),r.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(a,b){r.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),r.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),o.focusin="onfocusin"in a,o.focusin||r.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){r.event.simulate(b,a.target,r.event.fix(a))};r.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=W.access(d,b);e||d.addEventListener(a,c,!0),W.access(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=W.access(d,b)-1;e?W.access(d,b,e):(d.removeEventListener(a,c,!0),W.remove(d,b))}}});var tb=a.location,ub=r.now(),vb=/\?/;r.parseXML=function(b){var c;if(!b||"string"!=typeof b)return null;try{c=(new a.DOMParser).parseFromString(b,"text/xml")}catch(d){c=void 0}return c&&!c.getElementsByTagName("parsererror").length||r.error("Invalid XML: "+b),c};var wb=/\[\]$/,xb=/\r?\n/g,yb=/^(?:submit|button|image|reset|file)$/i,zb=/^(?:input|select|textarea|keygen)/i;function Ab(a,b,c,d){var e;if(Array.isArray(b))r.each(b,function(b,e){c||wb.test(a)?d(a,e):Ab(a+"["+("object"==typeof e&&null!=e?b:"")+"]",e,c,d)});else if(c||"object"!==r.type(b))d(a,b);else for(e in b)Ab(a+"["+e+"]",b[e],c,d)}r.param=function(a,b){var c,d=[],e=function(a,b){var c=r.isFunction(b)?b():b;d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(null==c?"":c)};if(Array.isArray(a)||a.jquery&&!r.isPlainObject(a))r.each(a,function(){e(this.name,this.value)});else for(c in a)Ab(c,a[c],b,e);return d.join("&")},r.fn.extend({serialize:function(){return r.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=r.prop(this,"elements");return a?r.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!r(this).is(":disabled")&&zb.test(this.nodeName)&&!yb.test(a)&&(this.checked||!ja.test(a))}).map(function(a,b){var c=r(this).val();return null==c?null:Array.isArray(c)?r.map(c,function(a){return{name:b.name,value:a.replace(xb,"\r\n")}}):{name:b.name,value:c.replace(xb,"\r\n")}}).get()}});var Bb=/%20/g,Cb=/#.*$/,Db=/([?&])_=[^&]*/,Eb=/^(.*?):[ \t]*([^\r\n]*)$/gm,Fb=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Gb=/^(?:GET|HEAD)$/,Hb=/^\/\//,Ib={},Jb={},Kb="*/".concat("*"),Lb=d.createElement("a");Lb.href=tb.href;function Mb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(L)||[];if(r.isFunction(c))while(d=f[e++])"+"===d[0]?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function Nb(a,b,c,d){var e={},f=a===Jb;function g(h){var i;return e[h]=!0,r.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function Ob(a,b){var c,d,e=r.ajaxSettings.flatOptions||{};for(c in b)void 0!==b[c]&&((e[c]?a:d||(d={}))[c]=b[c]);return d&&r.extend(!0,a,d),a}function Pb(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===d&&(d=a.mimeType||b.getResponseHeader("Content-Type"));if(d)for(e in h)if(h[e]&&h[e].test(d)){i.unshift(e);break}if(i[0]in c)f=i[0];else{for(e in c){if(!i[0]||a.converters[e+" "+i[0]]){f=e;break}g||(g=e)}f=f||g}if(f)return f!==i[0]&&i.unshift(f),c[f]}function Qb(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}r.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:tb.href,type:"GET",isLocal:Fb.test(tb.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Kb,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":r.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?Ob(Ob(a,r.ajaxSettings),b):Ob(r.ajaxSettings,a)},ajaxPrefilter:Mb(Ib),ajaxTransport:Mb(Jb),ajax:function(b,c){"object"==typeof b&&(c=b,b=void 0),c=c||{};var e,f,g,h,i,j,k,l,m,n,o=r.ajaxSetup({},c),p=o.context||o,q=o.context&&(p.nodeType||p.jquery)?r(p):r.event,s=r.Deferred(),t=r.Callbacks("once memory"),u=o.statusCode||{},v={},w={},x="canceled",y={readyState:0,getResponseHeader:function(a){var b;if(k){if(!h){h={};while(b=Eb.exec(g))h[b[1].toLowerCase()]=b[2]}b=h[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return k?g:null},setRequestHeader:function(a,b){return null==k&&(a=w[a.toLowerCase()]=w[a.toLowerCase()]||a,v[a]=b),this},overrideMimeType:function(a){return null==k&&(o.mimeType=a),this},statusCode:function(a){var b;if(a)if(k)y.always(a[y.status]);else for(b in a)u[b]=[u[b],a[b]];return this},abort:function(a){var b=a||x;return e&&e.abort(b),A(0,b),this}};if(s.promise(y),o.url=((b||o.url||tb.href)+"").replace(Hb,tb.protocol+"//"),o.type=c.method||c.type||o.method||o.type,o.dataTypes=(o.dataType||"*").toLowerCase().match(L)||[""],null==o.crossDomain){j=d.createElement("a");try{j.href=o.url,j.href=j.href,o.crossDomain=Lb.protocol+"//"+Lb.host!=j.protocol+"//"+j.host}catch(z){o.crossDomain=!0}}if(o.data&&o.processData&&"string"!=typeof o.data&&(o.data=r.param(o.data,o.traditional)),Nb(Ib,o,c,y),k)return y;l=r.event&&o.global,l&&0===r.active++&&r.event.trigger("ajaxStart"),o.type=o.type.toUpperCase(),o.hasContent=!Gb.test(o.type),f=o.url.replace(Cb,""),o.hasContent?o.data&&o.processData&&0===(o.contentType||"").indexOf("application/x-www-form-urlencoded")&&(o.data=o.data.replace(Bb,"+")):(n=o.url.slice(f.length),o.data&&(f+=(vb.test(f)?"&":"?")+o.data,delete o.data),o.cache===!1&&(f=f.replace(Db,"$1"),n=(vb.test(f)?"&":"?")+"_="+ub++ +n),o.url=f+n),o.ifModified&&(r.lastModified[f]&&y.setRequestHeader("If-Modified-Since",r.lastModified[f]),r.etag[f]&&y.setRequestHeader("If-None-Match",r.etag[f])),(o.data&&o.hasContent&&o.contentType!==!1||c.contentType)&&y.setRequestHeader("Content-Type",o.contentType),y.setRequestHeader("Accept",o.dataTypes[0]&&o.accepts[o.dataTypes[0]]?o.accepts[o.dataTypes[0]]+("*"!==o.dataTypes[0]?", "+Kb+"; q=0.01":""):o.accepts["*"]);for(m in o.headers)y.setRequestHeader(m,o.headers[m]);if(o.beforeSend&&(o.beforeSend.call(p,y,o)===!1||k))return y.abort();if(x="abort",t.add(o.complete),y.done(o.success),y.fail(o.error),e=Nb(Jb,o,c,y)){if(y.readyState=1,l&&q.trigger("ajaxSend",[y,o]),k)return y;o.async&&o.timeout>0&&(i=a.setTimeout(function(){y.abort("timeout")},o.timeout));try{k=!1,e.send(v,A)}catch(z){if(k)throw z;A(-1,z)}}else A(-1,"No Transport");function A(b,c,d,h){var j,m,n,v,w,x=c;k||(k=!0,i&&a.clearTimeout(i),e=void 0,g=h||"",y.readyState=b>0?4:0,j=b>=200&&b<300||304===b,d&&(v=Pb(o,y,d)),v=Qb(o,v,y,j),j?(o.ifModified&&(w=y.getResponseHeader("Last-Modified"),w&&(r.lastModified[f]=w),w=y.getResponseHeader("etag"),w&&(r.etag[f]=w)),204===b||"HEAD"===o.type?x="nocontent":304===b?x="notmodified":(x=v.state,m=v.data,n=v.error,j=!n)):(n=x,!b&&x||(x="error",b<0&&(b=0))),y.status=b,y.statusText=(c||x)+"",j?s.resolveWith(p,[m,x,y]):s.rejectWith(p,[y,x,n]),y.statusCode(u),u=void 0,l&&q.trigger(j?"ajaxSuccess":"ajaxError",[y,o,j?m:n]),t.fireWith(p,[y,x]),l&&(q.trigger("ajaxComplete",[y,o]),--r.active||r.event.trigger("ajaxStop")))}return y},getJSON:function(a,b,c){return r.get(a,b,c,"json")},getScript:function(a,b){return r.get(a,void 0,b,"script")}}),r.each(["get","post"],function(a,b){r[b]=function(a,c,d,e){return r.isFunction(c)&&(e=e||d,d=c,c=void 0),r.ajax(r.extend({url:a,type:b,dataType:e,data:c,success:d},r.isPlainObject(a)&&a))}}),r._evalUrl=function(a){return r.ajax({url:a,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,"throws":!0})},r.fn.extend({wrapAll:function(a){var b;return this[0]&&(r.isFunction(a)&&(a=a.call(this[0])),b=r(a,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstElementChild)a=a.firstElementChild;return a}).append(this)),this},wrapInner:function(a){return r.isFunction(a)?this.each(function(b){r(this).wrapInner(a.call(this,b))}):this.each(function(){var b=r(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=r.isFunction(a);return this.each(function(c){r(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(a){return this.parent(a).not("body").each(function(){r(this).replaceWith(this.childNodes)}),this}}),r.expr.pseudos.hidden=function(a){return!r.expr.pseudos.visible(a)},r.expr.pseudos.visible=function(a){return!!(a.offsetWidth||a.offsetHeight||a.getClientRects().length)},r.ajaxSettings.xhr=function(){try{return new a.XMLHttpRequest}catch(b){}};var Rb={0:200,1223:204},Sb=r.ajaxSettings.xhr();o.cors=!!Sb&&"withCredentials"in Sb,o.ajax=Sb=!!Sb,r.ajaxTransport(function(b){var c,d;if(o.cors||Sb&&!b.crossDomain)return{send:function(e,f){var g,h=b.xhr();if(h.open(b.type,b.url,b.async,b.username,b.password),b.xhrFields)for(g in b.xhrFields)h[g]=b.xhrFields[g];b.mimeType&&h.overrideMimeType&&h.overrideMimeType(b.mimeType),b.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest");for(g in e)h.setRequestHeader(g,e[g]);c=function(a){return function(){c&&(c=d=h.onload=h.onerror=h.onabort=h.onreadystatechange=null,"abort"===a?h.abort():"error"===a?"number"!=typeof h.status?f(0,"error"):f(h.status,h.statusText):f(Rb[h.status]||h.status,h.statusText,"text"!==(h.responseType||"text")||"string"!=typeof h.responseText?{binary:h.response}:{text:h.responseText},h.getAllResponseHeaders()))}},h.onload=c(),d=h.onerror=c("error"),void 0!==h.onabort?h.onabort=d:h.onreadystatechange=function(){4===h.readyState&&a.setTimeout(function(){c&&d()})},c=c("abort");try{h.send(b.hasContent&&b.data||null)}catch(i){if(c)throw i}},abort:function(){c&&c()}}}),r.ajaxPrefilter(function(a){a.crossDomain&&(a.contents.script=!1)}),r.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(a){return r.globalEval(a),a}}}),r.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET")}),r.ajaxTransport("script",function(a){if(a.crossDomain){var b,c;return{send:function(e,f){b=r(" + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+ +
+

+ + + Blog components +

+ + + + + + +
+ +
+ + +
+ + + + + + +
+ + And this isn't my nose. This is a false one. + + + + + + +
+

And this isn't my nose. This is a false one.

+ +
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+ +
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + Well, I didn't vote for you. + + + + + + +
+

Well, I didn't vote for you.

+ +
Well, we did do the nose. Why? Shut up! Will you shut up?! You don't frighten us, English pig-dog...
+ +
+
+
+ Peter Richards + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + How do you know she is a witch? + + + + + + +
+

How do you know she is a witch?

+ +
Are you suggesting that coconuts migrate? No, no, no! Yes, yes. A bit. But she's got a wart. You ...
+ +
+
+
+ Wayne Holland + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + Shut up! + + + + + + +
+

Shut up!

+ +
Burn her! How do you know she is a witch? You don't frighten us, English pig-dogs! Go and boil yo...
+ +
+
+
+ Michelle Ross + 3 days ago +
+
+ +
+
+
+
+
+ + + +
+ + + + + + +
+ + + + + + +
+

Weaseling out of things is important to learn.

+ +
Please do not offer my god a peanut. That's why I love elementary school, Edna. The children beli...
+ +
+
+
+ Bobby Knight + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + + + + + +
+

You don't like your job, you don't strike.

+ +
But, Aquaman, you cannot marry a woman without gills. You're from two different worlds… Oh, I've ...
+ +
+
+
+ Craig Anderson + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + + + + + +
+

I hope I didn't brain my damage.

+ +
I don't like being outdoors, Smithers. For one thing, there's too many fat children. Oh, loneline...
+ +
+
+
+ Crystal Wallace + 3 days ago +
+
+ +
+
+
+
+
+ + + +
+ + + + + + +
+ + + + + + + + +
+

And this isn't my nose. This is a false one.

+ +
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+ +
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + + + + + + + +
+

Well, I didn't vote for you.

+ +
Well, we did do the nose. Why? Shut up! Will you shut up?! You don't frighten us, English pig-dog...
+ +
+
+
+ Peter Richards + 3 days ago +
+
+ +
+
+
+
+
+ + + +
+ + + + + + +
+ + + + + + + + +
+

Weaseling out of things is important to learn.

+ +
Please do not offer my god a peanut. That's why I love elementary school, Edna. The children believe anything you tell them. Brace yourselves gentlemen. According to the gas chromatograph, the secr...
+ +
+
+
+ Bobby Knight + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + + + + + + + +
+

You don't like your job, you don't strike.

+ +
But, Aquaman, you cannot marry a woman without gills. You're from two different worlds… Oh, I've wasted my life. Son, when you participate in sporting events, it's not whether you win or lose: it's...
+ +
+
+
+ Craig Anderson + 3 days ago +
+
+ +
+
+
+
+
+ + +
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/cards.html b/dist/cards.html new file mode 100644 index 000000000..7d4cb9d71 --- /dev/null +++ b/dist/cards.html @@ -0,0 +1,889 @@ + + + + + + + + + + + + + + + + + + +Cards design - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+ +
+
+ +
+
+
+ + +
+

This is a standard card

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+ This is standard card footer +
+ +
+
+
+
+ + +
+

Built card

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card blue

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card green

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card orange

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card red

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card yellow

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card teal

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card purple

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card status on left side

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Initial collapsed card

+ + +
+ + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

With additional fullscreen button

+ + +
+ + + + + + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Pannel with custom buttons

+ + +
+ + Action 1 + Action 2 + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Card with search form

+ + +
+ +
+
+ + + + +
+
+ +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Card with alert

+ + +
+ + + + + +
+ +
+ +
+ Adding action was successful +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Card with alert

+ + +
+ + + + + +
+ +
+ +
+ Adding action was failed +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Card with switch

+ + +
+ + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ + +
+

Card with loader

+ + +
+ + + + + +
+ +
+ +
+ +
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! +
+
+ +
+ +
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/charts.html b/dist/charts.html new file mode 100644 index 000000000..53b12a58e --- /dev/null +++ b/dist/charts.html @@ -0,0 +1,1303 @@ + + + + + + + + + + + + + + + + + + +Charts - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Charts +

+ + + + + + +
+ + +
+ + + + + + +
+
+
+

Employment Growth

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Monthly Average Temperature

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Wind speed during two days

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Lorem ipsum

+
+
+
+
+
+ +
+ + + + + +
+
+
+

Combination chart

+
+
+
+
+
+ +
+ + + +
+ +
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/crypto-currencies.html b/dist/crypto-currencies.html new file mode 100644 index 000000000..d76bc97c0 --- /dev/null +++ b/dist/crypto-currencies.html @@ -0,0 +1,1704 @@ + + + + + + + + + + + + + + + + + + +Crypto currencies - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Crypto currencies +

+ + + + + + +
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
NamePrice% 24hMarket CapCirculating SupplyVolume 24HCMGR/MonthInflation
1BitcoinBitcoin$10513.00-7%$179,470,305,92316,819,612 BTC$9,578,830,0008.11% / 570.36%
2EthereumEthereum$966.61-6%$95,270,125,03697,145,024 ETH$3,466,060,00022.62% / 290.64%
3RippleRipple$1.2029-11%$47,649,145,65738,739,144,704 XRP$2,081,450,00010.85% / 530.06%
4Bitcoin Cash$1547.00-11%$26,720,210,95616,925,988 BCH$598,337,00021.30% / 60.32%
5CardanoCardano$0.550768-9%$14,279,800,78625,927,069,696 ADA$466,381,000205.35% / 30.00%
6LitecoinLitecoin$173.86-7%$9,670,920,26754,873,584 LTC$430,524,0006.87% / 570.80%
7EOSEOS$13.3945%$8,420,143,033621,412,800 EOS$2,864,780,00053.25% / 611.56%
8NEMNEM$0.935049-11%$8,415,440,9998,999,999,488 XEM$66,061,00026.99% / 330.24%
9Stellar$0.4678132%$8,358,735,08017,867,683,840 XLM$370,297,00013.12% / 410.19%
10NEO$118.61-9%$7,693,400,00065,000,000 NEO$318,308,00062.68% / 150.00%
11IOTA$2.34-14%$6,504,100,8622,779,530,240 MIOTA$103,132,00023.27% / 7-0.02%
12DashDash$747.222-8%$5,881,413,8157,833,738 DASH$96,147,90019.19% / 470.81%
13Monero$305.16-11%$4,778,157,53315,633,286 XMR$100,788,00011.88% / 440.78%
14TRON$0.067691-5%$4,450,560,89665,748,193,280 TRX$581,651,000142.69% / 40.00%
15Bitcoin Gold$181.39-7%$3,084,108,67616,779,700 BTG$199,652,000-25.44% / 30.34%
16ICON$7.90-10%$3,002,355,531380,044,992 ICX$78,201,200179.33% / 390.09%
17Qtum$38.37-9%$2,832,729,40473,826,672 QTUM$593,524,00030.43% / 80.11%
18Ethereum Classic$28.023-6%$2,827,320,11299,308,752 ETC$303,356,00022.79% / 180.74%
19Lisk$20.48-6%$2,401,760,051117,273,440 LSK$44,483,50012.05% / 210.86%
20VeChain$8.339%$2,308,764,732277,162,624 VEN$348,907,000101.15% / 5-0.06%
21RaiBlocks$14.46-15%$1,926,770,258133,248,288 XRB$13,331,500112.15% / 100.06%
22Tether$1.0097-1%$1,618,090,8231,618,090,880 USDT$3,022,620,0000.03% / 3333.71%
23OmiseGO$14.83-11%$1,532,679,131102,042,552 OMG$63,574,50050.49% / 6-0.04%
24Populous$41.22-3%$1,525,305,99237,004,028 PPT$2,271,65058.49% / 6-10.29%
25Zcash$431.43-10%$1,358,979,7113,114,069 ZEC$71,375,000-13.51% / 157.44%
26Verge$0.089875-13%$1,303,358,29814,501,900,288 XVG$75,841,90027.95% / 392.06%
27Binance Coin$12.60-9%$1,247,576,40099,014,000 BNB$129,483,000122.80% / 60.08%
28Siacoin$0.037594-13%$1,180,306,71931,396,145,152 SC$58,783,60026.70% / 290.00%
29Stratis$11.50-13%$1,135,175,76498,710,936 STRAT$25,548,10049.79% / 17-0.02%
30Bytecoin$0.006127-8%$1,125,403,469183,679,369,216 BCN$7,904,87011.39% / 430.23%
31Steem$4.13-14%$1,022,039,920247,467,296 STEEM$29,580,00010.15% / 210.68%
32Ardor$0.995641-9%$994,644,856998,999,488 ARDR$143,752,00020.75% / 18-0.41%
33Status$0.264278-9%$917,172,5143,470,483,712 SNT$355,833,00024.53% / 70.00%
34Maker$1480.84-7%$915,496,751618,228 MKR$1,662,69042.77% / 12-
35Augur$81.55-5%$897,050,00011,000,000 REP$16,086,60016.36% / 270.01%
36BitShares$0.317687-9%$828,330,7302,607,379,968 BTS$43,185,6008.22% / 420.06%
370x$1.66-3%$827,949,569498,764,800 ZRX$20,493,00072.59% / 5-0.24%
38Waves$8.13-1%$813,000,000100,000,000 WAVES$26,239,60010.11% / 19-0.01%
39Dogecoin$0.00659-8%$743,890,685112,881,745,920 DOGE$20,613,4005.35% / 490.36%
40KuCoin Shares$7.91-17%$720,150,73191,043,072 KCS$5,481,780276.01% / 2-0.04%
41Electroneum$0.120304-7%$712,763,8195,924,689,408 ETN$5,103,98019.45% / 218.19%
42Walton$27.791%$691,920,36624,898,178 WTC$50,403,90092.30% / 50.00%
43Veritaseum$335.15-8%$682,581,5712,036,645 VERI$628,12833.82% / 70.00%
44Komodo$5.96-11%$614,151,644103,045,576 KMD$7,010,05045.00% / 11-1.09%
45Decred$91.29-8%$603,249,1586,608,053 DCR$1,304,41022.47% / 233.04%
46Dragonchain$2.39-11%$569,828,436238,421,936 DRGN$3,490,920926.29% / 10.14%
47Dentacoin$0.001735-5%$564,205,023325,190,221,824 DCN$1,082,85043.44% / 50.05%
48Loopring$0.965091-9%$541,577,621561,167,424 LRC$11,179,90055.67% / 595.51%
49Ark$5.36-11%$525,179,68297,981,280 ARK$7,183,61068.16% / 10-0.07%
50SALT$7.23-11%$514,095,07871,105,824 SALT$12,135,1004.35% / 438.07%
51QASH$1.46-9%$511,000,000350,000,000 QASH$19,206,80085.16% / 2-0.17%
52DigiByte$0.050116-11%$487,853,9289,734,494,208 DGB$11,389,9008.02% / 471.48%
53Basic Attention Token$0.487348-12%$487,348,0001,000,000,000 BAT$14,891,30019.38% / 70.00%
54PIVX$8.684%$480,968,83455,411,156 PIVX$11,144,70047.24% / 230.42%
55Golem$0.571295-9%$476,609,709834,262,016 GNT$10,420,80030.48% / 140.10%
56Hshare$10.82-9%$460,173,19342,529,872 HSR$100,098,000-9.81% / 50.30%
57Byteball Bytes$700.65-1%$452,074,794645,222 GBYTE$1,461,46032.04% / 130.00%
58Kyber Network$3.32-9%$445,320,554134,132,696 KNC$39,139,80018.46% / 40.08%
59WAX$0.903366-8%$445,318,368492,954,528 WAX$8,945,930-77.44% / 1-
60Ethos$5.84-8%$440,377,39975,407,088 ETHOS$3,608,20084.05% / 20.31%
61Gas$44.44-12%$425,068,2889,564,993 GAS$19,148,90074.36% / 64.55%
62RChain$1.71-6%$417,309,706244,040,768 RHOC$773,418117.91% / 333.41%
63FunFair$0.092324-8%$407,987,6574,419,085,824 FUN$12,285,80037.92% / 63.98%
64Cindicator$0.27288632%$394,586,7671,445,976,576 CND$262,465,000120.78% / 30.00%
65SmartCash$0.634479-14%$393,086,475619,542,144 SMART$943,55388.55% / 624.97%
66Factom$44.59-6%$389,944,0988,745,102 FCT$10,792,40022.26% / 270.00%
67Nxt$0.38182329%$381,441,154998,999,936 NXT$122,842,0006.32% / 49-0.20%
68Kin$0.0004920%$372,000,000756,097,548,288 KIN$1,325,07049.42% / 40.11%
69Aion$4.75-13%$370,278,76477,953,424 AION$8,336,950108.52% / 330.32%
70Dent$0.033938-12%$360,243,75710,614,761,472 DENT$10,021,500129.26% / 50.00%
71MonaCoin$6.24-8%$355,053,03656,899,524 MONA$5,033,73010.28% / 461.17%
72DigixDAO$176.77-6%$353,540,0002,000,000 DGD$6,663,63012.74% / 80.00%
73Power Ledger$0.949943-9%$345,599,442363,810,720 POWR$27,744,500337.83% / 21.12%
74Aeternity$1.48-2%$344,870,298233,020,480 AE$2,399,09011.87% / 7-0.13%
75aelf$1.37-10%$342,500,000250,000,000 ELF$91,334,50043.85% / 1-
76Bytom$0.340729-4%$336,299,523987,000,000 BTM$20,267,40026.63% / 50.00%
77ZClassic$106.69-19%$336,029,5433,149,588 ZCL$29,954,80025.48% / 1473.30%
78Nebulas$9.32-7%$330,860,00035,500,000 NAS$22,865,40017.66% / 5-
79MaidSafeCoin$0.7304598%$330,570,982452,552,416 MAID$11,475,7008.94% / 440.00%
80Syscoin$0.613294-3%$325,307,399530,426,528 SYS$29,120,20015.10% / 410.13%
81ReddCoin$0.010511-11%$302,001,00728,731,899,904 RDD$5,219,45013.19% / 470.09%
82Nexus$5.47-6%$301,758,33755,166,056 NXS$2,823,43022.15% / 361.13%
83SIRIN LABS Token$3.0223%$298,797,16698,939,456 SRN$15,880,000229.99% / 1-
84GXShares$4.920%$295,200,00060,000,000 GXS$9,631,300-2.54% / 748.19%
85Enigma$3.91-11%$292,609,42874,836,168 ENG$7,421,05092.34% / 30.41%
86Request Network$0.455615-8%$292,069,688641,044,928 REQ$13,739,700104.63% / 30.05%
87Cryptonex$6.267%$282,187,76645,077,920 CNX$293,94430.18% / 30.11%
88Emercoin$6.72-10%$276,999,59641,220,176 EMC$1,951,95023.20% / 410.14%
89ChainLink$0.790746-10%$276,761,100350,000,000 LINK$11,327,70054.30% / 4-0.36%
90Neblio$21.57-13%$274,933,39812,746,101 NEBL$7,116,500153.01% / 40.66%
91Bancor$6.59-7%$268,693,21940,772,872 BNT$8,478,5406.69% / 7-0.01%
92ZCoin$67.90-12%$267,385,7183,937,934 XZC$3,653,91042.92% / 155.28%
93Substratum$1.17-16%$264,526,995226,091,456 SUB$12,041,500131.18% / 40.14%
94Experience Points$0.00127-11%$268,849,841211,692,781,568 XP$1,528,840160.93% / 19.61%
95MediBloc$0.088088-13%$261,302,8422,966,384,128 MED$6,968,920390.11% / 1-
96Quantstamp$0.412894-6%$254,885,317617,314,176 QSP$15,626,100159.68% / 20.00%
97Bitcore$22.43-17%$244,287,08110,891,087 BTX$3,291,47016.18% / 9444.11%
98TenX$2.23-6%$233,394,721104,661,312 PAY$11,627,30017.68% / 60.05%
99XPlay$0.2317560%$231,756,0001,000,000,000 XPA$143,905106.90% / 40.00%
100Iconomi$2.26-11%$225,521,58999,788,312 ICN$3,993,010-3.30% / 7-0.19%
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs.html b/dist/docs.html new file mode 100644 index 000000000..e350b492e --- /dev/null +++ b/dist/docs.html @@ -0,0 +1,10 @@ + + + +Redirecting… + + + + + + \ No newline at end of file diff --git a/dist/docs/alerts.html b/dist/docs/alerts.html new file mode 100644 index 000000000..d39c7d21f --- /dev/null +++ b/dist/docs/alerts.html @@ -0,0 +1,602 @@ + + + + + + + + + + + + + + + + + + +Alerts - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Alerts

+ + +

Provide contextual feedback messages for typical user actions with the handful of available and flexible alert messages.

+ + + +
+

Work in progress!

+
More detailed documentation is coming soon, but in the meantime here's a quick class reference.
+
+ + + + +

Default alerts

+ +

Add color contextual class.

+ +
+ + + + + + + + + + + +
+
<div class="alert alert-primary" role="alert">
+  This is a primary alert—check it out!
+</div>
+<div class="alert alert-secondary" role="alert">
+  This is a secondary alert—check it out!
+</div>
+<div class="alert alert-success" role="alert">
+  This is a success alert—check it out!
+</div>
+<div class="alert alert-info" role="alert">
+  This is a info alert—check it out!
+</div>
+<div class="alert alert-warning" role="alert">
+  This is a warning alert—check it out!
+</div>
+<div class="alert alert-danger" role="alert">
+  This is a danger alert—check it out!
+</div>
+ +

Alert with icon

+ +

Add .alert-icon class.

+ +
+ + + +
+
<div class="alert alert-icon alert-primary" role="alert">
+  <i class="fe fe-bell mr-2" aria-hidden="true"></i> You have done 5 actions. 
+</div>
+<div class="alert alert-icon alert-success" role="alert">
+  <i class="fe fe-check mr-2" aria-hidden="true"></i> The page has been added. 
+</div>
+<div class="alert alert-icon alert-danger" role="alert">
+  <i class="fe fe-alert-triangle mr-2" aria-hidden="true"></i> The daily report has failed. Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit.
+</div>
+ +

Alert dismissible

+ +

Add a dismiss button and the .alert-dismissible class, which adds extra padding to the right of the alert and positions the .close button. On the dismiss button, add the data-dismiss="alert" attribute, which triggers the JavaScript functionality. Be sure to use the <button> element with it for proper behavior across all devices.

+ +
+
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. +
+
+
<div class="alert alert-warning alert-dismissible">
+  <button type="button" class="close" data-dismiss="alert"></button>
+  Lorem ipsum dolor sit amet, consectetur adipisicing elit.
+</div>
+ +

Alert with avatar

+ +
+
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit. +
+
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. +
+
+
<div class="alert alert-avatar alert-primary alert-dismissible">
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/4.jpg)"></span>
+  Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit. Lorem ipsum dolor sit amet, consectetur adipisicing elit.
+</div>
+<div class="alert alert-avatar alert-success alert-dismissible">
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/35.jpg)"></span>
+  Lorem ipsum dolor sit amet, consectetur adipisicing elit.
+</div>
+ +

Alert with buttons

+ +
+
+ + +

Some Message

+

+ Lorem ipsum Minim ad pariatur eiusmod ea ut nulla aliqua est quis id dolore minim + voluptate. +

+
+ + +
+
+
+
<div class="alert alert-success alert-dismissible">
+  <button data-dismiss="alert" class="close"></button>
+  <h4>Some Message</h4>
+  <p>
+    Lorem ipsum Minim ad pariatur eiusmod ea ut nulla aliqua est quis id dolore minim
+    voluptate.
+  </p>
+  <div class="btn-list">
+    <button class="btn btn-success" type="button">Okay</button>
+    <button class="btn btn-secondary" type="button">No, thanks</button>
+  </div>
+</div>
+ + +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/avatars.html b/dist/docs/avatars.html new file mode 100644 index 000000000..0f9a6a2b9 --- /dev/null +++ b/dist/docs/avatars.html @@ -0,0 +1,657 @@ + + + + + + + + + + + + + + + + + + +Avatars - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Avatars

+ + + + + + + +

Simple avatar

+ +
+
+ + + + + + + + + +
+
+
<span class="avatar" style="background-image: url(./assets/images/faces/male/21.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/male/25.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/5.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/17.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/male/40.jpg)"></span>
+ +

Avatar size

+ +
+
+ + + + + + +
+
+
<span class="avatar avatar-sm" style="background-image: url(./assets/images/faces/male/9.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/8.jpg)"></span>
+<span class="avatar avatar-md" style="background-image: url(./assets/images/faces/male/4.jpg)"></span>
+<span class="avatar avatar-lg" style="background-image: url(./assets/images/faces/male/35.jpg)"></span>
+<span class="avatar avatar-xl" style="background-image: url(./assets/images/faces/female/29.jpg)"></span>
+<span class="avatar avatar-xxl" style="background-image: url(./assets/images/faces/male/2.jpg)"></span>
+ +

Avatar status

+ +
+
+ + + + + + + + + + + + + +
+
+
<span class="avatar" style="background-image: url(./assets/images/faces/male/2.jpg)"></span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/25.jpg)">
+  <span class="avatar-status"></span>
+</span>
+<span class="avatar" style="background-image: url(./assets/images/faces/male/9.jpg)">
+  <span class="avatar-status bg-red"></span>
+</span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/25.jpg)">
+  <span class="avatar-status bg-green"></span>
+</span>
+<span class="avatar" style="background-image: url(./assets/images/faces/female/16.jpg)">
+  <span class="avatar-status bg-yellow"></span>
+</span>
+ +

Avatar placeholder

+ +
+
+RB + +KH + +BK + + + +
+
+
<span class="avatar">RB</span>
+<span class="avatar">KH</span>
+<span class="avatar">BK</span>
+<span class="avatar avatar-placeholder"></span>
+<span class="avatar"><i class="fe fe-more-horizontal"></i></span>
+ +
+
+NG + + +AM + + +RB + + +PR + + +WH + + +MR + + +DB + + +PP + + +JR + + +RB + + +KH + + +BK + + +CA + + +CW +
+
+
<span class="avatar avatar-blue">NG</span>
+<span class="avatar avatar-azure">AM</span>
+<span class="avatar avatar-indigo">RB</span>
+<span class="avatar avatar-purple">PR</span>
+<span class="avatar avatar-pink">WH</span>
+<span class="avatar avatar-red">MR</span>
+<span class="avatar avatar-orange">DB</span>
+<span class="avatar avatar-yellow">PP</span>
+<span class="avatar avatar-lime">JR</span>
+<span class="avatar avatar-green">RB</span>
+<span class="avatar avatar-teal">KH</span>
+<span class="avatar avatar-cyan">BK</span>
+<span class="avatar avatar-gray">CA</span>
+<span class="avatar avatar-gray-dark">CW</span>
+ +

Avatars list

+ +
+
+ + + + + + + + + + + +
+
+
<div class="avatar-list">
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/21.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/25.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/5.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/17.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/40.jpg)"></span>
+</div>
+ +
+
+ + + + + + + + + + + + +8 +
+
+
<div class="avatar-list avatar-list-stacked">
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/12.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/21.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/29.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/female/2.jpg)"></span>
+  <span class="avatar" style="background-image: url(./assets/images/faces/male/34.jpg)"></span>
+  <span class="avatar">+8</span>
+</div>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/buttons.html b/dist/docs/buttons.html new file mode 100644 index 000000000..66cd51ed5 --- /dev/null +++ b/dist/docs/buttons.html @@ -0,0 +1,998 @@ + + + + + + + + + + + + + + + + + + +Buttons - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Buttons

+ + +

Use Bootstrap’s custom button styles for actions in forms, dialogs, and more. Includes support for a handful of contextual variations, sizes, states, and more.

+ + + + + + +

Button tag

+ +

The .btn classes are designed to be used with the <button> element. However, you can also use these classes on <a> or <input> elements (though some browsers may apply a slightly different rendering).

+ +
+
+Link + + + + +
+
+
<a href="#" class="btn btn-primary" role="button">Link</a>
+<button class="btn btn-primary">Button</button>
+<input type="button" class="btn btn-primary" value="Input" />
+<input type="submit" class="btn btn-primary" value="Submit" />
+<input type="reset" class="btn btn-primary" value="Reset" />
+ +

Button variations

+ +

Use any of the available button classes to quickly create a styled button . We provide a variety of colors for you to express different emotions.

+ +
+
+Primary + +Secondary + +Success + +Info + +Warning + +Danger + +Link +
+
+
<a href="#" class="btn btn-primary">Primary</a>
+<a href="#" class="btn btn-secondary">Secondary</a>
+<a href="#" class="btn btn-success">Success</a>
+<a href="#" class="btn btn-info">Info</a>
+<a href="#" class="btn btn-warning">Warning</a>
+<a href="#" class="btn btn-danger">Danger</a>
+<a href="#" class="btn btn-link">Link</a>
+ +

Disabled buttons

+ +

Make buttons look inactive by adding the disabled boolean attribute to any .btn element. <a>s don’t support the disabled attribute, so you must add the .disabled class to make it visually appear disabled.

+ +
+
+Primary + +Secondary + +Success + +Info + +Warning + +Danger +
+
+
<a href="#" class="btn btn-primary disabled">Primary</a>
+<a href="#" class="btn btn-secondary disabled">Secondary</a>
+<a href="#" class="btn btn-success disabled">Success</a>
+<a href="#" class="btn btn-info disabled">Info</a>
+<a href="#" class="btn btn-warning disabled">Warning</a>
+<a href="#" class="btn btn-danger disabled">Danger</a>
+ +

Color variations

+ +

The classic button, in different colors.

+ +
+
+Blue + +Azure + +Indigo + +Purple + +Pink + +Red + +Orange + +Yellow + +Lime + +Green + +Teal + +Cyan + +Gray + +Dark gray +
+
+
<a href="#" class="btn btn-blue">Blue</a>
+<a href="#" class="btn btn-azure">Azure</a>
+<a href="#" class="btn btn-indigo">Indigo</a>
+<a href="#" class="btn btn-purple">Purple</a>
+<a href="#" class="btn btn-pink">Pink</a>
+<a href="#" class="btn btn-red">Red</a>
+<a href="#" class="btn btn-orange">Orange</a>
+<a href="#" class="btn btn-yellow">Yellow</a>
+<a href="#" class="btn btn-lime">Lime</a>
+<a href="#" class="btn btn-green">Green</a>
+<a href="#" class="btn btn-teal">Teal</a>
+<a href="#" class="btn btn-cyan">Cyan</a>
+<a href="#" class="btn btn-gray">Gray</a>
+<a href="#" class="btn btn-gray-dark">Dark gray</a>
+ +

Square buttons

+ +

Add .btn-square to button to remove border-radius.

+ +
+
+Primary + +Secondary + +Success + +Info + +Warning + +Danger +
+
+
<a href="#" class="btn btn-square btn-primary">Primary</a>
+<a href="#" class="btn btn-square btn-secondary">Secondary</a>
+<a href="#" class="btn btn-square btn-success">Success</a>
+<a href="#" class="btn btn-square btn-info">Info</a>
+<a href="#" class="btn btn-square btn-warning">Warning</a>
+<a href="#" class="btn btn-square btn-danger">Danger</a>
+ +

Pill buttons

+ +

Add .btn-pill class to any button to make them more rounded.

+ +
+
+Primary + +Secondary + +Success + +Info + +Warning + +Danger +
+
+
<a href="#" class="btn btn-pill btn-primary">Primary</a>
+<a href="#" class="btn btn-pill btn-secondary">Secondary</a>
+<a href="#" class="btn btn-pill btn-success">Success</a>
+<a href="#" class="btn btn-pill btn-info">Info</a>
+<a href="#" class="btn btn-pill btn-warning">Warning</a>
+<a href="#" class="btn btn-pill btn-danger">Danger</a>
+ +

Outline buttons

+ +

In need of a button, but not the hefty background colors they bring? Replace the default modifier classes with the .btn-outline-* ones to remove all background images and colors on any button.

+ +
+
+Primary + +Secondary + +Success + +Info + +Warning + +Danger +
+
+
<a href="#" class="btn btn-outline-primary">Primary</a>
+<a href="#" class="btn btn-outline-secondary">Secondary</a>
+<a href="#" class="btn btn-outline-success">Success</a>
+<a href="#" class="btn btn-outline-info">Info</a>
+<a href="#" class="btn btn-outline-warning">Warning</a>
+<a href="#" class="btn btn-outline-danger">Danger</a>
+ +

Button size

+ +

Add .btn-lg or .btn-sm for additional sizes.

+ +
+
+ + +
+
+
<button type="button" class="btn btn-primary btn-lg">Large button</button>
+<button type="button" class="btn btn-secondary btn-lg">Large button</button>
+ +
+
+ + +
+
+
<button type="button" class="btn btn-primary btn-sm">Small button</button>
+<button type="button" class="btn btn-secondary btn-sm">Small button</button>
+ +

Create block level buttons—those that span the full width of a parent—by adding .btn-block.

+ +
+ + +
+
<button type="button" class="btn btn-primary btn-block">Block level button</button>
+<button type="button" class="btn btn-secondary btn-block">Block level button</button>
+ +

Button with icon

+ +

Basic buttons are traditional buttons with borders and background with an extra commponent like an icon. You can place it either on the left or the right which ever you want with different color opitons.

+ +
+
+ + + + + + +
+
+
<button type="button" class="btn btn-dark"><i class="fe fe-upload mr-2"></i>Upload</button>
+<button type="button" class="btn btn-warning"><i class="fe fe-heart mr-2"></i>I like</button>
+<button type="button" class="btn btn-success"><i class="fe fe-check mr-2"></i>I agree</button>
+<button type="button" class="btn btn-outline-primary"><i class="fe fe-plus mr-2"></i>More</button>
+<button type="button" class="btn btn-danger"><i class="fe fe-link mr-2"></i>Link</button>
+<button type="button" class="btn btn-info"><i class="fe fe-message-circle mr-2"></i>Comment</button>
+ +

Social buttons

+ +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
<button type="button" class="btn btn-facebook"><i class="fa fa-facebook mr-2"></i>Facebook</button>
+<button type="button" class="btn btn-twitter"><i class="fa fa-twitter mr-2"></i>Twitter</button>
+<button type="button" class="btn btn-google"><i class="fa fa-google mr-2"></i>Google</button>
+<button type="button" class="btn btn-youtube"><i class="fa fa-youtube mr-2"></i>Youtube</button>
+<button type="button" class="btn btn-vimeo"><i class="fa fa-vimeo mr-2"></i>Vimeo</button>
+<button type="button" class="btn btn-dribbble"><i class="fa fa-dribbble mr-2"></i>Dribble</button>
+<button type="button" class="btn btn-github"><i class="fa fa-github mr-2"></i>Github</button>
+<button type="button" class="btn btn-instagram"><i class="fa fa-instagram mr-2"></i>Instagram</button>
+<button type="button" class="btn btn-pinterest"><i class="fa fa-pinterest mr-2"></i>Pinterest</button>
+<button type="button" class="btn btn-vk"><i class="fa fa-vk mr-2"></i>VKontakte</button>
+<button type="button" class="btn btn-rss"><i class="fa fa-rss mr-2"></i>RSS</button>
+<button type="button" class="btn btn-flickr"><i class="fa fa-flickr mr-2"></i>Flickr</button>
+<button type="button" class="btn btn-bitbucket"><i class="fa fa-bitbucket mr-2"></i>Bitbucket</button>
+ +

You can use only icons.

+ +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
<button type="button" class="btn btn-icon btn-facebook"><i class="fa fa-facebook"></i></button>
+<button type="button" class="btn btn-icon btn-twitter"><i class="fa fa-twitter"></i></button>
+<button type="button" class="btn btn-icon btn-google"><i class="fa fa-google"></i></button>
+<button type="button" class="btn btn-icon btn-youtube"><i class="fa fa-youtube"></i></button>
+<button type="button" class="btn btn-icon btn-vimeo"><i class="fa fa-vimeo"></i></button>
+<button type="button" class="btn btn-icon btn-dribbble"><i class="fa fa-dribbble"></i></button>
+<button type="button" class="btn btn-icon btn-github"><i class="fa fa-github"></i></button>
+<button type="button" class="btn btn-icon btn-instagram"><i class="fa fa-instagram"></i></button>
+<button type="button" class="btn btn-icon btn-pinterest"><i class="fa fa-pinterest"></i></button>
+<button type="button" class="btn btn-icon btn-vk"><i class="fa fa-vk"></i></button>
+<button type="button" class="btn btn-icon btn-rss"><i class="fa fa-rss"></i></button>
+<button type="button" class="btn btn-icon btn-flickr"><i class="fa fa-flickr"></i></button>
+<button type="button" class="btn btn-icon btn-bitbucket"><i class="fa fa-bitbucket"></i></button>
+ +

Icon buttons

+ +

Icon only button. Add .btn-icon class to remove unnecessary padding from button.

+ +
+
+ + + + + + + +
+
+
<button type="button" class="btn btn-icon btn-primary"><i class="fe fe-activity"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-github"><i class="fe fe-github"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-success"><i class="fe fe-bell"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-warning"><i class="fe fe-star"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-danger"><i class="fe fe-trash"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-purple"><i class="fe fe-bar-chart"></i></button>
+<button type="button" class="btn btn-icon btn-primary btn-secondary"><i class="fe fe-git-merge"></i></button>
+ +

Button dropdown

+ +

Wrap the dropdown’s toggle (your button or link) and the dropdown menu within .dropdown, or another element that declares position: relative;. Dropdowns can be triggered from <a> or <button> elements to better fit your potential needs.

+ +
+
+
+ +
+ Dropdown link + Dropdown link +
+
+ +
+ +
+ Dropdown link + Dropdown link +
+
+ +
+ +
+ Dropdown link + Dropdown link +
+
+
+
+
<div class="dropdown">
+  <button type="button" class="btn btn-secondary dropdown-toggle" data-toggle="dropdown">
+     <i class="fe fe-calendar"></i>
+  </button>
+  <div class="dropdown-menu">
+    <a class="dropdown-item" href="#">Dropdown link</a>
+    <a class="dropdown-item" href="#">Dropdown link</a>
+  </div>
+</div>
+<div class="dropdown">
+  <button type="button" class="btn btn-secondary dropdown-toggle" data-toggle="dropdown">
+     <i class="fe fe-calendar mr-2"></i>Show calendar
+  </button>
+  <div class="dropdown-menu">
+    <a class="dropdown-item" href="#">Dropdown link</a>
+    <a class="dropdown-item" href="#">Dropdown link</a>
+  </div>
+</div>
+<div class="dropdown">
+  <button type="button" class="btn btn-secondary dropdown-toggle" data-toggle="dropdown">
+     Show calendar
+  </button>
+  <div class="dropdown-menu">
+    <a class="dropdown-item" href="#">Dropdown link</a>
+    <a class="dropdown-item" href="#">Dropdown link</a>
+  </div>
+</div>
+ +

Loading button

+ +

Add .btn-loading to use a loading state on a button. The width of the button depends on the length of the text inside.

+ +

Since the loading spinner is implemented using the :after pseudo-element, it is not supported by the <input type="submit"> element.

+ +
+
+ + + + + +
+
+
<button type="button" class="btn btn-primary btn-loading">Button text</button>
+<button type="button" class="btn btn-success btn-loading btn-icon"><i class="fe fe-check"></i></button>
+<button type="button" class="btn btn-warning btn-loading btn-sm">Button text</button>
+<button type="button" class="btn btn-danger btn-loading btn-lg">Button text</button>
+<button type="button" class="btn btn-secondary btn-loading btn-block">Button text</button>
+ +

List of buttons

+ +

You can now create a list of buttons with the .btn-list container.

+ +
+
+ Save changes + Save and continue + Cancel +
+
+
<div class="btn-list">
+  <a href="#" class="btn btn-success">Save changes</a>
+  <a href="#" class="btn btn-secondary">Save and continue</a>
+  <a href="#" class="btn btn-danger">Cancel</a>
+</div>
+ +

If the list is very long, it will automatically wrap on multiple lines, while keeping all buttons evenly spaced.

+ +
+
+ One + Two + Three + Four + Five + Six + Seven + Eight + Nine + Ten + Eleven + Twelve + Thirteen + Fourteen + Fifteen + Sixteen + Seventeen + Eighteen + Nineteen +
+
+
<div class="btn-list">
+  <a href="#" class="btn btn-secondary">One</a>
+  <a href="#" class="btn btn-secondary">Two</a>
+  <a href="#" class="btn btn-secondary">Three</a>
+  <a href="#" class="btn btn-secondary">Four</a>
+  <a href="#" class="btn btn-secondary">Five</a>
+  <a href="#" class="btn btn-secondary">Six</a>
+  <a href="#" class="btn btn-secondary">Seven</a>
+  <a href="#" class="btn btn-secondary">Eight</a>
+  <a href="#" class="btn btn-secondary">Nine</a>
+  <a href="#" class="btn btn-secondary">Ten</a>
+  <a href="#" class="btn btn-secondary">Eleven</a>
+  <a href="#" class="btn btn-secondary">Twelve</a>
+  <a href="#" class="btn btn-secondary">Thirteen</a>
+  <a href="#" class="btn btn-secondary">Fourteen</a>
+  <a href="#" class="btn btn-secondary">Fifteen</a>
+  <a href="#" class="btn btn-secondary">Sixteen</a>
+  <a href="#" class="btn btn-secondary">Seventeen</a>
+  <a href="#" class="btn btn-secondary">Eighteen</a>
+  <a href="#" class="btn btn-secondary">Nineteen</a>
+</div>
+ +

Use the .text-center or the .text-right modifiers to alter the alignment.

+ +
+
+ Save changes + Save and continue +
+
+
<div class="btn-list text-center">
+  <a href="#" class="btn btn-primary">Save changes</a>
+  <a href="#" class="btn btn-secondary">Save and continue</a>
+</div>
+ +
+
+ Save changes + Save and continue +
+
+
<div class="btn-list text-right">
+  <a href="#" class="btn btn-primary">Save changes</a>
+  <a href="#" class="btn btn-secondary">Save and continue</a>
+</div>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/cards.html b/dist/docs/cards.html new file mode 100644 index 000000000..a3a34557f --- /dev/null +++ b/dist/docs/cards.html @@ -0,0 +1,846 @@ + + + + + + + + + + + + + + + + + + +Cards - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Cards

+ + +

A card is a flexible and extensible content container. It includes options for headers and footers, a wide variety of content, contextual background colors, and powerful display options.

+ + + + + + +

The .card element is simply a container with a shadow, a border, a radius, and some padding. Built with flexbox, they offer easy alignment and mix well with other Bootstrap components.

+ +

Default card

+ +
+
+
+ + +
+

Card title

+ + +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
<div class="card">
+  <div class="card-header">
+    <h3 class="card-title">Card title</h3>
+  </div>
+  <div class="card-body">
+    Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+  </div>
+</div>
+ +

Advanced card

+ +
+
+
+ + +
+

Card title

+ + +
+ + Action 1 + Action 2 + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+ This is standard card footer +
+ +
+
+
+
<div class="card">
+  <div class="card-header">
+    <h3 class="card-title">Card title</h3>
+    <div class="card-options">
+        <a class="btn btn-secondary btn-sm">Action 1</a>
+        <a class="btn btn-secondary btn-sm ml-2">Action 2</a>
+    </div>
+  </div>
+  <div class="card-body">
+    Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+  </div>
+  <div class="card-footer">
+    This is standard card footer
+  </div>
+</div>
+ +

Blog post card

+ +

The best way to make your post eye-catching is adding an image to it. To do so, just add the image with the .card-img-top class. We’ve added the .d-flex .flex-column classes to the .card-body to have the author details be on the bottom of the card.

+ +
+
+
+ + And this isn't my nose. This is a false one. + + + + + + +
+

And this isn't my nose. This is a false one.

+ +
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+ +
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+
+
<div class="card">
+  <a href="#"><img class="card-img-top" src="./assets/images/photos/david-klaasen-54203-500.jpg" alt="And this isn&#39;t my nose. This is a false one."></a>
+  <div class="card-body d-flex flex-column">
+    <h4><a href="#">And this isn't my nose. This is a false one.</a></h4>
+    <div class="text-muted">Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...</div>
+    <div class="d-flex align-items-center pt-5 mt-auto">
+      <div class="avatar avatar-md mr-3" style="background-image: url(./assets/images/faces/female/18.jpg)"></div>
+      <div>
+        <a href="./profile.html" class="text-default">Rose Bradley</a>
+        <small class="d-block text-muted">3 days ago</small>
+      </div>
+      <div class="ml-auto text-muted">
+        <a href="#" class="icon d-none d-md-inline-block ml-3"><i class="fe fe-heart mr-1"></i></a>
+      </div>
+    </div>
+  </div>
+</div>
+ +

Row deck

+ +

If you want to create a couple of posts next to each other, add the .row-deck class to .row—then they will all have the same height.

+ +
+
+
+
+
+
Short content
+
+
+
+
+
Extra long content of card. Lorem ipsum dolor sit amet, consetetur sadipscing elitr
+
+
+
+
+
Short content
+
+
+
+
+
+
<div class="row row-cards row-deck">
+    <div class="col-md-4">
+        <div class="card">
+            <div class="card-body">Short content</div>
+        </div>
+    </div>
+    <div class="col-md-4">
+        <div class="card">
+            <div class="card-body">Extra long content of card. Lorem ipsum dolor sit amet, consetetur sadipscing elitr</div>
+        </div>
+    </div>
+    <div class="col-md-4">
+        <div class="card">
+            <div class="card-body">Short content</div>
+        </div>
+    </div>
+</div>
+ +

Post card with aside image

+ +

You can also add the image on the left side of the card. All you need do to is: add the .card-aside class to the element with the .card class. Then add the image in the .card-aside-column element. No worries, tabler will automatically center it and scale to right size:

+ +
+
+
+ + + + + + + + +
+

And this isn't my nose. This is a false one.

+ +
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+ +
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+
+
<div class="card card-aside">
+  <a href="#" class="card-aside-column" style="background-image: url(./assets/images/photos/david-klaasen-54203-500.jpg)"></a>
+  <div class="card-body d-flex flex-column">
+    <h4><a href="#">And this isn't my nose. This is a false one.</a></h4>
+    <div class="text-muted">Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...</div>
+    <div class="d-flex align-items-center pt-5 mt-auto">
+      <div class="avatar avatar-md mr-3" style="background-image: url(./assets/images/faces/female/18.jpg)"></div>
+      <div>
+        <a href="./profile.html" class="text-default">Rose Bradley</a>
+        <small class="d-block text-muted">3 days ago</small>
+      </div>
+      <div class="ml-auto text-red">
+        <a href="#" class="icon d-none d-md-inline-block ml-3"><i class="fe fe-heart mr-1"></i></a>
+      </div>
+    </div>
+  </div>
+</div>
+ +

Color variations

+ +
+
+
+
+
+ +
+ + +
+

Card status

+ + +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+ +
+ + +
+

Card status on left side

+ + +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
+
+
<div class="row row-cards row-deck">
+    <div class="col-md-6">
+        <div class="card">
+  <div class="card-status bg-purple"></div>
+  <div class="card-header">
+    <h3 class="card-title">Card status</h3>
+  </div>
+  <div class="card-body">
+    Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+  </div>
+</div>
+    </div>
+    <div class="col-md-6">
+        <div class="card">
+  <div class="card-status card-status-left bg-blue"></div>
+  <div class="card-header">
+    <h3 class="card-title">Card status on left side</h3>
+  </div>
+  <div class="card-body">
+    Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+  </div>
+</div>
+    </div>
+</div>
+ +

Card with switch

+ +
+
+
+ + +
+

Card with switch

+ + +
+ + + +
+ +
+ +
+ + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! + +
+ +
+
+
+
<div class="card">
+  <div class="card-header">
+    <h3 class="card-title">Card with switch</h3>
+    <div class="card-options">
+      <label class="custom-switch m-0">
+        <input type="checkbox" value="1" class="custom-switch-input" checked>
+        <span class="custom-switch-indicator"></span>
+      </label>
+    </div>
+  </div>
+  <div class="card-body">
+    Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+  </div>
+</div>
+ +

Card with loader

+ +
+
+
+ + +
+

Card with loader

+ + +
+ +
+ +
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus! +
+
+ +
+ +
+
+
+
<div class="card">
+  <div class="card-header">
+    <h3 class="card-title">Card with loader</h3>
+  </div>
+  <div class="card-body">
+    <div class="dimmer active">
+      <div class="loader"></div>
+      <div class="dimmer-content">
+        Lorem ipsum dolor sit amet, consectetur adipisicing elit. Aperiam deleniti fugit incidunt, iste, itaque minima neque pariatur perferendis sed suscipit velit vitae voluptatem. A consequuntur, deserunt eaque error nulla temporibus!
+      </div>
+    </div>
+  </div>
+</div>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/charts.html b/dist/docs/charts.html new file mode 100644 index 000000000..b43055054 --- /dev/null +++ b/dist/docs/charts.html @@ -0,0 +1,560 @@ + + + + + + + + + + + + + + + + + + +Charts - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Charts

+ + + + + + + +

c3.js charts

+ +
+
+
+
+

Chart name

+
+
+
+
+
+ +
+
+
<div class="card">
+  <div class="card-header">
+    <h3 class="card-title">Chart name</h3>
+  </div>
+  <div class="card-body">
+    <div id="chart-wrapper" style="height: 16rem"></div>
+  </div>
+</div>
+<script>
+require(['c3', 'jquery'], function(c3, $) {
+  $(document).ready(function(){
+    var chart = c3.generate({
+      bindto: '#chart-wrapper', // id of chart wrapper
+      data: {
+        columns: [
+            // each columns data
+          ['data1', 7.0, 6.9, 9.5, 14.5, 18.4, 21.5, 25.2, 26.5, 23.3, 18.3, 13.9, 9.6],
+          ['data2', 3.9, 4.2, 5.7, 8.5, 11.9, 15.2, 17.0, 16.6, 14.2, 10.3, 6.6, 4.8]
+        ],
+        labels: true,
+        type: 'line', // default type of chart
+        colors: { 
+          'data1': tabler.colors.blue,
+          'data2': tabler.colors.green
+        },
+        names: {
+            // name of each serie
+          'data1': 'Tokyo',
+          'data2': 'London'
+        }
+      },
+      axis: {
+        x: {
+          type: 'category',
+          // name of each category
+          categories: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun']
+        },
+      },
+      legend: {
+        show: false, //hide legend
+      },
+      padding: {
+        bottom: 0,
+        top: 0
+      },
+    });
+  });
+});
+</script>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/form-components.html b/dist/docs/form-components.html new file mode 100644 index 000000000..0fca5eeec --- /dev/null +++ b/dist/docs/form-components.html @@ -0,0 +1,802 @@ + + + + + + + + + + + + + + + + + + +Form components - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Form components

+ + + + + + + + +

Color input

+ +
+
+ +
+ + + + + + + + + + + + + + + + + + + + + +
+
+
+
<div class="form-group">
+  <label class="form-label">Color Input</label>
+  <div class="d-flex">
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="azure" class="colorinput-input" />
+      <span class="colorinput-color bg-azure"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="indigo" class="colorinput-input"  checked/>
+      <span class="colorinput-color bg-indigo"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="purple" class="colorinput-input" />
+      <span class="colorinput-color bg-purple"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="pink" class="colorinput-input" />
+      <span class="colorinput-color bg-pink"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="red" class="colorinput-input" />
+      <span class="colorinput-color bg-red"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="orange" class="colorinput-input" />
+      <span class="colorinput-color bg-orange"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="yellow" class="colorinput-input" />
+      <span class="colorinput-color bg-yellow"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="lime" class="colorinput-input" />
+      <span class="colorinput-color bg-lime"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="green" class="colorinput-input" />
+      <span class="colorinput-color bg-green"></span>
+    </label>
+    <label class="colorinput mr-2">
+      <input name="color" type="checkbox" value="teal" class="colorinput-input" />
+      <span class="colorinput-color bg-teal"></span>
+    </label>
+  </div>
+</div>
+ +

Image input

+ +
+
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+
+
+
<div class="form-group">
+  <label class="form-label">Image Check</label>
+  <div class="row sm-gutters">
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="1" class="imagecheck-input"  />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/nathan-anderson-316188-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="2" class="imagecheck-input"  checked />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/nathan-dumlao-287713-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="3" class="imagecheck-input"  />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/nicolas-picard-208276-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="4" class="imagecheck-input"  checked />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/oskar-vertetics-53043-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="5" class="imagecheck-input"  />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/priscilla-du-preez-181896-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+    <div class="col-sm-2">
+      <label class="imagecheck mb-4">
+        <input name="imagecheck" type="checkbox" value="6" class="imagecheck-input"  />
+        <figure class="imagecheck-figure">
+          <img src="./assets/images/photos/ricardo-gomez-angel-262359-500.jpg" alt="}" class="imagecheck-image">
+        </figure>
+      </label>
+    </div>
+  </div>
+</div>
+ +

Icon input

+ +
+
+ +
+ + + + +
+
+ + + + +
+
+
+
<div class="form-group">
+  <label class="form-label">Icon input</label>
+  <div class="input-icon mb-3">
+    <input type="text" class="form-control" placeholder="Search for...">
+    <span class="input-icon-addon">
+      <i class="fe fe-search"></i>
+    </span>
+  </div>
+  <div class="input-icon">
+    <span class="input-icon-addon">
+      <i class="fe fe-user"></i>
+    </span>
+    <input type="text" class="form-control" placeholder="Username">
+  </div>
+</div>
+ +

Toggle switches

+ +
+
+
Toggle switches
+
+ + + + +
+
+
+
<div class="form-group">
+  <div class="form-label">Toggle switches</div>
+  <div class="custom-switches-stacked">
+    <label class="custom-switch">
+      <input type="radio" name="option" value="1" class="custom-switch-input" checked>
+      <span class="custom-switch-indicator"></span>
+      <span class="custom-switch-description">Option 1</span>
+    </label>
+    <label class="custom-switch">
+      <input type="radio" name="option" value="2" class="custom-switch-input">
+      <span class="custom-switch-indicator"></span>
+      <span class="custom-switch-description">Option 2</span>
+    </label>
+    <label class="custom-switch">
+      <input type="radio" name="option" value="3" class="custom-switch-input">
+      <span class="custom-switch-indicator"></span>
+      <span class="custom-switch-description">Option 3</span>
+    </label>
+  </div>
+</div>
+ +

Form fieldset

+ +
+
+
+ + +
+
+ + +
+
+ + +
+
+ + +
+
+
+
<fieldset class="form-fieldset">
+  <div class="form-group">
+    <label class="form-label">Full name<span class="form-required">*</span></label>
+    <input type="text" class="form-control" />
+  </div>
+  <div class="form-group">
+    <label class="form-label">Company<span class="form-required">*</span></label>
+    <input type="text" class="form-control" />
+  </div>
+  <div class="form-group">
+    <label class="form-label">Email<span class="form-required">*</span></label>
+    <input type="email" class="form-control" />
+  </div>
+  <div class="form-group mb-0">
+    <label class="form-label">Phone number</label>
+    <input type="tel" class="form-control" />
+  </div>
+</fieldset>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/grid.html b/dist/docs/grid.html new file mode 100644 index 000000000..a3f06eef4 --- /dev/null +++ b/dist/docs/grid.html @@ -0,0 +1,462 @@ + + + + + + + + + + + + + + + + + + +Grid utilities - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Grid utilities

+ + + + +
+

Work in progress!

+
More detailed documentation is coming soon, but in the meantime here's a quick class reference.
+
+ + + + + + +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/index.html b/dist/docs/index.html new file mode 100644 index 000000000..9afbe50ac --- /dev/null +++ b/dist/docs/index.html @@ -0,0 +1,489 @@ + + + + + + + + + + + + + + + + + + +Introduction - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Introduction

+ + + + + + + +

We’ve created this admin panel for everyone who wants to create any templates based on our ready components. Our mission is to deliver a user-friendly, clear and easy administration panel, that can be used by both, simple websites and sophisticated systems. The only requirement is a basic HTML and CSS knowledge—as a reward, you’ll be able to manage and visualize different types of data in the easiest possible way!

+ +

Setup environment

+ +

To use our build system and run our documentation locally, you’ll need a copy of Tabler’s source files and Node. Follow these steps:

+ +
    +
  1. Download and install Node.js, which we use to manage our dependencies.
    2. +
  2. Navigate to the root /tabler directory and run npm install to install our local dependencies listed in package.json.
    3. +
  3. +

    Install Ruby, install Bundler with gem install bundler, and finally run bundle install. This will install all Ruby dependencies, such as Jekyll and plugins.

    + +

    Windows users: Read this guide to get Jekyll up and running without problems.

    +
    4. +
+ +

When completed, you’ll be able to run the various commands provided from the command line.

+ +

Build Tabler locally

+ +
    +
  1. From the root /tabler directory, run npm run serve in the command line.
    2. +
  2. Open http://localhost:4000 in your browser, and voilà.
    3. +
  3. Any change in /src directory will build application and refresh the page.
    4. +
+ +
+Warning! all changes made in _site/ folder would be overwriten on application build. +
+ +

Bugs and feature requests

+ +

Have a bug or a feature request? Please open a new issue.

+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/tags.html b/dist/docs/tags.html new file mode 100644 index 000000000..82697f11a --- /dev/null +++ b/dist/docs/tags.html @@ -0,0 +1,768 @@ + + + + + + + + + + + + + + + + + + +Tags - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Tags

+ + +

Small tag labels to insert anywhere

+ + + + + + +

Default tag

+ +
+
+First tag +Second tag +Third tag +
+
+
<span class="tag">First tag</span>
+<span class="tag">Second tag</span>
+<span class="tag">Third tag</span>
+ + + +
+
+First tag +Second tag +Third tag +
+
+
<a href="#" class="tag">First tag</a>
+<a href="#" class="tag">Second tag</a>
+<a href="#" class="tag">Third tag</a>
+ +

Rounded tag

+ +
+
+First tag +Second tag +Third tag +
+
+
<span class="tag tag-rounded">First tag</span>
+<span class="tag tag-rounded">Second tag</span>
+<span class="tag tag-rounded">Third tag</span>
+ +

Color tag

+ +
+
+Blue tag + +Azure tag + +Indigo tag + +Purple tag + +Pink tag + +Red tag + +Orange tag + +Yellow tag + +Lime tag + +Green tag + +Teal tag + +Cyan tag + +Gray tag + +Dark gray tag +
+
+
<span class="tag tag-blue">Blue tag</span>
+<span class="tag tag-azure">Azure tag</span>
+<span class="tag tag-indigo">Indigo tag</span>
+<span class="tag tag-purple">Purple tag</span>
+<span class="tag tag-pink">Pink tag</span>
+<span class="tag tag-red">Red tag</span>
+<span class="tag tag-orange">Orange tag</span>
+<span class="tag tag-yellow">Yellow tag</span>
+<span class="tag tag-lime">Lime tag</span>
+<span class="tag tag-green">Green tag</span>
+<span class="tag tag-teal">Teal tag</span>
+<span class="tag tag-cyan">Cyan tag</span>
+<span class="tag tag-gray">Gray tag</span>
+<span class="tag tag-gray-dark">Dark gray tag</span>
+ +

Avatar tag

+ +
+
+ + + Victoria + + + + + Nathan + + + + + Alice + + + + + Rose + + + + + Peter + + + + + Wayne + + + + + Michelle + + + + + Debra + +
+
+
<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/female/16.jpg)"></span>
+  Victoria
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/male/41.jpg)"></span>
+  Nathan
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/female/1.jpg)"></span>
+  Alice
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/female/18.jpg)"></span>
+  Rose
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/male/16.jpg)"></span>
+  Peter
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/male/26.jpg)"></span>
+  Wayne
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/female/7.jpg)"></span>
+  Michelle
+</span>
+<span class="tag">
+  <span class="tag-avatar avatar" style="background-image: url(./assets/images/faces/female/17.jpg)"></span>
+  Debra
+</span>
+ +

List of tags

+ +

You can create a list of tags with the .tags container.

+ +
+
+ First tag + Second tag + Third tag +
+
+
<div class="tags">
+  <span class="tag">First tag</span>
+  <span class="tag">Second tag</span>
+  <span class="tag">Third tag</span>
+</div>
+ +

If the list is very long, it will automatically wrap on multiple lines, while keeping all tags evenly spaced.

+ +
+
+ One + Two + Three + Four + Five + Six + Seven + Eight + Nine + Ten + Eleven + Twelve + Thirteen + Fourteen + Fifteen + Sixteen + Seventeen + Eighteen + Nineteen + Twenty +
+
+
<div class="tags">
+  <span class="tag">One</span>
+  <span class="tag">Two</span>
+  <span class="tag">Three</span>
+  <span class="tag">Four</span>
+  <span class="tag">Five</span>
+  <span class="tag">Six</span>
+  <span class="tag">Seven</span>
+  <span class="tag">Eight</span>
+  <span class="tag">Nine</span>
+  <span class="tag">Ten</span>
+  <span class="tag">Eleven</span>
+  <span class="tag">Twelve</span>
+  <span class="tag">Thirteen</span>
+  <span class="tag">Fourteen</span>
+  <span class="tag">Fifteen</span>
+  <span class="tag">Sixteen</span>
+  <span class="tag">Seventeen</span>
+  <span class="tag">Eighteen</span>
+  <span class="tag">Nineteen</span>
+  <span class="tag">Twenty</span>
+</div>
+ +

Tag remove

+ +
+
+ + One + + + + Two + + + + Three + + + + Four + + +
+
+
<div class="tags">
+  <span class="tag">
+    One 
+    <a href="#" class="tag-addon"><i class="fe fe-x"></i></a>
+  </span>
+  <span class="tag">
+    Two 
+    <a href="#" class="tag-addon"><i class="fe fe-x"></i></a>
+  </span>
+  <span class="tag">
+    Three 
+    <a href="#" class="tag-addon"><i class="fe fe-x"></i></a>
+  </span>
+  <span class="tag">
+    Four 
+    <a href="#" class="tag-addon"><i class="fe fe-x"></i></a>
+  </span>
+</div>
+ +

Tag addons

+ +
+
+
+ npm + +
+
+ npm + +
+
+ bundle + passing +
+ + CSS gzip size + 20.9 kB + +
+
+
<div class="tag">
+  npm
+  <a href="#" class="tag-addon"><i class="fe fe-x"></i></a>
+</div>
+<div class="tag tag-danger">
+  npm
+  <span class="tag-addon"><i class="fe fe-activity"></i></span>
+</div>
+<div class="tag">
+  bundle
+  <span class="tag-addon tag-success">passing</span>
+</div>
+<span class="tag tag-dark">
+  CSS gzip size
+  <span class="tag-addon tag-warning">20.9 kB</span>
+</span>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/docs/typography.html b/dist/docs/typography.html new file mode 100644 index 000000000..fcde01bae --- /dev/null +++ b/dist/docs/typography.html @@ -0,0 +1,644 @@ + + + + + + + + + + + + + + + + + + +Typography - Documentation - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Documentation +

+ + + + + + +
+ +
+
+ + Browse source code + + + + +
+ + + Introduction + +
+ + +
+ + + Alerts + + + Avatars + + + Buttons + + + Cards + + + Charts + + + Form components + + + Tags + + + Typography + +
+ + +
+ Edit this page +
+
+
+
+
+ +
+

Typography

+ + +

A single class to handle WYSIWYG generated content, where only HTML tags are available

+ + + + + + +

Basic elements

+ +

When you can’t use the CSS classes you want, or when you just want to directly use HTML tags, use .text-wrap as container. It can handle almost any HTML tag.

+ +
+
+

Hello World

+

Lorem ipsum[1] dolor sit amet, consectetur adipiscing elit. Nulla accumsan, metus ultrices eleifend gravida, nulla nunc varius lectus, nec rutrum justo nibh eu lectus. Ut vulputate semper dui. Fusce erat odio, sollicitudin vel erat vel, interdum mattis neque. Subscript works as well!

+

Second level

+

Curabitur accumsan turpis pharetra augue tincidunt blandit. Quisque condimentum maximus mi, sit amet commodo arcu rutrum id. Proin pretium urna vel cursus venenatis. Suspendisse potenti. Etiam mattis sem rhoncus lacus dapibus facilisis. Donec at dignissim dui. Ut et neque nisl.

+
    +
  • In fermentum leo eu lectus mollis, quis dictum mi aliquet.
    • +
  • Morbi eu nulla lobortis, lobortis est in, fringilla felis.
    • +
  • Aliquam nec felis in sapien venenatis viverra fermentum nec lectus.
    • +
  • Ut non enim metus.
    • +
+

Third level

+

Quisque ante lacus, malesuada ac auctor vitae, congue non ante. Phasellus lacus ex, semper ac tortor nec, fringilla condimentum orci. Fusce eu rutrum tellus.

+
    +
  1. Donec blandit a lorem id convallis.
    2. +
  2. Cras gravida arcu at diam gravida gravida.
    3. +
  3. Integer in volutpat libero.
    4. +
  4. Donec a diam tellus.
    5. +
  5. Aenean nec tortor orci.
    6. +
  6. Quisque aliquam cursus urna, non bibendum massa viverra eget.
    7. +
  7. Vivamus maximus ultricies pulvinar.
    8. +
+
Ut venenatis, nisl scelerisque sollicitudin fermentum, quam libero hendrerit ipsum, ut blandit est tellus sit amet turpis.
+

Quisque at semper enim, eu hendrerit odio. Etiam auctor nisl et justo sodales elementum. Maecenas ultrices lacus quis neque consectetur, et lobortis nisi molestie.

+

Sed sagittis enim ac tortor maximus rutrum. Nulla facilisi. Donec mattis vulputate risus in luctus. Maecenas vestibulum interdum commodo.

+
+
Web
+
The part of the Internet that contains websites and web pages
+
HTML
+
A markup language for creating web pages
+
CSS
+
A technology to make HTML look better
+
+

Suspendisse egestas sapien non felis placerat elementum. Morbi tortor nisl, suscipit sed mi sit amet, mollis malesuada nulla. Nulla facilisi. Nullam ac erat ante.

+

Fourth level

+

Nulla efficitur eleifend nisi, sit amet bibendum sapien fringilla ac. Mauris euismod metus a tellus laoreet, at elementum ex efficitur.

+ 
+<!DOCTYPE html>
+<html>
+  <head>
+    <title>Hello World</title>
+  </head>
+  <body>
+    <p>Lorem ipsum dolor sit amet, consectetur adipiscing elit. Donec viverra nec nulla vitae mollis.</p>
+  </body>
+</html>
+
+

Maecenas eleifend sollicitudin dui, faucibus sollicitudin augue cursus non. Ut finibus eleifend arcu ut vehicula. Mauris eu est maximus est porta condimentum in eu justo. Nulla id iaculis sapien.

+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
OneTwo
ThreeFour
FiveSix
SevenEight
NineTen
ElevenTwelve
+

Phasellus porttitor enim id metus volutpat ultricies. Ut nisi nunc, blandit sed dapibus at, vestibulum in felis. Etiam iaculis lorem ac nibh bibendum rhoncus. Nam interdum efficitur ligula sit amet ullamcorper. Etiam tristique, leo vitae porta faucibus, mi lacus laoreet metus, at cursus leo est vel tellus. Sed ac posuere est. Nunc ultricies nunc neque, vitae ultricies ex sodales quis. Aliquam eu nibh in libero accumsan pulvinar. Nullam nec nisl placerat, pretium metus vel, euismod ipsum. Proin tempor cursus nisl vel condimentum. Nam pharetra varius metus non pellentesque.

+
Fifth level
+

Aliquam sagittis rhoncus vulputate. Cras non luctus sem, sed tincidunt ligula. Vestibulum at nunc elit. Praesent aliquet ligula mi, in luctus elit volutpat porta. Phasellus molestie diam vel nisi sodales, a eleifend augue laoreet. Sed nec eleifend justo. Nam et sollicitudin odio.

+
+ +
+ Figure 1: Some beautiful placeholders +
+
+
Sixth level
+

Cras in nibh lacinia, venenatis nisi et, auctor urna. Donec pulvinar lacus sed diam dignissim, ut eleifend eros accumsan. Phasellus non tortor eros. Ut sed rutrum lacus. Etiam purus nunc, scelerisque quis enim vitae, malesuada ultrices turpis. Nunc vitae maximus purus, nec consectetur dui. Suspendisse euismod, elit vel rutrum commodo, ipsum tortor maximus dui, sed varius sapien odio vitae est. Etiam at cursus metus.

+
+
+
<div class="text-wrap">
+  <h1>Hello World</h1>
+  <p>Lorem ipsum<sup><a>[1]</a></sup> dolor sit amet, consectetur adipiscing elit. Nulla accumsan, metus ultrices eleifend gravida, nulla nunc varius lectus, nec rutrum justo nibh eu lectus. Ut vulputate semper dui. Fusce erat odio, sollicitudin vel erat vel, interdum mattis neque. Sub<sub>script</sub> works as well!</p>
+  <h2>Second level</h2>
+  <p>Curabitur accumsan turpis pharetra <strong>augue tincidunt</strong> blandit. Quisque condimentum maximus mi, sit amet commodo arcu rutrum id. Proin pretium urna vel cursus venenatis. Suspendisse potenti. Etiam mattis sem rhoncus lacus dapibus facilisis. Donec at dignissim dui. Ut et neque nisl.</p>
+  <ul>
+    <li>In fermentum leo eu lectus mollis, quis dictum mi aliquet.</li>
+    <li>Morbi eu nulla lobortis, lobortis est in, fringilla felis.</li>
+    <li>Aliquam nec felis in sapien venenatis viverra fermentum nec lectus.</li>
+    <li>Ut non enim metus.</li>
+  </ul>
+  <h3>Third level</h3>
+  <p>Quisque ante lacus, malesuada ac auctor vitae, congue <a href="#">non ante</a>. Phasellus lacus ex, semper ac tortor nec, fringilla condimentum orci. Fusce eu rutrum tellus.</p>
+  <ol>
+    <li>Donec blandit a lorem id convallis.</li>
+    <li>Cras gravida arcu at diam gravida gravida.</li>
+    <li>Integer in volutpat libero.</li>
+    <li>Donec a diam tellus.</li>
+    <li>Aenean nec tortor orci.</li>
+    <li>Quisque aliquam cursus urna, non bibendum massa viverra eget.</li>
+    <li>Vivamus maximus ultricies pulvinar.</li>
+  </ol>
+  <blockquote>Ut venenatis, nisl scelerisque sollicitudin fermentum, quam libero hendrerit ipsum, ut blandit est tellus sit amet turpis.</blockquote>
+  <p>Quisque at semper enim, eu hendrerit odio. Etiam auctor nisl et <em>justo sodales</em> elementum. Maecenas ultrices lacus quis neque consectetur, et lobortis nisi molestie.</p>
+  <p>Sed sagittis enim ac tortor maximus rutrum. Nulla facilisi. Donec mattis vulputate risus in luctus. Maecenas vestibulum interdum commodo.</p>
+  <dl>
+    <dt>Web</dt>
+    <dd>The part of the Internet that contains websites and web pages</dd>
+    <dt>HTML</dt>
+    <dd>A markup language for creating web pages</dd>
+    <dt>CSS</dt>
+    <dd>A technology to make HTML look better</dd>
+  </dl>
+  <p>Suspendisse egestas sapien non felis placerat elementum. Morbi tortor nisl, suscipit sed mi sit amet, mollis malesuada nulla. Nulla facilisi. Nullam ac erat ante.</p>
+  <h4>Fourth level</h4>
+  <p>Nulla efficitur eleifend nisi, sit amet bibendum sapien fringilla ac. Mauris euismod metus a tellus laoreet, at elementum ex efficitur.</p>
+  <pre>
+&lt;!DOCTYPE html&gt;
+&lt;html&gt;
+  &lt;head&gt;
+    &lt;title&gt;Hello World&lt;/title&gt;
+  &lt;/head&gt;
+  &lt;body&gt;
+    &lt;p&gt;Lorem ipsum dolor sit amet, consectetur adipiscing elit. Donec viverra nec nulla vitae mollis.&lt;/p&gt;
+  &lt;/body&gt;
+&lt;/html&gt;
+</pre>
+  <p>Maecenas eleifend sollicitudin dui, faucibus sollicitudin augue cursus non. Ut finibus eleifend arcu ut vehicula. Mauris eu est maximus est porta condimentum in eu justo. Nulla id iaculis sapien.</p>
+  <table>
+    <thead>
+      <tr>
+        <th>One</th>
+        <th>Two</th>
+      </tr>
+    </thead>
+    <tbody>
+      <tr>
+        <td>Three</td>
+        <td>Four</td>
+      </tr>
+      <tr>
+        <td>Five</td>
+        <td>Six</td>
+      </tr>
+      <tr>
+        <td>Seven</td>
+        <td>Eight</td>
+      </tr>
+      <tr>
+        <td>Nine</td>
+        <td>Ten</td>
+      </tr>
+      <tr>
+        <td>Eleven</td>
+        <td>Twelve</td>
+      </tr>
+    </tbody>
+  </table>
+  <p>Phasellus porttitor enim id metus volutpat ultricies. Ut nisi nunc, blandit sed dapibus at, vestibulum in felis. Etiam iaculis lorem ac nibh bibendum rhoncus. Nam interdum efficitur ligula sit amet ullamcorper. Etiam tristique, leo vitae porta faucibus, mi lacus laoreet metus, at cursus leo est vel tellus. Sed ac posuere est. Nunc ultricies nunc neque, vitae ultricies ex sodales quis. Aliquam eu nibh in libero accumsan pulvinar. Nullam nec nisl placerat, pretium metus vel, euismod ipsum. Proin tempor cursus nisl vel condimentum. Nam pharetra varius metus non pellentesque.</p>
+  <h5>Fifth level</h5>
+  <p>Aliquam sagittis rhoncus vulputate. Cras non luctus sem, sed tincidunt ligula. Vestibulum at nunc elit. Praesent aliquet ligula mi, in luctus elit volutpat porta. Phasellus molestie diam vel nisi sodales, a eleifend augue laoreet. Sed nec eleifend justo. Nam et sollicitudin odio.</p>
+  <figure>
+    <img src="https://placehold.it/256x256">
+    <figcaption>
+      Figure 1: Some beautiful placeholders
+    </figcaption>
+  </figure>
+  <h6>Sixth level</h6>
+  <p>Cras in nibh lacinia, venenatis nisi et, auctor urna. Donec pulvinar lacus sed diam dignissim, ut eleifend eros accumsan. Phasellus non tortor eros. Ut sed rutrum lacus. Etiam purus nunc, scelerisque quis enim vitae, malesuada ultrices turpis. Nunc vitae maximus purus, nec consectetur dui. Suspendisse euismod, elit vel rutrum commodo, ipsum tortor maximus dui, sed varius sapien odio vitae est. Etiam at cursus metus.</p>
+</div>
+ +
+
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/empty.html b/dist/empty.html new file mode 100644 index 000000000..e97d4000e --- /dev/null +++ b/dist/empty.html @@ -0,0 +1,372 @@ + + + + + + + + + + + + + + + + + + +Empty page - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + + +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/favicon.ico b/dist/favicon.ico new file mode 100644 index 000000000..9c3cd64d1 Binary files /dev/null and b/dist/favicon.ico differ diff --git a/dist/forgot-password.html b/dist/forgot-password.html new file mode 100644 index 000000000..7bb592760 --- /dev/null +++ b/dist/forgot-password.html @@ -0,0 +1,90 @@ + + + + + + + + + + + + + + + + + + +Forgot password - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ +
+
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/form-elements.html b/dist/form-elements.html new file mode 100644 index 000000000..fcd643e9b --- /dev/null +++ b/dist/form-elements.html @@ -0,0 +1,1767 @@ + + + + + + + + + + + + + + + + + + +tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+
+
+
+

Form elements

+
+
+
+
+
+ +
Username
+
+
+ + +
+
+ + +
+
+ + +
+
+ + +
+ + +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+
+ +
+ +
+ + + + + + + + + + + + + + + + + + + + + +
+
+ +
+ +
+ + + + +
+
+
+ +
+ +
+ + +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+ +
+ +
+ + + + +
+
+ + + + +
+
+ +
+ +
+
+ +
+ + + +
+
+
+ +
+
+ +
+ + ? + +
+
+
+
+
+ + +
+ +
+ + + + +
+ +
+ + +
Invalid feedback
+ + +
+ +
+ + +
+
+ +
+
+ +
+
+ +
+
+
+
+ +
+ + + + + +
+
+
+ +
+ + + + +
+
+
+ +
+ + +
+
+
+ +
+ + + + + + + +
+
+ +
+
Toggle switches
+
+ + + + +
+
+ +
+
Toggle switch single
+ +
+ +
+
+ + +
+
+ + +
+
+ + +
+
+ + +
+
+
+
+
+ +
+ + + + +
+
+
+
Inline Radios
+
+
+ + Option 1 +
+
+ + Option 2 +
+
+ + Option 3 +
+
+
+
+ +
+
+ + +
+
+ + +
+
+ + +
+
+ + +
+
+
+
+
Inline Checkboxes
+
+
+ + +
+
+ + +
+
+ + +
+
+
+
+
Bootstrap's Custom File Input
+
+ + +
+
+ +
+ +
+
+ +
+
+ +
+
+ +
+
+
+ + +
+ +
+ + @ + + +
+
+ +
+ +
+ + + .example.com + +
+
+ +
+ +
+ + https://example.com/users/ + + +
+
+ +
+ +
+ + $ + + + + .00 + +
+
+ +
+ +
+
+ +
+ Action + Another action + Something else here + + Separated link +
+
+ +
+
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+
+
+
+
+
+ Cancel + +
+ +
+
+ + +
+
+
+
+

Input mask

+
+
+
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ + +
+
+
+ + +
+
+

My Profile

+
+
+
+
+
+ +
+
+
+ + +
+
+
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ +
+
+
+
+
+
+
+
+

Edit Profile

+ +
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+
+ +
+
+
+
+

HTTP Request

+
+
+
+
+ + +
+
+ + +
+
+ +
Assertions
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
SourcePropertyComparisonTarget
+ + + + + + +
+ + + + + + + +
+ + + + + + +
+ + + + + + + +
+
+
+
+ +
+
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + + + + + \ No newline at end of file diff --git a/dist/gallery.html b/dist/gallery.html new file mode 100644 index 000000000..4156321eb --- /dev/null +++ b/dist/gallery.html @@ -0,0 +1,639 @@ + + + + + + + + + + + + + + + + + + +tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ Gallery +

+
1 - 12 of 1713 photos
+
+ +
+ + + + +
+
+
+ +
+ + +
+ +
+ + Photo by Nathan Guerrero + +
+
+
+
Nathan Guerrero
+ 17 days ago +
+
+ 157 + 87 +
+
+
+
+ +
+ +
+ + Photo by Alice Mason + +
+
+
+
Alice Mason
+ 17 days ago +
+
+ 159 + 89 +
+
+
+
+ +
+ +
+ + Photo by Rose Bradley + +
+
+
+
Rose Bradley
+ 12 days ago +
+
+ 127 + 57 +
+
+
+
+ +
+ +
+ + Photo by Peter Richards + +
+
+
+
Peter Richards
+ 6 days ago +
+
+ 86 + 16 +
+
+
+
+ +
+ +
+ + Photo by Wayne Holland + +
+
+
+
Wayne Holland
+ 4 days ago +
+
+ 79 + 9 +
+
+
+
+ +
+ +
+ + Photo by Michelle Ross + +
+
+
+
Michelle Ross
+ 9 days ago +
+
+ 106 + 36 +
+
+
+
+ +
+ +
+ + Photo by Debra Beck + +
+
+
+
Debra Beck
+ 16 days ago +
+
+ 151 + 81 +
+
+
+
+ +
+ +
+ + Photo by Phillip Peters + +
+
+
+
Phillip Peters
+ 18 days ago +
+
+ 162 + 92 +
+
+
+
+ +
+ +
+ + Photo by Jack Ruiz + +
+
+
+
Jack Ruiz
+ 14 days ago +
+
+ 140 + 70 +
+
+
+
+ +
+ +
+ + Photo by Ronald Bradley + +
+
+
+
Ronald Bradley
+ 7 days ago +
+
+ 94 + 24 +
+
+
+
+ +
+ +
+ + Photo by Kathleen Harper + +
+
+
+
Kathleen Harper
+ 4 days ago +
+
+ 78 + 8 +
+
+
+
+ +
+ +
+ + Photo by Bobby Knight + +
+
+
+
Bobby Knight
+ 7 days ago +
+
+ 94 + 24 +
+
+
+
+ + + +
+ +
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/icons.html b/dist/icons.html new file mode 100644 index 000000000..f3d1953b1 --- /dev/null +++ b/dist/icons.html @@ -0,0 +1,3471 @@ + + + + + + + + + + + + + + + + + + +Icons - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Icons +

+ + + + + + +
+ +
+
+
+
+
Feather Icons
+
+
+ +
+
+

Simply beautiful open source icons. For more info click here.

+

<i class="fe fe-ICON_NAME"></i>

+
+
+
+
    + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
+
+
+
+
+
+
+
+
Font Awesome
+
+
+ +
+
+

Powered by Font Awesome set. For more info click here.

+

<i class="fa fa-ICON_NAME"></i>

+
+
+
+
    + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
+
+
+
+
+
+
+
+
Flags
+
+
+ +
+
+

For more info click here.

+

<i class="flag flag-ICON_NAME"></i>

+
+
+
+
    + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
+
+
+
+
+
+
+
+
Payments
+
+
+ +
+
+

For more info click here.

+

<i class="payment payment-ICON_NAME"></i>

+
+
+
+
    + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + +
    • + + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
  • + +
+
+
+
+
+
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/index.html b/dist/index.html new file mode 100644 index 000000000..a0de54641 --- /dev/null +++ b/dist/index.html @@ -0,0 +1,2006 @@ + + + + + + + + + + + + + + + + + + +Homepage - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+ +
+

+ + + Dashboard +

+ + + + + + +
+ +
+ +
+
+
+
+ 6% + + + +
+
43
+
New Tickets
+
+
+
+
+
+
+
+ -3% + + + +
+
17
+
Closed Today
+
+
+
+
+
+
+
+ 9% + + + +
+
7
+
New Replies
+
+
+
+
+
+
+
+ 3% + + + +
+
27.3K
+
Followers
+
+
+
+
+
+
+
+ -2% + + + +
+
$95
+
Daily Earnings
+
+
+
+
+
+
+
+ -1% + + + +
+
621
+
Products
+
+
+
+
+
+
+

Tasks activity

+
+ +
+
+
+
+
+
+ +

120

+
Tasks completed
+ + +

25

+
Hours logged
+ + +

2

+
Invoices sent
+ + +

2

+
Files uploaded
+ +
+
+ + +
+ +
+
Are you in trouble? Read our documentation with code samples.
+ +
+
+

Chart name

+
+
+
+
+
+ +
+ + +
+
+
+ + + +
+

132 Sales

+ 12 waiting payments +
+
+
+
+
+
+
+ + + +
+

78 Orders

+ 32 shipped +
+
+
+
+
+
+
+ + + +
+

1,352 Members

+ 163 registered today +
+
+
+
+
+
+
+ + + +
+

132 Comments

+ 16 waiting +
+
+
+
+
+ +
+ +
+ + + + + + +
+ + + + + + + + +
+

And this isn't my nose. This is a false one.

+ +
Look, my liege! The Knights Who Say Ni demand a sacrifice! …Are you suggesting that coconuts migr...
+ +
+
+
+ Rose Bradley + 3 days ago +
+
+ +
+
+
+
+
+ +
+ + + + + + +
+ + + + + + + + +
+

Well, I didn't vote for you.

+ +
Well, we did do the nose. Why? Shut up! Will you shut up?! You don't frighten us, English pig-dog...
+ +
+
+
+ Peter Richards + 3 days ago +
+
+ +
+
+
+
+
+ +
+ +
+ +
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
UserUsagePaymentActivitySatisfaction
+
+ +
+ 		+
Elizabeth Martin
+
+ Registered: Feb 4, 2018 +
+ 		+
+
+ 87% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
11 minutes ago
+ 		+ +
+
91%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Michelle Schultz
+
+ Registered: Dec 24, 2017 +
+ 		+
+
+ 89% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
11 minutes ago
+ 		+ +
+
63%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Crystal Austin
+
+ Registered: Dec 3, 2017 +
+ 		+
+
+ 57% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
7 minutes ago
+ 		+ +
+
19%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Douglas Ray
+
+ Registered: Dec 13, 2017 +
+ 		+
+
+ 16% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
2 minutes ago
+ 		+ +
+
8%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Teresa Reyes
+
+ Registered: Jan 23, 2018 +
+ 		+
+
+ 9% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
a minute ago
+ 		+ +
+
31%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Emma Wade
+
+ Registered: Feb 18, 2018 +
+ 		+
+
+ 36% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
4 minutes ago
+ 		+ +
+
77%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Carol Henderson
+
+ Registered: Feb 12, 2018 +
+ 		+
+
+ 81% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
10 minutes ago
+ 		+ +
+
92%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+
+ +
+ 		+
Christopher Harvey
+
+ Registered: Jan 5, 2018 +
+ 		+
+
+ 92% +
+
+ Jun 11, 2015 - Jul 10, 2015 +
+
+
+
+
+ 		+ + +
Last login
+
12 minutes ago
+ 		+ +
+
75%
+
+ 		+
+ +
+ Action + Another action + Something else here +
+ Separated link +
+
+
+ +
+
+ +
+
+
+

Browser Stats

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Google Chrome23%
Mozila Firefox15%
Apple Safari7%
Internet Explorer9%
Opera mini23%
Microsoft edge9%
+
+
+
+
+
+

Projects

+
+ + + + + + + + + + + + + + + + + + + + + + + + + +
Admin Template + 65% +
Landing Page + Finished +
Backend UI + Rejected +
Personal Blog + 40% +
E-mail Templates + 13% +
Corporate Website + Pending +
+
+
+
+
+
+

Members

+
+ +
+ +
+
+
+ +
+
+
+ + + + + +
+
+
+5%
+

423

+
Users online
+
+
+
+
+
+ + +
+
+ + + + + +
+
+
-3%
+

423

+
Users online
+
+
+
+
+
+ + +
+
+ + + + + +
+
+
-3%
+

423

+
Users online
+
+
+
+
+
+ + +
+
+ + + + + +
+
+
9%
+

423

+
Users online
+
+
+
+
+
+ + +
+
+
+ +
+
+
+

Invoices

+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
No.Invoice SubjectClientVAT No.CreatedStatusPrice + Actions + + Download +
001401Design Works + Carlson Limited + + 87956621 + + 15 Dec 2017 + + Paid + $887 + Manage +
+ +
+ 		+ + + +
001402UX Wireframes + Adobe + + 87956421 + + 12 Apr 2017 + + Pending + $1200 + Manage +
+ +
+ 		+ + + +
001403New Dashboard + Bluewolf + + 87952621 + + 23 Oct 2017 + + Pending + $534 + Manage +
+ +
+ 		+ + + +
001404Landing Page + Salesforce + + 87953421 + + 2 Sep 2017 + + Due in 2 Weeks + $1500 + Manage +
+ +
+ 		+ + + +
001405Marketing Templates + Printic + + 87956621 + + 29 Jan 2018 + + Paid Today + $648 + Manage +
+ +
+ 		+ + + +
001406Sales Presentation + Tabdaq + + 87956621 + + 4 Feb 2018 + + Due in 3 Weeks + $300 + Manage +
+ +
+ 		+ + + +
+
+
+ +
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusamus aperiam atque blanditiis commodi consequuntur ea, esse est facere ipsa ipsum maxime necessitatibus nisi numquam officia quidem repellat veritatis voluptates voluptatibus! +
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/login.html b/dist/login.html new file mode 100644 index 000000000..b311647b5 --- /dev/null +++ b/dist/login.html @@ -0,0 +1,104 @@ + + + + + + + + + + + + + + + + + + +Login - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ +
+
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/lookup.html b/dist/lookup.html new file mode 100644 index 000000000..f7923688e --- /dev/null +++ b/dist/lookup.html @@ -0,0 +1,590 @@ + + + + + + + + + + + + + + + + + + +Lookup company - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Lookup company +

+ + + + + + +
+ +
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium alias consequuntur cum dicta doloremque, enim eos illo ipsam labore laboriosam laborum perspiciatis quibusdam repudiandae sed sequi sit temporibus veniam, voluptatum. +
+
+
+
+
+
+
+
+
+
amazon.com
+
+
+ +
+
+
Name
+
Amazon.com
+
+
+
Legal Name
+
Amazon.com, Inc.
+
+
+
Ticker
+
AMZN
+
+
+
Founded Year
+
1995
+
+
+
Type
+
Public
+
+
+
Employees
+
341,400
+
+
+
Annual Revenue
+
$135B
+
+
+
+
+
+
+
+
+
Location
+
207 Boren Ave, Seattle, WA 98109, USA
+
+
+
Timezone
+
America/Los_Angeles
+
+
+ +
+ +
+ +
Recent News
+ + +
+
+
    +
  • +
    Description
    +
    + Online shopping from the earth's biggest selection of books, magazines, music, DVDs, videos, electronics, computers, software, apparel & acc… +
    +
    • +
  • +
    Tags
    +
    + E-Commerce & Marketplaces + E-commerce + B2C + Internet + Consumer Discretionary + Technology +
    +
    • +
  • +
    Industry
    +
    Internet Software & Services
    +
    • +
  • +
    Sector
    +
    Information Technology
    +
    • +
  • +
    SIC Code
    +
    59
    +
    • +
  • +
    NAICS Code
    +
    45
    +
    • +
  • +
    EIN
    +
    911646860
    +
    • +
  • +
    Technologies
    +
    + amazon associates + amazon ses + dyn dns + omniture adobe analytics + typekit by adobe +
    +
    • +
  • +
    Alexa US Rank
    +
    5
    +
    • +
  • +
    Alexa Global Rank
    +
    10
    +
    • +
  • +
    Fiscal Year End
    +
    End of December
    +
    • +
  • +
    Phone
    + +
    • +
  • +
    Crunchbase
    + +
    • +
  • +
    Twitter
    + +
    • +
  • +
    Facebook
    + +
    • +
+
+
+
+
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/maps.html b/dist/maps.html new file mode 100644 index 000000000..0cd589d38 --- /dev/null +++ b/dist/maps.html @@ -0,0 +1,699 @@ + + + + + + + + + + + + + + + + + + +Maps - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+
+ + + +
+ +
+
+
+
+

Client card

+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+
+ +
+
+ Generic placeholder image +
+
Axa Global Group
+
+ 1290 Avenua of The Americas
+ New York, NY 101040105 +
+
+
+ +
+
+
Relationship
+

Client

+
+
+
Business Type
+

Insurance Company

+
+
+
Website
+

http://www.axa.com

+
+
+
Office Phone
+

+123456789

+
+
+ +
Description
+

Lorem ipsum dolor sit amet, consectetur adipisicing elit. Consectetur dignissimos doloribus eum fugiat itaque laboriosam maiores nisi nostrum perspiciatis vero.

+
+
+
+
+

Germany map

+
+
+
+
+
+
+
+ + +
+
+
+
+

Visitors map

+
+
+
+
+
+
+
+ + + +
+
+
+
+

Map of Warsaw metro

+
+
L2
+
+
+
+ +
+
    +
  • +
    + Rondo Daszyńskiego +
    2 min. ago
    +
    • +
  • +
    + Rondo ONZ +
    1 min ago
    +
    • +
  • +
    +
    + Świętokrzyska + Lorem ipsum dolor sit amet, consectetur adipisicing elit. +
    +
    now
    +
    • +
  • +
    + Nowy Świat-Uniwersytet +
    2 min.
    +
    • +
  • +
    + Centrum Nauki Kopernik +
    3 min.
    +
    • +
  • +
    + Stadion Narodowy +
    5 min.
    +
    • +
  • +
    + Dworzec Wileński +
    7 min.
    +
    • +
+
+
+ + +
+
2
+
+
+
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/profile.html b/dist/profile.html new file mode 100644 index 000000000..0ecf63e2b --- /dev/null +++ b/dist/profile.html @@ -0,0 +1,629 @@ + + + + + + + + + + + + + + + + + + +Profile - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+
+
+
+
+ + +

Peter Richards

+ +

+ Big belly rude boy, million dollar hustler. Unemployed. +

+ + +
+
+
+
+
+ +
+

Juan Hernandez

+

Webdeveloper

+ + + +
+
+
+
+
+
+

My Profile

+
+
+
+
+
+ +
+
+
+ + +
+
+
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ +
+
+
+
+
+
+
+
+
+ +
+ +
+
+
+
    +
  • +
    +
    +
    +
    + 4 min +
    Peter Richards
    +
    + +
    + Aenean lacinia bibendum nulla sed consectetur. Vestibulum id ligula porta felis euismod semper. Morbi leo risus, porta ac consectetur ac, vestibulum at eros. Cras + justo odio, dapibus ac facilisis in, egestas eget quam. Vestibulum id ligula porta felis euismod semper. Cum sociis natoque penatibus et magnis dis parturient montes, + nascetur ridiculus mus. +
    + +
      +
    • +
      +
      + Debra Beck: + Donec id elit non mi porta gravida at eget metus. Vivamus sagittis lacus vel augue laoreet rutrum faucibus dolor auctor. Donec ullamcorper nulla non metus + auctor fringilla. Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Sed posuere consectetur est at lobortis. +
      +
      • +
    • +
      +
      + Jack Ruiz: + Lorem ipsum dolor sit amet, consectetur adipiscing elit. Fusce dapibus, tellus ac cursus commodo, tortor mauris condimentum nibh, ut fermentum massa justo sit + amet risus. +
      +
      • +
    +
    +
    +
    • +
  • +
    +
    +
    +
    + 12 min +
    Peter Richards
    +
    +
    + Donec id elit non mi porta gravida at eget metus. Integer posuere erat a ante venenatis dapibus posuere velit aliquet. Cum sociis natoque penatibus et magnis dis + parturient montes, nascetur ridiculus mus. Morbi leo risus, porta ac consectetur ac, vestibulum at eros. Lorem ipsum dolor sit amet, consectetur adipiscing elit. +
    +
    +
    +
    • +
  • +
    +
    +
    +
    + 34 min +
    Peter Richards
    +
    + +
    + Donec ullamcorper nulla non metus auctor fringilla. Vestibulum id ligula porta felis euismod semper. Aenean eu leo quam. Pellentesque ornare sem lacinia quam + venenatis vestibulum. Etiam porta sem malesuada magna mollis euismod. Donec sed odio dui. +
    + +
      +
    • +
      +
      + Wayne Holland: + Donec id elit non mi porta gravida at eget metus. Vivamus sagittis lacus vel augue laoreet rutrum faucibus dolor auctor. Donec ullamcorper nulla non metus + auctor fringilla. Praesent commodo cursus magna, vel scelerisque nisl consectetur et. Sed posuere consectetur est at lobortis. +
      +
      • +
    +
    +
    +
    • +
+
+
+
+

Edit Profile

+ +
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+
+ +
+
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/register.html b/dist/register.html new file mode 100644 index 000000000..46fb3b0ea --- /dev/null +++ b/dist/register.html @@ -0,0 +1,104 @@ + + + + + + + + + + + + + + + + + + +Register - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+ +
+
+
+
+ + + + + + + \ No newline at end of file diff --git a/dist/sample-cards.html b/dist/sample-cards.html new file mode 100644 index 000000000..5b89776ae --- /dev/null +++ b/dist/sample-cards.html @@ -0,0 +1,3715 @@ + + + + + + + + + + + + + + + + + + +Homepage - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + + + + + + + + +
+
+
+

Dashboard

+
+
    +
  • Section 500
    • +
  • English learning French
    • +
  • + United states +
    • +
  • 7 students
    • +
+
+
+
+ + +
+ +
+ +
+
+
+
+
+
+
+
+ +

+ John Smith @johnsmith 31 minutes ago +

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing elit. Aenean efficitur sit amet massa fringilla egestas. Nullam condimentum luctus turpis. +

+ +
+ +
+
+
+
+ +
+
+
+
+
+
+
+
+ +

+ John Smith @johnsmith 31 minutes ago +

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing elit. Aenean efficitur sit amet massa fringilla egestas. Nullam condimentum luctus turpis. +

+ +
+ +
+
+
+
+
+
+ +
+
+
+
+
+
+
+
+ +

+ John Smith @johnsmith 31 minutes ago +

+

+ Lorem ipsum dolor sit amet, consectetur adipiscing elit. Aenean efficitur sit amet massa fringilla egestas. Nullam condimentum luctus turpis. +

+ +
+ +
+ +
+ +
+
+
+
+
+ +
+
+
+

HTTP Request

+
+
+
+
+ + +
+
+ + +
+
+ +
Assertions
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
SourcePropertyComparisonTarget
+ + + + + + +
+ + + + + + + +
+ + + + + + +
+ + + + + + + +
+
+
+
+ +
+
+
+ +
+ +
+
+
+ + + +
+

132 Sales

+ 12 waiting payments +
+
+
+
+
+
+
+ + + +
+

78 Orders

+ 32 shipped +
+
+
+
+
+
+
+ + + +
+

1,352 Members

+ 163 registered today +
+
+
+
+
+
+
+ + + +
+

132 Comments

+ 16 waiting +
+
+
+
+ +
+ +
+
+ Total revenue +
+
$14,320
+
+ Income +
+ + + + + 4% +
+
+
+
+
+ +
+
+ Order status +
+
738
+
+ New order +
+ + + + + 10% +
+
+
+
+
+ +
+
+ Income status +
+
$3,205
+
+ New income +
+ + + 0% +
+
+
+
+
+ +
+
+ Customer status +
+
118
+
+ New users +
+ + + + + 3% +
+
+
+
+ +
+
+
+
+
+ +
+
+
+
Capacity
+
105GB
+
+
+
+
+
+
+
+
+
+ +
+
+
+
Revenue
+
$1,345
+
+
+
+
+
+
+
+
+
+ +
+
+
+
Errors
+
23
+
+
+
+
+
+
+
+
+
+ +
+
+
+
Followers
+
1685
+
+
+
+
+ +
+
+
+ + +
+
+
+

HTML & CSS lessons

+ +
+
+
6 Dec 2017
+
+
+
Warsaw, Poland
+
+
+
+
+ +
+
+
+

HTML & CSS lessons

+ +
+
+
5 Jun 2019
+
+
+
London, UK
+
+
+
+
+ +
+
+
+

HTML & CSS lessons

+ +
+
+
22 Oct 2018
+
+
+
Barcelona, Spain
+
+
+
+
+ +
+
+
+

Smashing Magazine Conference

+ +
+
+
11 Dec 2018
+
+
+
Santa Crus, Spain
+
+
+
+
+ + +
+
+
+
+
+
+

Create new classroom

+
+
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ + +
+
+
+
+ +
+ + +
+
+
+
+
+
+
+ Cancel + +
+
+
+
+
+
+
+

+ Colors +

+
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+ +
+
+
+
+
+

December 2017

+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
MoTuWeThFrSaSu
27282930123
45678910
11121314151617
18192021222324
2526272829301
+
+ + +
+
+
+
+
+

Browsers traffic

+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Google Chrome23%
Mozila Firefox15%
Apple Safari7%
Opera mini23%
Microsoft edge9%
+
+ + +
+
+
+
+

Email Statistics

+
+
+ + +
+
+
+ Campaign sent 2 days ago +
+
+ + +
+
+
+
+

Invoices

+
+ +
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
No.Invoice SubjectClientVAT No.CreatedStatusPrice + Actions + + Download +
001401Design Works + Carlson Limited + + 87956621 + + 15 Dec 2017 + + Paid + $887 + Manage +
+ +
+ 		+ + + +
001402UX Wireframes + Adobe + + 87956421 + + 12 Apr 2017 + + Pending + $1200 + Manage +
+ +
+ 		+ + + +
001403New Dashboard + Bluewolf + + 87952621 + + 23 Oct 2017 + + Pending + $534 + Manage +
+ +
+ 		+ + + +
001404Landing Page + Salesforce + + 87953421 + + 2 Sep 2017 + + Due in 2 Weeks + $1500 + Manage +
+ +
+ 		+ + + +
001405Marketing Templates + Printic + + 87956621 + + 29 Jan 2018 + + Paid Today + $648 + Manage +
+ +
+ 		+ + + +
001406Sales Presentation + Tabdaq + + 87956621 + + 4 Feb 2018 + + Due in 3 Weeks + $300 + Manage +
+ +
+ 		+ + + +
+
+
+
+
+
+
+
+
+
+
+
Projects
+
11,164
+
+
+
+
+
+
+
+
+
+
Calls
+
986
+
+
+
+
+
+
+
+
+
+
Referrals
+
1,986
+
+
+
+
+
+
+
+
+
+
Revenue
+
$640
+
+
+
+
+
+
+
+
+ + +
+
+
+
+ +
+
+ +
+
+
+
+
+
1800 users
+
+
+
+
"#f8b700", "name"=>"Warning"}"> +
1350 tasks
+
+
+
+
+
+
+
+
Missing Success URL
+
Waiting in queue
+
Everything is ready
+
Unknown status
+
+
+
+
+

Content loader

+
+
+
+
+
+ Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, sed diam voluptua. At vero eos et accusam et justo duo dolores et ea rebum. Stet clita kasd gubergren, no sea takimata sanctus est Lorem ipsum dolor sit amet. Lorem ipsum dolor sit amet, consetetur sadipscing elitr, sed diam nonumy eirmod tempor invidunt ut labore et dolore magna aliquyam erat, sed diam voluptua. +
+
+
+
+
+
+

Progress bars

+
+
+
+
+
+ +
+
+
+
+
+ +
+
+
+ +
+
+
+
+
+
+ +
+ +

Girl & Lake

+ +
+
+ ISO 200 +
+
+ 1/1000 +
+
3780 x 2984
+
9.54 MB
+
+ +
+
Created:
+
09 Jun 2017 11:32AM
+
Updated:
+
19 Jun 2017 9:43PM
+
Bit Depth:
+
16 bit
+
Creator:
+
Nathan Guerrero
+
Used colors:
+
+
+ + + + + + + +
+
+
+ +
+ +
+
Privacy
+
+ +
+
+
+
Collaborators
+
+
    + +
  • + +
    • + +
  • + +
    • + +
  • + +
    • + +
  • + +
    • + +
  • + +
    • + +
  • + +
    • + +
+
+
+
+
+ + + +
+
+ +

72

+
Up to date
+ + +

25

+
Outdated
+ + +

2

+
Danger
+ +
+ + + + + + + + + +
+ uglify-js + 3.0.10
+ moment + 2.18.1
+
+
+
+

Germany map

+
+
+
+
+
+
+
+ + +
+
+
Portfolio
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + +
AAPL + 115.52 + (0.34%) +
GOOG + 635.3 + (-1.15%) +
MSFT + 46.74 + (0.26%) +
LNKD + 190.04 + (0.28%) +
TSLA + 181.47 + (-0.23%) +
YA + 37.75 + (-0.74%) +
+
+
+
+

Match results

+
+
+
+
+ +
+
+
2:4
+
Today, 20:45
+
+
+ +
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Match stats
19Fouls12
6Yellow Cards2
0Red Cards0
0Offsides0
3Corner Kicks4
5Saves3
+
+
+
+

My Profile

+
+
+
+
+
+ +
+
+
+ + +
+
+
+ +
+ + +
+ +
+ + +
+ +
+ + +
+ +
+ +
+
+
+
+ + + + + + +
+
+
+
"#467fcf", "name"=>"Blue"}" data-sparkline-type="bar">
+
+

$10M

+
Profit for this month
+
+
+ + + + + + + +
+
+
+
"#e74c3c", "name"=>"Red"}" data-sparkline-type="line">
+
+

$10M

+
Profit for this month
+
+
+ +
+
+

Card with options

+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+ +
+ +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Eligendi fugiat fugit numquam quae rerum sed ut! Ad, blanditiis consequatur corporis cumque deserunt dolorem id perferendis recusandae repellendus sed, suscipit vitae. +
+
+ + + + + + + +
+
+
+5%
+

423

+
Users online
+
+
+
+
+
+ + +
+
+

New users

+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+ +
+
+ +
+
+
+
+
+
20%
+

1530

+
Total Leads
+ +
+
+
+
+
+ +
+
+
+
+
0%
+

$8,530

+
Total Payment
+ +
+
+
+
+

Best Pictures for Today

+
+
+
+
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ +
+ + + + + + +
+ + +
+
+
+ +
+
+
+
+

16°C

+
Warsaw, Poland
+ +
+
+
+
+
+

Card with aside

+

+ Lorem ipsum dolor sit amet. +

+
+
+
+
+

Card title

+
Card subtitle
+

Some quick example text to build on the card title and make up the bulk of the card's content.

+ +
+
+ +
+
+
+ Apple iPhone 7 128GB +
+

+
+ +
+
+
+ +
+
+ Add to cart +
+
+
+
+
+
+

+ Success card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+
+

Follow

+
+ + + + + + + + + + + + + + + + + +
+ + + Jacob Thornton + @fat + + +
+ + + Dave Gamache + @dhg + + +
+ + + Mark Otto + @mdo + + +
+
+
+
+
+ + +

Peter Richards

+ +

+ Big belly rude boy, million dollar hustler. Unemployed. +

+ + +
+
+
+
+

Special title treatment

+

With supporting text below as a natural lead-in to additional content.

+ Go somewhere +
+
+
+
+ +
+
+

Special title treatment

+

With supporting text below as a natural lead-in to additional content.

+ Go somewhere +
+
+
+
+

+ Danger card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+
+
+
+

Tasks activity

+
+ +
+
+
+
+
+
+ +

120

+
Tasks completed
+ + +

25

+
Hours logged
+ + +

2

+
Invoices sent
+ + +

2

+
Files uploaded
+ +
+
+ + +
+
+

Visitors map

+
+
+
+
+
+
+
+ + +
+
+
+
+

25563

+
Total tickets
+
+
+

6952

+
Pending Tickets
+
+
+

18361

+
Closed Tickets
+
+
+
+
+ +
+
+
+
+
+ +
+

Juan Hernandez

+

Webdeveloper

+ + + +
+
+
+
+
+
+

Client card

+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+
+ +
+
+ Generic placeholder image +
+
Axa Global Group
+
+ 1290 Avenua of The Americas
+ New York, NY 101040105 +
+
+
+ +
+
+
Relationship
+

Client

+
+
+
Business Type
+

Insurance Company

+
+
+
Website
+

http://www.axa.com

+
+
+
Office Phone
+

+123456789

+
+
+ +
Description
+

Lorem ipsum dolor sit amet, consectetur adipisicing elit. Consectetur dignissimos doloribus eum fugiat itaque laboriosam maiores nisi nostrum perspiciatis vero.

+
+
+ + + + +
+
+
Today Expenses
+
$8500
+
+
+
+
+
+
+
+ + + +
+
+
New fedbacks
+
62
+
+
+
+
+
+
+ + + +
+
+
Users online
+
76
+
+
+
+
+
+
+ + + + +
+
+
Profit for this month
+
$65,256
+
+
+
+
+
+ + + + + +
+
+
-3%
+

$5255

+
Revenue
+
+
+
+
+
+ + +
+
+
+ Server params +
+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+
+
+
+ 10/200 GB +
Memory
+
+
+
+
+ +
+ 20 GB +
Bandwidth
+
+
+
+
+ +
+ 73% +
Activity
+
+
+
+
+ +
+ 400 GB +
FTP
+
+
+
+
+
+
+
+
+
+
-1%
+

935

+
Total Sales
+ +
+
+
+
+
+ +
+
+
+
+
60%
+

5324

+
New Orders
+
+
+
+ Card image cap +
+

Card title

+
Lorem ipsum dolor sit amet.
+

Some quick example text to build on the card title and make up the bulk of the card's content.

+ Go somewhere +
+
+
+
+
+ Card with header content +
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusamus aliquid architecto commodi dolorum nam odio perspiciatis quo sapiente vitae voluptatem? Accusamus beatae distinctio dolores laborum nobis, obcaecati odio quia reprehenderit. +
+
+
+
+

+ Danger card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Animi asperiores atque beatae commodi, deserunt dolores eligendi esse est harum maxime nesciunt non nostrum quibusdam quisquam ratione repudiandae saepe soluta sunt. + Lorem ipsum dolor sit amet, consectetur adipisicing elit. Animi asperiores atque beatae commodi, deserunt dolores eligendi esse est harum maxime nesciunt non nostrum quibusdam quisquam ratione repudiandae saepe soluta sunt. +
+
+
+
+

+ Warning card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+
+

Top Countries

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ USA +
+
+
+ 		$6425
+ Poland +
+
+
+ 		$5582
+ Germany +
+
+
+ 		$4587
+ Russia +
+
+
+ 		$2520
+ Australia +
+
+
+ 		$1899
+ Great Britain +
+
+
+ 		$1056
+
+
+ Card image cap +
+

Card title

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
    +
  • Cras justo odio
    • +
  • Dapibus ac facilisis in
    • +
  • Vestibulum at eros
    • +
+
+ Card link + Another link +
+
+
+
+
Create new account
+ +
+ + +
+
+ + +
+
+ + +
+
+ +
+ +
+ +
+
+
+ +
+ Already have account? Sign in +
+
+
+
+ +
+ + +
+ +
+ +
+
+ +
+
+ +
+
+
+ +
+ +
+ + + +
+
+ +
+ +
+ + + + + +
+
+ +
+ + +
+ +
+ + +
+ +
+ +
+ +
+
+
+
+
+ +
+
+

+ Finance Stats +

+
+
+
    +
  • +
    +
    +
    + IPO Margin +
    + Awerage IPO Margin +
    +
    + +24% +
    +
    +
    • +
  • +
    +
    +
    + Payments +
    + Yearly Expenses +
    +
    + +$560,800 +
    +
    +
    • +
  • +
    +
    +
    + Logistics +
    + Overall Regional Logistics +
    +
    + -10% +
    +
    +
    • +
  • +
    +
    +
    + Expenses +
    + Balance +
    +
    + $345,000 +
    +
    +
    • +
+
+
+
+
+

+ Sales Stats +

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ Scheduled + + Count + + Amount +
+ 13.06.2017 + + 67 + + $14,740 +
+ 28.02.2017 + + 120 + + $11,002 +
+ 06.03.2017 + + 32 + + $10,900 +
+ 21.10.2017 + + 130 + + $14,740 +
+ 02.01.2017 + + 5 + + $18,540 +
+ 06.03.2017 + + 32 + + $10,900 +
+ 31.12.2017 + + 201 + + $25,609 +
+
+
+ +
+
+
+
+
+

Pie chart

+
+
+
+
+
+ + +
+
+

Radar chart

+
+
+ +
+
+ + +
+
+

Private message

+
Send private message to Olivia Wenscombe
+
+
+ + +
+
+ + +
+ +
+
+
+
+ Card image +
+

Card title

+

This is a wider card with supporting text below as a natural lead-in to additional content. This content is a little bit longer.

+
+
+
+
+

Browser Stats

+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
Google Chrome23%
Mozila Firefox15%
Apple Safari7%
Internet Explorer9%
Opera mini23%
Microsoft edge9%
+
+
+
+

+ Dark card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusamus aliquid architecto commodi dolorum nam odio perspiciatis quo sapiente vitae voluptatem? Accusamus beatae distinctio dolores laborum nobis, obcaecati odio quia reprehenderit. +
+
+ Card with footer content +
+
+
+
+

Feeds

+
+ +
+ +
+ + News + + + Messages + +
+ + Edit Profile + +
+
+
+
+
+
+
+
+
Some of the fantastic things people have had to say about Ooooh
+ 2 days ago +
+
+
+
+
+
Here are just some of the magazine reviews we have had
+ 1 day ago +
+
+
+
+
+
Lorem ipsum dolor amet, consectetur adipisicing elit.
+ 2 days ago +
+
+
+
+
+
“It’s just brilliant. I will recommend it to everyone!”
+ 2 mins ago +
+
+
+
+
+
John has just started working on the project
+ right now +
+
+
+
+
+ Card image cap +
    +
  • Cras justo odio
    • +
  • Dapibus ac facilisis in
    • +
  • Vestibulum at eros
    • +
+
+
+
+ +
+
+

Special title treatment

+

With supporting text below as a natural lead-in to additional content.

+ Go somewhere +
+
+
+
+

+ Primary card title +

+

Some quick example text to build on the card title and make up the bulk of the card's content.

+
+
+
+ +
+
Login to your account
+ +
+ + +
+
+ + +
+
+ +
+ +
+ +
+
+
+ +
+ Don't have account yet? Sign up +
+
+ +
+
Forgot password
+ +

Enter your email address and your password will be reset and emailed to you.

+
+ + +
+
+ +
+
+
+
+ Forget it, send me back to the sign in screen. +
+
+
+
+ +
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + + + \ No newline at end of file diff --git a/dist/store.html b/dist/store.html new file mode 100644 index 000000000..c78c03fd1 --- /dev/null +++ b/dist/store.html @@ -0,0 +1,588 @@ + + + + + + + + + + + + + + + + + + +Store components - tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ + + Store components +

+ + + + + + +
+ + +
+
+
+
+ +
+
+
+ Apple iPhone 7 128GB +
+

Apple iPhone 7 Plus 256GB Red Special Edition

+
+ Apple +
+
+
+ $499 +
+
+ Add to cart +
+
+
+
+
+
+ +
+
+
+ Apple iPhone 7 128GB +
+

GoPro HERO6 Black

+
+ GoPro +
+
+
+ $599 +
+
+ Add to cart +
+
+
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ Apple iPhone 7 Plus 256GB Red Special Edition + + + + 44 reviews37 offers + $499 +
+ Apple MacBook Pro i7 3,1GHz/16/512/Radeon 560 Space Gray + + + +
New
+ + 		45 reviews46 offers + $1499 +
+ Apple iPhone 7 32GB Jet Black + + + + 30 reviews40 offers + $499 +
+ GoPro HERO6 Black + + + +
New
+ + 		11 reviews20 offers + $599 +
+ MSI GV62 i5-7300HQ/8GB/1TB/Win10X GTX1050 + + + + 8 reviews8 offers + $1599 +
+ Xiaomi Mi A1 64GB Black + + + +
New
+ + 		21 reviews12 offers + $269 +
+ Huawei Mate 10 Pro Dual SIM Gray + + + + 41 reviews31 offers + $999 +
+ Sony KD-49XE7005 + + + +
New
+ + 		46 reviews45 offers + $799 +
+ Samsung Galaxy A5 A520F 2017 LTE Black Sky + + + + 36 reviews44 offers + $399 +
+
+
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file diff --git a/dist/sw.js b/dist/sw.js new file mode 100644 index 000000000..e69de29bb diff --git a/dist/users-list.html b/dist/users-list.html new file mode 100644 index 000000000..5c7f23542 --- /dev/null +++ b/dist/users-list.html @@ -0,0 +1,722 @@ + + + + + + + + + + + + + + + + + + +tabler.github.io - a responsive, flat and full featured admin template + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + +
+ +
+
+
+ + tabler.io + +
+
+ Source code +
+ + + +
+ + + 1 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + 10 + +
+ Lorem ipsum dolor sit amet, consectetur adipisicing elit. Accusantium architecto asperiores dolorem, est fugiat in maxime natus officia velit voluptas! Ab asperiores + delectus dolore dolores maxime nesciunt qui quia totam. +
+
+
+ + + + Jane Pearson + Administrator + + +
+ + Profile + + + Settings + + + 6 + Inbox + + + Message + +
+ Need help? + Sign out +
+
+
+ +
+
+
+ +
+
+
+
+ +
+ +
+
+ +
+ +
+
+
+
+
+
+ + +
+ + +
+
+

+ Users +

+
1 - 20 of 1713 users
+
+ +
+
+ +
+
+
+
+
+
Filter
+ +
+
+
Calendar
+ +
+
+
Group
+
+ + + + + +
+
+
+
Country
+ +
+
+ +
+ +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
NameDateAmount
+ + Jane PearsonFebruary 10, 1994$1809.22
+ + Jason PorterNovember 14, 1983$1841.80
+ + Teresa WoodFebruary 02, 1988$1355.49
+ + Mary ButlerNovember 12, 1982$735.05
+ + Janice LaneDecember 07, 1983$636.07
+ + Anthony MillerDecember 17, 1994$1043.15
+ + Denise ElliottMarch 01, 1994$1708.05
+ + Rose CookFebruary 10, 1983$1876.76
+ + Terry TuckerFebruary 06, 1993$1550.41
+ + Grace KnightAugust 26, 1989$861.81
+ + Elizabeth MartinOctober 16, 1992$618.90
+ + Michelle SchultzMarch 19, 1995$866.60
+ + Crystal AustinFebruary 01, 1985$1555.93
+ + Douglas RayJuly 11, 1983$1877.27
+ + Teresa ReyesMay 28, 1995$1704.06
+ + Emma WadeNovember 03, 1988$1037.04
+ + Carol HendersonMarch 02, 1994$635.01
+ + Christopher HarveyDecember 09, 1984$738.23
+ + Deborah AlvaradoApril 02, 1993$1361.99
+ + Gregory HuntJune 30, 1991$1843.48
+
+ + +
+
+
+
+
+ +
+
+
+
+
+
+ +
+
+ +
+
+ +
+
+ +
+
+
+
+ Premium and Open Source dashboard template with responsive and high quality UI. For Free! +
+
+
+
+ + +
+ + + + + + + \ No newline at end of file